DE2749597C2 - Metallkomplex-Reaktivfarbstoffe - Google Patents
Metallkomplex-ReaktivfarbstoffeInfo
- Publication number
- DE2749597C2 DE2749597C2 DE2749597A DE2749597A DE2749597C2 DE 2749597 C2 DE2749597 C2 DE 2749597C2 DE 2749597 A DE2749597 A DE 2749597A DE 2749597 A DE2749597 A DE 2749597A DE 2749597 C2 DE2749597 C2 DE 2749597C2
- Authority
- DE
- Germany
- Prior art keywords
- dye
- complexes
- dyes
- formula
- meaning given
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000985 reactive dye Substances 0.000 title claims description 9
- 150000004696 coordination complex Chemical class 0.000 title description 6
- 239000000975 dye Substances 0.000 claims description 65
- -1 o-carboxy-phenyl Chemical group 0.000 claims description 28
- 229910052804 chromium Inorganic materials 0.000 claims description 15
- 239000000203 mixture Substances 0.000 claims description 15
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical group 0.000 claims description 12
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 7
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 4
- 229920002678 cellulose Polymers 0.000 claims description 4
- 239000001913 cellulose Substances 0.000 claims description 4
- 230000008878 coupling Effects 0.000 claims description 4
- 238000010168 coupling process Methods 0.000 claims description 4
- 238000005859 coupling reaction Methods 0.000 claims description 4
- 238000004043 dyeing Methods 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000004957 naphthylene group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 2
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical class C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 claims 1
- 101710201629 Ribulose bisphosphate carboxylase/oxygenase activase 2, chloroplastic Proteins 0.000 claims 1
- 229910006069 SO3H Inorganic materials 0.000 claims 1
- 239000011651 chromium Substances 0.000 description 32
- 239000000243 solution Substances 0.000 description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 239000000306 component Substances 0.000 description 13
- 150000003254 radicals Chemical class 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 8
- 229920000742 Cotton Polymers 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- 229920000297 Rayon Polymers 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000000434 metal complex dye Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000002964 rayon Substances 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000000987 azo dye Substances 0.000 description 2
- 150000004699 copper complex Chemical class 0.000 description 2
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- HTMCAAYEBUHTGT-UHFFFAOYSA-N 2,3-diamino-4-(5-chloro-2,6-difluoropyrimidin-4-yl)benzenesulfonic acid Chemical compound NC1=C(N)C(S(O)(=O)=O)=CC=C1C1=NC(F)=NC(F)=C1Cl HTMCAAYEBUHTGT-UHFFFAOYSA-N 0.000 description 1
- BGMULPAXTCPLMW-UHFFFAOYSA-N 2,3-diamino-5-(5-chloro-2,6-difluoropyrimidin-4-yl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=C(N)C(N)=CC(C=2C(=C(F)N=C(F)N=2)Cl)=C1 BGMULPAXTCPLMW-UHFFFAOYSA-N 0.000 description 1
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- ONMOULMPIIOVTQ-UHFFFAOYSA-N 98-47-5 Chemical compound OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 ONMOULMPIIOVTQ-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- 241000872198 Serjania polyphylla Species 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000006103 coloring component Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000012875 nonionic emulsifier Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/022—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring the heterocyclic ring being alternatively specified
- C09B62/026—Azo dyes
- C09B62/032—Metal complex azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2749597A DE2749597C2 (de) | 1977-11-05 | 1977-11-05 | Metallkomplex-Reaktivfarbstoffe |
| IN763/DEL/78A IN148963B (enExample) | 1977-11-05 | 1978-10-16 | |
| GB7842731A GB2007701B (en) | 1977-11-05 | 1978-11-01 | Metal complex reacitive dyestuffs |
| BR7807233A BR7807233A (pt) | 1977-11-05 | 1978-11-01 | Corantes reativos de complexo metalico,processo para sua preparacao,composicoes e sua aplicacao |
| JP13466678A JPS5474828A (en) | 1977-11-05 | 1978-11-02 | Metal complex reactive dye |
| US05/957,074 US4248771A (en) | 1977-11-05 | 1978-11-02 | Metal complex reactive dyestuffs |
| ES474791A ES474791A1 (es) | 1977-11-05 | 1978-11-03 | Procedimiento para la obtencion de colorantes reactivos de metal complejos 1 : 1 y 1 : 2. |
| BE191507A BE871734A (fr) | 1977-11-05 | 1978-11-03 | Nouveaux colorants reactifs combines a un complexe metallique et leurs applications tinctoriales |
| IT29427/78A IT1100910B (it) | 1977-11-05 | 1978-11-03 | Coloranti reattivi complressi di metalli |
| CH1136078A CH642802B (de) | 1977-11-05 | 1978-11-03 | Metallkomplex-reaktivfarbstoffe. |
| FR7831143A FR2407967B1 (fr) | 1977-11-05 | 1978-11-03 | Nouveaux colorants reactifs combines a un complexe metallique et leurs applications tinctoriales |
| IN793/DEL/80A IN150695B (enExample) | 1977-11-05 | 1980-11-05 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2749597A DE2749597C2 (de) | 1977-11-05 | 1977-11-05 | Metallkomplex-Reaktivfarbstoffe |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2749597A1 DE2749597A1 (de) | 1979-05-10 |
| DE2749597C2 true DE2749597C2 (de) | 1986-04-24 |
Family
ID=6023111
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2749597A Expired DE2749597C2 (de) | 1977-11-05 | 1977-11-05 | Metallkomplex-Reaktivfarbstoffe |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4248771A (enExample) |
| JP (1) | JPS5474828A (enExample) |
| BE (1) | BE871734A (enExample) |
| BR (1) | BR7807233A (enExample) |
| CH (1) | CH642802B (enExample) |
| DE (1) | DE2749597C2 (enExample) |
| ES (1) | ES474791A1 (enExample) |
| FR (1) | FR2407967B1 (enExample) |
| GB (1) | GB2007701B (enExample) |
| IN (1) | IN148963B (enExample) |
| IT (1) | IT1100910B (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0097119A3 (de) * | 1982-06-11 | 1984-09-05 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0133843B1 (de) * | 1983-07-29 | 1987-07-29 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| EP0179019B1 (de) * | 1984-10-15 | 1990-05-16 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
| CH668979A5 (de) * | 1985-08-10 | 1989-02-15 | Basf Ag | Reaktivfarbstoffe. |
| US5227476A (en) * | 1987-01-14 | 1993-07-13 | Sandoz Ltd. | 2-(3,6,8-trisulfonaphth-2-ylazo)-5-[2-chloro-4-[2-(5-chloro-2,4-difluoropyrimid-6-ylamino)-2-methyl-ethyl]amino-1,3,5-triazin-6-ylamino]phenyl urea salts thereof |
| DE3918653C2 (de) * | 1988-06-14 | 2003-01-16 | Clariant Finance Bvi Ltd | Chromophore Verbindung mit heterocyclischem Reaktivrest |
| US5227477A (en) * | 1988-06-14 | 1993-07-13 | Sandoz Ltd. | Dyes having one or two 2,4- or 4,6-dichloro-5-cyanopyrimidyl groups linked through bridging radicals containing at least two nitrogen atoms to chloro-1,3,5-triazinyl groups |
| DE3910649A1 (de) * | 1989-04-01 | 1990-10-11 | Basf Ag | Reaktivfarbstoffe, die zwei oder drei stickstoffhaltige halogenheterocyclen als anker aufweisen |
| US5245020A (en) * | 1989-04-01 | 1993-09-14 | Basf Aktiengesellschaft | Reactive dyes with two or three nitrogen-containing haloheterocycles as reactive system |
| US5274083A (en) * | 1989-05-03 | 1993-12-28 | Bayer Aktiengesellschaft | Polyfunctional fibre-reactive dyestuffs |
| DE59206979D1 (de) * | 1991-05-15 | 1996-10-02 | Bayer Ag | Reaktivfarbstoffe |
| GB2270923B (en) * | 1992-09-24 | 1995-11-08 | Sandoz Ltd | Fibre-reactive monoazo copper complexes |
| CN101538413B (zh) * | 2009-04-02 | 2012-08-29 | 无锡润新染料有限公司 | 活性黑k-br及其清洁化生产工艺 |
| CN106854382A (zh) * | 2017-01-03 | 2017-06-16 | 上海安诺其集团股份有限公司 | 一种偶氮类化合物及其应用 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2824093A (en) * | 1952-10-03 | 1958-02-18 | Saul & Co | Azo dyestuffs |
| GB1093656A (en) * | 1965-03-23 | 1967-12-06 | Ici Ltd | New water-soluble reactive metal-complex azo dyestuffs, their preparation and use |
| DE1644208C3 (de) * | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
| DE2607028A1 (de) * | 1976-02-20 | 1977-08-25 | Bayer Ag | Reaktivfarbstoffe |
-
1977
- 1977-11-05 DE DE2749597A patent/DE2749597C2/de not_active Expired
-
1978
- 1978-10-16 IN IN763/DEL/78A patent/IN148963B/en unknown
- 1978-11-01 BR BR7807233A patent/BR7807233A/pt unknown
- 1978-11-01 GB GB7842731A patent/GB2007701B/en not_active Expired
- 1978-11-02 US US05/957,074 patent/US4248771A/en not_active Expired - Lifetime
- 1978-11-02 JP JP13466678A patent/JPS5474828A/ja active Granted
- 1978-11-03 ES ES474791A patent/ES474791A1/es not_active Expired
- 1978-11-03 IT IT29427/78A patent/IT1100910B/it active
- 1978-11-03 CH CH1136078A patent/CH642802B/de not_active IP Right Cessation
- 1978-11-03 BE BE191507A patent/BE871734A/xx not_active IP Right Cessation
- 1978-11-03 FR FR7831143A patent/FR2407967B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH642802GA3 (enExample) | 1984-05-15 |
| FR2407967B1 (fr) | 1985-09-20 |
| US4248771A (en) | 1981-02-03 |
| ES474791A1 (es) | 1979-03-16 |
| FR2407967A1 (fr) | 1979-06-01 |
| IT7829427A0 (it) | 1978-11-03 |
| GB2007701B (en) | 1982-03-24 |
| IT1100910B (it) | 1985-09-28 |
| BE871734A (fr) | 1979-05-03 |
| CH642802B (de) | |
| GB2007701A (en) | 1979-05-23 |
| DE2749597A1 (de) | 1979-05-10 |
| JPS6131743B2 (enExample) | 1986-07-22 |
| BR7807233A (pt) | 1979-06-12 |
| JPS5474828A (en) | 1979-06-15 |
| IN148963B (enExample) | 1981-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2749597C2 (de) | Metallkomplex-Reaktivfarbstoffe | |
| CH639680A5 (de) | Wasserloesliche farbstoffe und verfahren zu deren herstellung. | |
| EP0013765B1 (de) | Reaktivazofarbstoffe sowie deren Herstellung und Verwendung zum Färben von OH- und N-haltigen Materialien | |
| DE2748966B2 (de) | Wasserlösliche Farbstoffe, Verfahren zu deren Herstellung, ihre Verwendung als faserreaktive Farbstoffe zum Färben und Bedrucken von Cellulose- und Polyamid-Fasermaterialien | |
| DE1235466B (de) | Verfahren zur Herstellung von organischen Farbstoffen | |
| DE4039866C2 (de) | Reaktivfarbstoffe | |
| DE1544482C3 (de) | Verfahren zur Herstellung von reaktiven, wasserlöslichen Disazofarbstoffen und ihren Metallkomplexverbindungen und die Verwendung dieser Farbstoffe zum Färben oder Bedrucken von Cellulose, Wolle, Seide oder Polyamidfasern | |
| EP0168703A2 (de) | Reaktivfarbstoffe | |
| EP0258806B1 (de) | Wasserlösliche Disazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0144704B1 (de) | Reaktivfarbstoffe | |
| DE2812634A1 (de) | Anthrachinon-azo-reaktivfarbstoffe | |
| DE2050901A1 (de) | Wasserlösliche Azofarbstoffe | |
| EP0235521A2 (de) | Wasserlösliche Azoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Farbstoffe | |
| EP0043465B1 (de) | Reaktivfarbstoffe und ihre Verwendung zum Färben und Bedrucken hydroxylgruppenhaltiger oder stickstoffhaltiger Fasermaterialien | |
| DE1228013B (de) | Verfahren zur Herstellung von wasserloeslichen Trihalogenpyrimidylfarbstoffen | |
| DE2847938A1 (de) | Reaktivfarbstoffe | |
| DE1419837C3 (de) | Reaktive Monoazokupferkomplexfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE1904113B2 (de) | Faserreaktive, schwermetallhaltige Formazanfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1155872B (de) | Verfahren zur Herstellung von metallhaltigen, reaktiven Farbstoffen | |
| DE888907C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE852724C (de) | Verfahren zur Herstellung neuer Disazofarbstoffe | |
| DE1644087C3 (de) | Verfahren zur Herstellung wasserlöslicher organischer Reaktivfarbstoffe | |
| DE19832220A1 (de) | Mischungen von faserreaktiven Farbstoffen und deren Verwendung zum Färben von hydroxy- und/oder carbonamidgruppenhaltigem Material | |
| DE1644258C3 (de) | Schwermetallhaltige Formazanfarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE921225C (de) | Verfahren zur Herstellung von Disazofarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8125 | Change of the main classification |
Ipc: C09B 62/032 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |