DE2627709C2 - Malonsäure-pentachlorphenylester und deren Herstellung - Google Patents
Malonsäure-pentachlorphenylester und deren HerstellungInfo
- Publication number
- DE2627709C2 DE2627709C2 DE2627709A DE2627709A DE2627709C2 DE 2627709 C2 DE2627709 C2 DE 2627709C2 DE 2627709 A DE2627709 A DE 2627709A DE 2627709 A DE2627709 A DE 2627709A DE 2627709 C2 DE2627709 C2 DE 2627709C2
- Authority
- DE
- Germany
- Prior art keywords
- ester
- pentachlorophenyl
- malonic acid
- mol
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- PCMZJGZAVUGYHF-UHFFFAOYSA-N 3-oxo-3-(2,3,4,5,6-pentachlorophenoxy)propanoic acid Chemical compound ClC1=C(C(=C(C(=C1OC(CC(=O)O)=O)Cl)Cl)Cl)Cl PCMZJGZAVUGYHF-UHFFFAOYSA-N 0.000 title claims description 5
- -1 furfuryl Chemical group 0.000 description 73
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 57
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 54
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 42
- 150000002148 esters Chemical class 0.000 description 37
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 34
- 239000000460 chlorine Substances 0.000 description 31
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 28
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 235000019441 ethanol Nutrition 0.000 description 19
- 239000002904 solvent Substances 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 16
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- 238000002329 infrared spectrum Methods 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 11
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 9
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 8
- WWYDYZMNFQIYPT-UHFFFAOYSA-N ru78191 Chemical class OC(=O)C(C(O)=O)C1=CC=CC=C1 WWYDYZMNFQIYPT-UHFFFAOYSA-N 0.000 description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 7
- 150000001875 compounds Chemical class 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 4
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 230000010933 acylation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 3
- ZPIUANRTQSWZBQ-UHFFFAOYSA-N 3-(2,3-dihydro-1h-inden-5-yloxy)-3-oxo-2-phenylpropanoic acid Chemical compound C=1C=C2CCCC2=CC=1OC(=O)C(C(=O)O)C1=CC=CC=C1 ZPIUANRTQSWZBQ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- XAKBSHICSHRJCL-UHFFFAOYSA-N [CH2]C(=O)C1=CC=CC=C1 Chemical group [CH2]C(=O)C1=CC=CC=C1 XAKBSHICSHRJCL-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- QVCWEBHDFJVROK-UHFFFAOYSA-N bis(2,3,4,5,6-pentachlorophenyl) 2-phenylpropanedioate Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1OC(=O)C(C=1C=CC=CC=1)C(=O)OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl QVCWEBHDFJVROK-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- SXYFKXOFMCIXQW-UHFFFAOYSA-N propanedioyl dichloride Chemical class ClC(=O)CC(Cl)=O SXYFKXOFMCIXQW-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000006000 trichloroethyl group Chemical group 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- JAEJSNFTJMYIEF-UHFFFAOYSA-N 2-benzylpropanedioic acid Chemical compound OC(=O)C(C(O)=O)CC1=CC=CC=C1 JAEJSNFTJMYIEF-UHFFFAOYSA-N 0.000 description 2
- YCOXTKKNXUZSKD-UHFFFAOYSA-N 3,4-xylenol Chemical compound CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000003158 alcohol group Chemical group 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- XXROGKLTLUQVRX-UHFFFAOYSA-N allyl alcohol Chemical compound OCC=C XXROGKLTLUQVRX-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 230000002140 halogenating effect Effects 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- BGMIRDHBNWQSGE-UHFFFAOYSA-N hypochlorous acid;pyridine Chemical compound ClO.C1=CC=NC=C1 BGMIRDHBNWQSGE-UHFFFAOYSA-N 0.000 description 2
- PEHSSTUGJUBZBI-UHFFFAOYSA-N indan-5-ol Chemical compound OC1=CC=C2CCCC2=C1 PEHSSTUGJUBZBI-UHFFFAOYSA-N 0.000 description 2
- 150000002690 malonic acid derivatives Chemical class 0.000 description 2
- 150000002691 malonic acids Chemical class 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 125000002256 xylenyl group Chemical group C1(C(C=CC=C1)C)(C)* 0.000 description 2
- QQGISFDJEJMKIL-JAIQZWGSSA-N (5z)-5-[[3-(hydroxymethyl)thiophen-2-yl]methylidene]-10-methoxy-2,2,4-trimethyl-1h-chromeno[3,4-f]quinolin-9-ol Chemical compound C1=CC=2NC(C)(C)C=C(C)C=2C2=C1C=1C(OC)=C(O)C=CC=1O\C2=C/C=1SC=CC=1CO QQGISFDJEJMKIL-JAIQZWGSSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- KCXRTPAQZZQSOH-UHFFFAOYSA-N 1-o-(2,3-dihydro-1h-inden-5-yl) 3-o-(2,3,4,5,6-pentachlorophenyl) 2-phenylpropanedioate Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1OC(=O)C(C=1C=CC=CC=1)C(=O)OC1=CC=C(CCC2)C2=C1 KCXRTPAQZZQSOH-UHFFFAOYSA-N 0.000 description 1
- NYSXWUPVOCFRSE-UHFFFAOYSA-N 1-phenyl-ethene-1,2-diol Natural products OC=C(O)C1=CC=CC=C1 NYSXWUPVOCFRSE-UHFFFAOYSA-N 0.000 description 1
- KPWDGTGXUYRARH-UHFFFAOYSA-N 2,2,2-trichloroethanol Chemical compound OCC(Cl)(Cl)Cl KPWDGTGXUYRARH-UHFFFAOYSA-N 0.000 description 1
- KUFFULVDNCHOFZ-UHFFFAOYSA-N 2,4-xylenol Chemical compound CC1=CC=C(O)C(C)=C1 KUFFULVDNCHOFZ-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- ZWVHTXAYIKBMEE-UHFFFAOYSA-N 2-hydroxyacetophenone Chemical compound OCC(=O)C1=CC=CC=C1 ZWVHTXAYIKBMEE-UHFFFAOYSA-N 0.000 description 1
- 125000002862 3,4-xylenyl group Chemical group [H]C1=C(O*)C([H])=C(C(=C1[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- JSOGYDALMCJGDM-UHFFFAOYSA-N 3-(2,4-dimethylphenoxy)-3-oxo-2-phenylpropanoic acid Chemical compound CC1=CC(C)=CC=C1OC(=O)C(C(O)=O)C1=CC=CC=C1 JSOGYDALMCJGDM-UHFFFAOYSA-N 0.000 description 1
- OASFMZFYUHQEFW-UHFFFAOYSA-N 3-(3,4-dimethylphenoxy)-3-oxo-2-phenylpropanoic acid Chemical compound C1=C(C)C(C)=CC=C1OC(=O)C(C(O)=O)C1=CC=CC=C1 OASFMZFYUHQEFW-UHFFFAOYSA-N 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- NEFQRBFCIVFWHF-UHFFFAOYSA-N 3-o-benzyl 1-o-(2,3,4,5,6-pentachlorophenyl) 2-phenylpropanedioate Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1OC(=O)C(C=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 NEFQRBFCIVFWHF-UHFFFAOYSA-N 0.000 description 1
- QSBAHMROFICXDC-UHFFFAOYSA-N 3-oxo-2-phenyl-3-phenylmethoxypropanoic acid Chemical compound C=1C=CC=CC=1C(C(=O)O)C(=O)OCC1=CC=CC=C1 QSBAHMROFICXDC-UHFFFAOYSA-N 0.000 description 1
- ADSGGVBIHQRGSX-UHFFFAOYSA-N 3-oxo-3-(2,3,4,5,6-pentachloro-1-phenylcyclohexa-2,4-dien-1-yl)oxy-2-phenylpropanoic acid Chemical compound C=1C=CC=CC=1C(C(=O)O)C(=O)OC1(C=2C=CC=CC=2)C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl ADSGGVBIHQRGSX-UHFFFAOYSA-N 0.000 description 1
- WWZUGFYZVXNMGT-UHFFFAOYSA-N 3-oxo-3-[2,3,4,5,6-pentachloro-1-(3,4-dimethylphenyl)cyclohexa-2,4-dien-1-yl]oxy-2-phenylpropanoic acid Chemical compound C1=C(C)C(C)=CC=C1C1(OC(=O)C(C(O)=O)C=2C=CC=CC=2)C(Cl)=C(Cl)C(Cl)=C(Cl)C1Cl WWZUGFYZVXNMGT-UHFFFAOYSA-N 0.000 description 1
- IDJNJFYWPMDFNB-UHFFFAOYSA-N 3-oxo-3-phenoxy-2-phenylpropanoic acid Chemical compound C=1C=CC=CC=1C(C(=O)O)C(=O)OC1=CC=CC=C1 IDJNJFYWPMDFNB-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- JKTYGPATCNUWKN-UHFFFAOYSA-N 4-nitrobenzyl alcohol Chemical compound OCC1=CC=C([N+]([O-])=O)C=C1 JKTYGPATCNUWKN-UHFFFAOYSA-N 0.000 description 1
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 1
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 1
- ZDZVKPXKLLLOOA-UHFFFAOYSA-N Allylmalonic acid Chemical compound OC(=O)C(C(O)=O)CC=C ZDZVKPXKLLLOOA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CDELRVGNUOBGJE-UHFFFAOYSA-N OC(C(C(OC(C=CC=C1)=C1C(C(Cl)=C(C(Cl)=C1Cl)Cl)=C1Cl)=O)C1=CC=CC=C1)=O Chemical compound OC(C(C(OC(C=CC=C1)=C1C(C(Cl)=C(C(Cl)=C1Cl)Cl)=C1Cl)=O)C1=CC=CC=C1)=O CDELRVGNUOBGJE-UHFFFAOYSA-N 0.000 description 1
- NTYDEGCGONCFGC-UHFFFAOYSA-N OC(C(C(OC1=CC=CC2=CC=CC=C12)=O)C1=CC=CC=C1)=O Chemical compound OC(C(C(OC1=CC=CC2=CC=CC=C12)=O)C1=CC=CC=C1)=O NTYDEGCGONCFGC-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- UUQDXXQXJRUPMA-UHFFFAOYSA-N benzene;thionyl dichloride Chemical compound ClS(Cl)=O.C1=CC=CC=C1 UUQDXXQXJRUPMA-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- GMVLGJDMPCRIJK-CGZBRXJRSA-N benzyl n-[(2s)-1-[(3-hydroxyoxan-4-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate Chemical compound N([C@@H](CC(C)C)C(=O)NC1C(COCC1)O)C(=O)OCC1=CC=CC=C1 GMVLGJDMPCRIJK-CGZBRXJRSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- JQFHKEBWCWYZPC-UHFFFAOYSA-N bis(2,3,4,5,6-pentachlorophenyl) 2-ethylpropanedioate Chemical compound ClC=1C(Cl)=C(Cl)C(Cl)=C(Cl)C=1OC(=O)C(CC)C(=O)OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl JQFHKEBWCWYZPC-UHFFFAOYSA-N 0.000 description 1
- CDLGQTRZLYGNKQ-UHFFFAOYSA-N bis(2,3,4,5,6-pentachlorophenyl) propanedioate Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1OC(=O)CC(=O)OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CDLGQTRZLYGNKQ-UHFFFAOYSA-N 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- UKFXDFUAPNAMPJ-UHFFFAOYSA-N ethylmalonic acid Chemical compound CCC(C(O)=O)C(O)=O UKFXDFUAPNAMPJ-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 150000002561 ketenes Chemical class 0.000 description 1
- CGJMROBVSBIBKP-UHFFFAOYSA-N malonamic acid Chemical class NC(=O)CC(O)=O CGJMROBVSBIBKP-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- WSHJJCPTKWSMRR-RXMQYKEDSA-N penam Chemical compound S1CCN2C(=O)C[C@H]21 WSHJJCPTKWSMRR-RXMQYKEDSA-N 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/34—Esters of acyclic saturated polycarboxylic acids having an esterified carboxyl group bound to an acyclic carbon atom
- C07C69/38—Malonic acid esters
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU75CI00001592A HU171729B (hu) | 1975-06-20 | 1975-06-20 | Sposob poluchenija slozhnykh pentagalogenofenil-ehfirov malonovoj kisloty |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2627709A1 DE2627709A1 (de) | 1976-12-30 |
| DE2627709C2 true DE2627709C2 (de) | 1983-01-05 |
Family
ID=10994572
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2627709A Expired DE2627709C2 (de) | 1975-06-20 | 1976-06-21 | Malonsäure-pentachlorphenylester und deren Herstellung |
Country Status (27)
| Country | Link |
|---|---|
| US (2) | US4324903A (https=) |
| JP (1) | JPS5214736A (https=) |
| AR (1) | AR219282A1 (https=) |
| AT (1) | AT347924B (https=) |
| AU (1) | AU509007B2 (https=) |
| BE (1) | BE843106A (https=) |
| BG (1) | BG24945A3 (https=) |
| CA (1) | CA1080716A (https=) |
| CH (1) | CH625778A5 (https=) |
| CS (1) | CS191977B2 (https=) |
| DD (1) | DD124725A5 (https=) |
| DE (1) | DE2627709C2 (https=) |
| DK (1) | DK155729C (https=) |
| ES (1) | ES448967A1 (https=) |
| FI (1) | FI761773A7 (https=) |
| FR (1) | FR2316212A1 (https=) |
| GB (1) | GB1546147A (https=) |
| GR (1) | GR60049B (https=) |
| HU (1) | HU171729B (https=) |
| IL (1) | IL49808A0 (https=) |
| IN (1) | IN144126B (https=) |
| IT (1) | IT1078624B (https=) |
| NL (1) | NL7606620A (https=) |
| NO (1) | NO762117L (https=) |
| PL (1) | PL103443B1 (https=) |
| SE (1) | SE433607B (https=) |
| SU (1) | SU691078A3 (https=) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU179000B (en) * | 1977-07-13 | 1982-07-28 | Chinoin Gyogyszer Es Vegyeszet | Process for preparing new malonic acid esters |
| US6288879B1 (en) * | 1998-09-25 | 2001-09-11 | Seagate Technolocy Llc | Top down assembly of a disk drive actuator using a tolerance ring and a post |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2419865A (en) * | 1944-07-31 | 1947-04-29 | Abbott Lab | Carbalkoxylation of phenylacetates |
| GB1199249A (en) * | 1968-09-20 | 1970-07-15 | Pfizer & Co C | Direct Mono-Esterification of Aryl Malonic Acids |
| US3824275A (en) * | 1969-01-23 | 1974-07-16 | Pfizer | Direct mono-esterification of arylmalonic acids |
| BE747295A (fr) * | 1970-03-13 | 1970-09-14 | Pfizer | Monoesterification directe d'acides arylmaloniques |
-
1975
- 1975-06-20 HU HU75CI00001592A patent/HU171729B/hu not_active IP Right Cessation
-
1976
- 1976-06-12 GR GR50981A patent/GR60049B/el unknown
- 1976-06-15 BG BG033484A patent/BG24945A3/xx unknown
- 1976-06-16 AT AT439176A patent/AT347924B/de not_active IP Right Cessation
- 1976-06-16 ES ES448967A patent/ES448967A1/es not_active Expired
- 1976-06-16 IT IT68479/76A patent/IT1078624B/it active
- 1976-06-16 IN IN1057/CAL/76A patent/IN144126B/en unknown
- 1976-06-16 GB GB24999/76A patent/GB1546147A/en not_active Expired
- 1976-06-16 IL IL49808A patent/IL49808A0/xx unknown
- 1976-06-17 DD DD193413A patent/DD124725A5/xx unknown
- 1976-06-17 FR FR7618418A patent/FR2316212A1/fr active Granted
- 1976-06-18 DK DK273576A patent/DK155729C/da not_active IP Right Cessation
- 1976-06-18 JP JP51071301A patent/JPS5214736A/ja active Pending
- 1976-06-18 SE SE7607044A patent/SE433607B/xx not_active IP Right Cessation
- 1976-06-18 NL NL7606620A patent/NL7606620A/xx not_active Application Discontinuation
- 1976-06-18 SU SU762373644A patent/SU691078A3/ru active
- 1976-06-18 AU AU15033/76A patent/AU509007B2/en not_active Expired
- 1976-06-18 BE BE168053A patent/BE843106A/xx not_active IP Right Cessation
- 1976-06-18 NO NO762117A patent/NO762117L/no unknown
- 1976-06-18 FI FI761773A patent/FI761773A7/fi not_active Application Discontinuation
- 1976-06-18 CH CH783476A patent/CH625778A5/de not_active IP Right Cessation
- 1976-06-18 CA CA255,260A patent/CA1080716A/en not_active Expired
- 1976-06-18 CS CS764032A patent/CS191977B2/cs unknown
- 1976-06-18 AR AR263665A patent/AR219282A1/es active
- 1976-06-19 PL PL1976190557A patent/PL103443B1/pl unknown
- 1976-06-21 DE DE2627709A patent/DE2627709C2/de not_active Expired
- 1976-06-21 US US05/698,063 patent/US4324903A/en not_active Expired - Lifetime
-
1979
- 1979-03-06 US US06/017,835 patent/US4289894A/en not_active Expired - Lifetime
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| IN144126B (https=) | 1978-03-25 |
| CH625778A5 (https=) | 1981-10-15 |
| US4324903A (en) | 1982-04-13 |
| DE2627709A1 (de) | 1976-12-30 |
| GB1546147A (en) | 1979-05-16 |
| SE7607044L (sv) | 1976-12-21 |
| SU691078A3 (ru) | 1979-10-05 |
| NO762117L (https=) | 1976-12-21 |
| FI761773A7 (https=) | 1976-12-21 |
| DD124725A5 (https=) | 1977-03-09 |
| CA1080716A (en) | 1980-07-01 |
| NL7606620A (nl) | 1976-12-22 |
| ES448967A1 (es) | 1977-11-16 |
| GR60049B (en) | 1978-04-01 |
| SE433607B (sv) | 1984-06-04 |
| AT347924B (de) | 1979-01-25 |
| ATA439176A (de) | 1978-06-15 |
| CS191977B2 (en) | 1979-07-31 |
| AR219282A1 (es) | 1980-08-15 |
| FR2316212A1 (fr) | 1977-01-28 |
| DK155729C (da) | 1989-10-16 |
| AU509007B2 (en) | 1980-04-17 |
| IT1078624B (it) | 1985-05-08 |
| DK155729B (da) | 1989-05-08 |
| PL103443B1 (pl) | 1979-06-30 |
| IL49808A0 (en) | 1976-08-31 |
| AU1503376A (en) | 1977-12-22 |
| US4289894A (en) | 1981-09-15 |
| BG24945A3 (bg) | 1978-06-15 |
| DK273576A (da) | 1976-12-21 |
| HU171729B (hu) | 1978-03-28 |
| BE843106A (fr) | 1976-10-18 |
| JPS5214736A (en) | 1977-02-03 |
| FR2316212B1 (https=) | 1980-01-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0039844A2 (de) | Verfahren zur Herstellung von O-substituierten Derivaten des (+)-Cyanidan-3-ols | |
| DE1146486B (de) | Verfahren zur Herstellung von O, O-Dialkyl-dithiophosphorylfettsaeure-amiden | |
| DE2627709C2 (de) | Malonsäure-pentachlorphenylester und deren Herstellung | |
| EP0915840B1 (de) | Verfahren zur herstellung von substituierten valinamid-derivaten | |
| EP0678518B1 (de) | Verfahren zur Herstellung von Zwischenprodukten für die Synthese von Glucose-6-Phosphatase-Inhibitoren sowie neue Zwischenprodukte | |
| DE1932297C3 (de) | Verfahren zur Herstellung von Benzimidazol -2-carbaminsäureestern | |
| DE3743111A1 (de) | Dierythromycin- und dicholinsalze von (3s(z))-2-(((1-(2-amino-4-thiazolyl)-2-((2,2-dimethyl-4-oxo-1-(sulfooxy)-3-azetidinyl)-amino)-2-oxoaethyliden)-amino)-oxy)-essigsaeure | |
| DE2325498A1 (de) | Penicillinverbindungen und verfahren zu ihrer herstellung | |
| DE3039069A1 (de) | Verfahren zur herstellung von acylcarbamiden | |
| DE1153373B (de) | Verfahren zur Herstellung von Pyrophosphorsaeureestern, Phosphorsaeureestern, -amiden oder -carbonsaeureanhydriden | |
| EP0271695B1 (de) | Verfahren zur Herstellung von Phosphin- oder Phosphonsäurechloriden | |
| DE962608C (de) | Verfahren zur Herstellung von Phosphorsaeure- bzw. Thiophosphorsaeureestern | |
| AT326638B (de) | Verfahren zur herstellung von n(beta-diäthylaminoäthyl) -4-amino-5-chlor-2-methoxybenzamid | |
| CH513849A (de) | Verfahren zur Herstellung von Pyrrolinverbindungen | |
| DE2619321C2 (de) | Oxalsäurederivate, ihre Herstellung und ihre Verwendung | |
| DE2952704C2 (de) | Verfahren zur Herstellung von (+)-(3-Methyl-4-oxo-5-piperidino-thiazolidin-2-yliden)-essigsäureestern | |
| DE1158499B (de) | Verfahren zur Herstellung von Isonitrilen | |
| AT364836B (de) | Verfahren zur herstellung von neuen o-substituierten derivaten des (+)-cyanidan-3-ols und deren salzen | |
| AT221508B (de) | Verfahren zur Herstellung von neuen Aniliden und deren Salzen | |
| DE68914813T2 (de) | 2-Acylamino-5-Halogen-Zimtsäurederivate und Verfahren zu ihrer Herstellung. | |
| DE1900948C (de) | Cis- und trans-2-Methyl-5-(3, 4, S-trimethoxybenzamidoJ-decahydroisochinolin | |
| AT231432B (de) | Verfahren zur Herstellung von neuen Bis - bzw. Tetrakisbenzoesäureestern und -phenylessigsäureestern und ihren Salzen | |
| CH529756A (de) | Verfahren zur Herstellung neuer 3-Phenylpiperidinderivate | |
| DE2402231B2 (de) | Verfahren zur herstellung von 4- acetamidophenyl-2-acetoxybenzoat | |
| DE2753234A1 (de) | Verfahren zur herstellung von estern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: LOTTERHOS, H., DIPL.-ING. DR.-ING. BARTSCH, E., DIPL.-CHEM. DR.RER.NAT., PAT.-ANWAELTE, 6000 FRANKFURT |
|
| 8339 | Ceased/non-payment of the annual fee |