DE2557341A1 - Basisch substituierte indolderivate und verfahren zu ihrer herstellung - Google Patents
Basisch substituierte indolderivate und verfahren zu ihrer herstellungInfo
- Publication number
- DE2557341A1 DE2557341A1 DE19752557341 DE2557341A DE2557341A1 DE 2557341 A1 DE2557341 A1 DE 2557341A1 DE 19752557341 DE19752557341 DE 19752557341 DE 2557341 A DE2557341 A DE 2557341A DE 2557341 A1 DE2557341 A1 DE 2557341A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- radical
- substituted
- piperazinyl
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 20
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- -1 Hydroxy, carboxy Chemical group 0.000 claims description 178
- 150000001875 compounds Chemical class 0.000 claims description 36
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 30
- 229910052739 hydrogen Inorganic materials 0.000 claims description 26
- 239000001257 hydrogen Substances 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 239000000460 chlorine Substances 0.000 claims description 21
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 18
- 229910052757 nitrogen Inorganic materials 0.000 claims description 16
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 11
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 11
- 229910052794 bromium Inorganic materials 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 9
- KMAKOBLIOCQGJP-UHFFFAOYSA-N indole-3-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=CNC2=C1 KMAKOBLIOCQGJP-UHFFFAOYSA-N 0.000 claims description 8
- 125000003277 amino group Chemical group 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 239000002168 alkylating agent Substances 0.000 claims description 2
- 229940100198 alkylating agent Drugs 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 239000003814 drug Substances 0.000 claims 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims 1
- 125000004103 aminoalkyl group Chemical group 0.000 claims 1
- 239000012059 conventional drug carrier Substances 0.000 claims 1
- 229940079593 drug Drugs 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 32
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 20
- 239000002904 solvent Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 229920005989 resin Polymers 0.000 description 10
- 239000011347 resin Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical group 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 5
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 4
- 150000002475 indoles Chemical class 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 3
- SXIIAHIAZAMFPW-UHFFFAOYSA-N 2-chloro-1h-indole-3-carboxylic acid Chemical class C1=CC=C2C(C(=O)O)=C(Cl)NC2=C1 SXIIAHIAZAMFPW-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- JAEVFWMBWOBWRD-UHFFFAOYSA-N C12=CC(OC)=CC=C2C(C(Cl)=O)=C(Cl)N1C1=CC=CC=C1 Chemical compound C12=CC(OC)=CC=C2C(C(Cl)=O)=C(Cl)N1C1=CC=CC=C1 JAEVFWMBWOBWRD-UHFFFAOYSA-N 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- FULQKYGOYMPNFP-UHFFFAOYSA-N (2-chloro-1-phenylindol-3-yl)-(4-methylpiperazin-1-yl)methanone Chemical compound C1CN(C)CCN1C(=O)C(C1=CC=CC=C11)=C(Cl)N1C1=CC=CC=C1 FULQKYGOYMPNFP-UHFFFAOYSA-N 0.000 description 2
- MSXDNWGDITZQSO-UHFFFAOYSA-N (4-methylpiperazin-1-yl)-(1-phenyl-2-piperazin-1-ylindol-3-yl)methanone Chemical compound C1CN(C)CCN1C(=O)C(C1=CC=CC=C1N1C=2C=CC=CC=2)=C1N1CCNCC1 MSXDNWGDITZQSO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- GSRAZJUJHOAOEF-UHFFFAOYSA-N 1-phenyl-2-piperazin-1-ylindole-3-carboxylic acid Chemical compound C=1C=CC=CC=1N1C2=CC=CC=C2C(C(=O)O)=C1N1CCNCC1 GSRAZJUJHOAOEF-UHFFFAOYSA-N 0.000 description 2
- UTTXEYODTTZTMS-UHFFFAOYSA-N 1-piperidin-1-yl-2-pyrrolidin-1-ylazepane Chemical class C1CCCN1C1N(N2CCCCC2)CCCCC1 UTTXEYODTTZTMS-UHFFFAOYSA-N 0.000 description 2
- GBKZPLIJKMRYTE-UHFFFAOYSA-N 2-(2-chloroethyl)-1,3-dioxolane Chemical compound ClCCC1OCCO1 GBKZPLIJKMRYTE-UHFFFAOYSA-N 0.000 description 2
- UKFTXWKNVSVVCJ-UHFFFAOYSA-N 2-[(6-hydrazinylpyridazin-3-yl)-(2-hydroxyethyl)amino]ethanol;hydron;dichloride Chemical compound Cl.Cl.NNC1=CC=C(N(CCO)CCO)N=N1 UKFTXWKNVSVVCJ-UHFFFAOYSA-N 0.000 description 2
- FWZUBSMPPRSUSD-UHFFFAOYSA-N 2-chloro-1-phenylindole-3-carboxylic acid Chemical class C12=CC=CC=C2C(C(=O)O)=C(Cl)N1C1=CC=CC=C1 FWZUBSMPPRSUSD-UHFFFAOYSA-N 0.000 description 2
- JJHFIUHWESDWHQ-UHFFFAOYSA-N 2-chloro-5-methoxy-1-methylindole-3-carbonyl chloride Chemical compound COC1=CC=C2N(C)C(Cl)=C(C(Cl)=O)C2=C1 JJHFIUHWESDWHQ-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical group [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 230000003288 anthiarrhythmic effect Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- UCFFGYASXIPWPD-UHFFFAOYSA-N methyl hypochlorite Chemical group COCl UCFFGYASXIPWPD-UHFFFAOYSA-N 0.000 description 2
- XTEGVFVZDVNBPF-UHFFFAOYSA-N naphthalene-1,5-disulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1S(O)(=O)=O XTEGVFVZDVNBPF-UHFFFAOYSA-N 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 150000004885 piperazines Chemical class 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- WLXGQMVCYPUOLM-UHFFFAOYSA-N 1-hydroxyethanesulfonic acid Chemical compound CC(O)S(O)(=O)=O WLXGQMVCYPUOLM-UHFFFAOYSA-N 0.000 description 1
- ATANDXMMSOPDGN-UHFFFAOYSA-N 1-phenyl-2-piperazin-1-ylindole Chemical compound C1CNCCN1C1=CC2=CC=CC=C2N1C1=CC=CC=C1 ATANDXMMSOPDGN-UHFFFAOYSA-N 0.000 description 1
- KISOWYLWDNQSTC-UHFFFAOYSA-N 1-phenyl-2-piperazin-1-ylindole-3-carbaldehyde Chemical compound C=1C=CC=CC=1N1C2=CC=CC=C2C(C=O)=C1N1CCNCC1 KISOWYLWDNQSTC-UHFFFAOYSA-N 0.000 description 1
- YBFCBQMICVOSRW-UHFFFAOYSA-N 1-phenylindole Chemical class C1=CC2=CC=CC=C2N1C1=CC=CC=C1 YBFCBQMICVOSRW-UHFFFAOYSA-N 0.000 description 1
- YGHRNXHXHDPPQM-UHFFFAOYSA-N 1h-indol-3-yl hydrogen carbonate Chemical class C1=CC=C2C(OC(=O)O)=CNC2=C1 YGHRNXHXHDPPQM-UHFFFAOYSA-N 0.000 description 1
- FBXWDVALKBNEJV-UHFFFAOYSA-N 1h-indol-3-yl(piperazin-1-yl)methanone Chemical class C=1NC2=CC=CC=C2C=1C(=O)N1CCNCC1 FBXWDVALKBNEJV-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- CBDVVMQAOSFOAM-UHFFFAOYSA-N 2-chloro-1-phenylindole Chemical compound ClC1=CC2=CC=CC=C2N1C1=CC=CC=C1 CBDVVMQAOSFOAM-UHFFFAOYSA-N 0.000 description 1
- IOEMMFHEICHTSW-UHFFFAOYSA-N 2-chloro-1-phenylindole-3-carbaldehyde Chemical compound ClC1=C(C=O)C2=CC=CC=C2N1C1=CC=CC=C1 IOEMMFHEICHTSW-UHFFFAOYSA-N 0.000 description 1
- XYSSNBNFOBVMAU-UHFFFAOYSA-N 2-chloro-1h-indole-3-carbaldehyde Chemical compound C1=CC=C2C(C=O)=C(Cl)NC2=C1 XYSSNBNFOBVMAU-UHFFFAOYSA-N 0.000 description 1
- ISPQTETUXLOOFK-UHFFFAOYSA-N 2-chloro-1h-indole-3-carbonyl chloride Chemical class C1=CC=C2C(C(=O)Cl)=C(Cl)NC2=C1 ISPQTETUXLOOFK-UHFFFAOYSA-N 0.000 description 1
- VAJWKRVMQDXVJJ-UHFFFAOYSA-N 2-chloro-5-methoxy-1-methylindole-3-carboxylic acid Chemical class COC1=CC=C2N(C)C(Cl)=C(C(O)=O)C2=C1 VAJWKRVMQDXVJJ-UHFFFAOYSA-N 0.000 description 1
- CFNUERVSNHYHJC-UHFFFAOYSA-N 2-chloro-6-methoxy-1-phenylindole-3-carboxylic acid Chemical class C12=CC(OC)=CC=C2C(C(O)=O)=C(Cl)N1C1=CC=CC=C1 CFNUERVSNHYHJC-UHFFFAOYSA-N 0.000 description 1
- CRWNQZTZTZWPOF-UHFFFAOYSA-N 2-methyl-4-phenylpyridine Chemical compound C1=NC(C)=CC(C=2C=CC=CC=2)=C1 CRWNQZTZTZWPOF-UHFFFAOYSA-N 0.000 description 1
- KPEKTRARZLEBCG-UHFFFAOYSA-N 2-methylpropyl piperazine-1-carboxylate Chemical compound CC(C)COC(=O)N1CCNCC1 KPEKTRARZLEBCG-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-PPJXEINESA-N 2-phenylacetic acid Chemical compound O[14C](=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-PPJXEINESA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- DWSUJONSJJTODA-UHFFFAOYSA-N 5-(chloromethyl)-1,3-benzodioxole Chemical compound ClCC1=CC=C2OCOC2=C1 DWSUJONSJJTODA-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- NYFGDTVSWAJCCH-UHFFFAOYSA-N C1CN(C(=O)OCC(C)C)CCN1C(N(C1=CC=CC=C11)C=2C=CC=CC=2)=C1C(=O)N1CCN(C)CC1 Chemical compound C1CN(C(=O)OCC(C)C)CCN1C(N(C1=CC=CC=C11)C=2C=CC=CC=2)=C1C(=O)N1CCN(C)CC1 NYFGDTVSWAJCCH-UHFFFAOYSA-N 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- OKJIRPAQVSHGFK-UHFFFAOYSA-N N-acetylglycine Chemical compound CC(=O)NCC(O)=O OKJIRPAQVSHGFK-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 235000019486 Sunflower oil Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229940039750 aconitine Drugs 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 229960004909 aminosalicylic acid Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N beta-hydroxyethanesulfonic acid Natural products OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 239000002327 cardiovascular agent Substances 0.000 description 1
- 229940125692 cardiovascular agent Drugs 0.000 description 1
- 210000000748 cardiovascular system Anatomy 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000003026 cod liver oil Substances 0.000 description 1
- 235000012716 cod liver oil Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000007902 hard capsule Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-N methyl sulfate Chemical compound COS(O)(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-N 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- HDOWRFHMPULYOA-UHFFFAOYSA-N piperidin-4-ol Chemical compound OC1CCNCC1 HDOWRFHMPULYOA-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- ULWHHBHJGPPBCO-UHFFFAOYSA-N propane-1,1-diol Chemical compound CCC(O)O ULWHHBHJGPPBCO-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 239000002600 sunflower oil Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- IMCGHZIGRANKHV-AJNGGQMLSA-N tert-butyl (3s,5s)-2-oxo-5-[(2s,4s)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidine-1-carboxylate Chemical compound O1C(=O)[C@H](C(C)C)C[C@H]1[C@H]1N(C(=O)OC(C)(C)C)C(=O)[C@H](C(C)C)C1 IMCGHZIGRANKHV-AJNGGQMLSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/42—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/06—Antiarrhythmics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Heart & Thoracic Surgery (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Indole Compounds (AREA)
Priority Applications (24)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752557341 DE2557341A1 (de) | 1975-12-19 | 1975-12-19 | Basisch substituierte indolderivate und verfahren zu ihrer herstellung |
| ES454234A ES454234A1 (es) | 1975-12-19 | 1976-12-14 | Procedimiento para la preparacion de derivados de indol. |
| FI763622A FI763622A7 (https=) | 1975-12-19 | 1976-12-16 | |
| US05/751,084 US4148895A (en) | 1975-12-19 | 1976-12-16 | Basically substituted indole derivatives |
| NZ182908A NZ182908A (en) | 1975-12-19 | 1976-12-17 | 2-tertiaryaminoindol-3-ylcarboxylic acid derivatives |
| AU20700/76A AU2070076A (en) | 1975-12-19 | 1976-12-17 | Basically substituted indole derivatives |
| AT936176A ATA936176A (de) | 1975-12-19 | 1976-12-17 | Verfahren zur herstellung neuer, basisch substituierter indolderivate und deren saeure- additionssalze |
| PT65980A PT65980B (de) | 1975-12-19 | 1976-12-17 | Basisch substituierte indolderivate und verfahren zu ihrerherstellung |
| IT30581/76A IT1065425B (it) | 1975-12-19 | 1976-12-17 | Derivati indolici sostituiti consostituenti basici e processo per la loro preparazione |
| SE7614218A SE7614218L (sv) | 1975-12-19 | 1976-12-17 | Basiskt substituerade indolderivat och forfarande for deras framstellning |
| NO764299A NO764299L (https=) | 1975-12-19 | 1976-12-17 | |
| ZA767522A ZA767522B (en) | 1975-12-19 | 1976-12-17 | Basically substituted indole derivatives and process for their manufacture |
| IL51119A IL51119A0 (en) | 1975-12-19 | 1976-12-17 | Basically substituted indole derivatives and process for their manufacture |
| LU76426A LU76426A1 (https=) | 1975-12-19 | 1976-12-17 | |
| NL7614052A NL7614052A (nl) | 1975-12-19 | 1976-12-17 | Basisch gesubstitueerde indoolderivaten en hun bereiding. |
| DK571476A DK571476A (da) | 1975-12-19 | 1976-12-17 | Indolderivater deres fremstilling og anvendelse |
| JP51151502A JPS5277067A (en) | 1975-12-19 | 1976-12-18 | Basic substituted indole derivative and method for its production |
| EG772/76A EG12485A (en) | 1975-12-19 | 1976-12-18 | Basically substituted indole derivatives and process for their manufacture |
| GR52437A GR61172B (en) | 1975-12-19 | 1976-12-18 | Basic substituted indole derivatives and process for the preparation thereof |
| BE173448A BE849627A (fr) | 1975-12-19 | 1976-12-20 | Derives d'indol substitues par des bases, leur preparation de preparation et leurs applications |
| GB53125/76A GB1573809A (en) | 1975-12-19 | 1976-12-20 | Basically substituted indole derivative and process for their manufacture |
| FR7638399A FR2335215A1 (fr) | 1975-12-19 | 1976-12-20 | Derives d'indol substitues par des bases, leur procede de preparation et leurs applications |
| AT576279A AT357518B (de) | 1975-12-19 | 1979-08-28 | Verfahren zur herstellung neuer,basisch substi- tuierter indolderivate und deren saeure- additionssalze |
| AT576379A AT357519B (de) | 1975-12-19 | 1979-08-28 | Verfahren zur herstellung neuer, basisch substituierter indolderivate und deren saeure- additionssalze |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19752557341 DE2557341A1 (de) | 1975-12-19 | 1975-12-19 | Basisch substituierte indolderivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2557341A1 true DE2557341A1 (de) | 1977-06-30 |
Family
ID=5964904
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752557341 Withdrawn DE2557341A1 (de) | 1975-12-19 | 1975-12-19 | Basisch substituierte indolderivate und verfahren zu ihrer herstellung |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4148895A (https=) |
| JP (1) | JPS5277067A (https=) |
| AT (1) | ATA936176A (https=) |
| AU (1) | AU2070076A (https=) |
| BE (1) | BE849627A (https=) |
| DE (1) | DE2557341A1 (https=) |
| DK (1) | DK571476A (https=) |
| EG (1) | EG12485A (https=) |
| ES (1) | ES454234A1 (https=) |
| FI (1) | FI763622A7 (https=) |
| FR (1) | FR2335215A1 (https=) |
| GB (1) | GB1573809A (https=) |
| GR (1) | GR61172B (https=) |
| IL (1) | IL51119A0 (https=) |
| IT (1) | IT1065425B (https=) |
| LU (1) | LU76426A1 (https=) |
| NL (1) | NL7614052A (https=) |
| NO (1) | NO764299L (https=) |
| NZ (1) | NZ182908A (https=) |
| PT (1) | PT65980B (https=) |
| SE (1) | SE7614218L (https=) |
| ZA (1) | ZA767522B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5001133A (en) * | 1983-12-23 | 1991-03-19 | Sandoz Ltd. | Benzoic acid derivatives |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH653021A5 (fr) * | 1981-04-24 | 1985-12-13 | Delalande Sa | Derives piperidino, piperazino et homopiperazino, n-substitues par un groupe heterocyclique aromatique, leur procede de preparation et composition therapeutique les contenant. |
| JPS5936675A (ja) * | 1982-07-13 | 1984-02-28 | サンド・アクチエンゲゼルシヤフト | 二環性複素環式カルボン酸アザビシクロアルキルエステルまたはアミド |
| US4588740A (en) * | 1982-12-07 | 1986-05-13 | Smithkline Beckman Corporation | Pharmaceutical methods using 4-aminoalkyl-2(3H)-indolones |
| FR2578842B1 (fr) * | 1985-03-15 | 1987-04-10 | Rhone Poulenc Sante | Nouveaux derives de la pyrrolo(1,2-a) azepinone, leur preparation et les compositions pharmaceutiques qui les contiennent |
| DE3531658A1 (de) * | 1985-09-05 | 1987-03-12 | Boehringer Mannheim Gmbh | Heterocyclisch substituierte indole, zwischenprodukte, verfahren zu ihrer herstellung und arzneimittel |
| US5004812A (en) * | 1987-06-26 | 1991-04-02 | E. I. Du Pont De Nemours And Company | Direct positive dimethine cyanine dyes containing 1-aryl-2-heteroaryl indole nucleus |
| US5254552A (en) * | 1988-05-24 | 1993-10-19 | American Home Products Corporation | Aryl-and heteroaryl piperazinyl carboxamides having central nervous system activity |
| PT97888B (pt) * | 1990-06-07 | 1998-12-31 | Zeneca Ltd | Processo para a preparacao de compostos heterociclicos derivados de indol e de composicoes farmaceuticas que os contem |
| US5102889B1 (en) * | 1990-09-27 | 1993-05-11 | 2-(4-piperidinyl)-1h-pyrido(4,3-b)indol-1-ones and related compounds | |
| US5229517A (en) * | 1990-09-27 | 1993-07-20 | Hoechst-Roussel Pharmaceuticals Incorporated | 2-(4-Piperindinyl)-1H-pyrido[4,3-B]indol-1-ones and related compounds |
| US5284862A (en) * | 1991-03-18 | 1994-02-08 | Warner-Lambert Company | Derivatives of 2-carboxyindoles having pharmaceutical activity |
| JP3140155B2 (ja) * | 1992-03-09 | 2001-03-05 | 杏林製薬株式会社 | N,n’−ジ置換アミド誘導体 |
| ES2063700B1 (es) * | 1993-04-28 | 1995-07-16 | Vita Invest Sa | Agente activo sobre el sistema nervioso central, proceso para su preparacion y composiciones farmaceuticas que lo contengan. |
| EP1021181A4 (en) * | 1996-03-28 | 2002-06-26 | Smithkline Beecham Corp | INDOLCARBOXYLIC ACIDS AS CHEMOKIN INHIBITORS |
| AU1193199A (en) | 1997-10-22 | 1999-05-10 | Eli Lilly And Company | Arylpiperazines as serotonin reuptake inhibitors and 5-ht1dalpha antagonists |
| JP2003040866A (ja) * | 2001-07-31 | 2003-02-13 | Nippon Kayaku Co Ltd | N置換インドール誘導体、その製造法及びそれを有効成分とする害虫防除剤 |
| WO2005023246A1 (en) * | 2003-09-04 | 2005-03-17 | Aventis Pharmaceuticals Inc. | Substituted indoles as inhibitors of poly (adp-ribose) polymerase (parp) |
| WO2007136790A2 (en) * | 2006-05-18 | 2007-11-29 | Mannkind Corporation | Intracellular kinase inhibitors |
| MX2009013332A (es) * | 2007-06-08 | 2010-01-25 | Mannkind Corp | Inhibidores de ire-1 alfa. |
| MY153611A (en) * | 2008-01-31 | 2015-02-27 | Sanofi Aventis | Cyclic indole-3-carboxamides, their preparation and their use as pharmaceuticals |
| KR20120117905A (ko) | 2010-01-28 | 2012-10-24 | 프레지던트 앤드 펠로우즈 오브 하바드 칼리지 | 프로테아좀 활성을 향상시키는 조성물 및 방법 |
| HUE044867T2 (hu) | 2011-05-12 | 2019-11-28 | Proteostasis Therapeutics Inc | Proteosztázis szabályzók |
| US9849135B2 (en) | 2013-01-25 | 2017-12-26 | President And Fellows Of Harvard College | USP14 inhibitors for treating or preventing viral infections |
| WO2015073528A1 (en) | 2013-11-12 | 2015-05-21 | Proteostasis Therapeutics, Inc. | Proteasome activity enhancing compounds |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3320278A (en) * | 1965-06-30 | 1967-05-16 | Merck & Co Inc | Alpha-(2-amino)-3-indolyl lower aliphatic acid derivatives |
| US3847920A (en) * | 1973-05-17 | 1974-11-12 | Warner Lambert Co | 3-substituted pyrimido(4,5-b)indoles |
| US3980668A (en) * | 1974-09-18 | 1976-09-14 | Bristol-Myers Company | Anti-arrhythimic 5-endo-(3-indolecarbonyloxy)-N-[amino-(lower)alkyl]bicyclo[2,2,1]heptane-2,3-di-endo-carboxylic acid imides |
-
1975
- 1975-12-19 DE DE19752557341 patent/DE2557341A1/de not_active Withdrawn
-
1976
- 1976-12-14 ES ES454234A patent/ES454234A1/es not_active Expired
- 1976-12-16 FI FI763622A patent/FI763622A7/fi not_active Application Discontinuation
- 1976-12-16 US US05/751,084 patent/US4148895A/en not_active Expired - Lifetime
- 1976-12-17 NO NO764299A patent/NO764299L/no unknown
- 1976-12-17 PT PT65980A patent/PT65980B/pt unknown
- 1976-12-17 ZA ZA767522A patent/ZA767522B/xx unknown
- 1976-12-17 LU LU76426A patent/LU76426A1/xx unknown
- 1976-12-17 SE SE7614218A patent/SE7614218L/xx unknown
- 1976-12-17 NZ NZ182908A patent/NZ182908A/xx unknown
- 1976-12-17 AT AT936176A patent/ATA936176A/de not_active Application Discontinuation
- 1976-12-17 NL NL7614052A patent/NL7614052A/xx not_active Application Discontinuation
- 1976-12-17 DK DK571476A patent/DK571476A/da not_active Application Discontinuation
- 1976-12-17 IL IL51119A patent/IL51119A0/xx unknown
- 1976-12-17 IT IT30581/76A patent/IT1065425B/it active
- 1976-12-17 AU AU20700/76A patent/AU2070076A/en not_active Expired
- 1976-12-18 JP JP51151502A patent/JPS5277067A/ja active Pending
- 1976-12-18 GR GR52437A patent/GR61172B/el unknown
- 1976-12-18 EG EG772/76A patent/EG12485A/xx active
- 1976-12-20 GB GB53125/76A patent/GB1573809A/en not_active Expired
- 1976-12-20 FR FR7638399A patent/FR2335215A1/fr not_active Withdrawn
- 1976-12-20 BE BE173448A patent/BE849627A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5001133A (en) * | 1983-12-23 | 1991-03-19 | Sandoz Ltd. | Benzoic acid derivatives |
Also Published As
| Publication number | Publication date |
|---|---|
| EG12485A (en) | 1981-06-30 |
| NO764299L (https=) | 1977-06-21 |
| FR2335215A1 (fr) | 1977-07-15 |
| NZ182908A (en) | 1979-08-31 |
| IL51119A0 (en) | 1977-02-28 |
| GB1573809A (en) | 1980-08-28 |
| BE849627A (fr) | 1977-06-20 |
| GR61172B (en) | 1978-10-03 |
| DK571476A (da) | 1977-06-20 |
| ES454234A1 (es) | 1977-12-16 |
| NL7614052A (nl) | 1977-06-21 |
| FI763622A7 (https=) | 1977-06-20 |
| ZA767522B (en) | 1977-11-30 |
| JPS5277067A (en) | 1977-06-29 |
| IT1065425B (it) | 1985-02-25 |
| US4148895A (en) | 1979-04-10 |
| PT65980A (de) | 1977-01-01 |
| PT65980B (de) | 1978-07-05 |
| ATA936176A (de) | 1980-01-15 |
| SE7614218L (sv) | 1977-06-20 |
| AU2070076A (en) | 1978-06-22 |
| LU76426A1 (https=) | 1977-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2557341A1 (de) | Basisch substituierte indolderivate und verfahren zu ihrer herstellung | |
| DE1297610B (de) | 2-(4-Benzylpiperazino)-pyrimidinderivate | |
| DD206991A5 (de) | Verfahren zur herstellung neuer piperazinone | |
| DE2557342A1 (de) | Basisch substituierte indolderivate und verfahren zu ihrer herstellung | |
| EP0005828B1 (de) | Neue substituierte Phenylpiperazinderivate, diese enthaltende Arzneimittel und Verfahren zu deren Herstellung | |
| DE3034001A1 (de) | Isochinolinderivate, verfahren zu ihrer hersellung, sie enthaltende pharmazeutische zubereitungen und ihre verwendung | |
| EP0005231B1 (de) | Isochinolinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zubereitungen | |
| CH636839A5 (de) | 4-(2-oxo-1-cycloalkylidenmethyl)-phenylessigsaeurederivate, sowie verfahren zu deren herstellung und pharmazeutisch zulaessige salze solcher verbindungen. | |
| DE2005134A1 (de) | 3-Oxo-2,3-dihydro-l,4-benzoxazinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE69820066T2 (de) | Piperazinderivate zur behandlung der niedrigen harnwege | |
| DE2818403A1 (de) | Neue isochinolinderivate und verfahren zu ihrer herstellung | |
| DE3233424A1 (de) | Isochinolinderivate, verfahren zu ihrer herstellung, pharmazeutische praeparate auf basis dieser verbindungen und ihre verwendung | |
| DE2167193C2 (de) | 4-(4-Hydroxypiperidino)-N,N,3-trimethyl-2,2-diphenylbutyramide und Verfahren zu ihrer Herstellung | |
| EP0004332B1 (de) | Isochinole,Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2342028A1 (de) | 3-(1-piperazinylalkyl)-2,4-chinazolindione | |
| DE3132915A1 (de) | 1,5-diphenylpyrazolin-3-on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2707270A1 (de) | Pyrazolo-diazepine und verfahren zu ihrer herstellung | |
| CH637105A5 (en) | Process for preparing novel 1-aryloxy-2-hydroxy-3-aminopropanes | |
| DE1075620B (de) | Verfahren zur Herstellung von Phenthiazmderivaten | |
| DE1670622A1 (de) | Verfahren zur Herstellung von Aminoalkyl-pyrrol-2-yl-ketonen | |
| DE1232587B (de) | Verfahren zur Herstellung von Piperazinderivaten | |
| DE2734270C2 (https=) | ||
| US3701786A (en) | Dibenzofuranyl-aminoalcohols | |
| DE2145682C3 (de) | 1,4-disubstituierte Piperazin-Derivate und deren Säureadditionsverbindungen | |
| DE69304453T2 (de) | Pyridin-Derivate und diese enthaltende pharmazeutische Zubereitungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |