DE2556858A1 - Verfahren zur herstellung von alpha, alpha'-aminonitroanthrachinonen - Google Patents
Verfahren zur herstellung von alpha, alpha'-aminonitroanthrachinonenInfo
- Publication number
- DE2556858A1 DE2556858A1 DE19752556858 DE2556858A DE2556858A1 DE 2556858 A1 DE2556858 A1 DE 2556858A1 DE 19752556858 DE19752556858 DE 19752556858 DE 2556858 A DE2556858 A DE 2556858A DE 2556858 A1 DE2556858 A1 DE 2556858A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- ammonia
- parts
- amino
- dipolar
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 25
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 24
- 229910021529 ammonia Inorganic materials 0.000 claims description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 8
- 238000000926 separation method Methods 0.000 claims description 7
- 239000000010 aprotic solvent Substances 0.000 claims description 6
- JTVJRNPZQWLJIZ-UHFFFAOYSA-N 1-amino-2-nitroanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC([N+]([O-])=O)=C2N JTVJRNPZQWLJIZ-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 claims description 2
- 239000000758 substrate Substances 0.000 claims description 2
- 239000000047 product Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- NMNSBFYYVHREEE-UHFFFAOYSA-N 1,2-dinitroanthracene-9,10-dione Chemical class C1=CC=C2C(=O)C3=C([N+]([O-])=O)C([N+](=O)[O-])=CC=C3C(=O)C2=C1 NMNSBFYYVHREEE-UHFFFAOYSA-N 0.000 description 5
- 238000005915 ammonolysis reaction Methods 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- MBIJFIUDKPXMAV-UHFFFAOYSA-N 1,8-dinitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC([N+]([O-])=O)=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] MBIJFIUDKPXMAV-UHFFFAOYSA-N 0.000 description 3
- MGYKQVLNFCLGNP-UHFFFAOYSA-N 1-amino-8-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC(O)=C2C(=O)C2=C1C=CC=C2N MGYKQVLNFCLGNP-UHFFFAOYSA-N 0.000 description 3
- VKIKDIQREAAOSK-UHFFFAOYSA-N 1-amino-8-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC([N+]([O-])=O)=C2C(=O)C2=C1C=CC=C2N VKIKDIQREAAOSK-UHFFFAOYSA-N 0.000 description 3
- CAYCLMJYVQVQBB-UHFFFAOYSA-N 1-hydroxy-8-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC([N+]([O-])=O)=C2C(=O)C2=C1C=CC=C2O CAYCLMJYVQVQBB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000003457 sulfones Chemical class 0.000 description 3
- VWBVCOPVKXNMMZ-UHFFFAOYSA-N 1,5-diaminoanthracene-9,10-dione Chemical compound O=C1C2=C(N)C=CC=C2C(=O)C2=C1C=CC=C2N VWBVCOPVKXNMMZ-UHFFFAOYSA-N 0.000 description 2
- QWXDVWSEUJXVIK-UHFFFAOYSA-N 1,8-diaminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC(N)=C2C(=O)C2=C1C=CC=C2N QWXDVWSEUJXVIK-UHFFFAOYSA-N 0.000 description 2
- ZKHNBCNZDYATQG-UHFFFAOYSA-N 1-amino-5-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=C(O)C=CC=C2C(=O)C2=C1C=CC=C2N ZKHNBCNZDYATQG-UHFFFAOYSA-N 0.000 description 2
- PMOIXALWOXIPOK-UHFFFAOYSA-N 1-hydroxy-5-nitroanthracene-9,10-dione Chemical compound O=C1C=2C(O)=CC=CC=2C(=O)C2=C1C=CC=C2[N+]([O-])=O PMOIXALWOXIPOK-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- 238000013459 approach Methods 0.000 description 2
- VDPDRYUUTXEEIE-UHFFFAOYSA-N bis(methylsulfonyl)methane Chemical compound CS(=O)(=O)CS(C)(=O)=O VDPDRYUUTXEEIE-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- XVMVHWDCRFNPQR-UHFFFAOYSA-N 1,5-dinitroanthracene-9,10-dione Chemical compound O=C1C=2C([N+](=O)[O-])=CC=CC=2C(=O)C2=C1C=CC=C2[N+]([O-])=O XVMVHWDCRFNPQR-UHFFFAOYSA-N 0.000 description 1
- BRPOLULJMDJSOG-UHFFFAOYSA-N 1-(ethylsulfonylmethylsulfonyl)ethane Chemical compound CCS(=O)(=O)CS(=O)(=O)CC BRPOLULJMDJSOG-UHFFFAOYSA-N 0.000 description 1
- PHZPGLMKVOOUGI-UHFFFAOYSA-N 1-amino-5-nitroanthracene-9,10-dione Chemical compound O=C1C=2C(N)=CC=CC=2C(=O)C2=C1C=CC=C2[N+]([O-])=O PHZPGLMKVOOUGI-UHFFFAOYSA-N 0.000 description 1
- NJAKRNRJVHIIDT-UHFFFAOYSA-N 1-ethylsulfonyl-2-methylpropane Chemical compound CCS(=O)(=O)CC(C)C NJAKRNRJVHIIDT-UHFFFAOYSA-N 0.000 description 1
- MBDUIEKYVPVZJH-UHFFFAOYSA-N 1-ethylsulfonylethane Chemical compound CCS(=O)(=O)CC MBDUIEKYVPVZJH-UHFFFAOYSA-N 0.000 description 1
- QRXUXNUNFHPWLQ-UHFFFAOYSA-N 1-methylsulfonylbutane Chemical compound CCCCS(C)(=O)=O QRXUXNUNFHPWLQ-UHFFFAOYSA-N 0.000 description 1
- YBJCDTIWNDBNTM-UHFFFAOYSA-N 1-methylsulfonylethane Chemical compound CCS(C)(=O)=O YBJCDTIWNDBNTM-UHFFFAOYSA-N 0.000 description 1
- QAPSIUMUNHNUPW-UHFFFAOYSA-N 1-methylsulfonylpropane Chemical compound CCCS(C)(=O)=O QAPSIUMUNHNUPW-UHFFFAOYSA-N 0.000 description 1
- JEXYCADTAFPULN-UHFFFAOYSA-N 1-propylsulfonylpropane Chemical compound CCCS(=O)(=O)CCC JEXYCADTAFPULN-UHFFFAOYSA-N 0.000 description 1
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical class NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 1
- ILJDSLLXQSVCFV-UHFFFAOYSA-N 2-methylsulfonylpentane Chemical compound CCCC(C)S(C)(=O)=O ILJDSLLXQSVCFV-UHFFFAOYSA-N 0.000 description 1
- VTWYQAQIXXAXOR-UHFFFAOYSA-N 2-methylsulfonylpropane Chemical compound CC(C)S(C)(=O)=O VTWYQAQIXXAXOR-UHFFFAOYSA-N 0.000 description 1
- CMJLMPKFQPJDKP-UHFFFAOYSA-N 3-methylthiolane 1,1-dioxide Chemical compound CC1CCS(=O)(=O)C1 CMJLMPKFQPJDKP-UHFFFAOYSA-N 0.000 description 1
- -1 Alkylene sulfones Chemical class 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- CESKLHVYGRFMFP-UHFFFAOYSA-N sulfonmethane Chemical compound CCS(=O)(=O)C(C)(C)S(=O)(=O)CC CESKLHVYGRFMFP-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- BUGOPWGPQGYYGR-UHFFFAOYSA-N thiane 1,1-dioxide Chemical compound O=S1(=O)CCCCC1 BUGOPWGPQGYYGR-UHFFFAOYSA-N 0.000 description 1
- CFRVORMUGQWQNZ-UHFFFAOYSA-N thiepane 1,1-dioxide Chemical compound O=S1(=O)CCCCCC1 CFRVORMUGQWQNZ-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/24—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings
- C07C225/26—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings
- C07C225/32—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones the carbon skeleton containing carbon atoms of quinone rings having amino groups bound to carbon atoms of quinone rings or of condensed ring systems containing quinone rings of condensed quinone ring systems formed by at least three rings
- C07C225/34—Amino anthraquinones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1697874A CH592607A5 (enExample) | 1974-12-19 | 1974-12-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2556858A1 true DE2556858A1 (de) | 1976-06-24 |
Family
ID=4421824
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752556858 Withdrawn DE2556858A1 (de) | 1974-12-19 | 1975-12-17 | Verfahren zur herstellung von alpha, alpha'-aminonitroanthrachinonen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4065478A (enExample) |
| JP (1) | JPS5183635A (enExample) |
| BE (1) | BE836778A (enExample) |
| CH (1) | CH592607A5 (enExample) |
| DE (1) | DE2556858A1 (enExample) |
| FR (1) | FR2295013A1 (enExample) |
| GB (1) | GB1524729A (enExample) |
| IT (1) | IT1052575B (enExample) |
| NL (1) | NL7514661A (enExample) |
| SU (1) | SU615851A3 (enExample) |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1255719A (en) * | 1917-04-26 | 1918-02-05 | Chem Ind Basel | Process for the manufacture of betaaminoanthraquinone. |
| DE2211411A1 (de) * | 1971-03-11 | 1972-09-21 | Sandoz Ag, Basel (Schweiz) | Verfahren zur Herstellung von Aminoanthrachinonen |
| GB1402142A (en) * | 1972-06-02 | 1975-08-06 | Ici Ltd | Anthraquinone dyestuff mixtures |
| BE812616A (fr) * | 1973-03-22 | 1974-09-23 | Procede de production de la 1-amino-anthraquinone | |
| DE2409542A1 (de) * | 1974-02-28 | 1975-09-11 | Bayer Ag | Verfahren zur herstellung von aminoanthrachinonen |
-
1974
- 1974-12-19 CH CH1697874A patent/CH592607A5/xx not_active IP Right Cessation
-
1975
- 1975-12-08 JP JP50145193A patent/JPS5183635A/ja active Pending
- 1975-12-15 IT IT52680/75A patent/IT1052575B/it active
- 1975-12-15 US US05/640,372 patent/US4065478A/en not_active Expired - Lifetime
- 1975-12-16 FR FR7538480A patent/FR2295013A1/fr active Granted
- 1975-12-16 NL NL7514661A patent/NL7514661A/xx unknown
- 1975-12-17 DE DE19752556858 patent/DE2556858A1/de not_active Withdrawn
- 1975-12-17 SU SU752198512A patent/SU615851A3/ru active
- 1975-12-18 BE BE162852A patent/BE836778A/xx unknown
- 1975-12-19 GB GB52230/75A patent/GB1524729A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL7514661A (nl) | 1976-06-22 |
| CH592607A5 (enExample) | 1977-10-31 |
| JPS5183635A (en) | 1976-07-22 |
| BE836778A (fr) | 1976-06-18 |
| GB1524729A (en) | 1978-09-13 |
| FR2295013B1 (enExample) | 1979-04-27 |
| SU615851A3 (ru) | 1978-07-15 |
| FR2295013A1 (fr) | 1976-07-16 |
| IT1052575B (it) | 1981-07-20 |
| US4065478A (en) | 1977-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2142100A1 (de) | Trennverfahren | |
| DE2524747C3 (de) | Verfahren zur Isolierung von 1,5-/1,8-Dinitroanthrachinon mit einem hohen Gehalt an a , a '-Duutroverbindungen | |
| DE2556858A1 (de) | Verfahren zur herstellung von alpha, alpha'-aminonitroanthrachinonen | |
| EP0001087B1 (de) | Verfahren zur Herstellung von 1-Amino-4-bromanthrachinon-2-sulfonsäure | |
| DE927333C (de) | Verfahren zur Reduktion von Nitroanthrachinonen und Trennung der Reduktionsprodukte | |
| DE2228660A1 (de) | Verfahren zur Herstellung von ein heithchen alpha Monohydroxylamino oder alpha, alpha Dihydroxylaminoanthrachinon verbindungen | |
| DE3022783C2 (enExample) | ||
| DE484360C (de) | Verfahren zur Darstellung von organischen Rhodanverbindungen | |
| DE2622838C2 (de) | Verfahren zur Herstellung von N-Alkylamino- und N,N-Dialkylamino- anthrachinonen | |
| DE415318C (de) | Verfahren zur Herstellung von 4-Arylamino-1-arylimino-2-naphthochinonen | |
| DE2344195B2 (de) | Verfahren zur Herstellung von Aminoanthrachinonen aus Nitroanthrachinonen | |
| DE935566C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE1288093B (de) | Verfahren zur Herstellung von Äthylidenpyrrolidonverbindungen | |
| DE2528866A1 (de) | Verfahren zur herstellung von nitro-amino-azobenzolen | |
| DE2631040A1 (de) | Verfahren zur herstellung basischer oxazinfarbstoffe | |
| DE2300019C3 (de) | Verfahren zur direkten Herstellung von 1,9-Anthrapyrimidin-2-carbonsäure-1 '-anthrachinonylamid in Pigmentform | |
| DE4222302A1 (de) | Verfahren zur Herstellung von 1,4-Diaminoanthrachinon-2,3-disulfonsäure und 1,4-Diaminoanthrachinon-2,3-dinitril | |
| DE810052C (de) | Verfahren zur Herstellung von Leukoschwefelsaeureestern verkuepbarer Verbindungen der Anthrachinon- und Indigoreihe | |
| DE595024C (de) | Verfahren zur Herstellung von Kondensationsprodukten des Fluoranthens | |
| DE2517435C3 (de) | Verfahren zur Gewinnung von 1,8-Dinitroanthrachinon aus Dinitroanthrachinon-Gemischen | |
| DE438934C (de) | Verfahren zur Herstellung von Farbstoffen der Anthrachinonreihe | |
| DE950914C (de) | Verfahren zur Herstellung von aromatischen Triaminomono- und -disulfamidsaeuren | |
| DE491878C (de) | Verfahren zur Darstellung von 2-Chlor-1, 4-dioxyanthrachinonen | |
| DE170728C (enExample) | ||
| DE2049161A1 (de) | Verfahren zur Herstellung von aromatischen o-Aminonitrilen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |