DE2523490C2 - - Google Patents
Info
- Publication number
- DE2523490C2 DE2523490C2 DE2523490A DE2523490A DE2523490C2 DE 2523490 C2 DE2523490 C2 DE 2523490C2 DE 2523490 A DE2523490 A DE 2523490A DE 2523490 A DE2523490 A DE 2523490A DE 2523490 C2 DE2523490 C2 DE 2523490C2
- Authority
- DE
- Germany
- Prior art keywords
- polylactone
- composition according
- basic compound
- washing
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000005406 washing Methods 0.000 claims description 34
- 239000003795 chemical substances by application Substances 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 32
- 239000004094 surface-active agent Substances 0.000 claims description 29
- 150000007514 bases Chemical class 0.000 claims description 27
- 239000007787 solid Substances 0.000 claims description 23
- -1 alkyl radical Chemical class 0.000 claims description 22
- 229920000642 polymer Polymers 0.000 claims description 17
- 238000004140 cleaning Methods 0.000 claims description 16
- 239000007788 liquid Substances 0.000 claims description 16
- FEWFXBUNENSNBQ-UHFFFAOYSA-N 2-hydroxyacrylic acid Chemical compound OC(=C)C(O)=O FEWFXBUNENSNBQ-UHFFFAOYSA-N 0.000 claims description 15
- 238000004061 bleaching Methods 0.000 claims description 14
- 239000012190 activator Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 9
- 235000011837 pasties Nutrition 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229920001577 copolymer Polymers 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 150000002148 esters Chemical class 0.000 claims description 5
- 150000002978 peroxides Chemical class 0.000 claims description 5
- 229960001922 sodium perborate Drugs 0.000 claims description 5
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 5
- 229910019142 PO4 Inorganic materials 0.000 claims description 4
- 125000003158 alcohol group Chemical group 0.000 claims description 4
- 235000021317 phosphate Nutrition 0.000 claims description 4
- 150000004760 silicates Chemical class 0.000 claims description 4
- NGULNJDDRUSDPR-UHFFFAOYSA-N (diacetylamino) acetate Chemical compound CC(=O)ON(C(C)=O)C(C)=O NGULNJDDRUSDPR-UHFFFAOYSA-N 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002671 adjuvant Substances 0.000 claims description 3
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 3
- 150000004679 hydroxides Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- 239000007844 bleaching agent Substances 0.000 claims description 2
- 150000001642 boronic acid derivatives Chemical class 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 238000002156 mixing Methods 0.000 claims description 2
- 125000005342 perphosphate group Chemical group 0.000 claims description 2
- 239000012459 cleaning agent Substances 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 125000002467 phosphate group Chemical class [H]OP(=O)(O[H])O[*] 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 239000000843 powder Substances 0.000 description 16
- 235000019832 sodium triphosphate Nutrition 0.000 description 13
- 238000012360 testing method Methods 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000008187 granular material Substances 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000003599 detergent Substances 0.000 description 7
- 239000004753 textile Substances 0.000 description 7
- 229920000742 Cotton Polymers 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 239000003945 anionic surfactant Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000002736 nonionic surfactant Substances 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 description 3
- 229940088598 enzyme Drugs 0.000 description 3
- 239000004744 fabric Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 229940045872 sodium percarbonate Drugs 0.000 description 3
- 239000013042 solid detergent Substances 0.000 description 3
- 238000001179 sorption measurement Methods 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- 238000004851 dishwashing Methods 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000002310 reflectometry Methods 0.000 description 2
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 150000003871 sulfonates Chemical class 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 2
- HTVWFMUWWPKVJJ-UHFFFAOYSA-N 1,1-diaminopropan-2-one Chemical compound CC(=O)C(N)N HTVWFMUWWPKVJJ-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- LAZUHOPLTJOKNS-UHFFFAOYSA-N 2-(2-chloroacetyl)oxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC(=O)CCl LAZUHOPLTJOKNS-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- OSPOJLWAJPWJTO-UHFFFAOYSA-N 3-[hexadecyl(dimethyl)azaniumyl]-2-hydroxypropane-1-sulfonate Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)CC(O)CS([O-])(=O)=O OSPOJLWAJPWJTO-UHFFFAOYSA-N 0.000 description 1
- TUBRCQBRKJXJEA-UHFFFAOYSA-N 3-[hexadecyl(dimethyl)azaniumyl]propane-1-sulfonate Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)CCCS([O-])(=O)=O TUBRCQBRKJXJEA-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical compound [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- 241000287826 Gallus Species 0.000 description 1
- 101001096355 Homo sapiens Replication factor C subunit 3 Proteins 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 102100037855 Replication factor C subunit 3 Human genes 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000002668 chloroacetyl group Chemical group ClCC(=O)* 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 150000007973 cyanuric acids Chemical class 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- CEJLBZWIKQJOAT-UHFFFAOYSA-N dichloroisocyanuric acid Chemical compound ClN1C(=O)NC(=O)N(Cl)C1=O CEJLBZWIKQJOAT-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical group OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- JGUQDUKBUKFFRO-CIIODKQPSA-N dimethylglyoxime Chemical compound O/N=C(/C)\C(\C)=N\O JGUQDUKBUKFFRO-CIIODKQPSA-N 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000004453 electron probe microanalysis Methods 0.000 description 1
- UFZOPKFMKMAWLU-UHFFFAOYSA-N ethoxy(methyl)phosphinic acid Chemical compound CCOP(C)(O)=O UFZOPKFMKMAWLU-UHFFFAOYSA-N 0.000 description 1
- 238000012851 eutrophication Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000003205 fragrance Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 238000007273 lactonization reaction Methods 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- VPMBHDMEXTYICP-UHFFFAOYSA-N n',n'-diacetylbenzohydrazide Chemical compound CC(=O)N(C(C)=O)NC(=O)C1=CC=CC=C1 VPMBHDMEXTYICP-UHFFFAOYSA-N 0.000 description 1
- UMHTVKGNHVUENZ-UHFFFAOYSA-N n,n',n'-triacetylacetohydrazide Chemical compound CC(=O)N(C(C)=O)N(C(C)=O)C(C)=O UMHTVKGNHVUENZ-UHFFFAOYSA-N 0.000 description 1
- APAACPVZDAGQHC-UHFFFAOYSA-N n-acetyl-n-(4-chlorophenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(Cl)C=C1 APAACPVZDAGQHC-UHFFFAOYSA-N 0.000 description 1
- UJPCOKISUIXFFR-UHFFFAOYSA-N n-acetyl-n-(4-methylphenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(C)C=C1 UJPCOKISUIXFFR-UHFFFAOYSA-N 0.000 description 1
- LUVMRKKWOQTAQD-UHFFFAOYSA-N n-acetyl-n-[6-(diacetylamino)hexyl]acetamide Chemical compound CC(=O)N(C(C)=O)CCCCCCN(C(C)=O)C(C)=O LUVMRKKWOQTAQD-UHFFFAOYSA-N 0.000 description 1
- KBDYPDHUODKDRK-UHFFFAOYSA-N n-acetyl-n-phenylacetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=CC=C1 KBDYPDHUODKDRK-UHFFFAOYSA-N 0.000 description 1
- YVRZNAMRFULZAB-UHFFFAOYSA-N n-butanoyl-n-phenylbutanamide Chemical compound CCCC(=O)N(C(=O)CCC)C1=CC=CC=C1 YVRZNAMRFULZAB-UHFFFAOYSA-N 0.000 description 1
- UBWXUGDQUBIEIZ-QNTYDACNSA-N nandrolone phenpropionate Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@H]4CCC(=O)C=C4CC3)CC[C@@]21C)C(=O)CCC1=CC=CC=C1 UBWXUGDQUBIEIZ-QNTYDACNSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 235000014593 oils and fats Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 230000009919 sequestration Effects 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- NWPMTMCXJZTLSO-UHFFFAOYSA-M sodium;4-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 NWPMTMCXJZTLSO-UHFFFAOYSA-M 0.000 description 1
- BOYKIWOLPHVJGW-UHFFFAOYSA-M sodium;4-butanoyloxybenzenesulfonate Chemical compound [Na+].CCCC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 BOYKIWOLPHVJGW-UHFFFAOYSA-M 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- XTQHKBHJIVJGKJ-UHFFFAOYSA-N sulfur monoxide Chemical class S=O XTQHKBHJIVJGKJ-UHFFFAOYSA-N 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- XUECSRVFRKTFKJ-UHFFFAOYSA-N tritylhydrazine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(NN)C1=CC=CC=C1 XUECSRVFRKTFKJ-UHFFFAOYSA-N 0.000 description 1
- 238000005199 ultracentrifugation Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 230000002087 whitening effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
- C11D3/3746—Macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- C11D3/3757—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions
- C11D3/3761—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions in solid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU70411*A LU70411A1 (enExample) | 1974-06-25 | 1974-06-25 | |
| LU70960A LU70960A1 (enExample) | 1974-06-25 | 1974-09-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2523490A1 DE2523490A1 (de) | 1976-01-15 |
| DE2523490C2 true DE2523490C2 (enExample) | 1992-07-09 |
Family
ID=26640161
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752523490 Granted DE2523490A1 (de) | 1974-06-25 | 1975-05-27 | Feste mittel zum waschen, reinigen und bleichen, verfahren zu ihrer herstellung und verwendung |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4079016A (enExample) |
| JP (1) | JPS5939480B2 (enExample) |
| AT (1) | AT343249B (enExample) |
| BE (1) | BE830603A (enExample) |
| BR (1) | BR7503682A (enExample) |
| CA (1) | CA1051741A (enExample) |
| CH (1) | CH599341A5 (enExample) |
| DE (1) | DE2523490A1 (enExample) |
| DK (1) | DK146479C (enExample) |
| ES (2) | ES436955A1 (enExample) |
| FR (1) | FR2276376A1 (enExample) |
| GB (1) | GB1470137A (enExample) |
| IE (1) | IE41547B1 (enExample) |
| IN (1) | IN144762B (enExample) |
| IT (1) | IT1037675B (enExample) |
| LU (2) | LU70411A1 (enExample) |
| NL (1) | NL185095C (enExample) |
| NO (1) | NO147723C (enExample) |
| SE (1) | SE420620B (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2424298A1 (fr) * | 1978-04-24 | 1979-11-23 | Solvay | Particules a base de polylactones derivees d'acides polyhydroxycarboxyliques et compositions pulverulentes contenant ces particules |
| JPS5935674B2 (ja) * | 1978-11-02 | 1984-08-30 | 日鉱エンジニアリング株式会社 | 廃触媒の抜き出し処理法 |
| FR2459203A1 (fr) * | 1979-06-21 | 1981-01-09 | Interox | Particules de composes peroxygenes stabilises, procede pour leur fabrication et composition en contenant |
| US4450089A (en) * | 1982-10-21 | 1984-05-22 | Colgate-Palmolive Company | Stabilized bleaching and laundering composition |
| US4455249A (en) * | 1982-10-21 | 1984-06-19 | Colgate-Palmolive Company | Stabilized bleach and laundering composition |
| DE3328882A1 (de) * | 1983-08-10 | 1985-02-28 | Vsesojuznyj naučno-issledovatel'skij biotechničeskij institut, Moskva | Fermenthaltiges reinigungsmittel zur behandlung von medizinischen instrumenten und geraeten vor der sterilisation |
| US4579676A (en) * | 1984-12-17 | 1986-04-01 | Economics Laboratory, Inc. | Low-phosphate liquid cleaning composition |
| JPS6232195A (ja) * | 1985-08-05 | 1987-02-12 | 花王株式会社 | 漂白性向上剤 |
| US4663071A (en) * | 1986-01-30 | 1987-05-05 | The Procter & Gamble Company | Ether carboxylate detergent builders and process for their preparation |
| JPS62253697A (ja) * | 1986-04-02 | 1987-11-05 | 花王株式会社 | 漂白剤組成物 |
| DE3720806C2 (de) * | 1986-07-03 | 1997-08-21 | Clariant Finance Bvi Ltd | Verwendung eines Stabilisators in Peroxydbleichverfahren |
| US4798907A (en) * | 1988-02-26 | 1989-01-17 | The Procter & Gamble Company | Controlled temperature process for making 2,2'-oxodisuccinates useful as laundry detergent builders |
| JPH02282103A (ja) * | 1989-04-12 | 1990-11-19 | Bunkyo So | 立体架倉庫 |
| GB8928320D0 (en) * | 1989-12-14 | 1990-02-21 | Unilever Plc | Polymers and detergent compositions containing them |
| JPH0623912U (ja) * | 1992-07-08 | 1994-03-29 | 芳彦 前島 | 金型保管棚装置 |
| US5302375A (en) * | 1992-11-19 | 1994-04-12 | Colgate-Palmolive Company | Oral composition having improved tooth whitening effect |
| US7824448B2 (en) | 2002-11-22 | 2010-11-02 | Schneider David J | Process for stain removal |
| US7513915B2 (en) * | 2002-11-22 | 2009-04-07 | Schneider Advanced Technologies, Inc. | Process for stain removal |
| KR100966460B1 (ko) * | 2005-12-29 | 2010-06-28 | 엘지디스플레이 주식회사 | 롤 스토커 및 이를 이용한 액정표시장치의 제조방법 |
| WO2015124189A1 (de) * | 2014-02-20 | 2015-08-27 | Henkel Ag & Co. Kgaa | Wasch- oder reinigungsmittel mit verbessertem schaumverhalten unter hoher schmutzbelastung |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1962125B2 (de) * | 1969-12-11 | 1973-11-08 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verwendung von Polyoxypolycar bonsauren als Aufbausalze in Wasch , Bleich und Reinigungsmitteln |
| US3920570A (en) * | 1970-12-17 | 1975-11-18 | Solvay | Sequestration of metal ions by the use of poly-alpha-hydroxyacrylates |
| DE2101508C3 (de) * | 1971-01-14 | 1979-05-17 | Henkel Kgaa, 4000 Duesseldorf | Geschirrspulmittel |
| DE2136672B2 (de) * | 1971-07-22 | 1979-10-18 | Henkel Kgaa, 4000 Duesseldorf | Wasch- und Reinigungsmittel |
| DE2336108A1 (de) * | 1972-07-21 | 1974-01-31 | Interox | Oxydationsmittel mit komplexierenden eigenschaften und diese verbindungen enthaltende waschmittelzusammensetzungen |
| US3776850A (en) * | 1972-07-28 | 1973-12-04 | Ethyl Corp | Detergent formulations |
| US3904685A (en) * | 1973-07-20 | 1975-09-09 | Celanese Corp | Polyacrylic acid having high chelation value and its production |
| LU68060A1 (enExample) * | 1973-07-20 | 1975-04-11 |
-
1974
- 1974-06-25 LU LU70411*A patent/LU70411A1/xx unknown
- 1974-09-23 LU LU70960A patent/LU70960A1/xx unknown
-
1975
- 1975-04-25 ES ES436955A patent/ES436955A1/es not_active Expired
- 1975-04-25 ES ES436922A patent/ES436922A1/es not_active Expired
- 1975-04-28 IT IT22789/75A patent/IT1037675B/it active
- 1975-04-29 CH CH547375A patent/CH599341A5/xx not_active IP Right Cessation
- 1975-05-22 GB GB2226075A patent/GB1470137A/en not_active Expired
- 1975-05-27 IN IN1065/CAL/75A patent/IN144762B/en unknown
- 1975-05-27 DE DE19752523490 patent/DE2523490A1/de active Granted
- 1975-06-05 CA CA228,608A patent/CA1051741A/fr not_active Expired
- 1975-06-09 IE IE1298/75A patent/IE41547B1/en unknown
- 1975-06-11 BR BR4723/75D patent/BR7503682A/pt unknown
- 1975-06-19 US US05/588,136 patent/US4079016A/en not_active Expired - Lifetime
- 1975-06-20 FR FR7519632A patent/FR2276376A1/fr active Granted
- 1975-06-24 AT AT483475A patent/AT343249B/de not_active IP Right Cessation
- 1975-06-24 DK DK285275A patent/DK146479C/da active
- 1975-06-24 NO NO752242A patent/NO147723C/no unknown
- 1975-06-24 SE SE7507254A patent/SE420620B/xx not_active IP Right Cessation
- 1975-06-25 BE BE157645A patent/BE830603A/xx not_active IP Right Cessation
- 1975-06-25 NL NLAANVRAGE7507566,A patent/NL185095C/xx not_active IP Right Cessation
- 1975-06-25 JP JP50077573A patent/JPS5939480B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK146479B (da) | 1983-10-17 |
| NL185095B (nl) | 1989-08-16 |
| LU70960A1 (enExample) | 1976-08-19 |
| ATA483475A (de) | 1977-09-15 |
| SE420620B (sv) | 1981-10-19 |
| GB1470137A (en) | 1977-04-14 |
| JPS5939480B2 (ja) | 1984-09-22 |
| AU8175875A (en) | 1976-12-09 |
| DE2523490A1 (de) | 1976-01-15 |
| IT1037675B (it) | 1979-11-20 |
| ES436955A1 (es) | 1976-12-16 |
| US4079016A (en) | 1978-03-14 |
| NO147723B (no) | 1983-02-21 |
| FR2276376B1 (enExample) | 1977-07-22 |
| JPS5118707A (en) | 1976-02-14 |
| NO147723C (no) | 1983-06-01 |
| NL185095C (nl) | 1990-01-16 |
| AT343249B (de) | 1978-05-10 |
| NO752242L (enExample) | 1975-12-30 |
| DK285275A (da) | 1975-12-26 |
| CA1051741A (fr) | 1979-04-03 |
| FR2276376A1 (fr) | 1976-01-23 |
| ES436922A1 (es) | 1976-12-16 |
| DK146479C (da) | 1984-03-26 |
| IE41547L (en) | 1975-12-25 |
| CH599341A5 (enExample) | 1978-05-31 |
| LU70411A1 (enExample) | 1976-04-13 |
| BR7503682A (pt) | 1976-07-06 |
| BE830603A (fr) | 1975-12-29 |
| NL7507566A (nl) | 1975-12-30 |
| IN144762B (enExample) | 1978-07-01 |
| SE7507254L (sv) | 1975-12-29 |
| IE41547B1 (en) | 1980-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2523490C2 (enExample) | ||
| DE69819153T2 (de) | Wasserfreie flüssige sprenkel enthaltende waschmittelzusammensetzungen | |
| DE69628784T2 (de) | Bleichmitteltabletten | |
| DE2604990A1 (de) | Fluessige reinigungsmittelzusammensetzungen | |
| DE3728256A1 (de) | Nicht-waessrige fluessige bleichmittelverstaerkende zusammensetzung | |
| DE19709411A1 (de) | Waschmittelformkörper | |
| EP0424403A1 (de) | Körniges adsorptionsmittel mit verbessertem einspülverhalten | |
| CH674371A5 (enExample) | ||
| CH673192B5 (enExample) | ||
| DE3024912A1 (de) | Teilchenfoermige bleichmittel | |
| EP1113068A2 (de) | Granulares Alkalischichtsilicat-Compound | |
| EP1723222B1 (de) | Bleichaktivatoren und verfahren zu ihrer herstellung | |
| EP0637627A2 (de) | Waschmittelformulierungen | |
| CA1284926C (en) | Bleaching synthetic detergent composition | |
| EP4506442A1 (de) | Co-granulate, wasch- und reinigungsmittel enthaltend diese und deren verwendung | |
| EP0612347A1 (de) | Verfahren zur herstellung niederalkalischer, aktivchlor- und phosphatfreier maschinengeschirrspülmittel in form von schwergranulaten | |
| DE102005041967A1 (de) | Granulare Bleichaktivator-Mischungen | |
| DE60009745T2 (de) | Waschmittelzusammensetzungen | |
| WO1998035011A1 (de) | Verwendung von cobuilder-haltigen additiven in wasch- oder reinigungsmitteln | |
| DE2032768A1 (de) | Lagerbeständiges, enzymhaltiges Wasch- und waschhilfsmittel und Verfahren zu dessen Herstellung | |
| DE10048875A1 (de) | Verfahren zur Herstellung von gefärbten Wasch- und Reinigungsmittelteilchen | |
| DE60305927T2 (de) | Waschmittelzusammensetzungen | |
| DE60033052T2 (de) | Waschmittelzusammensetzungen | |
| DE2504276A1 (de) | Waschmittel mit einem gehalt an n-alkansulfonaten und optischen aufhellern | |
| EP1489160B1 (de) | Wasch- oder reinigungsaktive Formkörper für den Gebrauch im Haushalt |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |