IE41547B1 - Solid washing cleaning or bleaching compositions and theirproduction and use - Google Patents
Solid washing cleaning or bleaching compositions and theirproduction and useInfo
- Publication number
- IE41547B1 IE41547B1 IE1298/75A IE129875A IE41547B1 IE 41547 B1 IE41547 B1 IE 41547B1 IE 1298/75 A IE1298/75 A IE 1298/75A IE 129875 A IE129875 A IE 129875A IE 41547 B1 IE41547 B1 IE 41547B1
- Authority
- IE
- Ireland
- Prior art keywords
- composition according
- polylactone
- washing
- solid
- cleaning
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 97
- 238000005406 washing Methods 0.000 title claims abstract description 50
- 239000007787 solid Substances 0.000 title claims abstract description 27
- 238000004061 bleaching Methods 0.000 title claims abstract description 23
- 238000004140 cleaning Methods 0.000 title claims abstract description 22
- 239000004094 surface-active agent Substances 0.000 claims abstract description 52
- 150000007514 bases Chemical class 0.000 claims abstract description 32
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims abstract description 30
- 150000001875 compounds Chemical class 0.000 claims abstract description 27
- 239000007788 liquid Substances 0.000 claims abstract description 20
- 239000000654 additive Substances 0.000 claims abstract description 19
- 229920000642 polymer Polymers 0.000 claims abstract description 19
- 239000012190 activator Substances 0.000 claims abstract description 15
- 230000000996 additive effect Effects 0.000 claims abstract description 15
- 239000002253 acid Substances 0.000 claims abstract description 14
- 235000011837 pasties Nutrition 0.000 claims abstract description 10
- 229920001577 copolymer Polymers 0.000 claims abstract description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 8
- FEWFXBUNENSNBQ-UHFFFAOYSA-N 2-hydroxyacrylic acid Chemical compound OC(=C)C(O)=O FEWFXBUNENSNBQ-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910019142 PO4 Inorganic materials 0.000 claims abstract description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 6
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 6
- 235000021317 phosphate Nutrition 0.000 claims abstract description 6
- 150000002978 peroxides Chemical class 0.000 claims abstract description 5
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims abstract description 4
- 150000002148 esters Chemical class 0.000 claims abstract description 4
- 150000004679 hydroxides Chemical class 0.000 claims abstract description 4
- 125000003158 alcohol group Chemical group 0.000 claims abstract description 3
- 150000001642 boronic acid derivatives Chemical class 0.000 claims abstract description 3
- 125000005342 perphosphate group Chemical group 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 18
- 239000000843 powder Substances 0.000 claims description 17
- 239000000463 material Substances 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 4
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 4
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 238000002156 mixing Methods 0.000 claims description 4
- 229960001922 sodium perborate Drugs 0.000 claims description 4
- 229940045872 sodium percarbonate Drugs 0.000 claims description 4
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 claims description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims description 2
- 150000001339 alkali metal compounds Chemical class 0.000 claims 1
- 125000002467 phosphate group Chemical class [H]OP(=O)(O[H])O[*] 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract description 21
- 235000019832 sodium triphosphate Nutrition 0.000 abstract description 12
- 125000000129 anionic group Chemical group 0.000 abstract description 8
- -1 ammonium silicates Chemical class 0.000 abstract description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract description 5
- 239000000460 chlorine Substances 0.000 abstract description 5
- 229910052801 chlorine Inorganic materials 0.000 abstract description 5
- 239000003599 detergent Substances 0.000 abstract description 5
- 238000007792 addition Methods 0.000 abstract description 4
- 239000007844 bleaching agent Substances 0.000 abstract description 3
- 125000002091 cationic group Chemical group 0.000 abstract description 3
- 229920001519 homopolymer Polymers 0.000 abstract description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 abstract description 3
- 238000004851 dishwashing Methods 0.000 abstract description 2
- 238000009991 scouring Methods 0.000 abstract description 2
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 abstract description 2
- 239000004753 textile Substances 0.000 abstract description 2
- 239000002736 nonionic surfactant Substances 0.000 abstract 2
- 239000002280 amphoteric surfactant Substances 0.000 abstract 1
- 239000003945 anionic surfactant Substances 0.000 abstract 1
- 239000003093 cationic surfactant Substances 0.000 abstract 1
- 239000002563 ionic surfactant Substances 0.000 abstract 1
- 230000000737 periodic effect Effects 0.000 abstract 1
- 239000008187 granular material Substances 0.000 description 11
- 239000008247 solid mixture Substances 0.000 description 11
- 239000004744 fabric Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 239000002689 soil Substances 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 230000005484 gravity Effects 0.000 description 5
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 239000003112 inhibitor Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 238000001179 sorption measurement Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229920000388 Polyphosphate Polymers 0.000 description 3
- 101710194948 Protein phosphatase PhpP Proteins 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 239000002671 adjuvant Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 230000014759 maintenance of location Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 3
- 239000001205 polyphosphate Substances 0.000 description 3
- 235000011176 polyphosphates Nutrition 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000000470 constituent Substances 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 238000012851 eutrophication Methods 0.000 description 2
- 238000005562 fading Methods 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000004900 laundering Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 2
- KFTHGQZJWAXFGG-ZUVMSYQZSA-N (NE)-N-[(1E)-1-hydroxyiminopropan-2-ylidene]hydroxylamine Chemical compound C\C(\C=N\O)=N/O KFTHGQZJWAXFGG-ZUVMSYQZSA-N 0.000 description 1
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 1
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 1
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 1
- JUVDEAXMLQQRFP-UHFFFAOYSA-N 1h-imidazol-2-yl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)C1=NC=CN1 JUVDEAXMLQQRFP-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- OKDGPOCKHMGDQY-UHFFFAOYSA-N 3,4-dihydropyrrol-2-one Chemical class O=C1CCC=N1 OKDGPOCKHMGDQY-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910001424 calcium ion Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004453 electron probe microanalysis Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- UFZOPKFMKMAWLU-UHFFFAOYSA-N ethoxy(methyl)phosphinic acid Chemical compound CCOP(C)(O)=O UFZOPKFMKMAWLU-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229940074391 gallic acid Drugs 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- RNYJXPUAFDFIQJ-UHFFFAOYSA-N hydron;octadecan-1-amine;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[NH3+] RNYJXPUAFDFIQJ-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000006233 lamp black Substances 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 229910001425 magnesium ion Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- UMHTVKGNHVUENZ-UHFFFAOYSA-N n,n',n'-triacetylacetohydrazide Chemical compound CC(=O)N(C(C)=O)N(C(C)=O)C(C)=O UMHTVKGNHVUENZ-UHFFFAOYSA-N 0.000 description 1
- APAACPVZDAGQHC-UHFFFAOYSA-N n-acetyl-n-(4-chlorophenyl)acetamide Chemical compound CC(=O)N(C(C)=O)C1=CC=C(Cl)C=C1 APAACPVZDAGQHC-UHFFFAOYSA-N 0.000 description 1
- CHVZPRDGLWBEMJ-UHFFFAOYSA-N n-chlorobenzenesulfonamide Chemical class ClNS(=O)(=O)C1=CC=CC=C1 CHVZPRDGLWBEMJ-UHFFFAOYSA-N 0.000 description 1
- 235000014593 oils and fats Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000019353 potassium silicate Nutrition 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000003352 sequestering agent Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000019351 sodium silicates Nutrition 0.000 description 1
- NWPMTMCXJZTLSO-UHFFFAOYSA-M sodium;4-acetyloxybenzenesulfonate Chemical compound [Na+].CC(=O)OC1=CC=C(S([O-])(=O)=O)C=C1 NWPMTMCXJZTLSO-UHFFFAOYSA-M 0.000 description 1
- JWBGBOFZNFXYPO-UHFFFAOYSA-M sodium;4-butoxybenzenesulfonate Chemical compound [Na+].CCCCOC1=CC=C(S([O-])(=O)=O)C=C1 JWBGBOFZNFXYPO-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000001273 sulfonato group Chemical group [O-]S(*)(=O)=O 0.000 description 1
- 229950009390 symclosene Drugs 0.000 description 1
- 239000000271 synthetic detergent Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- FRPJTGXMTIIFIT-UHFFFAOYSA-N tetraacetylethylenediamine Chemical compound CC(=O)C(N)(C(C)=O)C(N)(C(C)=O)C(C)=O FRPJTGXMTIIFIT-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- XUECSRVFRKTFKJ-UHFFFAOYSA-N tritylhydrazine Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(NN)C1=CC=CC=C1 XUECSRVFRKTFKJ-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/16—Organic compounds
- C11D3/37—Polymers
- C11D3/3746—Macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds
- C11D3/3757—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions
- C11D3/3761—(Co)polymerised carboxylic acids, -anhydrides, -esters in solid and liquid compositions in solid compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU70411*A LU70411A1 (enExample) | 1974-06-25 | 1974-06-25 | |
| LU70960A LU70960A1 (enExample) | 1974-06-25 | 1974-09-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE41547L IE41547L (en) | 1975-12-25 |
| IE41547B1 true IE41547B1 (en) | 1980-01-30 |
Family
ID=26640161
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1298/75A IE41547B1 (en) | 1974-06-25 | 1975-06-09 | Solid washing cleaning or bleaching compositions and theirproduction and use |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4079016A (enExample) |
| JP (1) | JPS5939480B2 (enExample) |
| AT (1) | AT343249B (enExample) |
| BE (1) | BE830603A (enExample) |
| BR (1) | BR7503682A (enExample) |
| CA (1) | CA1051741A (enExample) |
| CH (1) | CH599341A5 (enExample) |
| DE (1) | DE2523490A1 (enExample) |
| DK (1) | DK146479C (enExample) |
| ES (2) | ES436955A1 (enExample) |
| FR (1) | FR2276376A1 (enExample) |
| GB (1) | GB1470137A (enExample) |
| IE (1) | IE41547B1 (enExample) |
| IN (1) | IN144762B (enExample) |
| IT (1) | IT1037675B (enExample) |
| LU (2) | LU70411A1 (enExample) |
| NL (1) | NL185095C (enExample) |
| NO (1) | NO147723C (enExample) |
| SE (1) | SE420620B (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2424298A1 (fr) * | 1978-04-24 | 1979-11-23 | Solvay | Particules a base de polylactones derivees d'acides polyhydroxycarboxyliques et compositions pulverulentes contenant ces particules |
| JPS5935674B2 (ja) * | 1978-11-02 | 1984-08-30 | 日鉱エンジニアリング株式会社 | 廃触媒の抜き出し処理法 |
| FR2459203A1 (fr) * | 1979-06-21 | 1981-01-09 | Interox | Particules de composes peroxygenes stabilises, procede pour leur fabrication et composition en contenant |
| US4450089A (en) * | 1982-10-21 | 1984-05-22 | Colgate-Palmolive Company | Stabilized bleaching and laundering composition |
| US4455249A (en) * | 1982-10-21 | 1984-06-19 | Colgate-Palmolive Company | Stabilized bleach and laundering composition |
| DE3328882A1 (de) * | 1983-08-10 | 1985-02-28 | Vsesojuznyj naučno-issledovatel'skij biotechničeskij institut, Moskva | Fermenthaltiges reinigungsmittel zur behandlung von medizinischen instrumenten und geraeten vor der sterilisation |
| US4579676A (en) * | 1984-12-17 | 1986-04-01 | Economics Laboratory, Inc. | Low-phosphate liquid cleaning composition |
| JPS6232195A (ja) * | 1985-08-05 | 1987-02-12 | 花王株式会社 | 漂白性向上剤 |
| US4663071A (en) * | 1986-01-30 | 1987-05-05 | The Procter & Gamble Company | Ether carboxylate detergent builders and process for their preparation |
| JPS62253697A (ja) * | 1986-04-02 | 1987-11-05 | 花王株式会社 | 漂白剤組成物 |
| DE3720806C2 (de) * | 1986-07-03 | 1997-08-21 | Clariant Finance Bvi Ltd | Verwendung eines Stabilisators in Peroxydbleichverfahren |
| US4798907A (en) * | 1988-02-26 | 1989-01-17 | The Procter & Gamble Company | Controlled temperature process for making 2,2'-oxodisuccinates useful as laundry detergent builders |
| JPH02282103A (ja) * | 1989-04-12 | 1990-11-19 | Bunkyo So | 立体架倉庫 |
| GB8928320D0 (en) * | 1989-12-14 | 1990-02-21 | Unilever Plc | Polymers and detergent compositions containing them |
| JPH0623912U (ja) * | 1992-07-08 | 1994-03-29 | 芳彦 前島 | 金型保管棚装置 |
| US5302375A (en) * | 1992-11-19 | 1994-04-12 | Colgate-Palmolive Company | Oral composition having improved tooth whitening effect |
| US7824448B2 (en) | 2002-11-22 | 2010-11-02 | Schneider David J | Process for stain removal |
| US7513915B2 (en) * | 2002-11-22 | 2009-04-07 | Schneider Advanced Technologies, Inc. | Process for stain removal |
| KR100966460B1 (ko) * | 2005-12-29 | 2010-06-28 | 엘지디스플레이 주식회사 | 롤 스토커 및 이를 이용한 액정표시장치의 제조방법 |
| WO2015124189A1 (de) * | 2014-02-20 | 2015-08-27 | Henkel Ag & Co. Kgaa | Wasch- oder reinigungsmittel mit verbessertem schaumverhalten unter hoher schmutzbelastung |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1962125B2 (de) * | 1969-12-11 | 1973-11-08 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verwendung von Polyoxypolycar bonsauren als Aufbausalze in Wasch , Bleich und Reinigungsmitteln |
| US3920570A (en) * | 1970-12-17 | 1975-11-18 | Solvay | Sequestration of metal ions by the use of poly-alpha-hydroxyacrylates |
| DE2101508C3 (de) * | 1971-01-14 | 1979-05-17 | Henkel Kgaa, 4000 Duesseldorf | Geschirrspulmittel |
| DE2136672B2 (de) * | 1971-07-22 | 1979-10-18 | Henkel Kgaa, 4000 Duesseldorf | Wasch- und Reinigungsmittel |
| DE2336108A1 (de) * | 1972-07-21 | 1974-01-31 | Interox | Oxydationsmittel mit komplexierenden eigenschaften und diese verbindungen enthaltende waschmittelzusammensetzungen |
| US3776850A (en) * | 1972-07-28 | 1973-12-04 | Ethyl Corp | Detergent formulations |
| US3904685A (en) * | 1973-07-20 | 1975-09-09 | Celanese Corp | Polyacrylic acid having high chelation value and its production |
| LU68060A1 (enExample) * | 1973-07-20 | 1975-04-11 |
-
1974
- 1974-06-25 LU LU70411*A patent/LU70411A1/xx unknown
- 1974-09-23 LU LU70960A patent/LU70960A1/xx unknown
-
1975
- 1975-04-25 ES ES436955A patent/ES436955A1/es not_active Expired
- 1975-04-25 ES ES436922A patent/ES436922A1/es not_active Expired
- 1975-04-28 IT IT22789/75A patent/IT1037675B/it active
- 1975-04-29 CH CH547375A patent/CH599341A5/xx not_active IP Right Cessation
- 1975-05-22 GB GB2226075A patent/GB1470137A/en not_active Expired
- 1975-05-27 IN IN1065/CAL/75A patent/IN144762B/en unknown
- 1975-05-27 DE DE19752523490 patent/DE2523490A1/de active Granted
- 1975-06-05 CA CA228,608A patent/CA1051741A/fr not_active Expired
- 1975-06-09 IE IE1298/75A patent/IE41547B1/en unknown
- 1975-06-11 BR BR4723/75D patent/BR7503682A/pt unknown
- 1975-06-19 US US05/588,136 patent/US4079016A/en not_active Expired - Lifetime
- 1975-06-20 FR FR7519632A patent/FR2276376A1/fr active Granted
- 1975-06-24 AT AT483475A patent/AT343249B/de not_active IP Right Cessation
- 1975-06-24 DK DK285275A patent/DK146479C/da active
- 1975-06-24 NO NO752242A patent/NO147723C/no unknown
- 1975-06-24 SE SE7507254A patent/SE420620B/xx not_active IP Right Cessation
- 1975-06-25 BE BE157645A patent/BE830603A/xx not_active IP Right Cessation
- 1975-06-25 NL NLAANVRAGE7507566,A patent/NL185095C/xx not_active IP Right Cessation
- 1975-06-25 JP JP50077573A patent/JPS5939480B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK146479B (da) | 1983-10-17 |
| NL185095B (nl) | 1989-08-16 |
| LU70960A1 (enExample) | 1976-08-19 |
| ATA483475A (de) | 1977-09-15 |
| SE420620B (sv) | 1981-10-19 |
| GB1470137A (en) | 1977-04-14 |
| DE2523490C2 (enExample) | 1992-07-09 |
| JPS5939480B2 (ja) | 1984-09-22 |
| AU8175875A (en) | 1976-12-09 |
| DE2523490A1 (de) | 1976-01-15 |
| IT1037675B (it) | 1979-11-20 |
| ES436955A1 (es) | 1976-12-16 |
| US4079016A (en) | 1978-03-14 |
| NO147723B (no) | 1983-02-21 |
| FR2276376B1 (enExample) | 1977-07-22 |
| JPS5118707A (en) | 1976-02-14 |
| NO147723C (no) | 1983-06-01 |
| NL185095C (nl) | 1990-01-16 |
| AT343249B (de) | 1978-05-10 |
| NO752242L (enExample) | 1975-12-30 |
| DK285275A (da) | 1975-12-26 |
| CA1051741A (fr) | 1979-04-03 |
| FR2276376A1 (fr) | 1976-01-23 |
| ES436922A1 (es) | 1976-12-16 |
| DK146479C (da) | 1984-03-26 |
| IE41547L (en) | 1975-12-25 |
| CH599341A5 (enExample) | 1978-05-31 |
| LU70411A1 (enExample) | 1976-04-13 |
| BR7503682A (pt) | 1976-07-06 |
| BE830603A (fr) | 1975-12-29 |
| NL7507566A (nl) | 1975-12-30 |
| IN144762B (enExample) | 1978-07-01 |
| SE7507254L (sv) | 1975-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE41547B1 (en) | Solid washing cleaning or bleaching compositions and theirproduction and use | |
| US4079015A (en) | Liquid detergent compositions | |
| US4746456A (en) | Detergents containing graft copolymers of polyalkylene oxides and vinyl acetate as antiredeposition inhibitors | |
| EP0213729B1 (en) | Detergent compositions | |
| JPH11514028A (ja) | 界面活性剤構築液相を含んだ非水性粒子含有液体洗剤組成物の製造 | |
| TW311932B (enExample) | ||
| JPH01185398A (ja) | 洗剤組成物 | |
| MXPA97002315A (en) | Compositions liquid detergents containing non-aqueous bleach | |
| JPH0198697A (ja) | 洗剤組成物 | |
| US4055505A (en) | Activated percompound bleaching compositions | |
| CA1321339C (en) | Liquid cleaning products | |
| AU633849B2 (en) | Liquid cleaning products and method for their preparation | |
| US20010009897A1 (en) | Granular alkali metal phyllosilicate compound | |
| US5496495A (en) | Detergent formulations free of phosphates, zeolites and crystalline layered silicates | |
| US4115309A (en) | Compositions and method for activating oxygen utilizing cyclic ester-anhydrides of α-hydroxycarboxylic acids | |
| EP1305387A1 (en) | Coloured speckle composition and particulate laundry detergent compositions containing it | |
| US4392975A (en) | Activating composition for bleaching with peroxide products | |
| CA1314186C (en) | Liquid cleaning products | |
| US6274664B1 (en) | Dye-transfer-inhibiting compositions and particulate detergent compositions containing them | |
| IE53182B1 (en) | Bleaching activator granules,their preparation and their use in detergent and bleaching compositions | |
| CA1323282C (en) | Liquid cleaning products | |
| CA1090505A (en) | Bleaching compositions | |
| US5002687A (en) | Fabric washing compositions | |
| NZ212082A (en) | Synthetic detergent composition containing polyacetal carboxylate builder and perborate bleach | |
| US3865793A (en) | Polyhydroxy compositions |