DE2439458A1 - Arzneimittel, in diesen enthaltene neue verbindungen und verfahren zu ihrer herstellung - Google Patents
Arzneimittel, in diesen enthaltene neue verbindungen und verfahren zu ihrer herstellungInfo
- Publication number
- DE2439458A1 DE2439458A1 DE2439458A DE2439458A DE2439458A1 DE 2439458 A1 DE2439458 A1 DE 2439458A1 DE 2439458 A DE2439458 A DE 2439458A DE 2439458 A DE2439458 A DE 2439458A DE 2439458 A1 DE2439458 A1 DE 2439458A1
- Authority
- DE
- Germany
- Prior art keywords
- compound
- general formula
- methane
- radical
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 136
- 238000000034 method Methods 0.000 title claims description 44
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- 229940126601 medicinal product Drugs 0.000 title 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 76
- -1 nitro, phenyl Chemical group 0.000 claims description 72
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 43
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 39
- 239000003814 drug Substances 0.000 claims description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 25
- 150000003839 salts Chemical class 0.000 claims description 24
- 239000002253 acid Substances 0.000 claims description 18
- 150000002148 esters Chemical class 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- AQSCHALQLXXKKC-UHFFFAOYSA-N 4-phenylmethoxybenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCC1=CC=CC=C1 AQSCHALQLXXKKC-UHFFFAOYSA-N 0.000 claims description 14
- 150000001408 amides Chemical class 0.000 claims description 14
- UMOKJIWMQFEFJE-UHFFFAOYSA-N ethyl 4-phenylmethoxybenzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=CC=C1 UMOKJIWMQFEFJE-UHFFFAOYSA-N 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 230000007062 hydrolysis Effects 0.000 claims description 13
- 238000006460 hydrolysis reaction Methods 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 9
- 229940079593 drug Drugs 0.000 claims description 9
- 125000004185 ester group Chemical group 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- 125000004434 sulfur atom Chemical group 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 8
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 7
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 7
- 239000013067 intermediate product Substances 0.000 claims description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 6
- 150000004820 halides Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 239000012876 carrier material Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 150000002825 nitriles Chemical class 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000003763 carbonization Methods 0.000 claims description 4
- MOTCFMNUJWFPPX-UHFFFAOYSA-N ethyl 4-[(4-bromophenyl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=C(Br)C=C1 MOTCFMNUJWFPPX-UHFFFAOYSA-N 0.000 claims description 4
- XKXWWCKVFAKGBJ-UHFFFAOYSA-N ethyl 4-[(4-methylphenyl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=C(C)C=C1 XKXWWCKVFAKGBJ-UHFFFAOYSA-N 0.000 claims description 4
- 239000011777 magnesium Substances 0.000 claims description 4
- 229910052749 magnesium Inorganic materials 0.000 claims description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N methyl pentane Natural products CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000003172 aldehyde group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000005529 alkyleneoxy group Chemical group 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- WMGSTGHXGRZWEB-UHFFFAOYSA-N ethyl 4-[(4-fluorophenyl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=C(F)C=C1 WMGSTGHXGRZWEB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000002560 nitrile group Chemical group 0.000 claims description 3
- 239000002243 precursor Substances 0.000 claims description 3
- SJJMMMALTYPIOU-UHFFFAOYSA-N 1-methyl-4-[(4-methylphenyl)methylsulfanyl]benzene Chemical compound C1=CC(C)=CC=C1CSC1=CC=C(C)C=C1 SJJMMMALTYPIOU-UHFFFAOYSA-N 0.000 claims description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 239000011575 calcium Substances 0.000 claims description 2
- 229910052791 calcium Inorganic materials 0.000 claims description 2
- 150000002641 lithium Chemical group 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical group O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims 1
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- SOWBFZRMHSNYGE-UHFFFAOYSA-N Monoamide-Oxalic acid Natural products NC(=O)C(O)=O SOWBFZRMHSNYGE-UHFFFAOYSA-N 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 47
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- 239000000203 mixture Substances 0.000 description 39
- 239000000243 solution Substances 0.000 description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- 210000004369 blood Anatomy 0.000 description 28
- 239000008280 blood Substances 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- 150000003254 radicals Chemical class 0.000 description 24
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 18
- NUVBSKCKDOMJSU-UHFFFAOYSA-N ethylparaben Chemical compound CCOC(=O)C1=CC=C(O)C=C1 NUVBSKCKDOMJSU-UHFFFAOYSA-N 0.000 description 17
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- 238000009833 condensation Methods 0.000 description 11
- 230000005494 condensation Effects 0.000 description 11
- 230000000694 effects Effects 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 210000002966 serum Anatomy 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 235000010228 ethyl p-hydroxybenzoate Nutrition 0.000 description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 8
- 150000002632 lipids Chemical class 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 235000019445 benzyl alcohol Nutrition 0.000 description 6
- 235000005911 diet Nutrition 0.000 description 6
- 230000037213 diet Effects 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- NDVLTYZPCACLMA-UHFFFAOYSA-N silver oxide Chemical compound [O-2].[Ag+].[Ag+] NDVLTYZPCACLMA-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- ICEKEZSKMGHZNT-UHFFFAOYSA-N 4-phenylmethoxybenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1OCC1=CC=CC=C1 ICEKEZSKMGHZNT-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 235000012000 cholesterol Nutrition 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 235000013305 food Nutrition 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- MKYMYZJJFMPDOA-UHFFFAOYSA-N 1-(4-phenylmethoxyphenyl)ethanone Chemical compound C1=CC(C(=O)C)=CC=C1OCC1=CC=CC=C1 MKYMYZJJFMPDOA-UHFFFAOYSA-N 0.000 description 3
- CHBXCQHBCCLICW-UHFFFAOYSA-N 1-methyl-4-phenylmethoxybenzene Chemical compound C1=CC(C)=CC=C1OCC1=CC=CC=C1 CHBXCQHBCCLICW-UHFFFAOYSA-N 0.000 description 3
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 3
- PAKRXFXJKMFKPU-UHFFFAOYSA-N 4-phenylmethoxybenzamide Chemical compound C1=CC(C(=O)N)=CC=C1OCC1=CC=CC=C1 PAKRXFXJKMFKPU-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 3
- 229940073608 benzyl chloride Drugs 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 206010012601 diabetes mellitus Diseases 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 210000004072 lung Anatomy 0.000 description 3
- BOTNYLSAWDQNEX-UHFFFAOYSA-N phenoxymethylbenzene Chemical compound C=1C=CC=CC=1COC1=CC=CC=C1 BOTNYLSAWDQNEX-UHFFFAOYSA-N 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 229910001923 silver oxide Inorganic materials 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 238000001228 spectrum Methods 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- OUQSGILAXUXMGI-UHFFFAOYSA-N 1-bromo-4-phenylmethoxybenzene Chemical compound C1=CC(Br)=CC=C1OCC1=CC=CC=C1 OUQSGILAXUXMGI-UHFFFAOYSA-N 0.000 description 2
- OEBIVOHKFYSBPE-UHFFFAOYSA-N 4-Benzyloxybenzyl alcohol Chemical compound C1=CC(CO)=CC=C1OCC1=CC=CC=C1 OEBIVOHKFYSBPE-UHFFFAOYSA-N 0.000 description 2
- ZVTWZSXLLMNMQC-UHFFFAOYSA-N 4-phenylmethoxybenzaldehyde Chemical compound C1=CC(C=O)=CC=C1OCC1=CC=CC=C1 ZVTWZSXLLMNMQC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- HIMXGTXNXJYFGB-UHFFFAOYSA-N alloxan Chemical compound O=C1NC(=O)C(=O)C(=O)N1 HIMXGTXNXJYFGB-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 238000010945 base-catalyzed hydrolysis reactiony Methods 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 150000001559 benzoic acids Chemical group 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000002274 desiccant Substances 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000003925 fat Substances 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 2
- 230000002218 hypoglycaemic effect Effects 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007530 organic bases Chemical group 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XAJGNXFJOSHAEO-UHFFFAOYSA-N 1,2-dimethyl-4-phenylmethoxybenzene Chemical compound C1=C(C)C(C)=CC=C1OCC1=CC=CC=C1 XAJGNXFJOSHAEO-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HRUAWSQBQLYDKH-UHFFFAOYSA-N 1-(3-methoxy-4-phenylmethoxyphenyl)ethanone Chemical compound COC1=CC(C(C)=O)=CC=C1OCC1=CC=CC=C1 HRUAWSQBQLYDKH-UHFFFAOYSA-N 0.000 description 1
- VCMADTQZCBWKAB-UHFFFAOYSA-N 1-benzylsulfanyl-4-methylbenzene Chemical compound C1=CC(C)=CC=C1SCC1=CC=CC=C1 VCMADTQZCBWKAB-UHFFFAOYSA-N 0.000 description 1
- WQHGXWCYVMOXDT-UHFFFAOYSA-N 1-dodecyl-4-phenylmethoxybenzene Chemical compound C1=CC(CCCCCCCCCCCC)=CC=C1OCC1=CC=CC=C1 WQHGXWCYVMOXDT-UHFFFAOYSA-N 0.000 description 1
- PLPFNFUMBJDJKF-UHFFFAOYSA-N 1-ethyl-4-phenylmethoxybenzene Chemical compound C1=CC(CC)=CC=C1OCC1=CC=CC=C1 PLPFNFUMBJDJKF-UHFFFAOYSA-N 0.000 description 1
- CZGNXONBQOCVJM-UHFFFAOYSA-N 1-fluoro-3-(phenoxymethyl)benzene Chemical compound FC1=CC=CC(COC=2C=CC=CC=2)=C1 CZGNXONBQOCVJM-UHFFFAOYSA-N 0.000 description 1
- ZEBWKHSZNNVJBD-UHFFFAOYSA-N 1-fluoro-4-(phenoxymethyl)benzene Chemical compound C1=CC(F)=CC=C1COC1=CC=CC=C1 ZEBWKHSZNNVJBD-UHFFFAOYSA-N 0.000 description 1
- QEXXENXGXSLHEJ-UHFFFAOYSA-N 1-methyl-4-(phenoxymethyl)benzene Chemical compound C1=CC(C)=CC=C1COC1=CC=CC=C1 QEXXENXGXSLHEJ-UHFFFAOYSA-N 0.000 description 1
- BVDRTEGCZJCYTO-UHFFFAOYSA-N 2,4-dimethyl-1-phenylmethoxybenzene Chemical compound CC1=CC(C)=CC=C1OCC1=CC=CC=C1 BVDRTEGCZJCYTO-UHFFFAOYSA-N 0.000 description 1
- FUJSJWRORKKPAI-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)acetyl chloride Chemical compound ClC(=O)COC1=CC=C(Cl)C=C1Cl FUJSJWRORKKPAI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- UEFBOQYLXLEJSM-UHFFFAOYSA-N 2-bromoethylsulfanylbenzene Chemical compound BrCCSC1=CC=CC=C1 UEFBOQYLXLEJSM-UHFFFAOYSA-N 0.000 description 1
- JYJUKNCPAKLMBY-UHFFFAOYSA-N 2-ethoxyethyl 4-phenylmethoxybenzoate Chemical compound C1=CC(C(=O)OCCOCC)=CC=C1OCC1=CC=CC=C1 JYJUKNCPAKLMBY-UHFFFAOYSA-N 0.000 description 1
- NDSGOBVTOHVLGW-UHFFFAOYSA-N 2-ethylhexanedioyl dichloride Chemical compound CCC(C(Cl)=O)CCCC(Cl)=O NDSGOBVTOHVLGW-UHFFFAOYSA-N 0.000 description 1
- QTUZIPZAPPPERU-UHFFFAOYSA-N 2-methoxy-1-phenylmethoxy-4-propylbenzene Chemical compound COC1=CC(CCC)=CC=C1OCC1=CC=CC=C1 QTUZIPZAPPPERU-UHFFFAOYSA-N 0.000 description 1
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- PBEJTRAJWCNHRS-UHFFFAOYSA-N 2-phenylmethoxybenzaldehyde Chemical compound O=CC1=CC=CC=C1OCC1=CC=CC=C1 PBEJTRAJWCNHRS-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- AGNTUZCMJBTHOG-UHFFFAOYSA-N 3-[3-(2,3-dihydroxypropoxy)-2-hydroxypropoxy]propane-1,2-diol Chemical compound OCC(O)COCC(O)COCC(O)CO AGNTUZCMJBTHOG-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- HVYWMOMLDIMFJA-UHFFFAOYSA-N 3-cholesterol Natural products C1C=C2CC(O)CCC2(C)C2C1C1CCC(C(C)CCCC(C)C)C1(C)CC2 HVYWMOMLDIMFJA-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- IRNKWMSXRZFVAI-UHFFFAOYSA-N 4,5-dihydroxy-1-phenoxy-1-phenylpentan-2-one Chemical compound C=1C=CC=CC=1C(C(=O)CC(O)CO)OC1=CC=CC=C1 IRNKWMSXRZFVAI-UHFFFAOYSA-N 0.000 description 1
- ZCGYVYRMBOFTPZ-UHFFFAOYSA-N 4-[(3,4-dichlorophenyl)methoxy]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCC1=CC=C(Cl)C(Cl)=C1 ZCGYVYRMBOFTPZ-UHFFFAOYSA-N 0.000 description 1
- VZSIKYBBDORAST-UHFFFAOYSA-N 4-[(3,4-dichlorophenyl)methoxy]benzonitrile Chemical compound C1=C(Cl)C(Cl)=CC=C1COC1=CC=C(C#N)C=C1 VZSIKYBBDORAST-UHFFFAOYSA-N 0.000 description 1
- RXXGPRFAVTVMKY-UHFFFAOYSA-N 4-[(4-fluorophenyl)methoxy]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OCC1=CC=C(F)C=C1 RXXGPRFAVTVMKY-UHFFFAOYSA-N 0.000 description 1
- XRYRTHRDVUSSMA-UHFFFAOYSA-N 4-[(4-fluorophenyl)methoxy]benzonitrile Chemical compound C1=CC(F)=CC=C1COC1=CC=C(C#N)C=C1 XRYRTHRDVUSSMA-UHFFFAOYSA-N 0.000 description 1
- XPBQQAHIVODAIC-UHFFFAOYSA-N 4-bromobutylbenzene Chemical compound BrCCCCC1=CC=CC=C1 XPBQQAHIVODAIC-UHFFFAOYSA-N 0.000 description 1
- LDZLXQFDGRCELX-UHFFFAOYSA-N 4-phenylbutan-1-ol Chemical compound OCCCCC1=CC=CC=C1 LDZLXQFDGRCELX-UHFFFAOYSA-N 0.000 description 1
- UDAOJHAASAWVIQ-UHFFFAOYSA-N 4-phenylmethoxybenzonitrile Chemical compound C1=CC(C#N)=CC=C1OCC1=CC=CC=C1 UDAOJHAASAWVIQ-UHFFFAOYSA-N 0.000 description 1
- QOLSAZPSEJXYSH-UHFFFAOYSA-N 6-bromohexoxybenzene Chemical class BrCCCCCCOC1=CC=CC=C1 QOLSAZPSEJXYSH-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical group NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 1
- 101100260565 Dictyostelium discoideum thyA gene Proteins 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 239000004366 Glucose oxidase Substances 0.000 description 1
- 108010015776 Glucose oxidase Proteins 0.000 description 1
- 208000013016 Hypoglycemia Diseases 0.000 description 1
- DKNPRRRKHAEUMW-UHFFFAOYSA-N Iodine aqueous Chemical compound [K+].I[I-]I DKNPRRRKHAEUMW-UHFFFAOYSA-N 0.000 description 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241001461123 Matrona Species 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241001442654 Percnon planissimum Species 0.000 description 1
- 102000003992 Peroxidases Human genes 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 101150052863 THY1 gene Proteins 0.000 description 1
- GOPYZMJAIPBUGX-UHFFFAOYSA-N [O-2].[O-2].[Mn+4] Chemical class [O-2].[O-2].[Mn+4] GOPYZMJAIPBUGX-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 1
- 239000003524 antilipemic agent Substances 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- BPLKDVGMXNZCQO-UHFFFAOYSA-N benzyl 4-phenylmethoxybenzoate Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1C(=O)OCC1=CC=CC=C1 BPLKDVGMXNZCQO-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 235000015895 biscuits Nutrition 0.000 description 1
- ZKLNAXPYJVFVBW-UHFFFAOYSA-N butyl 4-phenylmethoxybenzoate Chemical compound C1=CC(C(=O)OCCCC)=CC=C1OCC1=CC=CC=C1 ZKLNAXPYJVFVBW-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000459 effect on growth Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- SHDUPSKQAIVXIO-UHFFFAOYSA-N ethyl 2-(4-phenacyloxyphenyl)acetate Chemical compound C1=CC(CC(=O)OCC)=CC=C1OCC(=O)C1=CC=CC=C1 SHDUPSKQAIVXIO-UHFFFAOYSA-N 0.000 description 1
- FLPSMYULYVTTGK-UHFFFAOYSA-N ethyl 2-phenoxy-2-phenylacetate Chemical compound C=1C=CC=CC=1C(C(=O)OCC)OC1=CC=CC=C1 FLPSMYULYVTTGK-UHFFFAOYSA-N 0.000 description 1
- HRQFAKGSEPQXDI-UHFFFAOYSA-N ethyl 3-[4-[(2-fluorophenyl)methoxy]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1OCC1=CC=CC=C1F HRQFAKGSEPQXDI-UHFFFAOYSA-N 0.000 description 1
- KBPJIAPCFJIKPP-UHFFFAOYSA-N ethyl 3-[4-[(3-fluorophenyl)methoxy]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1OCC1=CC=CC(F)=C1 KBPJIAPCFJIKPP-UHFFFAOYSA-N 0.000 description 1
- WMNWJILJDYGIOE-UHFFFAOYSA-N ethyl 3-[4-[(4-fluorophenyl)methoxy]phenyl]propanoate Chemical compound C1=CC(CCC(=O)OCC)=CC=C1OCC1=CC=C(F)C=C1 WMNWJILJDYGIOE-UHFFFAOYSA-N 0.000 description 1
- YEGKQBCKUPGCHE-UHFFFAOYSA-N ethyl 4-(2-phenylsulfanylethoxy)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCCSC1=CC=CC=C1 YEGKQBCKUPGCHE-UHFFFAOYSA-N 0.000 description 1
- QUHKYWPZFINGSR-UHFFFAOYSA-N ethyl 4-(phenoxymethyl)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1COC1=CC=CC=C1 QUHKYWPZFINGSR-UHFFFAOYSA-N 0.000 description 1
- HTNICMBZGOLHCB-UHFFFAOYSA-N ethyl 4-[(2,4-dichlorophenyl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=C(Cl)C=C1Cl HTNICMBZGOLHCB-UHFFFAOYSA-N 0.000 description 1
- LHKVNYSJSVWIKT-UHFFFAOYSA-N ethyl 4-[(2-methoxyphenyl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=CC=C1OC LHKVNYSJSVWIKT-UHFFFAOYSA-N 0.000 description 1
- ZYQVESSAMUSQBX-UHFFFAOYSA-N ethyl 4-[(3,4-dimethoxyphenyl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=C(OC)C(OC)=C1 ZYQVESSAMUSQBX-UHFFFAOYSA-N 0.000 description 1
- LZYYQYQGQNECIN-UHFFFAOYSA-N ethyl 4-[(3,4-dimethylphenoxy)methyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1COC1=CC=C(C)C(C)=C1 LZYYQYQGQNECIN-UHFFFAOYSA-N 0.000 description 1
- BNJLFKNCVRGOBQ-UHFFFAOYSA-N ethyl 4-[(3-methoxyphenyl)methoxy]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC1=CC=CC(OC)=C1 BNJLFKNCVRGOBQ-UHFFFAOYSA-N 0.000 description 1
- SZARDIUVTZIBJE-UHFFFAOYSA-N ethyl 4-phenacyloxybenzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1OCC(=O)C1=CC=CC=C1 SZARDIUVTZIBJE-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 239000004403 ethyl p-hydroxybenzoate Substances 0.000 description 1
- 229940043351 ethyl-p-hydroxybenzoate Drugs 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 235000012631 food intake Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 229940116332 glucose oxidase Drugs 0.000 description 1
- 235000019420 glucose oxidase Nutrition 0.000 description 1
- 230000002641 glycemic effect Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-N hydroperoxyl Chemical group O[O] OUUQCZGPVNCOIJ-UHFFFAOYSA-N 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- XAAMAAXKDLWBKO-UHFFFAOYSA-N methyl 3-(4-phenylmethoxyphenyl)propanoate Chemical compound C1=CC(CCC(=O)OC)=CC=C1OCC1=CC=CC=C1 XAAMAAXKDLWBKO-UHFFFAOYSA-N 0.000 description 1
- ZLLQTDQOTFCCDF-UHFFFAOYSA-N methyl 4-phenylmethoxybenzoate Chemical compound C1=CC(C(=O)OC)=CC=C1OCC1=CC=CC=C1 ZLLQTDQOTFCCDF-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- JFIKHFNGAURIIB-UHFFFAOYSA-N n,n-dimethyl-1,1-bis(phenylmethoxy)methanamine Chemical compound C=1C=CC=CC=1COC(N(C)C)OCC1=CC=CC=C1 JFIKHFNGAURIIB-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 108040007629 peroxidase activity proteins Proteins 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- ZYNFGAFJARXKIF-UHFFFAOYSA-N phenyl 4-phenylmethoxybenzoate Chemical compound C=1C=C(OCC=2C=CC=CC=2)C=CC=1C(=O)OC1=CC=CC=C1 ZYNFGAFJARXKIF-UHFFFAOYSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- MOEQJUWOGHCFSH-UHFFFAOYSA-N propan-2-yl 4-phenylmethoxybenzoate Chemical compound C1=CC(C(=O)OC(C)C)=CC=C1OCC1=CC=CC=C1 MOEQJUWOGHCFSH-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002577 pseudohalo group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000000072 sodium resin Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- KLBIUKJOZFWCLW-UHFFFAOYSA-N thallium(iii) nitrate Chemical compound [Tl+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O KLBIUKJOZFWCLW-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- HERSKCAGZCXYMC-UHFFFAOYSA-N thiophen-3-ol Chemical compound OC=1C=CSC=1 HERSKCAGZCXYMC-UHFFFAOYSA-N 0.000 description 1
- 101150068774 thyX gene Proteins 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C321/00—Thiols, sulfides, hydropolysulfides or polysulfides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/205—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring the aromatic ring being a non-condensed ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
- C07C45/298—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups with manganese derivatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/45—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by condensation
- C07C45/46—Friedel-Crafts reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/76—Ketones containing a keto group bound to a six-membered aromatic ring
- C07C49/84—Ketones containing a keto group bound to a six-membered aromatic ring containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/24—Radicals substituted by singly bound oxygen or sulfur atoms esterified
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB39902/73A GB1482195A (en) | 1973-08-23 | 1973-08-23 | Biologically active phenyl(thio)ether derivatives |
| GB4265473 | 1973-09-11 | ||
| GB1391174 | 1974-03-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2439458A1 true DE2439458A1 (de) | 1975-02-27 |
Family
ID=27257058
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2439458A Pending DE2439458A1 (de) | 1973-08-23 | 1974-08-16 | Arzneimittel, in diesen enthaltene neue verbindungen und verfahren zu ihrer herstellung |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3983164A (cg-RX-API-DMAC7.html) |
| AU (1) | AU7261774A (cg-RX-API-DMAC7.html) |
| BG (1) | BG25069A3 (cg-RX-API-DMAC7.html) |
| CH (1) | CH601154A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2439458A1 (cg-RX-API-DMAC7.html) |
| DK (1) | DK449874A (cg-RX-API-DMAC7.html) |
| ES (1) | ES429459A1 (cg-RX-API-DMAC7.html) |
| FI (1) | FI242574A7 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2241296B1 (cg-RX-API-DMAC7.html) |
| IL (1) | IL45396A0 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7411220A (cg-RX-API-DMAC7.html) |
| NO (1) | NO743014L (cg-RX-API-DMAC7.html) |
| RO (1) | RO65769A (cg-RX-API-DMAC7.html) |
| SE (1) | SE7410654L (cg-RX-API-DMAC7.html) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2926644A1 (de) * | 1978-07-03 | 1980-01-24 | Dow Chemical Co | Verwendung von aminobenzoesaeure-derivaten bei der bekaempfung des diabetes und arzneimittel |
| US4683244A (en) * | 1985-01-14 | 1987-07-28 | Henkel Kommanditgesellschaft Auf Aktien | Sebosuppressive cosmetic preparations containing alkoxy or alkylbenzyloxy benzoic acids or their salts |
| US4684665A (en) * | 1985-01-14 | 1987-08-04 | Henkel Kommanditgesellschaft Auf Aktien | Sebosuppressive benzoic acid ester derivatives and cosmetic preparations containing them |
| DE4136900C1 (cg-RX-API-DMAC7.html) * | 1991-11-09 | 1993-07-29 | Schaper & Bruemmer Gmbh & Co Kg, 3320 Salzgitter, De | |
| US5374772A (en) * | 1992-12-08 | 1994-12-20 | Hoffmann-Laroche Inc. | Substituted benzoic acids, inhibitors of phospholipases A2 |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4074057A (en) * | 1973-12-12 | 1978-02-14 | Takeda Chemical Co., Ltd. | 2-Halopropionic acid and its derivatives |
| PT65179B (en) * | 1975-06-09 | 1977-11-18 | Takeda Chemical Industries Ltd | Alpha/chlorocarboxylic acids |
| DE2544513A1 (de) * | 1975-10-04 | 1977-04-14 | Dynamit Nobel Ag | Halogenhaltige aromatische aether-ester, deren herstellung und verwendung als flammschutzmittel fuer kunststoffe |
| GB1551416A (en) * | 1976-08-27 | 1979-08-30 | Beecham Group Ltd | Long chain dioxy hypolipidaemics |
| DE2735856A1 (de) * | 1977-08-09 | 1979-02-22 | Klinge Co Chem Pharm Fab | Neue 1,3-diphenoxypropan-2-on-derivate, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| US4175209A (en) * | 1977-10-19 | 1979-11-20 | American Hoechst Corporation | Preparation of 6,11-dihydro-11-oxodibenz[b,e]-oxepin-2-acetic acid and precursors therefor |
| US4774257A (en) * | 1978-05-20 | 1988-09-27 | Martin Rubin | Treatment of urinary calculi |
| DE2964790D1 (en) * | 1978-06-23 | 1983-03-24 | Dow Chemical Co | Hypoglycemic phenylpropynylamino benzoic acids, their salts, pharmaceutical compositions containing said compounds and their application |
| US4207330A (en) * | 1978-07-03 | 1980-06-10 | The Dow Chemical Company | Method for treating hyperglycemia in mammals using arylamino benzoic acids |
| US4206223A (en) * | 1979-01-05 | 1980-06-03 | The Dow Chemical Company | Method for treating hyperglycemia in mammals using 4-(((1,3-benzodioxol-5-yl)methyl)amino)benzoic acid or derivatives thereof |
| US4263320A (en) * | 1979-06-04 | 1981-04-21 | The Dow Chemical Company | Hypoglycemic phenylpropynylamino benzoic acids |
| US4409227A (en) * | 1979-08-09 | 1983-10-11 | The Dow Chemical Co. | 4-(((Heterocyclo)thio)methyl)benzoic acids, esters and amides and their pharmaceutical use |
| US4325959A (en) * | 1979-08-09 | 1982-04-20 | The Dow Chemical Company | Hypoglycemic 4-(((1,3,4, thiadiazolyl)thio)methyl)benzoic acids, ester and amides |
| DE3169094D1 (en) * | 1980-11-20 | 1985-03-28 | Beecham Group Plc | Secondary amines |
| DE3169761D1 (en) * | 1981-01-09 | 1985-05-09 | Fisons Plc | Phenoxy- and thiophenoxy compounds, methods for their preparation and pharmaceutical formulations containing them |
| US4443473A (en) * | 1981-06-30 | 1984-04-17 | The Procter & Gamble Company | Carbamate derivatives |
| DE3461796D1 (en) * | 1983-02-23 | 1987-02-05 | Bayer Ag | Agent for regulating the growth of plants |
| FR2550785B1 (fr) * | 1983-08-18 | 1985-12-06 | Sanofi Sa | Nouvelles compositions a activite antimicrobienne contenant des derives de l'acide benzoique, leur procede de preparation, leur utilisation en tant que medicaments desinfectants ou conservateurs |
| US5041653A (en) * | 1985-05-03 | 1991-08-20 | Sri International | Substituted benzamide radiosensitizers |
| US5032617A (en) * | 1985-05-03 | 1991-07-16 | Sri International | Substituted benzamide radiosensitizers |
| WO1986006628A1 (en) * | 1985-05-03 | 1986-11-20 | Sri International | Benzamide and nicotinamide radiosensitizers |
| CA2133115A1 (en) * | 1993-10-01 | 1995-04-02 | Yozo Hori | Carboxylate derivatives exhibiting phospholipase a2 inhibitory activity |
| US6677473B1 (en) | 1999-11-19 | 2004-01-13 | Corvas International Inc | Plasminogen activator inhibitor antagonists |
| US6638977B1 (en) | 1999-11-19 | 2003-10-28 | Corvas International, Inc. | Plasminogen activator inhibitor antagonists |
| HU230352B1 (hu) * | 2001-06-12 | 2016-02-29 | Wellstat Therapeutics Corporation | Metabolikus rendellenességek kezelésére adható vegyületek és ezeket tartalmazó gyógyászati készítmények |
| CA2796077A1 (en) * | 2010-04-15 | 2011-10-20 | Chromocell Corporation | Compounds, compositions, and methods for reducing or eliminating bitter taste |
| US11096909B2 (en) | 2016-04-06 | 2021-08-24 | University Of Oulu | Compounds for use in the treatment of cancer |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL284977A (cg-RX-API-DMAC7.html) * | 1961-11-01 |
-
1974
- 1974-08-02 IL IL45396A patent/IL45396A0/xx unknown
- 1974-08-05 US US05/495,119 patent/US3983164A/en not_active Expired - Lifetime
- 1974-08-15 FI FI2425/74A patent/FI242574A7/fi unknown
- 1974-08-16 DE DE2439458A patent/DE2439458A1/de active Pending
- 1974-08-20 RO RO197479843A patent/RO65769A/ro unknown
- 1974-08-20 FR FR7428529A patent/FR2241296B1/fr not_active Expired
- 1974-08-21 CH CH1141374A patent/CH601154A5/xx not_active IP Right Cessation
- 1974-08-21 SE SE7410654A patent/SE7410654L/xx unknown
- 1974-08-22 NL NL7411220A patent/NL7411220A/xx not_active Application Discontinuation
- 1974-08-22 NO NO743014A patent/NO743014L/no unknown
- 1974-08-22 AU AU72617/74A patent/AU7261774A/en not_active Expired
- 1974-08-22 DK DK449874A patent/DK449874A/da unknown
- 1974-08-22 ES ES429459A patent/ES429459A1/es not_active Expired
- 1974-08-22 BG BG027545A patent/BG25069A3/xx unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2926644A1 (de) * | 1978-07-03 | 1980-01-24 | Dow Chemical Co | Verwendung von aminobenzoesaeure-derivaten bei der bekaempfung des diabetes und arzneimittel |
| US4683244A (en) * | 1985-01-14 | 1987-07-28 | Henkel Kommanditgesellschaft Auf Aktien | Sebosuppressive cosmetic preparations containing alkoxy or alkylbenzyloxy benzoic acids or their salts |
| US4684665A (en) * | 1985-01-14 | 1987-08-04 | Henkel Kommanditgesellschaft Auf Aktien | Sebosuppressive benzoic acid ester derivatives and cosmetic preparations containing them |
| DE4136900C1 (cg-RX-API-DMAC7.html) * | 1991-11-09 | 1993-07-29 | Schaper & Bruemmer Gmbh & Co Kg, 3320 Salzgitter, De | |
| US5374772A (en) * | 1992-12-08 | 1994-12-20 | Hoffmann-Laroche Inc. | Substituted benzoic acids, inhibitors of phospholipases A2 |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2241296A1 (cg-RX-API-DMAC7.html) | 1975-03-21 |
| DK449874A (cg-RX-API-DMAC7.html) | 1975-04-28 |
| IL45396A0 (en) | 1974-11-29 |
| BG25069A3 (bg) | 1978-07-12 |
| CH601154A5 (cg-RX-API-DMAC7.html) | 1978-06-30 |
| FR2241296B1 (cg-RX-API-DMAC7.html) | 1979-04-20 |
| ES429459A1 (es) | 1977-04-16 |
| RO65769A (fr) | 1982-10-26 |
| NL7411220A (nl) | 1975-02-25 |
| FI242574A7 (cg-RX-API-DMAC7.html) | 1975-02-24 |
| NO743014L (cg-RX-API-DMAC7.html) | 1975-03-24 |
| AU7261774A (en) | 1976-02-26 |
| SE7410654L (cg-RX-API-DMAC7.html) | 1975-02-24 |
| US3983164A (en) | 1976-09-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2439458A1 (de) | Arzneimittel, in diesen enthaltene neue verbindungen und verfahren zu ihrer herstellung | |
| EP0054168A1 (de) | 1,1,2-Triphenyl-but-1-en-Derivate sowie Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel | |
| DE2414680C2 (de) | Substituierte 2-Furancarbonsäuren und 2-Furancarbonsäureester, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen enthalten | |
| DE3931954A1 (de) | Substituierte n-(2-piperidylmethyl)benzamide und diese enthaltende antiarrhythmische mittel | |
| DE2527937A1 (de) | Benzcycloamidderivate und verfahren zu ihrer herstellung sowie pharmazeutische mittel, worin sie enthalten sind | |
| DE2528147A1 (de) | Aromatische ketone, verfahren zu ihrer herstellung und diese ketone enthaltende arzneimittel | |
| EP0046961B1 (de) | Epoxi-cycloalkylalkancarbonsäuren, Verfahren zu ihrer Herstellung, ihre Verwendung sowie sie enthaltende Arzneimittel | |
| DE2814321A1 (de) | Interphenylen-8-aza-9-dioxothia- 11,12-secoprostaglandine | |
| DE2716189A1 (de) | Phenoxypropionsaeurederivate, verfahren zu ihrer herstellung und ihre verwendung als oder in therapeutischen und herbiciden mitteln | |
| DE2735394A1 (de) | Phenylalkylcarbonsaeure-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2501834C2 (de) | Neue Appetitzügler | |
| DE2723051C3 (de) | NKAcyO-p-amino-NMn-decyl- und n-tridecyl)-benzamide sowie diese enthaltende Arzneimittel | |
| EP0054872B1 (de) | 3,4-Bis-substituierte 1,2,5-Oxadiazol-2-oxide, Verfahren zu ihrer Herstellung, und sie enthaltende pharmazeutische Zubereitungen | |
| DE2157272C3 (de) | Verwendung von bis-(p-Chlorphenoxy)acetylharnstoff | |
| DE2449205C2 (de) | Substituierte Furylverbindungen, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1493972A1 (de) | Carbonsaeurederivate und Verfahren zu deren Herstellung | |
| DE1493912A1 (de) | Naphthylessigsaeuren und Verfahren zu deren Herstellung | |
| DE2501122B2 (de) | Amidoximderivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE3235850A1 (de) | Neue indolessigsaeureesterderivate und verfahren zur herstellung derselben | |
| DD150060A5 (de) | Verfahren zur herstellung von neuen phenthiazin-derivaten | |
| DE3718765C2 (cg-RX-API-DMAC7.html) | ||
| DE2412388A1 (de) | Dibenzothiophenderivate, verfahren zu deren herstellung und sie enthaltende arzneimittel | |
| DD142875A5 (de) | Verfahren zur herstellung von 2-aminoaethanolderivaten | |
| CH647750A5 (de) | Zweiringige aromatische insektizide. | |
| DE2214561A1 (de) | 2-Substituierte Propionsäuren, Derivate derselben und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |