DE2436261B2 - Elektrochemische gasdetektoren - Google Patents
Elektrochemische gasdetektorenInfo
- Publication number
- DE2436261B2 DE2436261B2 DE19742436261 DE2436261A DE2436261B2 DE 2436261 B2 DE2436261 B2 DE 2436261B2 DE 19742436261 DE19742436261 DE 19742436261 DE 2436261 A DE2436261 A DE 2436261A DE 2436261 B2 DE2436261 B2 DE 2436261B2
- Authority
- DE
- Germany
- Prior art keywords
- electrolyte
- gas detector
- electrochemical gas
- measuring
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000007789 gas Substances 0.000 claims description 69
- 239000002904 solvent Substances 0.000 claims description 41
- 239000003792 electrolyte Substances 0.000 claims description 34
- 239000011245 gel electrolyte Substances 0.000 claims description 33
- 229920000642 polymer Polymers 0.000 claims description 25
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 24
- 229920002239 polyacrylonitrile Polymers 0.000 claims description 16
- RUOJZAUFBMNUDX-UHFFFAOYSA-N propylene carbonate Chemical compound CC1COC(=O)O1 RUOJZAUFBMNUDX-UHFFFAOYSA-N 0.000 claims description 16
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 14
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 14
- 150000002500 ions Chemical class 0.000 claims description 13
- 239000002000 Electrolyte additive Substances 0.000 claims description 12
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 12
- 239000000126 substance Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 239000007787 solid Substances 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 229910052709 silver Inorganic materials 0.000 claims description 9
- 239000004332 silver Substances 0.000 claims description 9
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 8
- LZCLXQDLBQLTDK-UHFFFAOYSA-N ethyl 2-hydroxypropanoate Chemical compound CCOC(=O)C(C)O LZCLXQDLBQLTDK-UHFFFAOYSA-N 0.000 claims description 8
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 claims description 8
- 229920002521 macromolecule Polymers 0.000 claims description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 8
- 239000003960 organic solvent Substances 0.000 claims description 6
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 229910000037 hydrogen sulfide Inorganic materials 0.000 claims description 5
- RUTXIHLAWFEWGM-UHFFFAOYSA-H iron(3+) sulfate Chemical compound [Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUTXIHLAWFEWGM-UHFFFAOYSA-H 0.000 claims description 5
- 229910000360 iron(III) sulfate Inorganic materials 0.000 claims description 5
- -1 y-bulyrolactone Chemical compound 0.000 claims description 5
- PAPBSGBWRJIAAV-UHFFFAOYSA-N ε-Caprolactone Chemical compound O=C1CCCCCO1 PAPBSGBWRJIAAV-UHFFFAOYSA-N 0.000 claims description 5
- ZZXUZKXVROWEIF-UHFFFAOYSA-N 1,2-butylene carbonate Chemical compound CCC1COC(=O)O1 ZZXUZKXVROWEIF-UHFFFAOYSA-N 0.000 claims description 4
- GDKSTFXHMBGCPG-UHFFFAOYSA-N 4,4-dimethyl-1,3-dioxane Chemical compound CC1(C)CCOCO1 GDKSTFXHMBGCPG-UHFFFAOYSA-N 0.000 claims description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 4
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 claims description 4
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 claims description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 claims description 4
- 239000004800 polyvinyl chloride Substances 0.000 claims description 4
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 4
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 claims description 4
- 239000004299 sodium benzoate Substances 0.000 claims description 4
- 235000010234 sodium benzoate Nutrition 0.000 claims description 4
- 239000005711 Benzoic acid Substances 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- YYLLIJHXUHJATK-UHFFFAOYSA-N Cyclohexyl acetate Chemical compound CC(=O)OC1CCCCC1 YYLLIJHXUHJATK-UHFFFAOYSA-N 0.000 claims description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 3
- 230000009471 action Effects 0.000 claims description 3
- 235000010233 benzoic acid Nutrition 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- GZFRSYFOWVTEHV-UHFFFAOYSA-N dimethylazanium;phosphate Chemical compound C[NH2+]C.C[NH2+]C.C[NH2+]C.[O-]P([O-])([O-])=O GZFRSYFOWVTEHV-UHFFFAOYSA-N 0.000 claims description 3
- 230000002401 inhibitory effect Effects 0.000 claims description 3
- IMXBRVLCKXGWSS-UHFFFAOYSA-N methyl 2-cyclohexylacetate Chemical compound COC(=O)CC1CCCCC1 IMXBRVLCKXGWSS-UHFFFAOYSA-N 0.000 claims description 3
- 239000005486 organic electrolyte Substances 0.000 claims description 3
- 229910052697 platinum Inorganic materials 0.000 claims description 3
- YPNVIBVEFVRZPJ-UHFFFAOYSA-L silver sulfate Chemical compound [Ag+].[Ag+].[O-]S([O-])(=O)=O YPNVIBVEFVRZPJ-UHFFFAOYSA-L 0.000 claims description 3
- 229910000367 silver sulfate Inorganic materials 0.000 claims description 3
- 229910052726 zirconium Inorganic materials 0.000 claims description 3
- JTXMVXSTHSMVQF-UHFFFAOYSA-N 2-acetyloxyethyl acetate Chemical compound CC(=O)OCCOC(C)=O JTXMVXSTHSMVQF-UHFFFAOYSA-N 0.000 claims description 2
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 claims description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 229920001577 copolymer Polymers 0.000 claims description 2
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 claims description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052737 gold Inorganic materials 0.000 claims description 2
- 239000010931 gold Substances 0.000 claims description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000000178 monomer Substances 0.000 claims description 2
- 125000002270 phosphoric acid ester group Chemical group 0.000 claims description 2
- 229920001059 synthetic polymer Polymers 0.000 claims description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 claims 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 claims 2
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 claims 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 claims 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 claims 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000000499 gel Substances 0.000 description 25
- 239000000084 colloidal system Substances 0.000 description 14
- 238000005259 measurement Methods 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 9
- 238000009792 diffusion process Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 238000010276 construction Methods 0.000 description 5
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 230000008859 change Effects 0.000 description 4
- 238000010494 dissociation reaction Methods 0.000 description 4
- 230000005593 dissociations Effects 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000011159 matrix material Substances 0.000 description 4
- 230000028161 membrane depolarization Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 238000013461 design Methods 0.000 description 3
- 239000007791 liquid phase Substances 0.000 description 3
- 230000010287 polarization Effects 0.000 description 3
- 239000007784 solid electrolyte Substances 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- UFMZWBIQTDUYBN-UHFFFAOYSA-N cobalt dinitrate Chemical compound [Co+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O UFMZWBIQTDUYBN-UHFFFAOYSA-N 0.000 description 2
- 230000001427 coherent effect Effects 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- RLJMLMKIBZAXJO-UHFFFAOYSA-N lead(II) nitrate Inorganic materials [O-][N+](=O)O[Pb]O[N+]([O-])=O RLJMLMKIBZAXJO-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 238000012544 monitoring process Methods 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000012453 solvate Substances 0.000 description 2
- 238000007614 solvation Methods 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 101710188106 SEC14-like protein 2 Proteins 0.000 description 1
- JGNPSJMNGPUQIW-UHFFFAOYSA-N [C].CC=C Chemical compound [C].CC=C JGNPSJMNGPUQIW-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- 238000002848 electrochemical method Methods 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 229940116333 ethyl lactate Drugs 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 238000009434 installation Methods 0.000 description 1
- 230000037427 ion transport Effects 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000008439 repair process Effects 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 238000004454 trace mineral analysis Methods 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- G—PHYSICS
- G01—MEASURING; TESTING
- G01N—INVESTIGATING OR ANALYSING MATERIALS BY DETERMINING THEIR CHEMICAL OR PHYSICAL PROPERTIES
- G01N27/00—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means
- G01N27/26—Investigating or analysing materials by the use of electric, electrochemical, or magnetic means by investigating electrochemical variables; by using electrolysis or electrophoresis
- G01N27/403—Cells and electrode assemblies
- G01N27/404—Cells with anode, cathode and cell electrolyte on the same side of a permeable membrane which separates them from the sample fluid, e.g. Clark-type oxygen sensors
- G01N27/4045—Cells with anode, cathode and cell electrolyte on the same side of a permeable membrane which separates them from the sample fluid, e.g. Clark-type oxygen sensors for gases other than oxygen
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Physics & Mathematics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Molecular Biology (AREA)
- Analytical Chemistry (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- General Physics & Mathematics (AREA)
- Immunology (AREA)
- Pathology (AREA)
- Measuring Oxygen Concentration In Cells (AREA)
- Investigating Or Analyzing Materials By The Use Of Fluid Adsorption Or Reactions (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742436261 DE2436261B2 (de) | 1974-07-27 | 1974-07-27 | Elektrochemische gasdetektoren |
| GB30598/75A GB1509582A (en) | 1974-07-27 | 1975-07-22 | Electrochemical gas detectors |
| SE7508441A SE424471B (sv) | 1974-07-27 | 1975-07-24 | Elektrokemisk gasdetektor |
| US05/598,601 US4049503A (en) | 1974-07-27 | 1975-07-24 | Electrochemical gas detection |
| BE158557A BE831673A (fr) | 1974-07-27 | 1975-07-24 | Analyseur electrochimique de gaz |
| NLAANVRAGE7508920,A NL179091C (nl) | 1974-07-27 | 1975-07-25 | Elektrochemische gasdetector. |
| JP9034075A JPS555052B2 (enExample) | 1974-07-27 | 1975-07-25 | |
| DK340275A DK340275A (da) | 1974-07-27 | 1975-07-25 | Elektrokemiske gasdetektorer |
| LU73068A LU73068A1 (enExample) | 1974-07-27 | 1975-07-25 | |
| CA232,221A CA1071304A (en) | 1974-07-27 | 1975-07-25 | Electrochemical gas detectors |
| IT25804/75A IT1040137B (it) | 1974-07-27 | 1975-07-25 | Rivelatori di gas elettrochimici |
| FR7523368A FR2280078A1 (fr) | 1974-07-27 | 1975-07-25 | Analyseur electrochimique de gaz |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742436261 DE2436261B2 (de) | 1974-07-27 | 1974-07-27 | Elektrochemische gasdetektoren |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2436261A1 DE2436261A1 (de) | 1976-02-12 |
| DE2436261B2 true DE2436261B2 (de) | 1976-11-25 |
Family
ID=5921708
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742436261 Granted DE2436261B2 (de) | 1974-07-27 | 1974-07-27 | Elektrochemische gasdetektoren |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4049503A (enExample) |
| JP (1) | JPS555052B2 (enExample) |
| BE (1) | BE831673A (enExample) |
| CA (1) | CA1071304A (enExample) |
| DE (1) | DE2436261B2 (enExample) |
| DK (1) | DK340275A (enExample) |
| FR (1) | FR2280078A1 (enExample) |
| GB (1) | GB1509582A (enExample) |
| IT (1) | IT1040137B (enExample) |
| LU (1) | LU73068A1 (enExample) |
| NL (1) | NL179091C (enExample) |
| SE (1) | SE424471B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2808165A1 (de) * | 1977-02-28 | 1978-08-31 | Gen Electric | Spannungsstabilisiert betriebener festpolymerelektrolyt-gasmessfuehler mit drei elektroden und mit hoechst temperaturunabhaengigen grundstromeigenschaften bei null-luft betrieb |
| DE2808339A1 (de) * | 1977-02-28 | 1978-09-07 | Ici Ltd | Elektrochemische vorrichtung zum aufspueren und/oder ueberwachen einer komponente in einem fluid |
| DE2951650A1 (de) * | 1978-12-26 | 1980-07-03 | Catalyst Research Corp | Elektrochemische zelle zum nachweis von chlorgas |
Families Citing this family (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2621676C3 (de) * | 1976-05-15 | 1979-01-11 | Bayer Ag, 5090 Leverkusen | Elektrochemischer Gasdetektor zum Nachweis von Gasspuren |
| DE2627487A1 (de) * | 1976-06-18 | 1977-12-29 | Bayer Ag | Elektrochemischer nachweis von phosgen in gasgemischen |
| DE2657570C3 (de) * | 1976-12-18 | 1980-11-20 | Bayer Ag, 5090 Leverkusen | Elektrochemische Zelle zum Nachweis von Schwefelwasserstoff in einem Gasgemisch |
| DE2715285C2 (de) * | 1977-04-05 | 1983-08-25 | Vjačeslav Michajlovič Puškino Moskovskaja oblast' Krylov | Elektrochemische Zelle zum Bestimmen von Wasserstoff und wasserstoffhaltigen Reduktionsmitteln |
| DE2832328C2 (de) * | 1977-07-27 | 1986-08-07 | Coal Industry (Patents) Ltd., London | Gassensor mit elektrochemischer Zelle |
| DE2733781A1 (de) | 1977-07-27 | 1979-02-15 | Hartmann & Braun Ag | Elektrochemische messzellen |
| US4123700A (en) * | 1977-11-14 | 1978-10-31 | General Electric Company | Potentiostated, self-humidifying, solid polymer electrolyte carbon monoxide dosimeter |
| US4169779A (en) * | 1978-12-26 | 1979-10-02 | Catalyst Research Corporation | Electrochemical cell for the detection of hydrogen sulfide |
| US4326200A (en) * | 1979-05-18 | 1982-04-20 | Neotronics Limited | Gas detecting and measuring apparatus |
| JPS5670928U (enExample) * | 1979-11-06 | 1981-06-11 | ||
| JPS56112641A (en) * | 1980-02-12 | 1981-09-05 | Mitsubishi Chem Ind Ltd | Electrolytic solution for coulometric titration by karl fischer method |
| DE3033796A1 (de) * | 1980-09-09 | 1982-04-22 | Bayer Ag, 5090 Leverkusen | Elektrochemischer sensor zum nachweis reduzierender gase, insbesondere von kohlenmonoxid, hydrazin und wasserstoff in luft |
| US4473456A (en) * | 1981-04-08 | 1984-09-25 | National Research Development Corporation | Conductimetric gas sensor |
| JPS57187647A (en) * | 1981-05-15 | 1982-11-18 | Hitachi Ltd | Combustion detector |
| DE3129680A1 (de) * | 1981-07-28 | 1983-02-17 | Bayer Ag, 5090 Leverkusen | Messeinrichtung zur analytischen bestimmung eines gaspartialdruckes |
| EP0096117B1 (en) * | 1982-06-07 | 1987-09-02 | The Dow Chemical Company | Analyzer for chemical oxidizing or reducing agents |
| US4460448A (en) * | 1982-09-30 | 1984-07-17 | The Dow Chemical Company | Calibration unit for gases |
| JPS59107980A (ja) * | 1982-12-07 | 1984-06-22 | イビデン株式会社 | 薄板状セラミツクス焼結体の製造方法 |
| US4469562A (en) * | 1982-12-29 | 1984-09-04 | Chang Kuo Wei | Carbon dioxide sensor |
| CH661128A5 (de) * | 1983-09-07 | 1987-06-30 | Proton Ag | Messsonde zu potentiometrischer messung von ionenkonzentrationen, verfahren zu deren herstellung und ihre verwendung. |
| US4525266A (en) * | 1983-10-13 | 1985-06-25 | Allied Corporation | Electrochemical gas sensor |
| US4522690A (en) * | 1983-12-01 | 1985-06-11 | Honeywell Inc. | Electrochemical sensing of carbon monoxide |
| US4595486A (en) * | 1985-02-01 | 1986-06-17 | Allied Corporation | Electrochemical gas sensor |
| DE3609402A1 (de) * | 1986-03-20 | 1987-09-24 | Bayer Diagnostic & Electronic | Verfahren zur herstellung elektrochemischer gassensoren |
| JP2511880B2 (ja) * | 1986-06-03 | 1996-07-03 | 松下電器産業株式会社 | 冷媒加熱器 |
| DE3715260C3 (de) * | 1987-05-08 | 1994-07-07 | Licentia Gmbh | Vorrichtung zum Nachweisen und zur quantitativen Bestimmung von Stickstoffdioxid in einem Gasgemisch |
| GB2205653A (en) * | 1987-05-15 | 1988-12-14 | Nat Res Dev | Electrochemical sensor with solid phase electrolyte |
| US4812221A (en) * | 1987-07-15 | 1989-03-14 | Sri International | Fast response time microsensors for gaseous and vaporous species |
| JPH0170011U (enExample) * | 1987-10-28 | 1989-05-10 | ||
| GB8927377D0 (en) * | 1989-12-04 | 1990-01-31 | Univ Edinburgh | Improvements in and relating to amperometric assays |
| DE4128494A1 (de) * | 1991-08-28 | 1993-03-04 | Bayer Ag | Elektrochemischer sensor |
| GB9218376D0 (en) * | 1992-08-28 | 1992-10-14 | Cranfield Inst Of Tech | Media for biocatalytic electrochemical reactions in the gaseous phase |
| DE19708038C2 (de) * | 1997-02-28 | 2000-03-09 | Draegerwerk Ag | Elektrochemische Meßzelle zum Nachweis von Phosgen |
| US6248224B1 (en) * | 1999-05-12 | 2001-06-19 | Mst Analytics Inc. | Toxic sensor and method of manufacture |
| WO2004025665A1 (en) * | 2002-09-16 | 2004-03-25 | Aerocrine Ab | Sensor holder |
| GB2404738B (en) * | 2003-08-04 | 2005-09-28 | Schlumberger Holdings | System and method for sensing using diamond based microelectrodes |
| US7678253B2 (en) * | 2003-08-11 | 2010-03-16 | Mehrooz Zamanzadeh | Atmospheric corrosion sensor |
| US7407998B2 (en) * | 2004-09-28 | 2008-08-05 | Arkema France | Stabilized UV transparent acrylic composition |
| US20060074161A1 (en) * | 2004-09-28 | 2006-04-06 | Shi-Jun Yang | Stabilized UV transparent acrylic composition |
| EP2167934A4 (en) * | 2007-03-08 | 2014-01-22 | Fsp Instr Llc | GAS ANALYZER |
| US20120276648A1 (en) * | 2011-04-29 | 2012-11-01 | Schlumberger Technology Corporation | Electrostatically stabilized metal sulfide nanoparticles for colorimetric measurement of hydrogen sulfide |
| JP6622955B2 (ja) * | 2014-10-09 | 2019-12-18 | 株式会社パイロットコーポレーション | ガスセンサ用ゲル状組成物 |
| JP2016148589A (ja) * | 2015-02-12 | 2016-08-18 | セイコーエプソン株式会社 | センサー用ゲルおよびセンサー |
| EP3735583A4 (en) | 2018-01-22 | 2021-10-27 | Insyte Systems, Inc. | LOW IMPEDANCE SENSOR FOR LOW DENSITY MATERIALS |
| WO2023042887A1 (ja) | 2021-09-15 | 2023-03-23 | 国立大学法人 琉球大学 | 認知機能低下、または過体重もしくは肥満症を処置することに用いるための医薬組成物 |
| US20250281474A1 (en) | 2021-09-15 | 2025-09-11 | University Of The Ryukyus | Pharmaceutical composition for treating cognitive decline or for treating overweightness or obesity |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3160577A (en) * | 1961-03-24 | 1964-12-08 | Bendix Corp | Sensing unit |
| US3272725A (en) * | 1963-05-08 | 1966-09-13 | Pan American Petroleum Corp | Method of electrolytically testing oxygen concentration |
| US3258415A (en) * | 1964-05-11 | 1966-06-28 | Union Carbide Corp | Oxygen analyzer and oxygen-depolarized cell therefor |
| US3857760A (en) * | 1968-07-08 | 1974-12-31 | Bayer Ag | Process of measuring the concentration of a dissociatable component in a gas and apparatus therefor |
| US3912614A (en) * | 1972-01-10 | 1975-10-14 | Int Biophysics Corp | Sensor |
| US3785948A (en) * | 1972-02-14 | 1974-01-15 | Dudley Wright H | Electrochemical oxygen detector |
-
1974
- 1974-07-27 DE DE19742436261 patent/DE2436261B2/de active Granted
-
1975
- 1975-07-22 GB GB30598/75A patent/GB1509582A/en not_active Expired
- 1975-07-24 US US05/598,601 patent/US4049503A/en not_active Expired - Lifetime
- 1975-07-24 SE SE7508441A patent/SE424471B/xx not_active IP Right Cessation
- 1975-07-24 BE BE158557A patent/BE831673A/xx not_active IP Right Cessation
- 1975-07-25 DK DK340275A patent/DK340275A/da unknown
- 1975-07-25 NL NLAANVRAGE7508920,A patent/NL179091C/xx not_active IP Right Cessation
- 1975-07-25 LU LU73068A patent/LU73068A1/xx unknown
- 1975-07-25 IT IT25804/75A patent/IT1040137B/it active
- 1975-07-25 FR FR7523368A patent/FR2280078A1/fr active Granted
- 1975-07-25 CA CA232,221A patent/CA1071304A/en not_active Expired
- 1975-07-25 JP JP9034075A patent/JPS555052B2/ja not_active Expired
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2808165A1 (de) * | 1977-02-28 | 1978-08-31 | Gen Electric | Spannungsstabilisiert betriebener festpolymerelektrolyt-gasmessfuehler mit drei elektroden und mit hoechst temperaturunabhaengigen grundstromeigenschaften bei null-luft betrieb |
| DE2808339A1 (de) * | 1977-02-28 | 1978-09-07 | Ici Ltd | Elektrochemische vorrichtung zum aufspueren und/oder ueberwachen einer komponente in einem fluid |
| DE2951650A1 (de) * | 1978-12-26 | 1980-07-03 | Catalyst Research Corp | Elektrochemische zelle zum nachweis von chlorgas |
Also Published As
| Publication number | Publication date |
|---|---|
| NL179091C (nl) | 1986-07-01 |
| GB1509582A (en) | 1978-05-04 |
| LU73068A1 (enExample) | 1976-07-01 |
| BE831673A (fr) | 1976-01-26 |
| IT1040137B (it) | 1979-12-20 |
| JPS5137287A (enExample) | 1976-03-29 |
| US4049503A (en) | 1977-09-20 |
| CA1071304A (en) | 1980-02-05 |
| SE424471B (sv) | 1982-07-19 |
| JPS555052B2 (enExample) | 1980-02-04 |
| FR2280078B1 (enExample) | 1981-08-07 |
| SE7508441L (sv) | 1976-01-28 |
| DK340275A (da) | 1976-01-28 |
| DE2436261A1 (de) | 1976-02-12 |
| FR2280078A1 (fr) | 1976-02-20 |
| NL7508920A (nl) | 1976-01-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2436261B2 (de) | Elektrochemische gasdetektoren | |
| DE3841622C2 (enExample) | ||
| DE3405431C2 (enExample) | ||
| DE69624885T2 (de) | Fühler für Kohlenstoffmonoxyd und toxische Gase mit Feuchtigkeitskompensation mit Hilfe von protonenleitenden Membranen und dessen Herstellungsverfahren | |
| DE69429892T2 (de) | Festkörper-Ionen-Sensor | |
| DE2951650C2 (de) | Elektrochemische Zelle zum Nachweis von Chlorgas | |
| EP0069285A1 (de) | Verfahren und Vorrichtung zur quantitativen Bestimmung von Kationen oder Anionen durch Ionenchromatographie | |
| EP0047898A2 (de) | Elektrochemischer Sensor zum Nachweis reduzierender Gase insbesondere von Kohlenmonoxid, Hydrazin und Wasserstoff in Luft | |
| WO2022236354A1 (de) | Verfahren zur herstellung eines sensors sowie sensor | |
| DE19780491B4 (de) | CO-Gassensor und Verfahren zur Messung der Konzentration von CO-Gas | |
| CH679526A5 (enExample) | ||
| DE102013007872A1 (de) | Elektrochemischer Gassensor, Verfahren zu dessen Herstellung und dessen Verwendung | |
| CH635200A5 (de) | Verfahren zur einstellung des ph-wertes eines probenstromes in einem potentiometrischen system zur messung niedriger ionenaktivitaeten. | |
| DE2215378C3 (de) | Ionenselektive Meßelektrode | |
| EP1377818B1 (de) | Verfahren und vorrichtung zur erfassung der konzentration einer sauerstoffhaltigen verbindung in einem messgas | |
| DE2652703A1 (de) | Elektrode zur messung der nitrationenkonzentration | |
| EP1480038B1 (de) | Potentiometrische, ionenselektive Elektrode | |
| DE2926172A1 (de) | Verfahren zur messung von aktivitaeten mit festen ionenleitern | |
| DE1598896B1 (de) | Elektrochemische elektrodenanordnung | |
| DE3841623C2 (enExample) | ||
| DE1598196A1 (de) | Elektrochemische Apparatur | |
| DE1170677B (de) | Normalbezugselektrode zur pH-Messung | |
| DE60122930T2 (de) | Verfahren zur messung der konzentration von verunreinigungen in stickstoff, wasserstoff und sauerstoff mittels eines ionenmobilitäts-spektrometers | |
| DE102013014994A1 (de) | Elektrochemischer Gassensor, flüssiger Elektrolyt und Verwendung eines flüssigen Elektrolyten in einem elektrochemischen Gassensor | |
| EP1936365A2 (de) | Set mit ionenselektiven Festkontakt-Elektroden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |