DE2423721A1 - Verfahren zur herstellung neuer heterocyclischer verbindungen - Google Patents
Verfahren zur herstellung neuer heterocyclischer verbindungenInfo
- Publication number
- DE2423721A1 DE2423721A1 DE19742423721 DE2423721A DE2423721A1 DE 2423721 A1 DE2423721 A1 DE 2423721A1 DE 19742423721 DE19742423721 DE 19742423721 DE 2423721 A DE2423721 A DE 2423721A DE 2423721 A1 DE2423721 A1 DE 2423721A1
- Authority
- DE
- Germany
- Prior art keywords
- piperidino
- lower alkyl
- chlorine
- sulfur
- bromine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title description 10
- 150000002391 heterocyclic compounds Chemical class 0.000 title description 2
- -1 methylenoxy group Chemical group 0.000 claims description 65
- 150000001875 compounds Chemical class 0.000 claims description 56
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 23
- 239000000460 chlorine Chemical group 0.000 claims description 23
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 22
- 229910052717 sulfur Inorganic materials 0.000 claims description 22
- 239000011593 sulfur Substances 0.000 claims description 22
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 19
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 19
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 19
- 229910052794 bromium Inorganic materials 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 18
- 125000003545 alkoxy group Chemical group 0.000 claims description 14
- 125000004414 alkyl thio group Chemical group 0.000 claims description 14
- 229910052731 fluorine Inorganic materials 0.000 claims description 13
- 239000011737 fluorine Chemical group 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 150000002148 esters Chemical class 0.000 claims description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical group [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 9
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 61
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 42
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 21
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 21
- 239000000203 mixture Substances 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 16
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 14
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- HTKABMPGOHRVCT-UHFFFAOYSA-N 5-bromopentan-2-one Chemical compound CC(=O)CCCBr HTKABMPGOHRVCT-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000000741 silica gel Substances 0.000 description 9
- 229910002027 silica gel Inorganic materials 0.000 description 9
- ONJRTQUWKRDCTA-UHFFFAOYSA-N 2h-thiochromene Chemical compound C1=CC=C2C=CCSC2=C1 ONJRTQUWKRDCTA-UHFFFAOYSA-N 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 8
- 235000019341 magnesium sulphate Nutrition 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 125000001424 substituent group Chemical group 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- VZCYOOQTPOCHFL-OWOJBTEDSA-M fumarate(1-) Chemical compound OC(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-M 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- APOUUAVNOCZMHS-UHFFFAOYSA-N 4-xanthen-9-ylidenepiperidine Chemical compound C1CNCCC1=C1C2=CC=CC=C2OC2=CC=CC=C21 APOUUAVNOCZMHS-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- ZGHFDIIVVIFNPS-UHFFFAOYSA-N 3-Methyl-3-buten-2-one Chemical compound CC(=C)C(C)=O ZGHFDIIVVIFNPS-UHFFFAOYSA-N 0.000 description 4
- FTOAOBMCPZCFFF-UHFFFAOYSA-N 5,5-diethylbarbituric acid Chemical compound CCC1(CC)C(=O)NC(=O)NC1=O FTOAOBMCPZCFFF-UHFFFAOYSA-N 0.000 description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 150000003053 piperidines Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000012730 sustained-release form Substances 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- NFHHBIGYIAIGFH-UHFFFAOYSA-N 2h-cyclohepta[b]thiophene Chemical compound C1=CC=CC2=CCSC2=C1 NFHHBIGYIAIGFH-UHFFFAOYSA-N 0.000 description 2
- WODOUWGGUWAIBD-UHFFFAOYSA-N 4-(5,6-dihydrodibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine Chemical compound C1CNCCC1=C1C2=CC=CC=C2CCC2=CC=CC=C21 WODOUWGGUWAIBD-UHFFFAOYSA-N 0.000 description 2
- FCWAMWPQSKCOMG-UHFFFAOYSA-N 4-(6h-benzo[c][1]benzoxepin-11-ylidene)piperidine Chemical compound C1CNCCC1=C1C2=CC=CC=C2OCC2=CC=CC=C21 FCWAMWPQSKCOMG-UHFFFAOYSA-N 0.000 description 2
- DIHAEJKTJPVECJ-UHFFFAOYSA-N 4-benzo[1,2]cyclohepta[3,4-b]thiophen-10-ylidenepiperidine Chemical class C1CNCCC1=C1C2=CC=CC=C2C=CC2=C1C=CS2 DIHAEJKTJPVECJ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 229960002319 barbital Drugs 0.000 description 2
- 150000001555 benzenes Chemical group 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000009194 climbing Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- UZVGSSNIUNSOFA-UHFFFAOYSA-N dibenzofuran-1-carboxylic acid Chemical compound O1C2=CC=CC=C2C2=C1C=CC=C2C(=O)O UZVGSSNIUNSOFA-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 230000000147 hypnotic effect Effects 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 2
- 230000037023 motor activity Effects 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical class ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 230000028527 righting reflex Effects 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- HBWDBNHWWKNEJG-UHFFFAOYSA-N 1-[4-(3,6-dichloro-10,10-dimethylanthracen-9-ylidene)piperidin-1-yl]pentan-3-one Chemical compound C1CN(CCC(=O)CC)CCC1=C1C2=CC=C(Cl)C=C2C(C)(C)C2=CC(Cl)=CC=C21 HBWDBNHWWKNEJG-UHFFFAOYSA-N 0.000 description 1
- UPSCFMGILLJQRB-UHFFFAOYSA-N 1-[4-(7-fluorobenzo[1,2]cyclohepta[2,4-b]thiophen-10-ylidene)piperidin-1-yl]-4-methylpentan-3-one Chemical compound C1CN(CCC(=O)C(C)C)CCC1=C1C2=CC=C(F)C=C2C=CC2=C1C=CS2 UPSCFMGILLJQRB-UHFFFAOYSA-N 0.000 description 1
- BMCHAUVBHKAKOM-UHFFFAOYSA-N 1-[4-(7-methylsulfanyl-4,5-dihydrobenzo[1,2]cyclohepta[2,4-b]thiophen-10-ylidene)piperidin-1-yl]pentan-3-one Chemical compound C1CN(CCC(=O)CC)CCC1=C1C2=CC=C(SC)C=C2CCC2=C1C=CS2 BMCHAUVBHKAKOM-UHFFFAOYSA-N 0.000 description 1
- XNHTZBFSFZSWOO-UHFFFAOYSA-N 1-bromopentan-2-one Chemical compound CCCC(=O)CBr XNHTZBFSFZSWOO-UHFFFAOYSA-N 0.000 description 1
- BQYAIXRTUQAHCK-UHFFFAOYSA-N 2h-benzo[1,2]cyclohepta[3,6-b]thiophene Chemical compound C1=C2C=CC=CC2=CC2=CCSC2=C1 BQYAIXRTUQAHCK-UHFFFAOYSA-N 0.000 description 1
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 1
- LXVCSQSHBRBADM-UHFFFAOYSA-N 4-(10,10-dimethylanthracen-9-ylidene)piperidine Chemical compound C12=CC=CC=C2C(C)(C)C2=CC=CC=C2C1=C1CCNCC1 LXVCSQSHBRBADM-UHFFFAOYSA-N 0.000 description 1
- BCTLPBWGLJDKHE-UHFFFAOYSA-N 4-(5,6-dihydrodibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2CCC2=CC=CC=C21 BCTLPBWGLJDKHE-UHFFFAOYSA-N 0.000 description 1
- MBGXTYVKSKOCFX-UHFFFAOYSA-N 4-(6h-benzo[c][1]benzothiepin-11-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2SCC2=CC=CC=C21 MBGXTYVKSKOCFX-UHFFFAOYSA-N 0.000 description 1
- GWALUVXPYMFLHM-UHFFFAOYSA-N 4-(6h-benzo[c][1]benzoxepin-11-ylidene)-1-methylpiperidine Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2OCC2=CC=CC=C21 GWALUVXPYMFLHM-UHFFFAOYSA-N 0.000 description 1
- INPJSDMJYRCDGA-UHFFFAOYSA-N 4-(dibenzo[1,2-a:1',2'-e][7]annulen-11-ylidene)piperidine Chemical class C1CNCCC1=C1C2=CC=CC=C2C=CC2=CC=CC=C21 INPJSDMJYRCDGA-UHFFFAOYSA-N 0.000 description 1
- UXHQLGLGLZKHTC-CUNXSJBXSA-N 4-[(3s,3ar)-3-cyclopentyl-7-(4-hydroxypiperidine-1-carbonyl)-3,3a,4,5-tetrahydropyrazolo[3,4-f]quinolin-2-yl]-2-chlorobenzonitrile Chemical compound C1CC(O)CCN1C(=O)C1=CC=C(C=2[C@@H]([C@H](C3CCCC3)N(N=2)C=2C=C(Cl)C(C#N)=CC=2)CC2)C2=N1 UXHQLGLGLZKHTC-CUNXSJBXSA-N 0.000 description 1
- POEKQJHFUMVZDR-UHFFFAOYSA-N 4-[4-(2-chlorodibenzo[1,3-e:1',2'-f][7]annulen-11-ylidene)piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1=C1C2=CC(Cl)=CC=C2C=CC2=CC=CC=C21 POEKQJHFUMVZDR-UHFFFAOYSA-N 0.000 description 1
- FGTMNJDSRPRDSC-UHFFFAOYSA-N 4-[4-(2-fluorodibenzo[1,3-e:1',2'-f][7]annulen-11-ylidene)piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1=C1C2=CC(F)=CC=C2C=CC2=CC=CC=C21 FGTMNJDSRPRDSC-UHFFFAOYSA-N 0.000 description 1
- VIMMROSHJJBFCC-UHFFFAOYSA-N 4-[4-(2-methyldibenzo[1,2-e:1',2'-f][7]annulen-11-ylidene)piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1=C1C2=CC(C)=CC=C2C=CC2=CC=CC=C21 VIMMROSHJJBFCC-UHFFFAOYSA-N 0.000 description 1
- IMVAIHUPYJRMAX-UHFFFAOYSA-N 4-[4-(2-methylsulfanyldibenzo[1,3-e:1',2'-f][7]annulen-11-ylidene)piperidin-1-yl]butan-2-one Chemical compound C12=CC(SC)=CC=C2C=CC2=CC=CC=C2C1=C1CCN(CCC(C)=O)CC1 IMVAIHUPYJRMAX-UHFFFAOYSA-N 0.000 description 1
- VOXCQWXGSUGHRA-UHFFFAOYSA-N 4-[4-(3-chloro-5,6-dihydrodibenzo[1,2-a:1',3'-e][7]annulen-11-ylidene)piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1=C1C2=CC=C(Cl)C=C2CCC2=CC=CC=C21 VOXCQWXGSUGHRA-UHFFFAOYSA-N 0.000 description 1
- GDINHPIJRUDMHB-UHFFFAOYSA-N 4-[4-(3-methylxanthen-9-ylidene)piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1=C1C2=CC=C(C)C=C2OC2=CC=CC=C21 GDINHPIJRUDMHB-UHFFFAOYSA-N 0.000 description 1
- PGTASEBQKMKRRM-UHFFFAOYSA-N 4-[4-(5-methylsulfanyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)piperidin-1-yl]butan-2-one Chemical compound C12=CC(SC)=CC=C2CCC2=CC=CC=C2C1=C1CCN(CCC(C)=O)CC1 PGTASEBQKMKRRM-UHFFFAOYSA-N 0.000 description 1
- WGKLMIIYKMSSKX-UHFFFAOYSA-N 4-[4-(8-fluoro-4,5-dihydrobenzo[3,4]cyclohepta[1,3-b]thiophen-10-ylidene)piperidin-1-yl]-3-methylbutan-2-one Chemical compound C1CN(CC(C)C(C)=O)CCC1=C1C2=CC(F)=CC=C2CCC2=C1C=CS2 WGKLMIIYKMSSKX-UHFFFAOYSA-N 0.000 description 1
- IITFYHSXTCLTSU-UHFFFAOYSA-N 4-[4-[2-(trifluoromethyl)-5,6-dihydrodibenzo[1,3-e:1',2'-f][7]annulen-11-ylidene]piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1=C1C2=CC(C(F)(F)F)=CC=C2CCC2=CC=CC=C21 IITFYHSXTCLTSU-UHFFFAOYSA-N 0.000 description 1
- JALPXXXAUYRSMJ-UHFFFAOYSA-N 4-[4-[2-(trifluoromethyl)dibenzo[1,3-e:1',2'-f][7]annulen-11-ylidene]piperidin-1-yl]butan-2-one Chemical compound C1CN(CCC(=O)C)CCC1=C1C2=CC(C(F)(F)F)=CC=C2C=CC2=CC=CC=C21 JALPXXXAUYRSMJ-UHFFFAOYSA-N 0.000 description 1
- BSGAESCCSVXSOG-UHFFFAOYSA-N 4-thieno[2,3-b]thiochromen-4-ylidenepiperidine Chemical class C1CNCCC1=C1C2=CC=CC=C2SC2=C1C=CS2 BSGAESCCSVXSOG-UHFFFAOYSA-N 0.000 description 1
- LZHOSAVJTUIYEZ-UHFFFAOYSA-N 5-[4-(3,10,10-trimethylanthracen-9-ylidene)piperidin-1-yl]pentan-2-one Chemical compound C1CN(CCCC(=O)C)CCC1=C1C2=CC=C(C)C=C2C(C)(C)C2=CC=CC=C21 LZHOSAVJTUIYEZ-UHFFFAOYSA-N 0.000 description 1
- GNFJXRBBWBDYHP-UHFFFAOYSA-N 5-[4-(3-chloro-10,10-dimethylanthracen-9-ylidene)piperidin-1-yl]pentan-2-one Chemical compound C1CN(CCCC(=O)C)CCC1=C1C2=CC=C(Cl)C=C2C(C)(C)C2=CC=CC=C21 GNFJXRBBWBDYHP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 206010008531 Chills Diseases 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 208000007101 Muscle Cramp Diseases 0.000 description 1
- 208000001431 Psychomotor Agitation Diseases 0.000 description 1
- 206010038743 Restlessness Diseases 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000003855 acyl compounds Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- FKPSBYZGRQJIMO-UHFFFAOYSA-M benzyl(triethyl)azanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC1=CC=CC=C1 FKPSBYZGRQJIMO-UHFFFAOYSA-M 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910002090 carbon oxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000001856 erectile effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 description 1
- 150000003948 formamides Chemical class 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- LFETXMWECUPHJA-UHFFFAOYSA-N methanamine;hydrate Chemical compound O.NC LFETXMWECUPHJA-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000003176 neuroleptic agent Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 208000019116 sleep disease Diseases 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH705673A CH580623A5 (en) | 1973-05-17 | 1973-05-17 | 4-tricyclylidene-piperidines - with sedative neuroleptic, muscle-relaxant and hypnotic activity |
| CH705173A CH580587A5 (en) | 1973-05-17 | 1973-05-17 | 4-tricyclylidene-piperidines - with sedative neuroleptic, muscle-relaxant and hypnotic activity |
| CH705373A CH580588A5 (en) | 1973-05-17 | 1973-05-17 | 4-tricyclylidene-piperidines - with sedative neuroleptic, muscle-relaxant and hypnotic activity |
| CH705773A CH580630A5 (en) | 1973-05-17 | 1973-05-17 | 4-tricyclylidene-piperidines - with sedative neuroleptic, muscle-relaxant and hypnotic activity |
| CH704873A CH574956A5 (en) | 1973-05-17 | 1973-05-17 | 4-tricyclylidene-piperidines - with sedative neuroleptic, muscle-relaxant and hypnotic activity |
| CH705573A CH580622A5 (en) | 1973-05-17 | 1973-05-17 | 4-tricyclylidene-piperidines - with sedative neuroleptic, muscle-relaxant and hypnotic activity |
| CH705473A CH580620A5 (en) | 1973-05-17 | 1973-05-17 | 4-tricyclylidene-piperidines - with sedative neuroleptic, muscle-relaxant and hypnotic activity |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2423721A1 true DE2423721A1 (de) | 1974-12-12 |
Family
ID=27561126
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742423721 Pending DE2423721A1 (de) | 1973-05-17 | 1974-05-16 | Verfahren zur herstellung neuer heterocyclischer verbindungen |
Country Status (9)
| Country | Link |
|---|---|
| JP (1) | JPS5018478A (https=) |
| AT (1) | ATA404674A (https=) |
| AU (1) | AU6900774A (https=) |
| DD (1) | DD110866A5 (https=) |
| DE (1) | DE2423721A1 (https=) |
| FR (1) | FR2229411B1 (https=) |
| GB (1) | GB1471751A (https=) |
| NL (1) | NL7406387A (https=) |
| PL (1) | PL90057B1 (https=) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5283854A (en) * | 1976-01-01 | 1977-07-13 | Smithkline Corp | Piperidilidene derivatives of tricyclic compounds |
| WO1989012443A1 (en) * | 1988-06-17 | 1989-12-28 | Fisons Corporation | Novel dibenzo-cycloheptenyl, -cycloheptyl and -oxepinyl amines having antihistaminic properties |
| US4912222A (en) * | 1988-06-17 | 1990-03-27 | Fisons Corporation | Antihistamines related to cyproheptadine |
| EP0371805A3 (en) * | 1988-11-30 | 1991-07-31 | Ajinomoto Co., Inc. | Piperidine derivatives and hypotensives containing the same |
| US5250681A (en) * | 1988-06-02 | 1993-10-05 | Ajinomoto Co., Inc. | Piperidine derivatives and hypotensives containing the same |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA756550B (en) * | 1974-11-06 | 1976-09-29 | Smithkline Corp | Pharmaceutical compositions and method of producing antipsychotic activity without extrapyramidal symptoms |
| CN102471326B (zh) | 2009-07-28 | 2015-04-29 | 日本脏器制药株式会社 | 硫杂苯并薁丙酸衍生物的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2020207A1 (en) * | 1968-10-09 | 1970-07-10 | Leo Ab | CNS-active tri:cyclic amino:ketone(s) |
-
1974
- 1974-05-10 JP JP49051423A patent/JPS5018478A/ja active Pending
- 1974-05-13 GB GB2097174A patent/GB1471751A/en not_active Expired
- 1974-05-13 NL NL7406387A patent/NL7406387A/xx unknown
- 1974-05-15 AU AU69007/74A patent/AU6900774A/en not_active Expired
- 1974-05-15 DD DD17851974A patent/DD110866A5/xx unknown
- 1974-05-15 PL PL17108974A patent/PL90057B1/pl unknown
- 1974-05-16 AT AT404674A patent/ATA404674A/de not_active Application Discontinuation
- 1974-05-16 DE DE19742423721 patent/DE2423721A1/de active Pending
- 1974-05-16 FR FR7417032A patent/FR2229411B1/fr not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5283854A (en) * | 1976-01-01 | 1977-07-13 | Smithkline Corp | Piperidilidene derivatives of tricyclic compounds |
| US5250681A (en) * | 1988-06-02 | 1993-10-05 | Ajinomoto Co., Inc. | Piperidine derivatives and hypotensives containing the same |
| WO1989012443A1 (en) * | 1988-06-17 | 1989-12-28 | Fisons Corporation | Novel dibenzo-cycloheptenyl, -cycloheptyl and -oxepinyl amines having antihistaminic properties |
| US4912222A (en) * | 1988-06-17 | 1990-03-27 | Fisons Corporation | Antihistamines related to cyproheptadine |
| EP0371805A3 (en) * | 1988-11-30 | 1991-07-31 | Ajinomoto Co., Inc. | Piperidine derivatives and hypotensives containing the same |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2229411B1 (https=) | 1977-11-10 |
| GB1471751A (en) | 1977-04-27 |
| NL7406387A (https=) | 1974-11-19 |
| ATA404674A (de) | 1978-03-15 |
| AU6900774A (en) | 1975-11-20 |
| DD110866A5 (https=) | 1975-01-12 |
| PL90057B1 (en) | 1976-12-31 |
| JPS5018478A (https=) | 1975-02-26 |
| FR2229411A1 (https=) | 1974-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2614406C2 (https=) | ||
| DE2111071A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| CH625516A5 (https=) | ||
| DE2256392A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE2423721A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DD238792A5 (de) | Verfahren zur herstellung von benzothiophen-derivaten | |
| US4072756A (en) | Tricyclo piperidino ketones and soporific compositions thereof | |
| DE68913367T2 (de) | Benzazepinderivate. | |
| AT391316B (de) | Neue thienyloxy-alkylamin-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE19932314A1 (de) | Benzofuranderivate | |
| SU1376941A3 (ru) | Способ получени производных пирролинона или их кислотно-аддитивных солей | |
| CH666031A5 (de) | Naphthoxazine, ihre herstellung und pharmazeutische zusammensetzungen. | |
| DE2443086A1 (de) | Verfahren zur herstellung neuer, heterocyclischer verbindungen | |
| DE1914981A1 (de) | Verfahren zur Herstellung heterocyclischer Verbindungen | |
| DE2346747A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| US3466290A (en) | 9,10-dihydro-4h-benzo(4,5)cyclohepta(1,2-b)thiophene ethers | |
| DE1933599A1 (de) | Chinolinderivate | |
| DE2238941A1 (de) | Verfahren zur herstellung von bestimmten indolbenzazepinderivaten | |
| AT349485B (de) | Verfahren zur herstellung von neuen 1,2- dithiolderivaten | |
| CH615928A5 (https=) | ||
| DE1470262C3 (de) | 4H-Benzo 4,5 cyclohepta 1,2-b thiophene | |
| CH554893A (de) | Verfahren zur herstellung neuer 9-(4-piperidyliden)-thioxanthenderivate. | |
| DE2209891C3 (de) | 9,10-Dihydro-thieno[3.2-b][f][4H]benzazepine sowie Verfahren zu deren Herstellung | |
| AT251765B (de) | Verfahren zur Herstellung von neuen Yohimbanderivaten und von deren Salzen | |
| CH537404A (de) | Verfahren zur Herstellung neuer Thiophenderivate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |