DE2407016C3 - 2-Alkoxybenzoylaminocarbonsäuren, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antipyretische Mittel - Google Patents
2-Alkoxybenzoylaminocarbonsäuren, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antipyretische MittelInfo
- Publication number
- DE2407016C3 DE2407016C3 DE2407016A DE2407016A DE2407016C3 DE 2407016 C3 DE2407016 C3 DE 2407016C3 DE 2407016 A DE2407016 A DE 2407016A DE 2407016 A DE2407016 A DE 2407016A DE 2407016 C3 DE2407016 C3 DE 2407016C3
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- alkoxybenzoylaminocarboxylic
- acids
- preparation
- processes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 14
- 239000002253 acid Substances 0.000 title claims description 10
- 150000007513 acids Chemical class 0.000 title claims description 6
- 238000000034 method Methods 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000002221 antipyretic Substances 0.000 title description 6
- 229940125716 antipyretic agent Drugs 0.000 title description 3
- -1 1,3-propylene group Chemical group 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 3
- 239000000243 solution Substances 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000002347 injection Methods 0.000 description 6
- 239000007924 injection Substances 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 5
- 230000000202 analgesic effect Effects 0.000 description 5
- 230000001754 anti-pyretic effect Effects 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 4
- MONIBWJWTIDTKS-UHFFFAOYSA-N 2-[(2-octoxybenzoyl)amino]acetic acid Chemical compound C(CCCCCCC)OC1=C(C(=O)NCC(=O)O)C=CC=C1 MONIBWJWTIDTKS-UHFFFAOYSA-N 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical compound NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 3
- 241000283973 Oryctolagus cuniculus Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000001663 anti-spastic effect Effects 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000002631 hypothermal effect Effects 0.000 description 3
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- WCJLKAOWUBVWSG-UHFFFAOYSA-N 2-octoxybenzoyl chloride Chemical compound CCCCCCCCOC1=CC=CC=C1C(Cl)=O WCJLKAOWUBVWSG-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 206010037660 Pyrexia Diseases 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000012496 blank sample Substances 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000002510 pyrogen Substances 0.000 description 2
- 210000000664 rectum Anatomy 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 2
- XIXNYHNTLCYSFX-UHFFFAOYSA-N 2-[(2-heptoxybenzoyl)amino]acetic acid Chemical compound C(CCCCCC)OC1=C(C(=O)NCC(=O)O)C=CC=C1 XIXNYHNTLCYSFX-UHFFFAOYSA-N 0.000 description 1
- KAGNTFGEYMLRLJ-UHFFFAOYSA-N 2-heptoxybenzoyl chloride Chemical compound C(CCCCCC)OC1=C(C(=O)Cl)C=CC=C1 KAGNTFGEYMLRLJ-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- ZJUVIQRMKHEHEL-UHFFFAOYSA-N CCCCCCCCOC(C=CC=C1)=C1C(ONCC(O)=O)=O Chemical compound CCCCCCCCOC(C=CC=C1)=C1C(ONCC(O)=O)=O ZJUVIQRMKHEHEL-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000002158 endotoxin Substances 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229920006008 lipopolysaccharide Polymers 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/42—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/44—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/58—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring
- C07C235/60—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to carbon atoms of six-membered aromatic rings and singly-bound oxygen atoms bound to the same carbon skeleton with carbon atoms of carboxamide groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring with carbon atoms of carboxamide groups and singly-bound oxygen atoms, bound in ortho-position to carbon atoms of the same non-condensed six-membered aromatic ring having the nitrogen atoms of the carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP1748373A JPS5530505B2 (enExample) | 1973-02-14 | 1973-02-14 | |
| JP4345173A JPS5530506B2 (enExample) | 1973-04-17 | 1973-04-17 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2407016A1 DE2407016A1 (de) | 1974-09-05 |
| DE2407016B2 DE2407016B2 (de) | 1979-07-19 |
| DE2407016C3 true DE2407016C3 (de) | 1980-06-19 |
Family
ID=26354008
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2407016A Expired DE2407016C3 (de) | 1973-02-14 | 1974-02-14 | 2-Alkoxybenzoylaminocarbonsäuren, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antipyretische Mittel |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3927082A (enExample) |
| CH (1) | CH588448A5 (enExample) |
| DE (1) | DE2407016C3 (enExample) |
| FR (1) | FR2217316B1 (enExample) |
| GB (1) | GB1418595A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57140754A (en) * | 1981-02-24 | 1982-08-31 | Kureha Chem Ind Co Ltd | Dihydroxybenzoic acid derivative and physiologically active preparation containing the same |
| US4505898A (en) * | 1982-04-21 | 1985-03-19 | Marks Robert E | Derivatives of acetylsalicylic acid and substituted phenylacetic acids and compositions containing them |
| US4452783A (en) * | 1982-04-21 | 1984-06-05 | Marks Robert E | Derivatives of substituted phenylacetic acids and compositions containing them |
| CN1090614C (zh) * | 1995-07-26 | 2002-09-11 | 辉瑞大药厂 | N-(芳酰基)甘氨酸异羟肟酸衍生物及相关化合物 |
| JP6770553B2 (ja) | 2018-07-20 | 2020-10-14 | 藤本化学製品株式会社 | アルコキシフェニル誘導体、ヌクレオシド保護体およびヌクレオチド保護体、オリゴヌクレオチド製造方法、ならびに、置換基除去方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2440658A (en) * | 1946-04-29 | 1948-04-27 | Nat Drug Co | Salicyloyl-beta alanide |
| GB1133647A (en) * | 1965-11-23 | 1968-11-13 | Menarini Sas | -¤-hydroxy-and -¤-alkyloxy-benzoyl-hydrazones of pyruvic acid |
| US3489793A (en) * | 1966-05-16 | 1970-01-13 | Francia Formaceutici S R L | New benzamido butyric acid derivatives |
-
1974
- 1974-01-25 GB GB367374A patent/GB1418595A/en not_active Expired
- 1974-02-05 US US439693A patent/US3927082A/en not_active Expired - Lifetime
- 1974-02-07 FR FR7404095A patent/FR2217316B1/fr not_active Expired
- 1974-02-13 CH CH197274A patent/CH588448A5/xx not_active IP Right Cessation
- 1974-02-14 DE DE2407016A patent/DE2407016C3/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1418595A (en) | 1975-12-24 |
| US3927082A (en) | 1975-12-16 |
| DE2407016A1 (de) | 1974-09-05 |
| FR2217316B1 (enExample) | 1980-02-15 |
| DE2407016B2 (de) | 1979-07-19 |
| FR2217316A1 (enExample) | 1974-09-06 |
| CH588448A5 (enExample) | 1977-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2414680C2 (de) | Substituierte 2-Furancarbonsäuren und 2-Furancarbonsäureester, Verfahren zu ihrer Herstellung und Arzneimittel, die diese Verbindungen enthalten | |
| DE2259627A1 (de) | Imidazolyl-(2)-thio-alkansaeureester und verfahren zu ihrer herstellung | |
| DE2947624A1 (de) | Beta, gamma -dihydropolyprenylalkohol und diesen enthaltendes blutdrucksenkendes arzneimittel | |
| DE2407016C3 (de) | 2-Alkoxybenzoylaminocarbonsäuren, Verfahren zu deren Herstellung und diese Verbindungen enthaltende antipyretische Mittel | |
| DE2711225C2 (enExample) | ||
| DE2157272C3 (de) | Verwendung von bis-(p-Chlorphenoxy)acetylharnstoff | |
| DE2446100C3 (de) | Phenoxyalkancarbonsäureamide von Thiazolidincarbonsäuren, Verfahren zu ihrer Herstellung und Arzneimittel | |
| DE2038628C3 (de) | N,N'-Di(carboxyalkyI)-p-phenylendiamine, deren Salze und Diäthylester, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2319834B2 (de) | Derivate von 2-Carboxy-pyrazin-4-oxiden, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE2038836C3 (de) | Arzneimittel | |
| DE1493513C3 (de) | Sulfamylanthranilsäuren, deren therapeutisch verwendbare Salze, Verfahren zu ihrer Herstellung und diese enthaltenden pharmazeutischen Präparate | |
| DE2244179C3 (de) | D-threo-l-p-substituierte Phenyl-2dichloracetamidopropan-I.S-diol-ester, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1082368B (de) | Roentgenkontrastmittel | |
| DE2808203C2 (de) | Arzneimittel, enthaltend p-Chlorphenoxyisobuttersäure-p-chlorphenolester | |
| DE3620215A1 (de) | Benzamide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| AT265243B (de) | Verfahren zur Herstellung von neuen Salzen der p-Chlorphenoxyisobuttersäure | |
| DE1445417A1 (de) | Verfahren zur Herstellung von neuen Hexitestern der Nikotinsaeure | |
| DE2436484A1 (de) | 4-(3-chlor-4-cyclohexyl-phenyl)-gammabutyrolacton, verfahren zu seiner herstellung sowie dieses enthaltende pharmazeutische zusammensetzung | |
| DE2810505A1 (de) | Verfahren zur herstellung von isobutyramidderivaten | |
| CH644594A5 (en) | 4-Acetamidophenyl alpha-(2-methyl-ind-[en/ol]-3-yl)acetates | |
| DE1792270C3 (de) | Antirheumatikum enthaltend ein Magnesium- oder Calciumsalz eines Malonsäurehydrazid s | |
| DE2316914C3 (de) | 4-(p-Chlorphenoxyacetylamino) benzoesäurediäthylamino-äthylester-pchlorphenoxyisobutyrat Verfahren zu seiner Herstellung und diese Verbindung enthaltende Arzneimittel | |
| AT244954B (de) | Verfahren zur Herstellung von neuen Succinimidverbindungen | |
| AT281780B (de) | Verfahren zur herstellung von neuen halogenierten alkandiolen | |
| DE2012644A1 (en) | Beta-pyridylcarbinol esters with circulatory activity |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |