DE2353149C3 - Saure Disazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von natürlichen oder synthetischen Polyamidfasern - Google Patents
Saure Disazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von natürlichen oder synthetischen PolyamidfasernInfo
- Publication number
- DE2353149C3 DE2353149C3 DE2353149A DE2353149A DE2353149C3 DE 2353149 C3 DE2353149 C3 DE 2353149C3 DE 2353149 A DE2353149 A DE 2353149A DE 2353149 A DE2353149 A DE 2353149A DE 2353149 C3 DE2353149 C3 DE 2353149C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- acid
- polyamide fibers
- preparation
- dyes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 title claims description 14
- 239000000975 dye Substances 0.000 title description 16
- 239000004952 Polyamide Substances 0.000 title description 9
- 229920002647 polyamide Polymers 0.000 title description 9
- 239000000835 fiber Substances 0.000 title description 7
- 239000002253 acid Substances 0.000 title description 4
- 238000000034 method Methods 0.000 title description 3
- 238000002360 preparation method Methods 0.000 title description 2
- 238000004043 dyeing Methods 0.000 title 1
- 229910018828 PO3H2 Inorganic materials 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 238000004040 coloring Methods 0.000 description 6
- -1 p-sulfobenzyl Chemical group 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000001632 sodium acetate Substances 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 3
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 description 2
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 2
- FWEOQOXTVHGIFQ-UHFFFAOYSA-N 8-anilinonaphthalene-1-sulfonic acid Chemical compound C=12C(S(=O)(=O)O)=CC=CC2=CC=CC=1NC1=CC=CC=C1 FWEOQOXTVHGIFQ-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000000980 acid dye Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- QDBZWLAQPHAUGV-UHFFFAOYSA-N (2-methoxyphenyl)phosphonic acid Chemical compound COC1=CC=CC=C1P(O)(O)=O QDBZWLAQPHAUGV-UHFFFAOYSA-N 0.000 description 1
- MZZQBSHNCYWSTL-UHFFFAOYSA-N (3-aminophenyl)phosphonic acid Chemical compound NC1=CC=CC(P(O)(O)=O)=C1 MZZQBSHNCYWSTL-UHFFFAOYSA-N 0.000 description 1
- HAIZAZONHOVLEK-UHFFFAOYSA-N (4-nitrophenyl) octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OC1=CC=C([N+]([O-])=O)C=C1 HAIZAZONHOVLEK-UHFFFAOYSA-N 0.000 description 1
- SJEYSFABYSGQBG-UHFFFAOYSA-M Patent blue Chemical compound [Na+].C1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)S([O-])(=O)=O)S([O-])(=O)=O)=C1C=CC(=[N+](CC)CC)C=C1 SJEYSFABYSGQBG-UHFFFAOYSA-M 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 1
- XPRMZBUQQMPKCR-UHFFFAOYSA-L disodium;8-anilino-5-[[4-[(3-sulfonatophenyl)diazenyl]naphthalen-1-yl]diazenyl]naphthalene-1-sulfonate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C3=CC=CC=C3C(N=NC=3C4=CC=CC(=C4C(NC=4C=CC=CC=4)=CC=3)S([O-])(=O)=O)=CC=2)=C1 XPRMZBUQQMPKCR-UHFFFAOYSA-L 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- HSZCJVZRHXPCIA-UHFFFAOYSA-N n-benzyl-n-ethylaniline Chemical compound C=1C=CC=CC=1N(CC)CC1=CC=CC=C1 HSZCJVZRHXPCIA-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 125000004437 phosphorous atom Chemical group 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B69/00—Dyes not provided for by a single group of this subclass
- C09B69/007—Dyestuffs containing phosphonic or phosphinic acid groups and derivatives
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/04—Disazo dyes from a coupling component "C" containing a directive amino group
- C09B31/041—Disazo dyes from a coupling component "C" containing a directive amino group containing acid groups, e.g. -CO2H, -SO3H, -PO3H2, -OSO3H, -OPO2H2; Salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7240114A FR2206358B1 (ref) | 1972-11-13 | 1972-11-13 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2353149A1 DE2353149A1 (de) | 1974-05-22 |
| DE2353149B2 DE2353149B2 (de) | 1978-11-02 |
| DE2353149C3 true DE2353149C3 (de) | 1979-07-05 |
Family
ID=9107043
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2353149A Expired DE2353149C3 (de) | 1972-11-13 | 1973-10-23 | Saure Disazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von natürlichen oder synthetischen Polyamidfasern |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3947435A (ref) |
| BE (1) | BE807205A (ref) |
| CH (1) | CH581169A5 (ref) |
| DE (1) | DE2353149C3 (ref) |
| FR (1) | FR2206358B1 (ref) |
| GB (1) | GB1450195A (ref) |
| IT (1) | IT999756B (ref) |
| NL (1) | NL151117B (ref) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4150020A (en) * | 1972-06-07 | 1979-04-17 | Burlington Industries, Inc. | Reactive xylylene diphosphonic acid dyes |
| US4098784A (en) * | 1974-12-18 | 1978-07-04 | Burlington Industries, Inc. | Red-1-hydroxy-3,6-disulfo-8-acetamido-2-(3 phosphonophenylazo)naphthalene dyes |
| GB1498669A (en) * | 1975-04-30 | 1978-01-25 | Ici Ltd | Azo dyestuffs |
| GB1491608A (en) * | 1975-05-28 | 1977-11-09 | Ici Ltd | Metal complex formazan dyestuffs and processes for their preparation |
| GB1500824A (en) * | 1975-09-04 | 1978-02-15 | Ici Ltd | Azo dyestuffs containing phosphonic acid groups |
| US4150021A (en) * | 1976-07-30 | 1979-04-17 | Burlington Industries, Inc. | Esters of cellulose with phosphonic acid dyes having a sulfonamide bridge |
| US4230618A (en) * | 1977-09-27 | 1980-10-28 | Ici United States, Inc. | Azo dyestuffs containing an amino or acylated amino naphthol di-sulfonic acid radical and at least one reactive phosphoric or phosphonic acid group |
| US4377519A (en) * | 1978-09-18 | 1983-03-22 | Toms River Chemical Corporation | Navy blue water-soluble sulfophenyl- or sulfonaphthyl-azo-1,4-phenylene-azo-5-(8-anilinonaphthalene-1-sulfonic acid) dyes for polyamides |
| JPS57159499A (en) * | 1981-03-26 | 1982-10-01 | Fuji Photo Film Co Ltd | Substrate for determining alkaline phosphatase and determining method |
| US4853466A (en) * | 1987-11-20 | 1989-08-01 | Crompton & Knowles Corporation | Water-soluble disazo reactive dyes and metals complexes (containing phosphonic acid groups) for dyeing cellulosic fibers |
| US4851516A (en) * | 1987-11-20 | 1989-07-25 | Crompton & Knowles Corporation | Dyes from diazotized sulfonylaminoalkylphosphonic acids and naphtholdisulfonic acids |
| JPH01319576A (ja) * | 1988-06-20 | 1989-12-25 | Orient Chem Ind Ltd | 水性インク組成物 |
| CN110128848B (zh) * | 2019-05-18 | 2021-01-01 | 上海雅运新材料有限公司 | 一种红色酸性染料组合物及其在纤维上的染色应用 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2277243A (en) * | 1936-11-21 | 1942-03-24 | Gen Aniline & Film Corp | Azo dyestuffs |
| US2861067A (en) * | 1954-11-03 | 1958-11-18 | Ici Ltd | Metallisable azo dyestuffs |
| US3580901A (en) * | 1968-11-14 | 1971-05-25 | Crompton & Knowles Corp | Maroon disazo dyes for polyamide fibers |
| US3814749A (en) * | 1969-04-14 | 1974-06-04 | Crompton & Knowles Corp | Blue phenylazonaphthylazo-n-aryl peri acids |
-
1972
- 1972-11-13 FR FR7240114A patent/FR2206358B1/fr not_active Expired
-
1973
- 1973-10-23 DE DE2353149A patent/DE2353149C3/de not_active Expired
- 1973-11-01 NL NL737314985A patent/NL151117B/xx unknown
- 1973-11-12 BE BE137653A patent/BE807205A/xx unknown
- 1973-11-12 GB GB5241073A patent/GB1450195A/en not_active Expired
- 1973-11-12 CH CH1585573A patent/CH581169A5/xx not_active IP Right Cessation
- 1973-11-13 US US05/415,474 patent/US3947435A/en not_active Expired - Lifetime
- 1973-11-13 IT IT70318/73A patent/IT999756B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| DE2353149B2 (de) | 1978-11-02 |
| IT999756B (it) | 1976-03-10 |
| BE807205A (fr) | 1974-05-13 |
| FR2206358B1 (ref) | 1975-11-07 |
| NL7314985A (ref) | 1974-05-15 |
| FR2206358A1 (ref) | 1974-06-07 |
| US3947435A (en) | 1976-03-30 |
| CH581169A5 (ref) | 1976-10-29 |
| DE2353149A1 (de) | 1974-05-22 |
| GB1450195A (en) | 1976-09-22 |
| NL151117B (nl) | 1976-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2915323A1 (de) | Basische bzw. kationische, sulfonsaeuregruppenhaltige monoazo- oder disazoverbindungen | |
| DE2353149C3 (de) | Saure Disazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von natürlichen oder synthetischen Polyamidfasern | |
| DE1794173B2 (de) | Verfahren zum Farben von Papier | |
| DE2421654C3 (de) | Trisazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben und Bedrucken von Textilmaterialien | |
| DE2355279C2 (de) | Auf der Faser diazotierbare Direktfarbstoffe ihre Herstellung und Verwendung | |
| DE2531445B2 (de) | Sulfogruppenfreie wasserloesliche azofarbstoffe und deren verwendung zum faerben und/oder bedrucken von synthetischen textilfasern | |
| DE2505188C2 (de) | Von 4,4'-Diaminobenzanilid abgeleiteter wasserlöslicher Azo-farbstoff | |
| DE2453209C2 (de) | Disazofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE2017873C3 (de) | Blaue Diazofarbstoffe | |
| EP0262095B1 (de) | Anionische Disazoverbindungen | |
| DE2339574C3 (de) | Verfahren zur Herstellung von sulfonsäuregruppenhaltigen Stilbenazo- und/oder Stilbenazoxyfarbstoffen | |
| DE2324198C3 (de) | Neue quaternäre Monoazofarbstoffe, Verfahren zu ihrer Herstellung und Färbeverfahren | |
| DE2503654C2 (de) | Neuer sulfonierter Triazofarbstoff | |
| CH624976A5 (ref) | ||
| DE4221008A1 (de) | Farbstoffmischungen, enthaltend Pyridonazofarbstoffe | |
| DE2362330A1 (de) | Polyfluorierte saure azofarbstoffe | |
| DE921225C (de) | Verfahren zur Herstellung von Disazofarbstoffen | |
| DE551953C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE849736C (de) | Verfahren zur Herstellung direktziehender Azofarbstoffe | |
| DE1469678C (de) | Basische Diazoverbindungen und ihre Verwendung zur Färbung von Fasern aus Polyacrylnitril | |
| DE961562C (de) | Verfahren zur Herstellung von Polyazofarbstoffen | |
| DE634211C (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE1444644C (de) | Verfahren zum Herstellen von wasser unlöslichen Monoazofarbstoffe^ deren Ver Wendung zum Farben und Bedrucken sowie was serunlosliche Monoazofarbstoffe | |
| DE1644222C (de) | Orangenfarbige bis scharlachrote Mono azoreaktivfarbstoffe und Verfahren zu deren Herstellung | |
| DE915381C (de) | Verfahren zur Herstellung unsymmetrischer Harnstoffderivate von Monoazofarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| EGA | New person/name/address of the applicant | ||
| 8339 | Ceased/non-payment of the annual fee |