DE2342028A1 - 3-(1-piperazinylalkyl)-2,4-chinazolindione - Google Patents
3-(1-piperazinylalkyl)-2,4-chinazolindioneInfo
- Publication number
- DE2342028A1 DE2342028A1 DE19732342028 DE2342028A DE2342028A1 DE 2342028 A1 DE2342028 A1 DE 2342028A1 DE 19732342028 DE19732342028 DE 19732342028 DE 2342028 A DE2342028 A DE 2342028A DE 2342028 A1 DE2342028 A1 DE 2342028A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- propylthio
- solution
- product
- phenyl7
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- -1 propylthio Chemical group 0.000 claims description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 claims description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000000047 product Substances 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 13
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 239000012458 free base Substances 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 8
- 241000700159 Rattus Species 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000004042 4-aminobutyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])N([H])[H] 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 230000037023 motor activity Effects 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000000932 sedative agent Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- CEKPSZQAYKRKMO-UHFFFAOYSA-N 1-(2-propylsulfanylphenyl)piperazine Chemical compound CCCSC1=CC=CC=C1N1CCNCC1 CEKPSZQAYKRKMO-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- USQQFJDERCVQKW-UHFFFAOYSA-N 4-[4-(2-propylsulfanylphenyl)piperazin-1-yl]butan-1-amine Chemical compound NCCCCN1CCN(CC1)C1=C(C=CC=C1)SCCC USQQFJDERCVQKW-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003874 central nervous system depressant Substances 0.000 description 2
- 230000002490 cerebral effect Effects 0.000 description 2
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- ZYMLBOINJTXUAK-UHFFFAOYSA-N dimethoxymethanamine Chemical compound COC(N)OC ZYMLBOINJTXUAK-UHFFFAOYSA-N 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- MYWUZJCMWCOHBA-UHFFFAOYSA-N n-methyl-1-phenylpropan-2-amine Chemical compound CNC(C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229940125723 sedative agent Drugs 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- PKORYTIUMAOPED-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinazoline Chemical compound C1=CC=C2NCNCC2=C1 PKORYTIUMAOPED-UHFFFAOYSA-N 0.000 description 1
- RTXBHRASQHVXDO-UHFFFAOYSA-N 1-(2-ethylsulfanylphenyl)piperazine Chemical compound CCSC1=CC=CC=C1N1CCNCC1 RTXBHRASQHVXDO-UHFFFAOYSA-N 0.000 description 1
- AGKHTCBPTYNECP-UHFFFAOYSA-N 1-(2-propan-2-ylsulfanylphenyl)piperazine Chemical compound CC(C)SC1=CC=CC=C1N1CCNCC1 AGKHTCBPTYNECP-UHFFFAOYSA-N 0.000 description 1
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- BWWHTIHDQBHTHP-UHFFFAOYSA-N 2-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1C(Cl)=O BWWHTIHDQBHTHP-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- YMOMYSDAOXOCID-UHFFFAOYSA-N 3-methoxy-2-nitrobenzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1[N+]([O-])=O YMOMYSDAOXOCID-UHFFFAOYSA-N 0.000 description 1
- IVHQFIICLHEQKD-UHFFFAOYSA-N 4-[4-(2-propan-2-ylsulfanylphenyl)piperazin-1-yl]butan-1-amine Chemical compound NCCCCN1CCN(CC1)C1=C(C=CC=C1)SC(C)C IVHQFIICLHEQKD-UHFFFAOYSA-N 0.000 description 1
- MYTYSEUIONBUDS-UHFFFAOYSA-N 4-[4-(2-propylsulfanylphenyl)piperazin-1-yl]butanenitrile Chemical compound C(CC)SC1=C(C=CC=C1)N1CCN(CC1)CCCC#N MYTYSEUIONBUDS-UHFFFAOYSA-N 0.000 description 1
- CQPGDDAKTTWVDD-UHFFFAOYSA-N 4-bromobutanenitrile Chemical compound BrCCCC#N CQPGDDAKTTWVDD-UHFFFAOYSA-N 0.000 description 1
- GBISCBLCGKIVCR-UHFFFAOYSA-N 5-[4-(2-propylsulfanylphenyl)piperazin-1-yl]pentan-1-amine Chemical compound NCCCCCN1CCN(CC1)C1=C(C=CC=C1)SCCC GBISCBLCGKIVCR-UHFFFAOYSA-N 0.000 description 1
- LTWIBNMUPZPXPD-UHFFFAOYSA-N 6-[4-(2-propylsulfanylphenyl)piperazin-1-yl]hexan-1-amine Chemical group NCCCCCCN1CCN(CC1)C1=C(C=CC=C1)SCCC LTWIBNMUPZPXPD-UHFFFAOYSA-N 0.000 description 1
- CWRGLNCDXLITND-UHFFFAOYSA-N BrCCCCCC#N.BrCCCCCC#N Chemical compound BrCCCCCC#N.BrCCCCCC#N CWRGLNCDXLITND-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000000561 anti-psychotic effect Effects 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- 125000000532 dioxanyl group Chemical group 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- YKWNUSJLICDQEO-UHFFFAOYSA-N ethoxyethane;propan-2-ol Chemical compound CC(C)O.CCOCC YKWNUSJLICDQEO-UHFFFAOYSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- KWHDXJHBFYQOTK-UHFFFAOYSA-N heptane;toluene Chemical compound CCCCCCC.CC1=CC=CC=C1 KWHDXJHBFYQOTK-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical compound NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000012022 methylating agents Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000003176 neuroleptic agent Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/59—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00282332A US3819630A (en) | 1972-08-21 | 1972-08-21 | 3-(1-piperazinylalkyl)-2,4-quinazolinedione compounds and methods for their production |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2342028A1 true DE2342028A1 (de) | 1974-03-07 |
Family
ID=23081024
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732342028 Withdrawn DE2342028A1 (de) | 1972-08-21 | 1973-08-20 | 3-(1-piperazinylalkyl)-2,4-chinazolindione |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3819630A (enExample) |
| JP (1) | JPS4985077A (enExample) |
| AR (1) | AR200736A1 (enExample) |
| AT (1) | AT327923B (enExample) |
| AU (1) | AU476177B2 (enExample) |
| BE (1) | BE803800A (enExample) |
| CA (1) | CA990293A (enExample) |
| CH (1) | CH586695A5 (enExample) |
| DE (1) | DE2342028A1 (enExample) |
| DK (1) | DK132758C (enExample) |
| ES (1) | ES418036A1 (enExample) |
| FI (1) | FI57937C (enExample) |
| FR (1) | FR2196803B1 (enExample) |
| GB (1) | GB1379188A (enExample) |
| IE (1) | IE38102B1 (enExample) |
| IL (1) | IL43033A (enExample) |
| NL (1) | NL7311458A (enExample) |
| NO (1) | NO138660C (enExample) |
| PH (1) | PH9220A (enExample) |
| SE (1) | SE398120B (enExample) |
| ZA (1) | ZA735728B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3879395A (en) * | 1973-10-23 | 1975-04-22 | Parke Davis & Co | 3-(1-Piperazinylalkylamino)-2-cycloalken-1-one compounds and methods for their production |
| US4268511A (en) * | 1980-03-11 | 1981-05-19 | Berri-Balzac | 3-Amino(1H,3H)quinazoline-2,4-dione derivatives and their therapeutic applications |
| DE3172006D1 (en) * | 1980-05-22 | 1985-10-03 | Masayuki Ishikawa | Novel quinazoline-dione compounds, process for production thereof and pharmaceutical use thereof |
| JPS58159480A (ja) * | 1982-03-17 | 1983-09-21 | Chugai Pharmaceut Co Ltd | 新規なフエニルピペラジン誘導体 |
| JPS5955878A (ja) * | 1982-09-24 | 1984-03-31 | Chugai Pharmaceut Co Ltd | 新規なフエニルピペラジン誘導体 |
| JPS60169467A (ja) * | 1984-02-10 | 1985-09-02 | Chugai Pharmaceut Co Ltd | 新規なフエニルピペラジン誘導体 |
| US4711883A (en) * | 1985-09-30 | 1987-12-08 | Ortho Pharmaceutical Corporation | Substituted 3-(4-phenyl-1-piperazinyl)alkylquinazolin-2,4-(1H,3H) diones, methods of preparation, compositions and method of use |
| US5160727A (en) * | 1990-02-13 | 1992-11-03 | Warner-Lambert Company | Tumor cell sensitization method using quinazolinedione derivatives |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3274194A (en) * | 1963-03-29 | 1966-09-20 | Miles Lab | Quinazolinedione derivatives |
-
1972
- 1972-08-21 US US00282332A patent/US3819630A/en not_active Expired - Lifetime
-
1973
- 1973-08-20 DK DK457173A patent/DK132758C/da active
- 1973-08-20 IL IL43033A patent/IL43033A/en unknown
- 1973-08-20 SE SE7311297A patent/SE398120B/xx unknown
- 1973-08-20 ES ES418036A patent/ES418036A1/es not_active Expired
- 1973-08-20 CA CA179,161A patent/CA990293A/en not_active Expired
- 1973-08-20 AR AR249617A patent/AR200736A1/es active
- 1973-08-20 NO NO3283/73A patent/NO138660C/no unknown
- 1973-08-20 AT AT722773A patent/AT327923B/de not_active IP Right Cessation
- 1973-08-20 FI FI2591/73A patent/FI57937C/fi active
- 1973-08-20 FR FR7330161A patent/FR2196803B1/fr not_active Expired
- 1973-08-20 DE DE19732342028 patent/DE2342028A1/de not_active Withdrawn
- 1973-08-20 GB GB3932673A patent/GB1379188A/en not_active Expired
- 1973-08-20 BE BE134748A patent/BE803800A/xx unknown
- 1973-08-20 IE IE1437/73A patent/IE38102B1/xx unknown
- 1973-08-20 NL NL7311458A patent/NL7311458A/xx not_active Application Discontinuation
- 1973-08-20 CH CH1194973A patent/CH586695A5/xx not_active IP Right Cessation
- 1973-08-20 JP JP48093222A patent/JPS4985077A/ja active Pending
- 1973-08-20 AU AU59420/73A patent/AU476177B2/en not_active Expired
- 1973-08-21 ZA ZA00735728A patent/ZA735728B/xx unknown
- 1973-09-26 PH PH15053*UA patent/PH9220A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7311458A (enExample) | 1974-02-25 |
| SE398120B (sv) | 1977-12-05 |
| ATA722773A (de) | 1975-05-15 |
| IE38102L (en) | 1974-02-21 |
| AU476177B2 (en) | 1976-09-16 |
| IL43033A (en) | 1976-09-30 |
| FI57937C (fi) | 1980-11-10 |
| ZA735728B (en) | 1975-04-30 |
| JPS4985077A (enExample) | 1974-08-15 |
| DK132758C (da) | 1976-08-23 |
| NO138660B (no) | 1978-07-10 |
| AU5942073A (en) | 1975-02-20 |
| AR200736A1 (es) | 1974-12-13 |
| US3819630A (en) | 1974-06-25 |
| CH586695A5 (enExample) | 1977-04-15 |
| AT327923B (de) | 1976-02-25 |
| FI57937B (fi) | 1980-07-31 |
| BE803800A (fr) | 1973-12-17 |
| FR2196803A1 (enExample) | 1974-03-22 |
| CA990293A (en) | 1976-06-01 |
| FR2196803B1 (enExample) | 1976-05-14 |
| ES418036A1 (es) | 1976-03-01 |
| IL43033A0 (en) | 1973-11-28 |
| DK132758B (da) | 1976-02-02 |
| IE38102B1 (en) | 1977-12-21 |
| NO138660C (no) | 1978-10-18 |
| PH9220A (en) | 1975-07-10 |
| GB1379188A (en) | 1975-01-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1470115C3 (de) | N-(1-Arylalkyl-4-piperidyl)-Narylamide, deren Säureadditionssalze und Verfahren zu ihrer Herstellung | |
| DE1695390A1 (de) | Verfahren zur Herstellung von Azaspiroalkandionen | |
| DE2941880A1 (de) | Diphenylbutyl-piperazincarboxamide und diese enthaltende arzneimittel | |
| CH624102A5 (enExample) | ||
| DD206991A5 (de) | Verfahren zur herstellung neuer piperazinone | |
| DE2557341A1 (de) | Basisch substituierte indolderivate und verfahren zu ihrer herstellung | |
| DE2311570C2 (de) | 4-Aminochinoline, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| DE2336130A1 (de) | Tricyclische verbindungen | |
| DD200152A5 (de) | Verfahren zur herstellung neuer 2-aminobenzoesaeure-derivate | |
| DE1620450C3 (de) | 1 - (2- Hydroxybenzyl) -2-piperazinomethylbenzimidazole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2712023A1 (de) | Sulfonamidoaminobenzoesaeurederivate, solche enthaltende arzneimittel sowie verfahren zur herstellung derselben | |
| DE3309596A1 (de) | 2-substituierte 1-(3'-aminoalkyl)-1,2,3,4-tetrahydro-ss-carboline, ihre herstellung und verwendung als arzneimittel | |
| EP0090369B1 (de) | Salicylsäurederivate, Verfahren zu ihrer Herstellung, pharmazeutische Präparate auf Basis dieser Verbindungen und ihre Verwendung | |
| DE2342028A1 (de) | 3-(1-piperazinylalkyl)-2,4-chinazolindione | |
| CH506525A (de) | Verfahren zur Herstellung von aromatischen Äthern | |
| DE2426149B2 (de) | 7-Fluor-substituierte Phenothiazine, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Mittel | |
| DE2167193C2 (de) | 4-(4-Hydroxypiperidino)-N,N,3-trimethyl-2,2-diphenylbutyramide und Verfahren zu ihrer Herstellung | |
| DE69431360T2 (de) | N-oxide von 4-arylpiperazinen und 4-arylpiperidinen als antipsychotische medikamente | |
| DE3132915A1 (de) | 1,5-diphenylpyrazolin-3-on-verbindungen sowie verfahren und zwischenprodukte zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE1905353C3 (de) | 2-Benzylimidazolinderivate, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen | |
| DE1470089A1 (de) | Verfahren zur Herstellung von 3-Amino-5-subst.-Pyrazinoylguanidinen | |
| DE1232587B (de) | Verfahren zur Herstellung von Piperazinderivaten | |
| DE2412520A1 (de) | Tricyclische verbindungen | |
| DE2456947A1 (de) | Neue alkensulfonamide, deren herstellung und diese enthaltende arzneimittel | |
| EP0224159A1 (de) | Neue basisch substituierte Pyridinverbindungen, Verfahren zu ihrer Herstellung, die sie enthaltenden Arzneimittel und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8139 | Disposal/non-payment of the annual fee |