DE2333828A1 - Azofarbstoffe - Google Patents
AzofarbstoffeInfo
- Publication number
- DE2333828A1 DE2333828A1 DE19732333828 DE2333828A DE2333828A1 DE 2333828 A1 DE2333828 A1 DE 2333828A1 DE 19732333828 DE19732333828 DE 19732333828 DE 2333828 A DE2333828 A DE 2333828A DE 2333828 A1 DE2333828 A1 DE 2333828A1
- Authority
- DE
- Germany
- Prior art keywords
- amino
- ethyl
- thiophene
- radical
- azo dyes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 42
- 239000000975 dye Substances 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 31
- 239000000463 material Substances 0.000 claims description 29
- 229930192474 thiophene Natural products 0.000 claims description 28
- 230000008878 coupling Effects 0.000 claims description 23
- 238000010168 coupling process Methods 0.000 claims description 23
- 238000005859 coupling reaction Methods 0.000 claims description 23
- 239000004753 textile Substances 0.000 claims description 20
- 125000001424 substituent group Chemical group 0.000 claims description 19
- 125000003118 aryl group Chemical group 0.000 claims description 17
- 239000000987 azo dye Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 13
- 229920000728 polyester Polymers 0.000 claims description 13
- 239000004215 Carbon black (E152) Substances 0.000 claims description 10
- 150000001412 amines Chemical class 0.000 claims description 10
- 229930195733 hydrocarbon Natural products 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 150000003577 thiophenes Chemical class 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000002843 carboxylic acid group Chemical group 0.000 claims description 8
- 238000004043 dyeing Methods 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229920002994 synthetic fiber Polymers 0.000 claims description 6
- 239000004758 synthetic textile Substances 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 150000004982 aromatic amines Chemical class 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- JVVRJMXHNUAPHW-UHFFFAOYSA-N 1h-pyrazol-5-amine Chemical class NC=1C=CNN=1 JVVRJMXHNUAPHW-UHFFFAOYSA-N 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 150000008049 diazo compounds Chemical class 0.000 claims description 4
- GGOZGYRTNQBSSA-UHFFFAOYSA-N pyridine-2,3-diol Chemical class OC1=CC=CN=C1O GGOZGYRTNQBSSA-UHFFFAOYSA-N 0.000 claims description 4
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 4
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 150000002989 phenols Chemical class 0.000 claims description 3
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical class OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 claims description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 claims description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000006575 electron-withdrawing group Chemical group 0.000 claims description 2
- 150000002790 naphthalenes Chemical group 0.000 claims description 2
- 150000004780 naphthols Chemical class 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229920006395 saturated elastomer Polymers 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- -1 chlorobenzoyl Chemical group 0.000 description 110
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 53
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 32
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 32
- 239000000203 mixture Substances 0.000 description 31
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 25
- 239000000243 solution Substances 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- JJYPMNFTHPTTDI-UHFFFAOYSA-N 3-methylaniline Chemical compound CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 12
- 244000172533 Viola sororia Species 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 10
- DZRZHFOFVWAKGT-UHFFFAOYSA-N 3,5-dinitrothiophen-2-amine Chemical compound NC=1SC([N+]([O-])=O)=CC=1[N+]([O-])=O DZRZHFOFVWAKGT-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000010438 heat treatment Methods 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 9
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 238000011282 treatment Methods 0.000 description 8
- JIZRGGUCOQKGQD-UHFFFAOYSA-N 2-nitrothiophene Chemical compound [O-][N+](=O)C1=CC=CS1 JIZRGGUCOQKGQD-UHFFFAOYSA-N 0.000 description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 5
- CFKZMYPOJOKAAD-UHFFFAOYSA-N 2-amino-5-nitrothiophene-3-carbonitrile Chemical compound NC=1SC([N+]([O-])=O)=CC=1C#N CFKZMYPOJOKAAD-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000012736 aqueous medium Substances 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 235000019260 propionic acid Nutrition 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 4
- 239000002609 medium Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- IICFGCMPQMPNRU-UHFFFAOYSA-N 2-amino-5-nitrothiophene-3-carboxylic acid Chemical compound NC=1SC([N+]([O-])=O)=CC=1C(O)=O IICFGCMPQMPNRU-UHFFFAOYSA-N 0.000 description 3
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 3
- 241000974482 Aricia saepiolus Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 235000019646 color tone Nutrition 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000006196 deacetylation Effects 0.000 description 3
- 238000003381 deacetylation reaction Methods 0.000 description 3
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 3
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 125000006501 nitrophenyl group Chemical group 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 229950003937 tolonium Drugs 0.000 description 3
- XOSXWYQMOYSSKB-LDKJGXKFSA-L water blue Chemical compound CC1=CC(/C(\C(C=C2)=CC=C2NC(C=C2)=CC=C2S([O-])(=O)=O)=C(\C=C2)/C=C/C\2=N\C(C=C2)=CC=C2S([O-])(=O)=O)=CC(S(O)(=O)=O)=C1N.[Na+].[Na+] XOSXWYQMOYSSKB-LDKJGXKFSA-L 0.000 description 3
- PPACJSOHFDRLBM-UHFFFAOYSA-N (2-amino-5-nitrothiophen-3-yl)-phenylmethanone Chemical compound NC=1SC(=CC1C(C1=CC=CC=C1)=O)[N+](=O)[O-] PPACJSOHFDRLBM-UHFFFAOYSA-N 0.000 description 2
- VOZSABVICTUWLY-UHFFFAOYSA-N 1-(2-amino-5-nitrothiophen-3-yl)ethanone Chemical compound CC(=O)C=1C=C([N+]([O-])=O)SC=1N VOZSABVICTUWLY-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- XGIMMKDOEWXVKN-UHFFFAOYSA-N 3-(benzenesulfonyl)-5-nitrothiophen-2-amine Chemical compound S1C([N+]([O-])=O)=CC(S(=O)(=O)C=2C=CC=CC=2)=C1N XGIMMKDOEWXVKN-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NTICRYSYQVALQQ-UHFFFAOYSA-N 5-bromo-4-nitrothiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C(Br)S1 NTICRYSYQVALQQ-UHFFFAOYSA-N 0.000 description 2
- RBQRZWYCXAXPIN-UHFFFAOYSA-N 5-methylthiophene-2-carbonitrile Chemical compound CC1=CC=C(C#N)S1 RBQRZWYCXAXPIN-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- 206010039587 Scarlet Fever Diseases 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 125000000068 chlorophenyl group Chemical group 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- DGVXLHAJVRRLGV-UHFFFAOYSA-N diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate Chemical compound CCOC(=O)C=1SC(N)=C(C(=O)OCC)C=1C DGVXLHAJVRRLGV-UHFFFAOYSA-N 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- IAFPZBCUVMQVBI-UHFFFAOYSA-N ethyl 2-acetamido-5-nitrothiophene-3-carboxylate Chemical compound CCOC(=O)C=1C=C([N+]([O-])=O)SC=1NC(C)=O IAFPZBCUVMQVBI-UHFFFAOYSA-N 0.000 description 2
- CTHOBBRGWQVVGK-UHFFFAOYSA-N ethyl 2-amino-5-cyano-4-methylthiophene-3-carboxylate Chemical compound CCOC(=O)C1=C(N)SC(C#N)=C1C CTHOBBRGWQVVGK-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- NCBZRJODKRCREW-UHFFFAOYSA-N m-anisidine Chemical compound COC1=CC=CC(N)=C1 NCBZRJODKRCREW-UHFFFAOYSA-N 0.000 description 2
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 2
- ISQLFHZQACIJBQ-UHFFFAOYSA-N methyl 2-amino-5-cyano-4-methylthiophene-3-carboxylate Chemical compound COC(=O)C1=C(N)SC(C#N)=C1C ISQLFHZQACIJBQ-UHFFFAOYSA-N 0.000 description 2
- SJWQCBCAGCEWCV-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)acetamide Chemical compound COC1=CC=C(NC(C)=O)C=C1N SJWQCBCAGCEWCV-UHFFFAOYSA-N 0.000 description 2
- PEMGGJDINLGTON-UHFFFAOYSA-N n-(3-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=CC(N)=C1 PEMGGJDINLGTON-UHFFFAOYSA-N 0.000 description 2
- 230000000802 nitrating effect Effects 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- FWFGVMYFCODZRD-UHFFFAOYSA-N oxidanium;hydrogen sulfate Chemical compound O.OS(O)(=O)=O FWFGVMYFCODZRD-UHFFFAOYSA-N 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GLQWRXYOTXRDNH-UHFFFAOYSA-N thiophen-2-amine Chemical class NC1=CC=CS1 GLQWRXYOTXRDNH-UHFFFAOYSA-N 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- VXIMIQNIBMDZCM-UHFFFAOYSA-N (2-aminothiophen-3-yl)-phenylmethanone Chemical compound S1C=CC(C(=O)C=2C=CC=CC=2)=C1N VXIMIQNIBMDZCM-UHFFFAOYSA-N 0.000 description 1
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 description 1
- ONYOSWJTGVFPDJ-UHFFFAOYSA-N 1-(5-amino-4-nitrothiophen-2-yl)ethanone Chemical compound CC(=O)C1=CC([N+]([O-])=O)=C(N)S1 ONYOSWJTGVFPDJ-UHFFFAOYSA-N 0.000 description 1
- YSNMMQRIPFUHAO-UHFFFAOYSA-N 1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile Chemical compound CCN1C(O)=C(C#N)C(C)=CC1=O YSNMMQRIPFUHAO-UHFFFAOYSA-N 0.000 description 1
- QFNFXYPFSYJCDF-UHFFFAOYSA-N 1-hydroxy-2h-isoquinolin-3-one Chemical compound C1=CC=CC2=C(O)NC(=O)C=C21 QFNFXYPFSYJCDF-UHFFFAOYSA-N 0.000 description 1
- VDQQJMHXZCMNMU-UHFFFAOYSA-N 1-phenylpyrrolidine Chemical compound C1CCCN1C1=CC=CC=C1 VDQQJMHXZCMNMU-UHFFFAOYSA-N 0.000 description 1
- BZYUMXXOAYSFOW-UHFFFAOYSA-N 2,3-dimethylthiophene Chemical compound CC=1C=CSC=1C BZYUMXXOAYSFOW-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- XRVRMVXPUOLGHR-UHFFFAOYSA-N 2-(4-methyl-2-nitrophenyl)thiophene Chemical compound CC1=CC(=C(C=C1)C=1SC=CC=1)[N+](=O)[O-] XRVRMVXPUOLGHR-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- YWCFEQPZXHQSSS-UHFFFAOYSA-N 2-acetamido-4-methylthiophene-3-carboxylic acid Chemical compound CC(=O)NC=1SC=C(C)C=1C(O)=O YWCFEQPZXHQSSS-UHFFFAOYSA-N 0.000 description 1
- RCEBHKDQZCVBTC-UHFFFAOYSA-N 2-acetamidothiophene-3-carboxylic acid Chemical compound CC(=O)NC=1SC=CC=1C(O)=O RCEBHKDQZCVBTC-UHFFFAOYSA-N 0.000 description 1
- CFBYBPOBHYGXNZ-UHFFFAOYSA-N 2-amino-4-methyl-5-nitrothiophene-3-carbonitrile Chemical compound CC1=C([N+]([O-])=O)SC(N)=C1C#N CFBYBPOBHYGXNZ-UHFFFAOYSA-N 0.000 description 1
- RMSVWOYCWFNSCM-UHFFFAOYSA-N 2-amino-4-phenylthiophene-3-carbonitrile Chemical compound N#CC1=C(N)SC=C1C1=CC=CC=C1 RMSVWOYCWFNSCM-UHFFFAOYSA-N 0.000 description 1
- HPSCXFOQUFPEPE-UHFFFAOYSA-N 2-chloro-5-methylaniline Chemical compound CC1=CC=C(Cl)C(N)=C1 HPSCXFOQUFPEPE-UHFFFAOYSA-N 0.000 description 1
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 1
- YRGYYQCOWUULNF-UHFFFAOYSA-N 2-hydroxy-4-methyl-6-oxo-1h-pyridine-3-carbonitrile Chemical compound CC1=CC(=O)NC(O)=C1C#N YRGYYQCOWUULNF-UHFFFAOYSA-N 0.000 description 1
- FDYLWXZGLNXBQT-UHFFFAOYSA-N 3,4,5-trinitrothiophen-2-amine Chemical compound NC=1SC([N+]([O-])=O)=C([N+]([O-])=O)C=1[N+]([O-])=O FDYLWXZGLNXBQT-UHFFFAOYSA-N 0.000 description 1
- SLKNLEPONRUFSK-UHFFFAOYSA-N 3,4-diamino-5-nitrobenzonitrile Chemical compound NC1=CC(C#N)=CC([N+]([O-])=O)=C1N SLKNLEPONRUFSK-UHFFFAOYSA-N 0.000 description 1
- DHYHYLGCQVVLOQ-UHFFFAOYSA-N 3-bromoaniline Chemical compound NC1=CC=CC(Br)=C1 DHYHYLGCQVVLOQ-UHFFFAOYSA-N 0.000 description 1
- DCTNYANFZYIEAB-UHFFFAOYSA-N 3-chloro-5-nitrothiophen-2-amine Chemical compound ClC1=C(SC(=C1)[N+](=O)[O-])N DCTNYANFZYIEAB-UHFFFAOYSA-N 0.000 description 1
- PNPCRKVUWYDDST-UHFFFAOYSA-N 3-chloroaniline Chemical compound NC1=CC=CC(Cl)=C1 PNPCRKVUWYDDST-UHFFFAOYSA-N 0.000 description 1
- RUYLULWJGCGKEV-UHFFFAOYSA-N 3-methyl-2-nitrothiophene Chemical compound CC=1C=CSC=1[N+]([O-])=O RUYLULWJGCGKEV-UHFFFAOYSA-N 0.000 description 1
- KDILIMALWBUMCY-UHFFFAOYSA-N 4-methyl-3,5-dinitrothiophen-2-amine Chemical compound CC1=C([N+]([O-])=O)SC(N)=C1[N+]([O-])=O KDILIMALWBUMCY-UHFFFAOYSA-N 0.000 description 1
- FHQRDEDZJIFJAL-UHFFFAOYSA-N 4-phenylmorpholine Chemical compound C1COCCN1C1=CC=CC=C1 FHQRDEDZJIFJAL-UHFFFAOYSA-N 0.000 description 1
- DZIJAMQPHHDKAM-UHFFFAOYSA-N 5-amino-4-cyano-3-methylthiophene-2-carboxamide Chemical compound CC1=C(C(N)=O)SC(N)=C1C#N DZIJAMQPHHDKAM-UHFFFAOYSA-N 0.000 description 1
- VVJZYYJUJFGNKU-UHFFFAOYSA-N 5-amino-4-nitrothiophene-2-carbonitrile Chemical compound NC=1SC(C#N)=CC=1[N+]([O-])=O VVJZYYJUJFGNKU-UHFFFAOYSA-N 0.000 description 1
- ZIOABGTXZUUIAD-UHFFFAOYSA-N 5-amino-4-nitrothiophene-2-carboxylic acid Chemical compound NC=1SC(C(O)=O)=CC=1[N+]([O-])=O ZIOABGTXZUUIAD-UHFFFAOYSA-N 0.000 description 1
- USCYAHHYQKHZEK-UHFFFAOYSA-N 5-amino-N,N-diethyl-4-nitrothiophene-2-carboxamide Chemical compound CCN(CC)C(=O)C1=CC([N+]([O-])=O)=C(N)S1 USCYAHHYQKHZEK-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- RPJXLEZOFUNGNZ-UHFFFAOYSA-N 5-methoxy-2-methylaniline Chemical compound COC1=CC=C(C)C(N)=C1 RPJXLEZOFUNGNZ-UHFFFAOYSA-N 0.000 description 1
- FMKMKBLHMONXJM-UHFFFAOYSA-N 5-methyl-2-phenylpyrazol-3-amine Chemical compound N1=C(C)C=C(N)N1C1=CC=CC=C1 FMKMKBLHMONXJM-UHFFFAOYSA-N 0.000 description 1
- PSRZQUKEUSRHJJ-UHFFFAOYSA-N 5-nitrothiophen-2-amine Chemical compound NC1=CC=C([N+]([O-])=O)S1 PSRZQUKEUSRHJJ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- 229920002284 Cellulose triacetate Polymers 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 125000003047 N-acetyl group Chemical group 0.000 description 1
- ABDMQSFNJPYOLA-UHFFFAOYSA-N NS(=O)(=O)[N+]([O-])=O Chemical class NS(=O)(=O)[N+]([O-])=O ABDMQSFNJPYOLA-UHFFFAOYSA-N 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical class [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 244000154870 Viola adunca Species 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 230000000397 acetylating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- YHWCPXVTRSHPNY-UHFFFAOYSA-N butan-1-olate;titanium(4+) Chemical compound [Ti+4].CCCC[O-].CCCC[O-].CCCC[O-].CCCC[O-] YHWCPXVTRSHPNY-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000005708 carbonyloxy group Chemical group [*:2]OC([*:1])=O 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- FPVGTPBMTFTMRT-UHFFFAOYSA-L disodium;2-amino-5-[(4-sulfonatophenyl)diazenyl]benzenesulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C(N)=CC=C1N=NC1=CC=C(S([O-])(=O)=O)C=C1 FPVGTPBMTFTMRT-UHFFFAOYSA-L 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- ZHBROGDSPSWMPO-UHFFFAOYSA-N ethyl 2-acetamido-4-methylthiophene-3-carboxylate Chemical compound CCOC(=O)C=1C(C)=CSC=1NC(C)=O ZHBROGDSPSWMPO-UHFFFAOYSA-N 0.000 description 1
- SMISMYGRSOUOJU-UHFFFAOYSA-N ethyl 2-acetamido-5-cyano-4-methylthiophene-3-carboxylate Chemical compound CCOC(=O)C=1C(C)=C(C#N)SC=1NC(C)=O SMISMYGRSOUOJU-UHFFFAOYSA-N 0.000 description 1
- JYSDXODDWAQWJR-UHFFFAOYSA-N ethyl 2-amino-4,5-dimethylthiophene-3-carboxylate Chemical compound CCOC(=O)C1=C(N)SC(C)=C1C JYSDXODDWAQWJR-UHFFFAOYSA-N 0.000 description 1
- QQDPRGVPYOPPBA-UHFFFAOYSA-N ethyl 2-amino-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate Chemical compound CCOC(=O)C1=C(N)SC(C(=O)NC=2C=CC=CC=2)=C1C QQDPRGVPYOPPBA-UHFFFAOYSA-N 0.000 description 1
- ILYCZKOBLRJJSW-UHFFFAOYSA-N ethyl 2-amino-4-methylthiophene-3-carboxylate Chemical compound CCOC(=O)C=1C(C)=CSC=1N ILYCZKOBLRJJSW-UHFFFAOYSA-N 0.000 description 1
- WYTHTMKMOSPACP-UHFFFAOYSA-N ethyl 2-amino-4-phenylthiophene-3-carboxylate Chemical compound CCOC(=O)C1=C(N)SC=C1C1=CC=CC=C1 WYTHTMKMOSPACP-UHFFFAOYSA-N 0.000 description 1
- SUDYCCQPUJJLDR-UHFFFAOYSA-N ethyl 2-amino-5-bromothiophene-3-carboxylate Chemical compound CCOC(=O)C=1C=C(Br)SC=1N SUDYCCQPUJJLDR-UHFFFAOYSA-N 0.000 description 1
- KZNNKLUXBNFFLZ-UHFFFAOYSA-N ethyl 2-amino-5-carbamoyl-4-methylthiophene-3-carboxylate Chemical compound CCOC(=O)C1=C(N)SC(C(N)=O)=C1C KZNNKLUXBNFFLZ-UHFFFAOYSA-N 0.000 description 1
- HUMLRQAUEFLAOO-UHFFFAOYSA-N ethyl 2-amino-5-chloro-4-methylthiophene-3-carboxylate Chemical compound CCOC(=O)C1=C(N)SC(Cl)=C1C HUMLRQAUEFLAOO-UHFFFAOYSA-N 0.000 description 1
- CVHZZPREEGCQBR-UHFFFAOYSA-N ethyl 2-amino-5-nitro-4-(4-nitrophenyl)thiophene-3-carboxylate Chemical compound CCOC(=O)C1=C(N)SC([N+]([O-])=O)=C1C1=CC=C([N+]([O-])=O)C=C1 CVHZZPREEGCQBR-UHFFFAOYSA-N 0.000 description 1
- MKJQYFVTEPGXIE-UHFFFAOYSA-N ethyl 2-aminothiophene-3-carboxylate Chemical compound CCOC(=O)C=1C=CSC=1N MKJQYFVTEPGXIE-UHFFFAOYSA-N 0.000 description 1
- NCCMCRFYSZRBBG-UHFFFAOYSA-N ethyl 5-amino-4-cyano-3-methylthiophene-2-carboxylate Chemical compound CCOC(=O)C=1SC(N)=C(C#N)C=1C NCCMCRFYSZRBBG-UHFFFAOYSA-N 0.000 description 1
- NYXZOVWQCSRKMZ-UHFFFAOYSA-N ethyl 5-methylthiophene-2-carboxylate Chemical compound CCOC(=O)C1=CC=C(C)S1 NYXZOVWQCSRKMZ-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 235000019233 fast yellow AB Nutrition 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000004994 m-toluidines Chemical class 0.000 description 1
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- MZBOBUPJGXDOFT-UHFFFAOYSA-N methyl 2-amino-4,5-dimethylthiophene-3-carboxylate Chemical compound COC(=O)C=1C(C)=C(C)SC=1N MZBOBUPJGXDOFT-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- FTWUXYZHDFCGSV-UHFFFAOYSA-N n,n'-diphenyloxamide Chemical compound C=1C=CC=CC=1NC(=O)C(=O)NC1=CC=CC=C1 FTWUXYZHDFCGSV-UHFFFAOYSA-N 0.000 description 1
- HKJNHYJTVPWVGV-UHFFFAOYSA-N n,n-diethyl-4-methylaniline Chemical compound CCN(CC)C1=CC=C(C)C=C1 HKJNHYJTVPWVGV-UHFFFAOYSA-N 0.000 description 1
- PJFIAKRRJLGWMD-UHFFFAOYSA-N n-(2,5-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC=C(OC)C(NC(=O)CC(C)=O)=C1 PJFIAKRRJLGWMD-UHFFFAOYSA-N 0.000 description 1
- DRXFARCOYOPZDW-UHFFFAOYSA-N n-(3-aminophenyl)butanamide Chemical compound CCCC(=O)NC1=CC=CC(N)=C1 DRXFARCOYOPZDW-UHFFFAOYSA-N 0.000 description 1
- NRYPAIPRDRHDTE-UHFFFAOYSA-N n-(3-cyano-5-nitrothiophen-2-yl)formamide Chemical compound [O-][N+](=O)C1=CC(C#N)=C(NC=O)S1 NRYPAIPRDRHDTE-UHFFFAOYSA-N 0.000 description 1
- YGHZTDCKVMBFIF-UHFFFAOYSA-N n-(3-cyanothiophen-2-yl)formamide Chemical compound O=CNC=1SC=CC=1C#N YGHZTDCKVMBFIF-UHFFFAOYSA-N 0.000 description 1
- QFGOIMALAWGJTG-UHFFFAOYSA-N n-(4-methylthiophen-2-yl)acetamide Chemical compound CC(=O)NC1=CC(C)=CS1 QFGOIMALAWGJTG-UHFFFAOYSA-N 0.000 description 1
- BTQVJGLHJQYVPI-UHFFFAOYSA-N n-(5-cyanothiophen-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(C#N)S1 BTQVJGLHJQYVPI-UHFFFAOYSA-N 0.000 description 1
- RYHPGKJBLSYSCH-UHFFFAOYSA-N n-(5-formylthiophen-2-yl)acetamide Chemical compound CC(=O)NC1=CC=C(C=O)S1 RYHPGKJBLSYSCH-UHFFFAOYSA-N 0.000 description 1
- NIICXGVKTWXNFY-UHFFFAOYSA-N n-[3-(benzenesulfonyl)thiophen-2-yl]acetamide Chemical compound S1C=CC(S(=O)(=O)C=2C=CC=CC=2)=C1NC(=O)C NIICXGVKTWXNFY-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- WHWPJUQTGCHISO-UHFFFAOYSA-N n-phenylthiophene-2-carboxamide Chemical compound C=1C=CSC=1C(=O)NC1=CC=CC=C1 WHWPJUQTGCHISO-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000005002 naphthylamines Chemical class 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 125000006502 nitrobenzyl group Chemical group 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- WXWCDTXEKCVRRO-UHFFFAOYSA-N para-Cresidine Chemical compound COC1=CC=C(C)C=C1N WXWCDTXEKCVRRO-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 239000004317 sodium nitrate Substances 0.000 description 1
- 235000010344 sodium nitrate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- JAUCIKCNYHCSIR-UHFFFAOYSA-M sodium;2-cyanoacetate Chemical compound [Na+].[O-]C(=O)CC#N JAUCIKCNYHCSIR-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- HIHKYDVSWLFRAY-UHFFFAOYSA-N thiophene-2,3-dicarboxylic acid Chemical compound OC(=O)C=1C=CSC=1C(O)=O HIHKYDVSWLFRAY-UHFFFAOYSA-N 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- 238000010023 transfer printing Methods 0.000 description 1
- LQKDCFTYZLOYBA-UHFFFAOYSA-N triethyl 5-aminothiophene-2,3,4-tricarboxylate Chemical compound CCOC(=O)C=1SC(N)=C(C(=O)OCC)C=1C(=O)OCC LQKDCFTYZLOYBA-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/42—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms
- C07D333/44—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms with nitro or nitroso radicals directly attached to ring carbon atoms attached in position 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0025—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds
- C09B29/0059—Monoazo dyes prepared by diazotising and coupling from diazotized amino heterocyclic compounds the heterocyclic ring containing only sulfur as heteroatom
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
- C09B29/3626—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O)
- C09B29/3634—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O) from diazotized heterocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3105172A GB1425029A (en) | 1972-07-03 | 1972-07-03 | Azo dyes derived from thiophene diazo components |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2333828A1 true DE2333828A1 (de) | 1974-01-17 |
Family
ID=10317230
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732333828 Pending DE2333828A1 (de) | 1972-07-03 | 1973-07-03 | Azofarbstoffe |
Country Status (13)
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0588489A1 (en) * | 1992-09-14 | 1994-03-23 | Zeneca Limited | Disperse dyes, free from sulphonic or carboxylic acid groups |
| WO1998023690A1 (en) * | 1996-11-27 | 1998-06-04 | Eastman Chemical Company | Method for preparing light-absorbing polymeric compositions |
| WO2012166584A1 (en) * | 2011-06-03 | 2012-12-06 | Milliken & Company | Thiophene azo carboxylate dyes and laundry care compositions containing the same |
| CN104053727B (zh) * | 2011-06-03 | 2016-11-30 | 美利肯公司 | 噻吩偶氮羧酸酯染料及包含其的衣物护理组合物 |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1480923A (en) * | 1974-12-05 | 1977-07-27 | Ici Ltd | Process for the manufacture of 2-amino-3-cyanothiophenes |
| EP0220042A3 (en) * | 1985-10-18 | 1990-01-17 | Imperial Chemical Industries Plc | Azo compound |
| US8715368B2 (en) | 2010-11-12 | 2014-05-06 | The Procter & Gamble Company | Thiophene azo dyes and laundry care compositions containing the same |
| US8888865B2 (en) | 2011-06-03 | 2014-11-18 | The Procter & Gamble Company | Thiophene azo carboxylate dyes and laundry care compositions containing the same |
| CN115368339B (zh) * | 2022-09-05 | 2024-04-05 | 浙江迪邦化工有限公司 | 一种2-乙酰氨基-3,5-二硝基噻吩的高产率连续合成方法 |
| CN116217542A (zh) * | 2023-03-21 | 2023-06-06 | 浙江万丰化工股份有限公司 | 一种染料中间体3,5-二硝基-2-乙酰氨基噻吩的制备方法 |
-
1972
- 1972-07-03 GB GB3105172A patent/GB1425029A/en not_active Expired
-
1973
- 1973-06-15 AU AU56986/73A patent/AU468842B2/en not_active Expired
- 1973-06-15 IT IT2544373A patent/IT994896B/it active
- 1973-06-25 BE BE132697A patent/BE801411A/xx unknown
- 1973-06-29 BR BR484773A patent/BR7304847D0/pt unknown
- 1973-06-29 CA CA175,347A patent/CA997754A/en not_active Expired
- 1973-07-02 FR FR7324210A patent/FR2236900B3/fr not_active Expired
- 1973-07-02 AR AR24887073A patent/AR197409A1/es active
- 1973-07-02 NL NL7309179A patent/NL7309179A/xx not_active Application Discontinuation
- 1973-07-03 DE DE19732333828 patent/DE2333828A1/de active Pending
- 1973-07-03 JP JP7516473A patent/JPS4963736A/ja active Pending
- 1973-07-03 ES ES416529A patent/ES416529A1/es not_active Expired
- 1973-07-03 CH CH968973A patent/CH575981A5/xx not_active IP Right Cessation
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0588489A1 (en) * | 1992-09-14 | 1994-03-23 | Zeneca Limited | Disperse dyes, free from sulphonic or carboxylic acid groups |
| WO1998023690A1 (en) * | 1996-11-27 | 1998-06-04 | Eastman Chemical Company | Method for preparing light-absorbing polymeric compositions |
| US6197223B1 (en) | 1996-11-27 | 2001-03-06 | Eastman Chemical Company | Method for preparing light-absorbing polymeric compositions |
| US6776930B2 (en) | 1996-11-27 | 2004-08-17 | Eastman Kodak Company | Method for preparing light-absorbing polymeric compositions |
| WO2012166584A1 (en) * | 2011-06-03 | 2012-12-06 | Milliken & Company | Thiophene azo carboxylate dyes and laundry care compositions containing the same |
| CN104053727A (zh) * | 2011-06-03 | 2014-09-17 | 美利肯公司 | 噻吩偶氮羧酸酯染料及包含其的衣物护理组合物 |
| US9163146B2 (en) | 2011-06-03 | 2015-10-20 | Milliken & Company | Thiophene azo carboxylate dyes and laundry care compositions containing the same |
| CN104053727B (zh) * | 2011-06-03 | 2016-11-30 | 美利肯公司 | 噻吩偶氮羧酸酯染料及包含其的衣物护理组合物 |
| US9567465B2 (en) | 2011-06-03 | 2017-02-14 | Milliken & Company | Thiophene azo carboxylate dyes and laundry care compositions containing the same |
Also Published As
| Publication number | Publication date |
|---|---|
| AR197409A1 (es) | 1974-04-05 |
| AU5698673A (en) | 1974-12-19 |
| JPS4963736A (enrdf_load_stackoverflow) | 1974-06-20 |
| CH575981A5 (enrdf_load_stackoverflow) | 1976-05-31 |
| FR2236900A1 (enrdf_load_stackoverflow) | 1975-02-07 |
| AU468842B2 (en) | 1976-01-22 |
| IT994896B (it) | 1975-10-20 |
| BR7304847D0 (pt) | 1974-08-29 |
| NL7309179A (enrdf_load_stackoverflow) | 1974-01-07 |
| ES416529A1 (es) | 1976-02-16 |
| GB1425029A (en) | 1976-02-18 |
| CA997754A (en) | 1976-09-28 |
| BE801411A (fr) | 1973-12-26 |
| FR2236900B3 (enrdf_load_stackoverflow) | 1976-06-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2304203C2 (de) | Disperse Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von Textilmaterialien | |
| DE2251719A1 (de) | Dispersionsfarbstoffe der 2,6diaminopyridinreihe | |
| JPS6139347B2 (enrdf_load_stackoverflow) | ||
| DE2340569C2 (de) | Azofarbstoffe | |
| DE2333828A1 (de) | Azofarbstoffe | |
| DE2004488A1 (en) | Water-soluble azo dyes for wool and poly-amide fibres | |
| DE2818101A1 (de) | Monoazodispersionsfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben von synthetischen textilmaterialien | |
| DE2531445C3 (de) | Sulfogruppenfreie wasserlösliche Azofarbstoffe und deren Verwendung zum Färben und/oder Bedrucken von synthetischen Textilfasern | |
| CH689353A5 (de) | Dispersionsfarbstoffe. | |
| DE2364476A1 (de) | Azofarbstoffe und ihre verwendung | |
| DE2509560A1 (de) | Verfahren zur herstellung von azoverbindungen | |
| DE2752805A1 (de) | Azofarbstoffe | |
| DE2046785A1 (en) | Basic mono-azo dyes - for synthetic fibres, cotton silk, leather, paper and paints | |
| DE2028395A1 (enrdf_load_stackoverflow) | ||
| CH618724A5 (en) | Process for the preparation of novel disperse dyestuffs of the monoazo series | |
| CH690824A5 (de) | Dispersionsfarbstoffe. | |
| DE2343115A1 (de) | Neue anthrachinonfarbstoffe, deren herstellung und verwendung | |
| DE1644282C3 (de) | Verfahren zur Herstellung von sulfonsäure- und carbonsäuregruppenfreien wasserunlöslichen Azofarbstoffen | |
| DE2003540C (enrdf_load_stackoverflow) | ||
| DE1644281C3 (de) | Wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| CH501703A (de) | Verfahren zur Herstellung wasserunlöslicher Monoazofarbstoffe | |
| DE2712969A1 (de) | Azofarbstoffe | |
| DE1644226C3 (de) | Wasserunlösliche Monoazoverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als Pigmente | |
| DE2339241A1 (de) | Azofarbstoffe | |
| DE2920590A1 (de) | Azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben von synthetischen polymeren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHA | Expiration of time for request for examination |