DE2329641C3 - Verfahren zur Polymerisation von ct-Olefinen - Google Patents
Verfahren zur Polymerisation von ct-OlefinenInfo
- Publication number
- DE2329641C3 DE2329641C3 DE2329641A DE2329641A DE2329641C3 DE 2329641 C3 DE2329641 C3 DE 2329641C3 DE 2329641 A DE2329641 A DE 2329641A DE 2329641 A DE2329641 A DE 2329641A DE 2329641 C3 DE2329641 C3 DE 2329641C3
- Authority
- DE
- Germany
- Prior art keywords
- polymerization
- component
- titanium
- aluminum
- millimoles
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000006116 polymerization reaction Methods 0.000 title claims description 46
- 238000000034 method Methods 0.000 title claims description 10
- 230000008569 process Effects 0.000 title claims description 7
- 239000010936 titanium Substances 0.000 claims description 39
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 36
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 36
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 33
- 229910052719 titanium Inorganic materials 0.000 claims description 33
- 229910052782 aluminium Inorganic materials 0.000 claims description 32
- -1 alkylaluminum chlorides Chemical class 0.000 claims description 30
- 239000011777 magnesium Substances 0.000 claims description 22
- 229930195733 hydrocarbon Natural products 0.000 claims description 19
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 18
- 239000003054 catalyst Substances 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 15
- 150000002430 hydrocarbons Chemical class 0.000 claims description 15
- 239000004215 Carbon black (E152) Substances 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 13
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 12
- 229910052749 magnesium Inorganic materials 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 7
- 239000005977 Ethylene Substances 0.000 claims description 7
- 229910052710 silicon Inorganic materials 0.000 claims description 7
- 239000010703 silicon Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 150000001805 chlorine compounds Chemical class 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 3
- 229910002651 NO3 Inorganic materials 0.000 claims description 3
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 238000005406 washing Methods 0.000 claims description 3
- 239000004711 α-olefin Substances 0.000 claims description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 239000002283 diesel fuel Substances 0.000 description 26
- 239000004743 Polypropylene Substances 0.000 description 20
- 229920001155 polypropylene Polymers 0.000 description 20
- 239000000203 mixture Substances 0.000 description 16
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 15
- 239000000725 suspension Substances 0.000 description 13
- 229920000642 polymer Polymers 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 150000002681 magnesium compounds Chemical class 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 6
- 150000001336 alkenes Chemical class 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 150000003609 titanium compounds Chemical class 0.000 description 6
- 239000004698 Polyethylene Substances 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000000178 monomer Substances 0.000 description 5
- 229920000573 polyethylene Polymers 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 4
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 4
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 4
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 3
- 229910003902 SiCl 4 Inorganic materials 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 150000007942 carboxylates Chemical group 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 238000007373 indentation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000037048 polymerization activity Effects 0.000 description 2
- 229920000098 polyolefin Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 2
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 235000000434 Melocanna baccifera Nutrition 0.000 description 1
- 241001497770 Melocanna baccifera Species 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000005234 alkyl aluminium group Chemical group 0.000 description 1
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- ZQAWBRRSQKDOEL-UHFFFAOYSA-J chloro(diethyl)alumane;trichlorotitanium Chemical compound Cl[Ti](Cl)Cl.CC[Al](Cl)CC ZQAWBRRSQKDOEL-UHFFFAOYSA-J 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 229920001887 crystalline plastic Polymers 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- CQYBWJYIKCZXCN-UHFFFAOYSA-N diethylaluminum Chemical compound CC[Al]CC CQYBWJYIKCZXCN-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- XDKQUSKHRIUJEO-UHFFFAOYSA-N magnesium;ethanolate Chemical compound [Mg+2].CC[O-].CC[O-] XDKQUSKHRIUJEO-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329641A DE2329641C3 (de) | 1973-06-09 | 1973-06-09 | Verfahren zur Polymerisation von ct-Olefinen |
| IN1180/CAL/74A IN140716B (show.php) | 1973-06-09 | 1974-05-29 | |
| CA201,162A CA1018299A (en) | 1973-06-09 | 1974-05-29 | Process for polymerizing -olefines |
| ES426885A ES426885A1 (es) | 1973-06-09 | 1974-06-03 | Procedimiento para la polimerizacion de alfa-olefinas. |
| NL7407491A NL7407491A (show.php) | 1973-06-09 | 1974-06-04 | |
| US05/476,584 US3951935A (en) | 1973-06-09 | 1974-06-05 | Process for polymerizing α-olefines |
| AU69860/74A AU6986074A (en) | 1973-06-09 | 1974-06-06 | Polymerizing alpha-olefines |
| IT23747/74A IT1014875B (it) | 1973-06-09 | 1974-06-07 | Processo per la polimerizzazione di alfa olefine |
| JP49064177A JPS5034084A (show.php) | 1973-06-09 | 1974-06-07 | |
| ZA00743629A ZA743629B (en) | 1973-06-09 | 1974-06-07 | Process for polymerizing alpha-olefines |
| BR4716/74A BR7404716D0 (pt) | 1973-06-09 | 1974-06-07 | Processo para a preparacao de uma poliolefina |
| FR7419997A FR2232552B1 (show.php) | 1973-06-09 | 1974-06-10 | |
| BE145241A BE816119A (fr) | 1973-06-09 | 1974-06-10 | Procede de polymerisation d'alpha -olefines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329641A DE2329641C3 (de) | 1973-06-09 | 1973-06-09 | Verfahren zur Polymerisation von ct-Olefinen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2329641A1 DE2329641A1 (de) | 1974-12-19 |
| DE2329641B2 DE2329641B2 (de) | 1978-02-09 |
| DE2329641C3 true DE2329641C3 (de) | 1978-09-28 |
Family
ID=5883651
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2329641A Expired DE2329641C3 (de) | 1973-06-09 | 1973-06-09 | Verfahren zur Polymerisation von ct-Olefinen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3951935A (show.php) |
| JP (1) | JPS5034084A (show.php) |
| AU (1) | AU6986074A (show.php) |
| BE (1) | BE816119A (show.php) |
| BR (1) | BR7404716D0 (show.php) |
| CA (1) | CA1018299A (show.php) |
| DE (1) | DE2329641C3 (show.php) |
| ES (1) | ES426885A1 (show.php) |
| FR (1) | FR2232552B1 (show.php) |
| IN (1) | IN140716B (show.php) |
| IT (1) | IT1014875B (show.php) |
| NL (1) | NL7407491A (show.php) |
| ZA (1) | ZA743629B (show.php) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4239650A (en) | 1977-11-25 | 1980-12-16 | Hoechst Aktiengesellschaft | Process for the manufacture of a mixed catalyst |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50160405A (show.php) * | 1974-06-20 | 1975-12-25 | ||
| JPS50160406A (show.php) * | 1974-06-20 | 1975-12-25 | ||
| US4039472A (en) * | 1975-11-14 | 1977-08-02 | Standard Oil Company (Indiana) | Increasing the particle size of as formed polyethylene or ethylene copolymer |
| JPS52136904A (en) * | 1976-05-08 | 1977-11-16 | Terukichi Hayashi | Apparatus for treating woods |
| US4081589A (en) * | 1976-12-20 | 1978-03-28 | The Standard Oil Company | Elimination of fibrous polymers |
| US4128502A (en) * | 1976-12-30 | 1978-12-05 | Standard Oil Company (Indiana) | Ethylene polymerization catalyst |
| DE2906639C2 (de) * | 1979-02-21 | 1982-03-25 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von weitgehend amorphen Ho mo- und/oder Copolymerisaten von α-Olefinen mit 3-3 2 Kohlenstoffatomen |
| JPS6042805B2 (ja) * | 1979-02-27 | 1985-09-25 | 日石三菱株式会社 | 共重合体の製法 |
| US4276191A (en) * | 1979-06-04 | 1981-06-30 | Standard Oil Company (Indiana) | Catalyst and process for polymerization of alpha-olefins |
| US4244838A (en) * | 1979-06-25 | 1981-01-13 | The Dow Chemical Company | High efficiency catalyst for polymerizing olefins |
| US4246383A (en) * | 1979-06-25 | 1981-01-20 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from an organomagnesium component which does not reduce TiCl4 |
| JPS5669103A (en) * | 1979-11-09 | 1981-06-10 | Koshi Preserving Kk | Insizing device |
| US4326988A (en) * | 1980-08-12 | 1982-04-27 | Phillips Petroleum Company | Catalyst, method of producing the catalyst, and polymerization process employing the catalyst |
| US4325837A (en) * | 1980-08-12 | 1982-04-20 | Phillips Petroleum Company | Catalyst, method of producing the catalyst, and polymerization process employing the catalyst |
| US4496660A (en) * | 1980-10-01 | 1985-01-29 | The Dow Chemical Company | Catalyst prepared from organo-magnesium compound; oxygen- or nitrogen-containing compound; halide source; transition metal compound and reducing agent |
| DE3148229A1 (de) * | 1981-12-05 | 1983-06-09 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von polyolefinwachsen |
| US4544647A (en) * | 1982-07-29 | 1985-10-01 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4426316A (en) | 1982-09-10 | 1984-01-17 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4605715A (en) * | 1982-09-20 | 1986-08-12 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4604374A (en) * | 1982-09-20 | 1986-08-05 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4434282A (en) | 1982-10-04 | 1984-02-28 | The Dow Chemical Company | Process for polymerizing olefins |
| US4456547A (en) * | 1982-10-21 | 1984-06-26 | Fuentes Jr Ricardo | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and complex formed from admixture of a transition metal compound and an organozinc compound |
| US4540756A (en) * | 1983-11-01 | 1985-09-10 | Hercules Incorporated | Process for making low crystallinity polyolefins |
| JPS60115603A (ja) * | 1983-11-29 | 1985-06-22 | Toa Nenryo Kogyo Kk | オレフインの重合方法 |
| US4549001A (en) * | 1984-09-27 | 1985-10-22 | Phillips Petroleum Company | Olefin polymerization |
| US4559317A (en) * | 1984-09-27 | 1985-12-17 | Phillips Petroleum Company | Olefin polymerization |
| US4661465A (en) * | 1985-10-31 | 1987-04-28 | The Dow Chemical Company | Method for preparing transition metal component of Ziegler-Natta catalysts |
| US4859757A (en) * | 1986-06-30 | 1989-08-22 | Rexene Products Company | Novel propylene polymers |
| US5045612A (en) * | 1990-04-18 | 1991-09-03 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5114897A (en) * | 1990-04-18 | 1992-05-19 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5100069A (en) * | 1990-08-27 | 1992-03-31 | Barclay Randel L | Hubless interlocking shearing machine with shallow gullet depths |
| EP0571882B1 (de) * | 1992-05-26 | 1997-03-12 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von Polyolefinwachsen |
| TW303368B (show.php) * | 1992-08-08 | 1997-04-21 | Hoechst Ag | |
| US5750813A (en) * | 1992-12-15 | 1998-05-12 | Clarian & Gmbh | Process for the preparation of polyolefin waxes |
| US5449732A (en) * | 1993-06-18 | 1995-09-12 | Conoco Inc. | Solvent free oil soluble drag reducing polymer suspension |
| US5521263A (en) * | 1994-10-18 | 1996-05-28 | Eastman Chemical Company | Catalysts and synthesis of high molecular weight amorphous polyolefins and recovery thereof |
| DE19544493A1 (de) * | 1995-11-29 | 1997-06-05 | Basf Ag | Strahlungshärtbare Zusammensetzung enthaltend alpha-Olefine |
| US6015779A (en) | 1996-03-19 | 2000-01-18 | Energy & Environmental International, L.C. | Methods for forming amorphous ultra-high molecular weight polyalphaolefin drag reducing agents |
| US5916801A (en) * | 1996-10-31 | 1999-06-29 | Lopinto; Richard William | Nectophotometer |
| DE19648895A1 (de) * | 1996-11-26 | 1998-05-28 | Clariant Gmbh | Polar modifizierte Polypropylen-Wachse |
| EP0890619B1 (de) * | 1997-07-11 | 2004-10-27 | Clariant GmbH | Verwendung von Polyolefinwachsen |
| DE19729833A1 (de) | 1997-07-11 | 1999-01-14 | Clariant Gmbh | Polypropylenwachs |
| US6815011B2 (en) | 2000-11-27 | 2004-11-09 | Energy & Environmental International, L.C. | Alpha olefin monomer partitioning agents for drag reducing agents and methods of forming drag reducing agents using alpha olefin monomer partitioning agents |
| DE60235444D1 (de) | 2001-01-16 | 2010-04-08 | Beta Technologies Ag | Verfahren zur herstellung von amorphen polyolefinen mit ultrahohem molekulargewicht zur strömungbeschleunigung |
| US7012046B2 (en) * | 2001-06-08 | 2006-03-14 | Eaton Gerald B | Drag reducing agent slurries having alfol alcohols and processes for forming drag reducing agent slurries having alfol alcohols |
| US20040166337A1 (en) * | 2003-02-20 | 2004-08-26 | Toray Plastics (America), Inc. | Biaxially oriented polypropylene high barrier metallized film for packaging |
| DE102007036792A1 (de) * | 2007-08-03 | 2009-02-05 | Clariant International Limited | Hochkristalline Polypropylenwachse |
| EP2113541A1 (en) | 2008-04-28 | 2009-11-04 | Borealis AG | Adhesive propylene polymer composition suitable for extrusion coating of paper substrates |
| DE102014001432A1 (de) | 2014-02-05 | 2015-08-06 | Clariant lnternational Ltd | Wässrige Wachsdispersionen für Oberflächenbeschichtungen |
| WO2016174019A1 (de) | 2015-04-29 | 2016-11-03 | Clariant International Ltd | Kurzkettige polyethylen-homopolymere mit verbesserter mahlbarkeit |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL135605C (show.php) * | 1968-01-17 | |||
| US3676415A (en) * | 1968-06-27 | 1972-07-11 | Hoechst Ag | Process for polymerizing {60 -olefins |
| US3644318A (en) * | 1968-08-21 | 1972-02-22 | Hoechst Ag | Process for the polymerization of olefins |
| DE1929863A1 (de) * | 1969-06-12 | 1970-12-17 | Hoechst Ag | Verfahren zur Polymerisation von Olefinen |
| DE1964186A1 (de) * | 1969-12-22 | 1971-06-24 | Hoechst Ag | Verfahren zur Polymerisation von alpha-Olefinen |
| DE2021831C3 (de) * | 1970-05-05 | 1974-08-01 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Verfahren zur Herstellung von Polymerisationskatalysatoren |
| DE2043508A1 (de) * | 1970-09-02 | 1972-03-16 | Farbwerke Hoechst AG, vorm. Meister Lucius & Brüning, 6000 Frankfurt | Verfahren zur Herstellung von Polyolefinen |
| DE2111455A1 (de) * | 1971-03-10 | 1972-09-28 | Hoechst Ag | Verfahren zur Herstellung von Polyolefinen |
-
1973
- 1973-06-09 DE DE2329641A patent/DE2329641C3/de not_active Expired
-
1974
- 1974-05-29 IN IN1180/CAL/74A patent/IN140716B/en unknown
- 1974-05-29 CA CA201,162A patent/CA1018299A/en not_active Expired
- 1974-06-03 ES ES426885A patent/ES426885A1/es not_active Expired
- 1974-06-04 NL NL7407491A patent/NL7407491A/xx not_active Application Discontinuation
- 1974-06-05 US US05/476,584 patent/US3951935A/en not_active Expired - Lifetime
- 1974-06-06 AU AU69860/74A patent/AU6986074A/en not_active Expired
- 1974-06-07 ZA ZA00743629A patent/ZA743629B/xx unknown
- 1974-06-07 BR BR4716/74A patent/BR7404716D0/pt unknown
- 1974-06-07 JP JP49064177A patent/JPS5034084A/ja active Pending
- 1974-06-07 IT IT23747/74A patent/IT1014875B/it active
- 1974-06-10 FR FR7419997A patent/FR2232552B1/fr not_active Expired
- 1974-06-10 BE BE145241A patent/BE816119A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4239650A (en) | 1977-11-25 | 1980-12-16 | Hoechst Aktiengesellschaft | Process for the manufacture of a mixed catalyst |
Also Published As
| Publication number | Publication date |
|---|---|
| ZA743629B (en) | 1975-06-25 |
| BE816119A (fr) | 1974-12-10 |
| ES426885A1 (es) | 1976-09-01 |
| NL7407491A (show.php) | 1974-12-11 |
| FR2232552A1 (show.php) | 1975-01-03 |
| AU6986074A (en) | 1975-12-11 |
| JPS5034084A (show.php) | 1975-04-02 |
| CA1018299A (en) | 1977-09-27 |
| BR7404716D0 (pt) | 1975-01-21 |
| IN140716B (show.php) | 1976-12-11 |
| DE2329641B2 (de) | 1978-02-09 |
| FR2232552B1 (show.php) | 1978-01-13 |
| US3951935A (en) | 1976-04-20 |
| IT1014875B (it) | 1977-04-30 |
| DE2329641A1 (de) | 1974-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2329641C3 (de) | Verfahren zur Polymerisation von ct-Olefinen | |
| DE2700774B2 (de) | Verfahren zur Herstellung einer Propylenpolymerisat-Masse mit einem Äthylengehalt von 3 bis 40 Mol-Prozent | |
| DE2615390C3 (de) | Verfahren zur Polymerisation von Äthylen, allein oder zusammen mit α-Olefinen mit 3 - 20 C-Atomen oder mit Diolefinen | |
| DE1645585C2 (de) | Verfahren zur Homopolymerisation bzw. Mischpolymerisation von Äthylen | |
| EP0023249B1 (de) | Verfahren zur Herstellung von weitgehend amorphen Buten-1-Propen-Ethen-Terpolymeren mit hohem Erweichungspunkt | |
| DE3028759A1 (de) | Katalysatoren fuer die polymerisation und copolymerisation von olefinen, deren herstellung und mit ihnen durchgefuehrtes polymerisationsverfahren | |
| DE1420365A1 (de) | Verfahren zur Herstellung fester kristalliner Polymerisate aus Olefinen | |
| DE69012981T2 (de) | Katalysatorzusammensetzung auf Zirkoniumbasis für Olefinpolymerisation. | |
| DE2637990A1 (de) | Propylen-terpolymer | |
| DE69026283T2 (de) | Ein Ziegler-Nattakatalysatorbestandteil | |
| DE1929863A1 (de) | Verfahren zur Polymerisation von Olefinen | |
| DE2847986A1 (de) | Verfahren zur herstellung von pulverfoermigen, thermoplastischen copolymeren aus aethylen und buten-(1) | |
| DE2905455A1 (de) | Verfahren zur herstellung von pulverfoermigem isotaktischem polyolefin | |
| DE2054950A1 (de) | Mischkatalysator Our Polymerisation von alpha-Olefinen | |
| DE69109434T2 (de) | Feste Komponente eines Katalysators zur Homo- und Co-Polymerisation von Ethyl. | |
| DE69206945T2 (de) | Katalysator für Olefinpolymerisation | |
| DE3140664A1 (de) | "blockpolymerisationsverfahren zur herstellung von schlagfesten aethylen/propylen-blockpolymeren bei hoher produktivitaet" | |
| DE2917451C2 (de) | Physikalisch gemischte Propylenpolymerisatzusammensetzung | |
| DE2600593A1 (de) | Katalysator und verfahren zur herstellung von polyolefinen | |
| DE2346471C3 (de) | Verfahren zur Homopolymerisation von Äthylen oder Propylen und zur Mischpolymerisation von Äthylen mit einem α-Olefin und/oder Diolefin und Katalysatorzusammensetzung hierfür | |
| DE68925488T2 (de) | Blockcopolymere aus Propylen und Verfahren zu ihrer Herstellung | |
| EP0223011A1 (de) | Verfahren zur Homo- und Mischpolymerisation von Olefinen | |
| DE3027350C2 (de) | Blockmischpolymerisationsverfahren | |
| DE3336761A1 (de) | Verfahren zur herstellung eines aethylen-copolymeren | |
| DE2528558A1 (de) | Verfahren zur herstellung eines polyolefins |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |