DE2249638B2 - Phlegmatisierter roter Phosphor - Google Patents
Phlegmatisierter roter PhosphorInfo
- Publication number
- DE2249638B2 DE2249638B2 DE2249638A DE2249638A DE2249638B2 DE 2249638 B2 DE2249638 B2 DE 2249638B2 DE 2249638 A DE2249638 A DE 2249638A DE 2249638 A DE2249638 A DE 2249638A DE 2249638 B2 DE2249638 B2 DE 2249638B2
- Authority
- DE
- Germany
- Prior art keywords
- red phosphorus
- phosphorus
- samples
- weight
- paraffin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 title claims description 54
- 239000007788 liquid Substances 0.000 claims description 7
- 239000002245 particle Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 2
- 239000008240 homogeneous mixture Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 description 10
- 239000012188 paraffin wax Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 239000011574 phosphorus Substances 0.000 description 8
- 229910052698 phosphorus Inorganic materials 0.000 description 8
- 239000000428 dust Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 238000002156 mixing Methods 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000002480 mineral oil Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 4
- 239000005662 Paraffin oil Substances 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 235000010446 mineral oil Nutrition 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 239000011261 inert gas Substances 0.000 description 3
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 description 2
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 2
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 2
- 229920001400 block copolymer Polymers 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- -1 polyethylene Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229920002545 silicone oil Polymers 0.000 description 2
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 2
- 229940029284 trichlorofluoromethane Drugs 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 238000009933 burial Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000003961 organosilicon compounds Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B25/00—Phosphorus; Compounds thereof
- C01B25/003—Phosphorus
- C01B25/006—Stabilisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Lubricants (AREA)
- Developing Agents For Electrophotography (AREA)
- Processing And Handling Of Plastics And Other Materials For Molding In General (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2249638A DE2249638B2 (de) | 1972-10-11 | 1972-10-11 | Phlegmatisierter roter Phosphor |
| NLAANVRAGE7312725,A NL177103C (nl) | 1972-10-11 | 1973-09-14 | Werkwijze voor het bereiden van geflegmatiseerde, vrij stromende rode fosfor. |
| CA181,845A CA995875A (en) | 1972-10-11 | 1973-09-25 | Desensitized free-flowing red phosphorus |
| DD173839A DD106616A5 (enExample) | 1972-10-11 | 1973-10-01 | |
| GB4598073A GB1397211A (en) | 1972-10-11 | 1973-10-02 | Desensitized free-flowing red phosphours |
| US05/403,462 US3974260A (en) | 1972-10-11 | 1973-10-04 | Desensitized free-flowing red phosphorus |
| SE7313722A SE396062B (sv) | 1972-10-11 | 1973-10-09 | Flegmatiserad, fririnnande, rod fosfor samt sett for dess framstellning |
| IT53008/73A IT997752B (it) | 1972-10-11 | 1973-10-09 | Fosforo rosso flemmatizzato e procedimento per produrlo |
| JP48113762A JPS5018614A (enExample) | 1972-10-11 | 1973-10-09 | |
| FR7336232A FR2202846B1 (enExample) | 1972-10-11 | 1973-10-10 | |
| BE136507A BE805875A (fr) | 1972-10-11 | 1973-10-10 | Phosphore rouge desensibilise a l'etat de poudre fluide |
| SU1967203A SU560525A3 (ru) | 1972-10-11 | 1973-10-10 | Способ стабилизации порошкообразного красного фосфора |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2249638A DE2249638B2 (de) | 1972-10-11 | 1972-10-11 | Phlegmatisierter roter Phosphor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2249638A1 DE2249638A1 (de) | 1974-04-18 |
| DE2249638B2 true DE2249638B2 (de) | 1981-01-15 |
Family
ID=5858654
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2249638A Ceased DE2249638B2 (de) | 1972-10-11 | 1972-10-11 | Phlegmatisierter roter Phosphor |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3974260A (enExample) |
| JP (1) | JPS5018614A (enExample) |
| BE (1) | BE805875A (enExample) |
| CA (1) | CA995875A (enExample) |
| DD (1) | DD106616A5 (enExample) |
| DE (1) | DE2249638B2 (enExample) |
| FR (1) | FR2202846B1 (enExample) |
| GB (1) | GB1397211A (enExample) |
| IT (1) | IT997752B (enExample) |
| NL (1) | NL177103C (enExample) |
| SE (1) | SE396062B (enExample) |
| SU (1) | SU560525A3 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3323135A1 (de) * | 1982-06-29 | 1984-02-09 | Erco Industries Ltd., Islington, Ontario | Stabilisierter roter phosphor und verfahren zum stabilisieren von rotem phosphor |
| EP0176836A3 (en) * | 1984-10-03 | 1988-11-23 | Hoechst Aktiengesellschaft | Desensitized red phosphorus |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1436640A (en) * | 1972-11-16 | 1976-05-19 | Williams C I | Method and apapratus for progressively constructing large concrete structures |
| JPS5254913U (enExample) * | 1975-10-18 | 1977-04-20 | ||
| DE2622296C2 (de) * | 1976-05-19 | 1984-12-06 | Hoechst Ag, 6230 Frankfurt | Stabilisierter roter Phosphor sowie Verfahren zu seiner Herstellung |
| DE2631532C2 (de) * | 1976-07-14 | 1984-09-13 | Hoechst Ag, 6230 Frankfurt | Stabilisierter pulverförmiger roter Phosphor sowie Verfahren zu seiner Herstellung |
| DE2632296C2 (de) * | 1976-07-17 | 1979-02-01 | Hoechst Ag, 6000 Frankfurt | Stabilisierter roter Phosphor sowie Verfahren zu seiner Herstellung |
| US4421728A (en) * | 1982-07-07 | 1983-12-20 | Erco Industries Limited | Stabilization of red phosphorus |
| CA1214314A (en) * | 1983-12-08 | 1986-11-25 | Helena Twardowska | Stabilization of red phosphorus |
| AU3756389A (en) * | 1988-05-31 | 1990-01-05 | Robert J. Darby | Reusable winding tube |
| DE3905039A1 (de) * | 1989-02-18 | 1990-08-23 | Hoechst Ag | Phlegmatisierter roter phosphor |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1433100A (en) * | 1921-12-22 | 1922-10-24 | Essex Specialty Co Inc | Phosphorus compound |
| US1692996A (en) * | 1925-12-10 | 1928-11-27 | Emma D Richardson | Method for protecting granular substances and resulting product |
| US1853818A (en) * | 1931-06-25 | 1932-04-12 | Texas Gulf Sulphur Co | Fire-proofing sulphur |
| US2005944A (en) * | 1932-03-14 | 1935-06-25 | Shell Dev | Stabilized form of phosphorus pentoxide |
| US2440303A (en) * | 1941-09-08 | 1948-04-27 | Martin S Silverstein | Increasing the resistance of red phosphorus to oxidation |
| US2926096A (en) * | 1955-04-27 | 1960-02-23 | Monsanto Chemicals | Impregnating composition |
| US3629309A (en) * | 1956-10-12 | 1971-12-21 | Union Carbide Corp | Organosilicon compounds and processes for producing the same |
| US3179589A (en) * | 1960-12-27 | 1965-04-20 | Stop Fire Inc | Fire extinguishing composition and method of making the same |
| US3220858A (en) * | 1961-11-06 | 1965-11-30 | Chapman Chem Co | Fire retardant |
| US3194846A (en) * | 1963-05-13 | 1965-07-13 | Allied Chem | Stabilized chlorinated paraffin wax |
| DE1567629B1 (de) * | 1966-06-24 | 1970-05-27 | Knapsack Ag | Verfahren zum Impraegnieren von rotem Phosphor |
| US3826762A (en) * | 1969-07-23 | 1974-07-30 | M & T Chemicals Inc | Non-burning polyurethane foam containing a non-porous filler,a halogen source,and a phosphorus-containing compound |
| DE2000033B2 (de) * | 1970-01-02 | 1971-11-11 | Knapsack AG, 5033 Hürth-Knapsack | Verfahren zum herstellen von passiviertem rotem phosphor |
| DE2128582A1 (de) * | 1971-06-09 | 1973-01-04 | Basf Ag | Mit trioxan impraegnierter roter phosphor |
-
1972
- 1972-10-11 DE DE2249638A patent/DE2249638B2/de not_active Ceased
-
1973
- 1973-09-14 NL NLAANVRAGE7312725,A patent/NL177103C/xx not_active IP Right Cessation
- 1973-09-25 CA CA181,845A patent/CA995875A/en not_active Expired
- 1973-10-01 DD DD173839A patent/DD106616A5/xx unknown
- 1973-10-02 GB GB4598073A patent/GB1397211A/en not_active Expired
- 1973-10-04 US US05/403,462 patent/US3974260A/en not_active Expired - Lifetime
- 1973-10-09 JP JP48113762A patent/JPS5018614A/ja active Pending
- 1973-10-09 SE SE7313722A patent/SE396062B/xx unknown
- 1973-10-09 IT IT53008/73A patent/IT997752B/it active
- 1973-10-10 BE BE136507A patent/BE805875A/xx not_active IP Right Cessation
- 1973-10-10 SU SU1967203A patent/SU560525A3/ru active
- 1973-10-10 FR FR7336232A patent/FR2202846B1/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3323135A1 (de) * | 1982-06-29 | 1984-02-09 | Erco Industries Ltd., Islington, Ontario | Stabilisierter roter phosphor und verfahren zum stabilisieren von rotem phosphor |
| EP0176836A3 (en) * | 1984-10-03 | 1988-11-23 | Hoechst Aktiengesellschaft | Desensitized red phosphorus |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7312725A (enExample) | 1974-04-16 |
| NL177103C (nl) | 1985-08-01 |
| NL177103B (nl) | 1985-03-01 |
| US3974260A (en) | 1976-08-10 |
| BE805875A (fr) | 1974-04-10 |
| DD106616A5 (enExample) | 1974-06-20 |
| CA995875A (en) | 1976-08-31 |
| SU560525A3 (ru) | 1977-05-30 |
| GB1397211A (en) | 1975-06-11 |
| JPS5018614A (enExample) | 1975-02-27 |
| FR2202846A1 (enExample) | 1974-05-10 |
| SE396062B (sv) | 1977-09-05 |
| FR2202846B1 (enExample) | 1977-03-11 |
| IT997752B (it) | 1975-12-30 |
| DE2249638A1 (de) | 1974-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3031369C2 (de) | Pyrotechnische Ladung aus Nebelsatz und Anzündsatz und Verfahren zur Herstellung der Nebelmischung und des Anzündsatzes | |
| DE69724441T2 (de) | Feuerlöschverfahren und feuerlöschsystem | |
| DE69904950T2 (de) | Aerosolbildendes feuerlöschmittel | |
| DE2249638B2 (de) | Phlegmatisierter roter Phosphor | |
| DE1542633B2 (de) | Verfahren zur herstellung eines oleophilen graphits und seine verwendung | |
| DE3620024C2 (enExample) | ||
| DE1592219A1 (de) | Neues oleophiles Molybdaenisulfid und Verfahren zur seiner Herstellung | |
| DE3238455A1 (de) | Nebelwurfkoerper | |
| DE2339581A1 (de) | Flammwidrige formmassen auf der basis von polyolefinen | |
| EP0560095B1 (de) | Aerosolbildendes Feuerlöschmittel | |
| DE1298718B (de) | Treibmittel fuer Polymere | |
| DE3320857C2 (enExample) | ||
| DE2451701C3 (de) | Rauch- oder Nebelsatz und Verfahren zu seiner Herstellung | |
| DE2530209A1 (de) | Brandmittel-zusammensetzung | |
| DE704223C (de) | Verfahren und Einrichtung zur Herstellung fettarmen bzw. fettfreien, feinen Aluminiumpulvers | |
| DE1816751A1 (de) | Anorganische,oxydierende Sprengstoffsalze | |
| DE1030953B (de) | Brennstoffzusammensetzungen | |
| US3166450A (en) | Ammonium nitrate-chromate salt explosive compositions | |
| DE1694530B2 (de) | Nichtglimmende Polyvinylchlorid formmasse | |
| DE2745333A1 (de) | Verfahren zur verringerung der entzuendungsgefahr bei kohlenwasserstoff- aerosolen | |
| DE1594514A1 (de) | Schmiermittelgemisch | |
| DE1812521C3 (de) | Verwendung eines Gemisches aus rotem Phosphor, Ammoniumbromid und Chlorparaffin als Flammschutzmittel für Füllstoffe und RuB enthaltende Kautschukmischungen | |
| DE2230120B2 (de) | Verfahren zur Herstellung von Reaktionsmischungen aus feinverteilten Metallen oder Legierungen und festen perhalogenierten Kohlenstoffverbindungen | |
| DE86568C (enExample) | ||
| DE2100030C3 (de) | Verfahren zur Herstellung von GuBladungen mit verringerter Rißbildung und Ausseigerung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8263 | Opposition against grant of a patent | ||
| 8235 | Patent refused |