DE2243226A1 - Flammwidrige thermoplastische massen - Google Patents
Flammwidrige thermoplastische massenInfo
- Publication number
- DE2243226A1 DE2243226A1 DE2243226A DE2243226A DE2243226A1 DE 2243226 A1 DE2243226 A1 DE 2243226A1 DE 2243226 A DE2243226 A DE 2243226A DE 2243226 A DE2243226 A DE 2243226A DE 2243226 A1 DE2243226 A1 DE 2243226A1
- Authority
- DE
- Germany
- Prior art keywords
- flame
- retardant
- compositions according
- styrene
- thermoplastic compositions
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000203 mixture Substances 0.000 title claims description 54
- 229920001169 thermoplastic Polymers 0.000 title claims description 45
- 239000004416 thermosoftening plastic Substances 0.000 title claims description 43
- -1 alkylene isophthalates Chemical class 0.000 claims description 49
- 239000003063 flame retardant Substances 0.000 claims description 49
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 43
- 229920000642 polymer Polymers 0.000 claims description 38
- 229920005989 resin Polymers 0.000 claims description 28
- 239000011347 resin Substances 0.000 claims description 28
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 24
- 229920005992 thermoplastic resin Polymers 0.000 claims description 22
- 150000002989 phenols Chemical class 0.000 claims description 18
- 229920000515 polycarbonate Polymers 0.000 claims description 13
- 239000004417 polycarbonate Substances 0.000 claims description 13
- 239000003365 glass fiber Substances 0.000 claims description 12
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 11
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 11
- 150000004649 carbonic acid derivatives Chemical class 0.000 claims description 11
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 10
- 150000001463 antimony compounds Chemical class 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 239000000178 monomer Substances 0.000 claims description 10
- 229920001577 copolymer Polymers 0.000 claims description 9
- 238000006116 polymerization reaction Methods 0.000 claims description 9
- 229920000728 polyester Polymers 0.000 claims description 8
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 7
- 229920001955 polyphenylene ether Polymers 0.000 claims description 7
- 229920002554 vinyl polymer Polymers 0.000 claims description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 6
- 239000004793 Polystyrene Substances 0.000 claims description 6
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 6
- 229920002223 polystyrene Polymers 0.000 claims description 6
- 239000002243 precursor Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 125000001246 bromo group Chemical group Br* 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 5
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 3
- 239000004952 Polyamide Substances 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 229920001281 polyalkylene Polymers 0.000 claims description 3
- 229920002647 polyamide Polymers 0.000 claims description 3
- 229920002857 polybutadiene Polymers 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 239000005062 Polybutadiene Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229940125782 compound 2 Drugs 0.000 claims description 2
- 229920003244 diene elastomer Polymers 0.000 claims description 2
- 229920005669 high impact polystyrene Polymers 0.000 claims description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical class OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 claims description 2
- 125000005395 methacrylic acid group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 229920000379 polypropylene carbonate Polymers 0.000 claims description 2
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 claims 3
- 229920005990 polystyrene resin Polymers 0.000 claims 3
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229920001519 homopolymer Polymers 0.000 claims 1
- 229920001596 poly (chlorostyrenes) Polymers 0.000 claims 1
- 229920003048 styrene butadiene rubber Polymers 0.000 claims 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 33
- 239000000654 additive Substances 0.000 description 25
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000047 product Substances 0.000 description 18
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 15
- 229910052760 oxygen Inorganic materials 0.000 description 15
- 239000001301 oxygen Substances 0.000 description 15
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 14
- 239000011521 glass Substances 0.000 description 14
- 238000012360 testing method Methods 0.000 description 13
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 10
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 9
- 229910000410 antimony oxide Inorganic materials 0.000 description 9
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000001746 injection moulding Methods 0.000 description 8
- BSWWXRFVMJHFBN-UHFFFAOYSA-N 2,4,6-tribromophenol Chemical compound OC1=C(Br)C=C(Br)C=C1Br BSWWXRFVMJHFBN-UHFFFAOYSA-N 0.000 description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000012763 reinforcing filler Substances 0.000 description 6
- SSKIYHMIAHJLBC-UHFFFAOYSA-N carbonic acid;2,6-dibromo-4-[2-(3,5-dibromo-4-hydroxyphenyl)propan-2-yl]phenol Chemical compound OC(O)=O.C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 SSKIYHMIAHJLBC-UHFFFAOYSA-N 0.000 description 5
- 238000007706 flame test Methods 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 239000002245 particle Substances 0.000 description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 5
- 239000001294 propane Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 4
- 229940058905 antimony compound for treatment of leishmaniasis and trypanosomiasis Drugs 0.000 description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 230000003014 reinforcing effect Effects 0.000 description 4
- LUTKACRCNQKOTM-UHFFFAOYSA-N 4-ethyl-1,3-dioxetan-2-one Chemical compound CCC1OC(=O)O1 LUTKACRCNQKOTM-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052787 antimony Inorganic materials 0.000 description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 3
- 239000000945 filler Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000000704 physical effect Effects 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- AFFLGGQVNFXPEV-UHFFFAOYSA-N 1-decene Chemical compound CCCCCCCCC=C AFFLGGQVNFXPEV-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 2
- 241001082241 Lythrum hyssopifolia Species 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000000020 Nitrocellulose Substances 0.000 description 2
- 229920001283 Polyalkylene terephthalate Polymers 0.000 description 2
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 230000033228 biological regulation Effects 0.000 description 2
- 238000007664 blowing Methods 0.000 description 2
- IAQRGUVFOMOMEM-UHFFFAOYSA-N but-2-ene Chemical compound CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- MWKFXSUHUHTGQN-UHFFFAOYSA-N decan-1-ol Chemical compound CCCCCCCCCCO MWKFXSUHUHTGQN-UHFFFAOYSA-N 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-L isophthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC(C([O-])=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-L 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 229920001220 nitrocellulos Polymers 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920002492 poly(sulfone) Polymers 0.000 description 2
- 229920002480 polybenzimidazole Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000002787 reinforcement Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- HVYVMSPIJIWUNA-UHFFFAOYSA-N triphenylstibine Chemical compound C1=CC=CC=C1[Sb](C=1C=CC=CC=1)C1=CC=CC=C1 HVYVMSPIJIWUNA-UHFFFAOYSA-N 0.000 description 2
- SDPNMKBPWRAPHY-UHFFFAOYSA-N 1-prop-2-enylazepan-2-one Chemical compound C=CCN1CCCCCC1=O SDPNMKBPWRAPHY-UHFFFAOYSA-N 0.000 description 1
- IGGDKDTUCAWDAN-UHFFFAOYSA-N 1-vinylnaphthalene Chemical compound C1=CC=C2C(C=C)=CC=CC2=C1 IGGDKDTUCAWDAN-UHFFFAOYSA-N 0.000 description 1
- LINPIYWFGCPVIE-UHFFFAOYSA-N 2,4,6-trichlorophenol Chemical compound OC1=C(Cl)C=C(Cl)C=C1Cl LINPIYWFGCPVIE-UHFFFAOYSA-N 0.000 description 1
- IVSIOPOKGGZDFE-UHFFFAOYSA-N 2,6-dibromo-4-[(3,5-dibromo-4-hydroxyphenyl)-phenylmethyl]phenol Chemical compound C1=C(Br)C(O)=C(Br)C=C1C(C=1C=C(Br)C(O)=C(Br)C=1)C1=CC=CC=C1 IVSIOPOKGGZDFE-UHFFFAOYSA-N 0.000 description 1
- HREXIBFZDJHFCF-UHFFFAOYSA-N 2,6-dibromo-4-propylphenol Chemical compound CCCC1=CC(Br)=C(O)C(Br)=C1 HREXIBFZDJHFCF-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- XKZQKPRCPNGNFR-UHFFFAOYSA-N 2-(3-hydroxyphenyl)phenol Chemical class OC1=CC=CC(C=2C(=CC=CC=2)O)=C1 XKZQKPRCPNGNFR-UHFFFAOYSA-N 0.000 description 1
- SYNPRNNJJLRHTI-UHFFFAOYSA-N 2-(hydroxymethyl)butane-1,4-diol Chemical compound OCCC(CO)CO SYNPRNNJJLRHTI-UHFFFAOYSA-N 0.000 description 1
- KYZSNVXYOQKZAK-UHFFFAOYSA-N 3,4-dibromophenol Chemical class OC1=CC=C(Br)C(Br)=C1 KYZSNVXYOQKZAK-UHFFFAOYSA-N 0.000 description 1
- JROYQRFMFGHIII-UHFFFAOYSA-N 3,5-dibromo-4-[(2,6-dibromo-4-hydroxyphenyl)methyl]phenol Chemical compound BrC1=CC(O)=CC(Br)=C1CC1=C(Br)C=C(O)C=C1Br JROYQRFMFGHIII-UHFFFAOYSA-N 0.000 description 1
- DAEQYPHQSDZTAC-UHFFFAOYSA-N 3,5-dibromo-4-[2-(2,6-dibromo-4-hydroxyphenyl)ethyl]phenol Chemical compound BrC1=CC(O)=CC(Br)=C1CCC1=C(Br)C=C(O)C=C1Br DAEQYPHQSDZTAC-UHFFFAOYSA-N 0.000 description 1
- HEBLZAMWZFFHCK-UHFFFAOYSA-N 3,5-dibromo-4-[2-(2,6-dibromo-4-hydroxyphenyl)pentan-2-yl]phenol Chemical compound BrC=1C=C(O)C=C(Br)C=1C(C)(CCC)C1=C(Br)C=C(O)C=C1Br HEBLZAMWZFFHCK-UHFFFAOYSA-N 0.000 description 1
- GBHYRDHQVKUKPO-UHFFFAOYSA-N 3-bromo-4-[(2-bromo-4-hydroxyphenyl)methyl]phenol Chemical compound BrC1=CC(O)=CC=C1CC1=CC=C(O)C=C1Br GBHYRDHQVKUKPO-UHFFFAOYSA-N 0.000 description 1
- ZLDLNSRPIZSQQD-UHFFFAOYSA-N 3-bromo-4-[1-(2-bromo-6-chloro-4-hydroxyphenyl)ethyl]-5-chlorophenol Chemical compound ClC=1C=C(O)C=C(Br)C=1C(C)C1=C(Cl)C=C(O)C=C1Br ZLDLNSRPIZSQQD-UHFFFAOYSA-N 0.000 description 1
- ATVJXMYDOSMEPO-UHFFFAOYSA-N 3-prop-2-enoxyprop-1-ene Chemical compound C=CCOCC=C ATVJXMYDOSMEPO-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical class OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- UWDMKTDPDJCJOP-UHFFFAOYSA-N 4-hydroxy-2,2,6,6-tetramethylpiperidin-1-ium-4-carboxylate Chemical compound CC1(C)CC(O)(C(O)=O)CC(C)(C)N1 UWDMKTDPDJCJOP-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910000906 Bronze Inorganic materials 0.000 description 1
- BTGHECRPFXMMCA-UHFFFAOYSA-N C(O)(O)=O.ClC=1C=C(C=C(C1O)Cl)C(C)(C)C1=CC(=C(C(=C1)Cl)O)Cl Chemical compound C(O)(O)=O.ClC=1C=C(C=C(C1O)Cl)C(C)(C)C1=CC(=C(C(=C1)Cl)O)Cl BTGHECRPFXMMCA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004709 Chlorinated polyethylene Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 239000004693 Polybenzimidazole Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical class OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229920003232 aliphatic polyester Polymers 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Chemical compound O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 description 1
- KIQKNTIOWITBBA-UHFFFAOYSA-K antimony(3+);phosphate Chemical compound [Sb+3].[O-]P([O-])([O-])=O KIQKNTIOWITBBA-UHFFFAOYSA-K 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229920005601 base polymer Polymers 0.000 description 1
- 239000005388 borosilicate glass Substances 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical class BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 239000010974 bronze Substances 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- DTETYQPQBBPHME-UHFFFAOYSA-N carbonic acid;2,6-dibromo-4-propylphenol Chemical compound OC(O)=O.CCCC1=CC(Br)=C(O)C(Br)=C1 DTETYQPQBBPHME-UHFFFAOYSA-N 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920001727 cellulose butyrate Polymers 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- YDVNLQGCLLPHAH-UHFFFAOYSA-N dichloromethane;hydrate Chemical compound O.ClCCl YDVNLQGCLLPHAH-UHFFFAOYSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000012757 flame retardant agent Substances 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-M hexanoate Chemical compound CCCCCC([O-])=O FUZZWVXGSFPDMH-UHFFFAOYSA-M 0.000 description 1
- LNMQRPPRQDGUDR-UHFFFAOYSA-N hexyl prop-2-enoate Chemical compound CCCCCCOC(=O)C=C LNMQRPPRQDGUDR-UHFFFAOYSA-N 0.000 description 1
- 239000004797 high-impact polystyrene Substances 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000002484 inorganic compounds Chemical class 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- CNPHCSFIDKZQAK-UHFFFAOYSA-N n-prop-2-enylprop-2-enamide Chemical compound C=CCNC(=O)C=C CNPHCSFIDKZQAK-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052755 nonmetal Inorganic materials 0.000 description 1
- 150000002843 nonmetals Chemical class 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920001707 polybutylene terephthalate Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920012287 polyphenylene sulfone Polymers 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- HJWLCRVIBGQPNF-UHFFFAOYSA-N prop-2-enylbenzene Chemical compound C=CCC1=CC=CC=C1 HJWLCRVIBGQPNF-UHFFFAOYSA-N 0.000 description 1
- LYBIZMNPXTXVMV-UHFFFAOYSA-N propan-2-yl prop-2-enoate Chemical compound CC(C)OC(=O)C=C LYBIZMNPXTXVMV-UHFFFAOYSA-N 0.000 description 1
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000009436 residential construction Methods 0.000 description 1
- 239000011342 resin composition Substances 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L67/00—Compositions of polyesters obtained by reactions forming a carboxylic ester link in the main chain; Compositions of derivatives of such polymers
- C08L67/02—Polyesters derived from dicarboxylic acids and dihydroxy compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/04—Oxygen-containing compounds
- C08K5/10—Esters; Ether-esters
- C08K5/109—Esters; Ether-esters of carbonic acid, e.g. R-O-C(=O)-O-R
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L101/00—Compositions of unspecified macromolecular compounds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S260/00—Chemistry of carbon compounds
- Y10S260/24—Flameproof
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Fireproofing Substances (AREA)
- Polyesters Or Polycarbonates (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00194518A US3855277A (en) | 1971-11-01 | 1971-11-01 | Flame retardant compounds and thermoplastic compositions containing the same |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2243226A1 true DE2243226A1 (de) | 1973-05-10 |
Family
ID=22717907
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2243226A Pending DE2243226A1 (de) | 1971-11-01 | 1972-09-01 | Flammwidrige thermoplastische massen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3855277A (enExample) |
| JP (1) | JPS5625953B2 (enExample) |
| AU (1) | AU469817B2 (enExample) |
| BE (1) | BE790385A (enExample) |
| DD (2) | DD101688A5 (enExample) |
| DE (1) | DE2243226A1 (enExample) |
| FR (1) | FR2159896A5 (enExample) |
| GB (1) | GB1398599A (enExample) |
| IT (1) | IT970091B (enExample) |
| NL (1) | NL7214790A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2448993A1 (de) * | 1973-10-18 | 1975-04-30 | Gen Electric | Flammhemmende zusammensetzung |
| DE2450851A1 (de) * | 1973-10-25 | 1975-04-30 | Daicel Ltd | Feuerhemmende schlagfeste harzmassen |
| DE2622414A1 (de) * | 1975-05-23 | 1976-12-09 | Mobay Chemical Corp | Polybutylenterephthalatabmischungen mit hoher schlagzaehigkeit |
| DE2726110A1 (de) * | 1976-06-11 | 1977-12-15 | Teijin Chemicals Ltd | Feuerhemmende thermoplastische polyesterzusammensetzung |
| DE2750064A1 (de) * | 1976-12-08 | 1978-06-15 | Gen Electric | Plastifizierte polycarbonatzusammensetzung |
| DE3428912A1 (de) * | 1983-08-08 | 1985-02-21 | Ppg Industries, Inc., Pittsburgh, Pa. | Alkandiyl-bromsubstituierte-arylendiyl-carbonatpolymere |
Families Citing this family (80)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS4988930A (enExample) * | 1972-12-27 | 1974-08-26 | ||
| JPS503441A (enExample) * | 1973-05-16 | 1975-01-14 | ||
| US3909485A (en) * | 1973-07-11 | 1975-09-30 | Mitsubishi Rayon Co | Flame-resistant glass-fiber reinforced polytetramethylene terephthalate resin composition |
| JPS5720974B2 (enExample) * | 1973-09-14 | 1982-05-04 | ||
| JPS5238587B2 (enExample) * | 1973-09-28 | 1977-09-29 | ||
| JPS5726305B2 (enExample) * | 1973-10-22 | 1982-06-03 | ||
| JPS5731587B2 (enExample) * | 1973-10-29 | 1982-07-06 | ||
| US4140730A (en) * | 1973-10-31 | 1979-02-20 | Bayer Aktiengesellschaft | Polycarbonate film |
| JPS5726307B2 (enExample) * | 1973-11-01 | 1982-06-03 | ||
| CH584731A5 (enExample) * | 1973-12-17 | 1977-02-15 | Ciba Geigy Ag | |
| JPS5320064B2 (enExample) * | 1974-01-29 | 1978-06-24 | ||
| JPS50109947A (enExample) * | 1974-02-09 | 1975-08-29 | ||
| US4032510A (en) * | 1975-07-18 | 1977-06-28 | Exxon Research And Engineering Company | Novel polycarbon stabilizers |
| US4024102A (en) * | 1974-02-13 | 1977-05-17 | Celanese Corporation | Molding composition suitable for forming improved flame retardant three-dimensional shaped articles |
| JPS5224942B2 (enExample) * | 1974-06-03 | 1977-07-05 | ||
| JPS604209B2 (ja) * | 1974-06-10 | 1985-02-02 | 帝人株式会社 | ポリエステルの製造法 |
| US3956229A (en) * | 1974-07-16 | 1976-05-11 | Allied Chemical Corporation | Films and sheets of polyester-polycarbonate blends |
| GB1512516A (en) * | 1974-07-31 | 1978-06-01 | Ici Ltd | Polyester composition |
| US4035333A (en) * | 1974-10-14 | 1977-07-12 | Mitsubishi Rayon Co., Ltd. | Flame-resistant resin composition |
| JPS536016B2 (enExample) * | 1974-10-17 | 1978-03-03 | ||
| US4155949A (en) * | 1975-01-21 | 1979-05-22 | Mitsubishi Gas Chemical Company, Inc. | Fire retardant polycarbonate resin composition |
| US4024093A (en) * | 1975-01-23 | 1977-05-17 | General Electric Company | Flame retardant polyphenylene ether resin compositions containing a halogenated flame retardant and selected organic iron salts |
| JPS5847418B2 (ja) * | 1975-01-23 | 1983-10-22 | 東レ株式会社 | ナンネンセイポリエステルソセイブツ |
| JPS5189545A (ja) * | 1975-02-04 | 1976-08-05 | Nannenseijushisoseibutsu | |
| JPS5195452A (enExample) * | 1975-02-19 | 1976-08-21 | ||
| US4268429A (en) * | 1975-07-18 | 1981-05-19 | General Electric Company | Novel flame retardant polycarbonate compositions |
| DE2620255C2 (de) * | 1976-05-07 | 1982-07-01 | Bayer Ag, 5090 Leverkusen | Thermoplastische Formmassen und Formkörper aus Polycarbonaten mit verbesserter Entformbarkeit beim Spritzgießen |
| US4098751A (en) * | 1976-12-08 | 1978-07-04 | General Electric Company | Organic carbonate plasticized polycarbonate composition |
| US4126592A (en) * | 1976-12-16 | 1978-11-21 | General Electric Company | Process for the preparation of polyesters having stabilized melt viscosity in the presence of aromatic poly(carbonates) |
| DE2755950A1 (de) * | 1976-12-16 | 1978-06-29 | Gen Electric | Flammwidrige verstaerkte thermoplastische formmassen |
| US4169081A (en) * | 1976-12-16 | 1979-09-25 | General Electric Company | Process for the preparation of polyesters having stabilized melt viscosity in the presence of aromatic (poly-)carbonates |
| JPS592466B2 (ja) * | 1977-05-18 | 1984-01-18 | 帝人株式会社 | 難燃性樹脂組成物 |
| DE2729763A1 (de) * | 1977-07-01 | 1979-01-18 | Bayer Ag | Thermoplastisch verarbeitbare polycarbonatmischungen |
| JPS6054347B2 (ja) * | 1977-08-08 | 1985-11-29 | 東レ株式会社 | 難燃性樹脂組成物 |
| US4180494A (en) * | 1977-08-15 | 1979-12-25 | Rohm And Haas Company | Thermoplastic polyesters |
| US4222910A (en) * | 1977-11-10 | 1980-09-16 | Teijin Chemicals, Ltd. | Fire-retardant polycarbonate composition |
| US4386027A (en) * | 1977-12-30 | 1983-05-31 | General Electric Company | Flame-retarded thermoplastic polyester compositions having improved arc resistance and process for preparing same |
| US4155898A (en) * | 1978-01-13 | 1979-05-22 | General Electric Company | Flame retardant blend comprising a polyalkylene terephthalate, an organo polysiloxane-polycarbonate block copolymer, and a halogenated copolycarbonate |
| JPS5930184B2 (ja) * | 1978-03-22 | 1984-07-25 | 東レ株式会社 | 難燃性ポリエステル組成物 |
| JPS555958A (en) * | 1978-06-30 | 1980-01-17 | Dainippon Ink & Chem Inc | Flame-retardant resin composition |
| JPS5512163A (en) * | 1978-07-13 | 1980-01-28 | Mitsubishi Rayon Co Ltd | Flame-retardant thermoplastic resin composition |
| JPS5525467A (en) * | 1978-08-14 | 1980-02-23 | Mitsubishi Gas Chem Co Inc | Polymer composition |
| US4220735A (en) * | 1978-12-18 | 1980-09-02 | General Electric Company | Modified polyester compositions |
| WO1980002430A1 (en) * | 1979-05-01 | 1980-11-13 | Gen Electric | Thermoplastic molding composition and process |
| US4414352A (en) * | 1979-05-01 | 1983-11-08 | General Electric Company | Thermoplastic molding compositions and process |
| US4267286A (en) * | 1979-07-03 | 1981-05-12 | General Electric Company | Modified polyester compositions |
| US4369282A (en) * | 1979-07-03 | 1983-01-18 | General Electric Company | Modified polyester compositions |
| JPS5674142A (en) * | 1979-11-22 | 1981-06-19 | Matsushita Electric Ind Co Ltd | Flame-retardant resin composition |
| US4338243A (en) * | 1980-05-07 | 1982-07-06 | E. I. Du Pont De Nemours And Company | Polyethylene terephthalate blends |
| US4365055A (en) * | 1981-06-24 | 1982-12-21 | Ppg Industries, Inc. | Process for producing substantially linear carbonate polymer |
| EP0069297A1 (en) * | 1981-07-08 | 1983-01-12 | General Electric Company | Melt viscosity control in flame retarded polybutylene terephthalate |
| DE3203905A1 (de) * | 1982-02-05 | 1983-08-11 | Bayer Ag, 5090 Leverkusen | Polycarbonat-formmassen mit verbesserter flammwidrigkeit |
| US4401792A (en) * | 1982-03-16 | 1983-08-30 | General Electric Company | Process for increasing the rate of crystallization of polyesters |
| CA1256621A (en) * | 1983-06-28 | 1989-06-27 | Visvaldis Abolins | Flame retardant blends of abs resin and polyphenylene ether |
| JPH0662837B2 (ja) * | 1984-09-10 | 1994-08-17 | ポリプラスチックス株式会社 | 難燃性ポリブチレンテレフタレート組成物 |
| US4673699A (en) * | 1984-11-19 | 1987-06-16 | Mobay Corporation | Flame retardant molding compositions |
| WO1988000219A1 (en) * | 1986-07-02 | 1988-01-14 | General Electric Company | Flame retarded polyester molding composition with improved electrical performance |
| US4783494A (en) * | 1985-09-24 | 1988-11-08 | General Electric Company | Thermoplastic compositions of polycarbonate resin and copolymers of ethylene and acrylic or methacrylic acid |
| US4753970A (en) * | 1986-04-21 | 1988-06-28 | Nippon Kasei Chemical Co., Ltd. | Fire-retardant polyolefin composition |
| JPS62285937A (ja) * | 1986-06-04 | 1987-12-11 | Japan Synthetic Rubber Co Ltd | 難燃性スチレン系樹脂組成物 |
| US4959481A (en) * | 1986-08-01 | 1990-09-25 | General Electric Company | Flame retardant compounds and thermoplastic compositions containing the same |
| US4743637A (en) * | 1986-08-01 | 1988-05-10 | General Electric Company | Flame retardant compounds and thermoplastic compositions containing the same |
| US4707510A (en) * | 1986-08-14 | 1987-11-17 | Daicel Chemical Industries, Ltd. | Flame retardant resin composition |
| JPH0825959B2 (ja) * | 1987-05-27 | 1996-03-13 | 三菱瓦斯化学株式会社 | ジクロロホ−メ−ト及びコポリカ−ボネ−トオリゴマ−の製法 |
| DE3835203A1 (de) * | 1988-10-15 | 1990-04-19 | Bayer Ag | Formmassen aus polycarbonat-mischungen hoher disperser loeslichkeit |
| US4918125A (en) * | 1988-12-27 | 1990-04-17 | General Electric Company | Flame retardant carbonate polymer blends |
| JPH04323255A (ja) * | 1991-04-22 | 1992-11-12 | Idemitsu Petrochem Co Ltd | ポリカーボネート樹脂組成物 |
| JPH04323256A (ja) * | 1991-04-22 | 1992-11-12 | Idemitsu Petrochem Co Ltd | ポリカーボネート樹脂組成物 |
| WO1999052971A1 (en) | 1998-04-09 | 1999-10-21 | Majilite Corporation | Fire retardant compositions and methods for their preparation and use |
| CN1524178B (zh) * | 2001-11-28 | 2011-11-23 | 株式会社松下回音技术中心 | 塑料的识别方法 |
| US7795320B2 (en) * | 2006-01-27 | 2010-09-14 | Sabic Innovative Plastics Ip B.V. | Copolyetheresters derived from polyethylene terephthalate |
| US7902263B2 (en) * | 2006-01-27 | 2011-03-08 | Sabic Innovative Plastics Ip B.V. | Process for making polybutylene terephthalate (PBT) from polyethylene terephthalate (PET) |
| US7799836B2 (en) * | 2006-03-01 | 2010-09-21 | Sabic Innovative Plastics Ip B.V. | Process for making polybutylene terephthalate (PBT) from polyethylene terephthalate (PET) |
| US8309656B2 (en) | 2006-07-26 | 2012-11-13 | Sabic Innovative Plastics Ip B.V. | Elastomer blends containing polycarbonates and copolyetheresters derived from polyethylene terephthalate, method of manufacture, and articles therefrom |
| DE102007061758A1 (de) * | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| WO2011136245A1 (ja) * | 2010-04-27 | 2011-11-03 | 三菱樹脂株式会社 | 耐火用配管材 |
| US8686072B2 (en) | 2010-06-29 | 2014-04-01 | Sabic Innovative Plastics Ip B.V. | Flame resistant polyester compositions, method of manufacture, and articles therof |
| US8716378B2 (en) | 2010-06-29 | 2014-05-06 | Sabic Innovative Plastics Ip B.V. | Flame resistant polyester compositions, method of manufacture, and articles thereof |
| US8440762B2 (en) | 2011-01-14 | 2013-05-14 | Sabic Innovative Plastics Ip B.V. | Polymer compositions, method of manufacture, and articles formed therefrom |
| US11105526B1 (en) | 2017-09-29 | 2021-08-31 | Integrated Global Services, Inc. | Safety shutdown systems and methods for LNG, crude oil refineries, petrochemical plants, and other facilities |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL104015C (enExample) * | 1953-10-16 | |||
| NL295172A (enExample) * | 1962-07-11 | |||
| US3267070A (en) * | 1963-02-04 | 1966-08-16 | Dow Chemical Co | Self-extinguishing polystyrene resins containing tribromoallyl alcohol esters |
| GB1045533A (en) * | 1963-02-21 | 1966-10-12 | Gen Electric | Flame-resistant polycarbonate compositions |
| US3365517A (en) * | 1965-04-08 | 1968-01-23 | Union Carbide Corp | Mixtures of polycarbonates and polyarylene polyethers |
| US3382207A (en) * | 1965-09-30 | 1968-05-07 | Gen Electric | Flame-retardant polycarbonates |
| US3668155A (en) * | 1968-06-27 | 1972-06-06 | Dow Chemical Co | Self-extinguishing ethylene copolymer foams comprising a ternary mixture of an antimony compound, a halogen-containing compound and a bromine compound |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
| US3647747A (en) * | 1970-04-15 | 1972-03-07 | Gen Electric | High temperature molding flame retardant polycarbonate composition |
| US3688001A (en) * | 1970-08-03 | 1972-08-29 | Dow Chemical Co | Carbonates containing halogenated neopentyl groups |
| US3671487A (en) * | 1971-05-05 | 1972-06-20 | Gen Electric | Glass reinforced polyester resins containing polytetrafluoroethylene and flame retardant additives |
-
0
- BE BE790385D patent/BE790385A/xx not_active IP Right Cessation
-
1971
- 1971-11-01 US US00194518A patent/US3855277A/en not_active Expired - Lifetime
-
1972
- 1972-08-18 AU AU45756/72A patent/AU469817B2/en not_active Expired
- 1972-08-24 GB GB3955472A patent/GB1398599A/en not_active Expired
- 1972-09-01 DE DE2243226A patent/DE2243226A1/de active Pending
- 1972-10-05 DD DD166054A patent/DD101688A5/xx unknown
- 1972-10-05 DD DD171810*A patent/DD105811A5/xx unknown
- 1972-10-24 FR FR7237659A patent/FR2159896A5/fr not_active Expired
- 1972-10-31 IT IT31138/72A patent/IT970091B/it active
- 1972-11-01 JP JP10983072A patent/JPS5625953B2/ja not_active Expired
- 1972-11-01 NL NL7214790A patent/NL7214790A/xx not_active Application Discontinuation
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2448993A1 (de) * | 1973-10-18 | 1975-04-30 | Gen Electric | Flammhemmende zusammensetzung |
| DE2450851A1 (de) * | 1973-10-25 | 1975-04-30 | Daicel Ltd | Feuerhemmende schlagfeste harzmassen |
| DE2622414A1 (de) * | 1975-05-23 | 1976-12-09 | Mobay Chemical Corp | Polybutylenterephthalatabmischungen mit hoher schlagzaehigkeit |
| DE2726110A1 (de) * | 1976-06-11 | 1977-12-15 | Teijin Chemicals Ltd | Feuerhemmende thermoplastische polyesterzusammensetzung |
| DE2750064A1 (de) * | 1976-12-08 | 1978-06-15 | Gen Electric | Plastifizierte polycarbonatzusammensetzung |
| DE3428912A1 (de) * | 1983-08-08 | 1985-02-21 | Ppg Industries, Inc., Pittsburgh, Pa. | Alkandiyl-bromsubstituierte-arylendiyl-carbonatpolymere |
Also Published As
| Publication number | Publication date |
|---|---|
| IT970091B (it) | 1974-04-10 |
| DD101688A5 (enExample) | 1973-11-12 |
| AU4575672A (en) | 1974-02-21 |
| GB1398599A (en) | 1975-06-25 |
| FR2159896A5 (enExample) | 1973-06-22 |
| US3855277A (en) | 1974-12-17 |
| NL7214790A (enExample) | 1973-05-03 |
| BE790385A (fr) | 1973-02-15 |
| AU469817B2 (en) | 1976-02-26 |
| DD105811A5 (enExample) | 1974-05-12 |
| JPS4852834A (enExample) | 1973-07-25 |
| JPS5625953B2 (enExample) | 1981-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2243226A1 (de) | Flammwidrige thermoplastische massen | |
| DE2310742C2 (de) | Flammwidrige thermoplastische Polyester-Formmasse | |
| DE2900029C2 (de) | Feuerhemmend ausgerüstete Nylonzusammensetzung und sie enthaltende polymere Gemische | |
| DE2242509C2 (de) | Nicht-tropfende, flammhemmende, mit Glas verstärkte Polyesterharze und Verfahren zu ihrer Herstellung | |
| DE2228072C3 (de) | Selbstauslöschende und nicht-tropfende thermoplastische Formmasse | |
| DE60021187T2 (de) | Flammhemmende polycarbonatharzzusammensetzung | |
| DE1569021A1 (de) | Feuerabweisende Formmassen und Anstrichmittel auf der Grundlage organischer Polymere | |
| DE2331826A1 (de) | Thermoplastische massen | |
| DE2948871A1 (de) | Flammhemmende polycarbonat-zusammensetzung | |
| DE2446452A1 (de) | Thermoplastische pressmasse | |
| DE2554324A1 (de) | Flammhemmende, nicht tropfende zusammensetzung aus polyphenylenaether und akrylnitril-butadien-styrol | |
| DE2154095B2 (de) | Ammoniumpolyphosphat, Phosphoniumbromid-Kombinationen als feuerhemmende Mittel für Propylenpolymere | |
| DE2820270A1 (de) | Verbesserte hochschlagfeste polyphenylenaetherharz-zusammensetzungen | |
| DE2727483A1 (de) | Selbstverloeschende thermoplastische formmassen | |
| DE2533578A1 (de) | Lichtstabilisierte polyesterharzzusammensetzungen | |
| DE2417663A1 (de) | Flammhemmende thermoplastische zusammensetzungen | |
| US4006118A (en) | Flame-retardant thermoplastic polymer compositions | |
| DE3342414A1 (de) | Neue flammschutzmittelkombinationen und ihre verwendung in thermoplastischen formmassen aus polycarbonaten und abs-polymerisaten | |
| DE4138386A1 (de) | Flammfeste thermoplastische formmassen | |
| DE3338502A1 (de) | Selbstverloeschende thermoplastische formmassen aus polycarbonat und abs-polymerisaten | |
| DE2633944A1 (de) | Massen aus aromatischen copolyestern | |
| DE2620367A1 (de) | Flammhemmende polyphenylenaetherharz-zusammensetzungen, die ein halogeniertes, flammhemmendes mittel und ausgewaehlte organische eisensalze enthalten | |
| DE68924886T2 (de) | Polyester mit modifizierter Schmelzviskosität. | |
| DE2757558A1 (de) | Verschaeumbare polyphenylenoxid-zusammensetzung | |
| DE2448993C2 (de) | Flammhemmende nichttropfende Zusammensetzung |