DE2241406C3 - Elektrophotographisches Aufzeichnungsmaterial - Google Patents
Elektrophotographisches AufzeichnungsmaterialInfo
- Publication number
- DE2241406C3 DE2241406C3 DE2241406A DE2241406A DE2241406C3 DE 2241406 C3 DE2241406 C3 DE 2241406C3 DE 2241406 A DE2241406 A DE 2241406A DE 2241406 A DE2241406 A DE 2241406A DE 2241406 C3 DE2241406 C3 DE 2241406C3
- Authority
- DE
- Germany
- Prior art keywords
- layer
- recording material
- electrically conductive
- photoconductive
- barrier layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 64
- 230000004888 barrier function Effects 0.000 claims description 24
- 229920001577 copolymer Polymers 0.000 claims description 16
- 239000011230 binding agent Substances 0.000 claims description 9
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical group CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 5
- 239000004065 semiconductor Substances 0.000 claims description 5
- 229920002554 vinyl polymer Polymers 0.000 claims description 5
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 4
- 229910021595 Copper(I) iodide Inorganic materials 0.000 claims description 3
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 claims description 3
- NIONDZDPPYHYKY-SNAWJCMRSA-N (2E)-hexenoic acid Chemical compound CCC\C=C\C(O)=O NIONDZDPPYHYKY-SNAWJCMRSA-N 0.000 claims description 2
- NIONDZDPPYHYKY-UHFFFAOYSA-N Z-hexenoic acid Natural products CCCC=CC(O)=O NIONDZDPPYHYKY-UHFFFAOYSA-N 0.000 claims description 2
- YIYBQIKDCADOSF-UHFFFAOYSA-N alpha-Butylen-alpha-carbonsaeure Natural products CCC=CC(O)=O YIYBQIKDCADOSF-UHFFFAOYSA-N 0.000 claims description 2
- 239000006229 carbon black Substances 0.000 claims description 2
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 claims description 2
- CPHCIYGRSFZNRD-UHFFFAOYSA-N n-methyl-1-(4,5,6,7-tetrahydro-1h-indazol-3-yl)methanamine Chemical compound C1CCCC2=C1NN=C2CNC CPHCIYGRSFZNRD-UHFFFAOYSA-N 0.000 claims description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 claims description 2
- YIYBQIKDCADOSF-ONEGZZNKSA-N trans-pent-2-enoic acid Chemical compound CC\C=C\C(O)=O YIYBQIKDCADOSF-ONEGZZNKSA-N 0.000 claims description 2
- 239000010410 layer Substances 0.000 description 71
- 230000035945 sensitivity Effects 0.000 description 16
- 238000000576 coating method Methods 0.000 description 15
- 239000011248 coating agent Substances 0.000 description 14
- 238000011534 incubation Methods 0.000 description 9
- -1 polyethylene terephthalate Polymers 0.000 description 5
- 230000005855 radiation Effects 0.000 description 5
- 230000000052 comparative effect Effects 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 125000005259 triarylamine group Chemical group 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000012790 adhesive layer Substances 0.000 description 3
- 239000008199 coating composition Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 238000007665 sagging Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 238000003384 imaging method Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000000737 periodic effect Effects 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 238000004528 spin coating Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 241000711573 Coronaviridae Species 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- IWBBAVPUHLAWGW-UHFFFAOYSA-N [4-(2,6-diphenylthiopyran-4-ylidene)cyclohexa-2,5-dien-1-ylidene]-dimethylazanium Chemical compound C1=CC(=[N+](C)C)C=CC1=C1C=C(C=2C=CC=CC=2)SC(C=2C=CC=CC=2)=C1 IWBBAVPUHLAWGW-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 229920000402 bisphenol A polycarbonate polymer Polymers 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 150000001789 chalcones Chemical class 0.000 description 1
- 235000005513 chalcones Nutrition 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000005266 diarylamine group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012799 electrically-conductive coating Substances 0.000 description 1
- 230000005670 electromagnetic radiation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N itaconic acid Chemical group OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052724 xenon Inorganic materials 0.000 description 1
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/14—Inert intermediate or cover layers for charge-receiving layers
- G03G5/142—Inert intermediate layers
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US17495671A | 1971-08-25 | 1971-08-25 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2241406A1 DE2241406A1 (de) | 1973-03-01 |
| DE2241406B2 DE2241406B2 (enExample) | 1974-05-02 |
| DE2241406C3 true DE2241406C3 (de) | 1974-11-28 |
Family
ID=22638216
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2241406A Expired DE2241406C3 (de) | 1971-08-25 | 1972-08-23 | Elektrophotographisches Aufzeichnungsmaterial |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3745005A (enExample) |
| JP (1) | JPS5139855B2 (enExample) |
| CA (1) | CA955785A (enExample) |
| DE (1) | DE2241406C3 (enExample) |
| FR (1) | FR2151375A5 (enExample) |
| GB (1) | GB1352487A (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3998987A (en) * | 1971-05-20 | 1976-12-21 | Tomoegawa Paper Mfg. Co., Ltd. | Electrostatic recording element |
| JPS5135147B2 (enExample) * | 1972-11-06 | 1976-09-30 | ||
| US3932179A (en) * | 1973-05-31 | 1976-01-13 | Eastman Kodak Company | Electrophotographic element containing a polymeric multi-phase interlayer |
| JPS50159339A (enExample) * | 1974-06-11 | 1975-12-23 | ||
| JPS5226050A (en) * | 1975-08-22 | 1977-02-26 | Mitsubishi Heavy Ind Ltd | Opposed current heat-exchanger |
| US4173472A (en) * | 1976-06-15 | 1979-11-06 | Eastman Kodak Company | Polyester interlayer and binder component in multilayer photoconductive element |
| US4284699A (en) * | 1977-02-14 | 1981-08-18 | Eastman Kodak Company | Polyester binder component in multilayer photoconductive element |
| JPS5816113B2 (ja) * | 1977-03-30 | 1983-03-29 | 工業技術院長 | 熱交換装置 |
| JPS5828518B2 (ja) * | 1977-03-30 | 1983-06-16 | 工業技術院長 | 熱交換方法 |
| US4082551A (en) * | 1977-03-31 | 1978-04-04 | Eastman Kodak Company | Electrophotographic element containing a multilayer interlayer |
| GB2033148A (en) * | 1978-10-26 | 1980-05-14 | Philips Electronic Associated | Photoconductive structures |
| JPS56113453A (en) * | 1980-02-13 | 1981-09-07 | Toyo Seikan Kaisha Ltd | Welded can*joint thereof is coated*and its manufacture |
| JPS56138742A (en) | 1980-03-31 | 1981-10-29 | Konishiroku Photo Ind Co Ltd | Charge retaining material and method for forming copy image using this material |
| JPS5891460A (ja) * | 1981-11-27 | 1983-05-31 | Fuji Photo Film Co Ltd | 電子写真感光体 |
| US5130216A (en) * | 1988-09-22 | 1992-07-14 | Canon Kabushiki Kaisha | Photosensitive member for electrophotography |
| JPH02118381A (ja) * | 1988-10-27 | 1990-05-02 | Sanden Corp | ブライン冷却システム |
| JP2567086B2 (ja) * | 1989-03-15 | 1996-12-25 | キヤノン株式会社 | 電子写真感光体 |
| US5063125A (en) * | 1989-12-29 | 1991-11-05 | Xerox Corporation | Electrically conductive layer for electrical devices |
| US5385796A (en) * | 1989-12-29 | 1995-01-31 | Xerox Corporation | Electrophotographic imaging member having unmodified hydroxy methacrylate polymer charge blocking layer |
| US4988597A (en) * | 1989-12-29 | 1991-01-29 | Xerox Corporation | Conductive and blocking layers for electrophotographic imaging members |
| US5063128A (en) * | 1989-12-29 | 1991-11-05 | Xerox Corporation | Conductive and blocking layers for electrophotographic imaging members |
| US5110700A (en) * | 1990-12-28 | 1992-05-05 | Xerox Corporation | Electrophotographic imaging member |
| US5419993A (en) * | 1991-11-01 | 1995-05-30 | Canon Kabushiki Kaisha | Polyamide, electrophotographic photosensitive member employing the polyamide, and electrophotographic apparatus, device unit and facsimile machine employing the member |
| US6335133B1 (en) * | 1999-03-19 | 2002-01-01 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member, process cartridge, and electrophotographic apparatus |
| JP5361665B2 (ja) * | 2009-11-02 | 2013-12-04 | キヤノン株式会社 | 電子写真感光体、プロセスカートリッジおよび電子写真装置 |
-
1971
- 1971-08-25 US US00174956A patent/US3745005A/en not_active Expired - Lifetime
-
1972
- 1972-06-30 CA CA146,131A patent/CA955785A/en not_active Expired
- 1972-08-23 DE DE2241406A patent/DE2241406C3/de not_active Expired
- 1972-08-24 GB GB3943172A patent/GB1352487A/en not_active Expired
- 1972-08-24 FR FR7230128A patent/FR2151375A5/fr not_active Expired
- 1972-08-25 JP JP47084693A patent/JPS5139855B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2241406A1 (de) | 1973-03-01 |
| DE2241406B2 (enExample) | 1974-05-02 |
| JPS4830936A (enExample) | 1973-04-23 |
| GB1352487A (en) | 1974-05-08 |
| JPS5139855B2 (enExample) | 1976-10-30 |
| CA955785A (en) | 1974-10-08 |
| US3745005A (en) | 1973-07-10 |
| FR2151375A5 (enExample) | 1973-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2241406C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2924865C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2939483C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3046240C2 (enExample) | ||
| DE2144776A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1908343A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| EP0001599A1 (de) | Elektrophotographisches Aufzeichnungsmaterial und dessen Verwendung in einem Kopierverfahren | |
| DE2712579C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3114472A1 (de) | Beschichtete lichtempfindliche platte fuer die elektrophotographie | |
| DE2801913C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2107667C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE19612681B4 (de) | Elektrophotographisches Aufzeichnungsmaterial und Verfahren zu dessen Herstellung | |
| DE2654873A1 (de) | Mehrschichtige elektrophotographische platte | |
| DE2651535A1 (de) | Elektrophotographischer lichtempfindlicher teil | |
| DE2301060C3 (de) | Elektrofotografisches Aufzeichnungsmaterial | |
| DE69414183T2 (de) | Elektrophotographisches, lichtempfindliches Element und elektrophotographischer Apparat unter Verwendung desselben | |
| DE1572345A1 (de) | Datenspeicherung | |
| DE2041064A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1797137C3 (enExample) | ||
| DE1814678A1 (de) | Neue Photoleiter mit kleinem Molekuel | |
| DE1522721C3 (enExample) | ||
| DE2801914C2 (de) | Elektrophotographisches Aufzeichnungsmaterial und dessen Verwendung | |
| DE2832859C2 (enExample) | ||
| DE2747143A1 (de) | Elektrofotografische lichtempfindliche teile | |
| DE1522598A1 (de) | Lichtelektrisches Isoliermaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |