DE2220273C3 - Verfahren zur Gewinnung von Terephthalsäure aus einer durch Flüssig-Phasenoxidation anfallenden rohen Terephthalsäuresuspension - Google Patents
Verfahren zur Gewinnung von Terephthalsäure aus einer durch Flüssig-Phasenoxidation anfallenden rohen TerephthalsäuresuspensionInfo
- Publication number
- DE2220273C3 DE2220273C3 DE2220273A DE2220273A DE2220273C3 DE 2220273 C3 DE2220273 C3 DE 2220273C3 DE 2220273 A DE2220273 A DE 2220273A DE 2220273 A DE2220273 A DE 2220273A DE 2220273 C3 DE2220273 C3 DE 2220273C3
- Authority
- DE
- Germany
- Prior art keywords
- terephthalic acid
- slurry
- solvent
- pump
- treatment
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title claims description 243
- 238000000034 method Methods 0.000 title claims description 49
- 238000007254 oxidation reaction Methods 0.000 title claims description 31
- 230000003647 oxidation Effects 0.000 title claims description 21
- 239000007791 liquid phase Substances 0.000 title claims description 18
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 239000000725 suspension Substances 0.000 title claims description 4
- 239000002002 slurry Substances 0.000 claims description 92
- 239000002245 particle Substances 0.000 claims description 40
- 239000002904 solvent Substances 0.000 claims description 38
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 claims description 28
- 239000007788 liquid Substances 0.000 claims description 20
- 238000003756 stirring Methods 0.000 claims description 15
- 239000003054 catalyst Substances 0.000 claims description 9
- 238000000926 separation method Methods 0.000 claims description 9
- 229910017052 cobalt Inorganic materials 0.000 claims description 8
- 239000010941 cobalt Substances 0.000 claims description 8
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 8
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 7
- 229910001882 dioxygen Inorganic materials 0.000 claims description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims description 5
- 239000007789 gas Substances 0.000 claims description 5
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 239000011572 manganese Substances 0.000 claims description 3
- 229910052748 manganese Inorganic materials 0.000 claims description 3
- 238000011282 treatment Methods 0.000 description 54
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 48
- GOUHYARYYWKXHS-UHFFFAOYSA-N 4-formylbenzoic acid Chemical compound OC(=O)C1=CC=C(C=O)C=C1 GOUHYARYYWKXHS-UHFFFAOYSA-N 0.000 description 40
- 238000007654 immersion Methods 0.000 description 32
- 206010001497 Agitation Diseases 0.000 description 29
- 238000013019 agitation Methods 0.000 description 29
- 239000013078 crystal Substances 0.000 description 19
- 239000012535 impurity Substances 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 16
- 230000008033 biological extinction Effects 0.000 description 14
- 239000000203 mixture Substances 0.000 description 13
- 238000004140 cleaning Methods 0.000 description 11
- 230000000052 comparative effect Effects 0.000 description 10
- 230000000694 effects Effects 0.000 description 9
- 239000012452 mother liquor Substances 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 7
- 238000005086 pumping Methods 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- -1 B. p-xylene Chemical class 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000011084 recovery Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 229910001385 heavy metal Inorganic materials 0.000 description 3
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 238000006116 polymerization reaction Methods 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 150000003503 terephthalic acid derivatives Chemical class 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 150000001869 cobalt compounds Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- PLXSXOUOWRGVOZ-UHFFFAOYSA-L dibromocobalt;hexahydrate Chemical compound O.O.O.O.O.O.Br[Co]Br PLXSXOUOWRGVOZ-UHFFFAOYSA-L 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- RVHSTXJKKZWWDQ-UHFFFAOYSA-N 1,1,1,2-tetrabromoethane Chemical compound BrCC(Br)(Br)Br RVHSTXJKKZWWDQ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HNNQYHFROJDYHQ-UHFFFAOYSA-N 3-(4-ethylcyclohexyl)propanoic acid 3-(3-ethylcyclopentyl)propanoic acid Chemical class CCC1CCC(CCC(O)=O)C1.CCC1CCC(CCC(O)=O)CC1 HNNQYHFROJDYHQ-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 230000010718 Oxidation Activity Effects 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- ZBICJTQZVYWJPB-UHFFFAOYSA-N [Mn].[Co].[Br] Chemical compound [Mn].[Co].[Br] ZBICJTQZVYWJPB-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000007806 chemical reaction intermediate Substances 0.000 description 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000002696 manganese Chemical class 0.000 description 1
- 229940082328 manganese acetate tetrahydrate Drugs 0.000 description 1
- 150000002697 manganese compounds Chemical class 0.000 description 1
- CESXSDZNZGSWSP-UHFFFAOYSA-L manganese(2+);diacetate;tetrahydrate Chemical compound O.O.O.O.[Mn+2].CC([O-])=O.CC([O-])=O CESXSDZNZGSWSP-UHFFFAOYSA-L 0.000 description 1
- HHDPJRSXPOGIOP-UHFFFAOYSA-L manganese(2+);dibromide;tetrahydrate Chemical compound O.O.O.O.[Mn+2].[Br-].[Br-] HHDPJRSXPOGIOP-UHFFFAOYSA-L 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 150000005526 organic bromine compounds Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 238000010951 particle size reduction Methods 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 238000006068 polycondensation reaction Methods 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000004300 potassium benzoate Substances 0.000 description 1
- 229940103091 potassium benzoate Drugs 0.000 description 1
- 235000010235 potassium benzoate Nutrition 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- HSUPHZPGTAURKR-UHFFFAOYSA-N terephthalic acid;1,4-xylene Chemical compound CC1=CC=C(C)C=C1.OC(=O)C1=CC=C(C(O)=O)C=C1 HSUPHZPGTAURKR-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/42—Separation; Purification; Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2735971A JPS5328419B1 (enExample) | 1971-04-26 | 1971-04-26 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2220273A1 DE2220273A1 (de) | 1972-11-09 |
| DE2220273B2 DE2220273B2 (de) | 1980-08-21 |
| DE2220273C3 true DE2220273C3 (de) | 1981-08-20 |
Family
ID=12218841
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2220273A Expired DE2220273C3 (de) | 1971-04-26 | 1972-04-25 | Verfahren zur Gewinnung von Terephthalsäure aus einer durch Flüssig-Phasenoxidation anfallenden rohen Terephthalsäuresuspension |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3887612A (enExample) |
| JP (1) | JPS5328419B1 (enExample) |
| BE (1) | BE782619A (enExample) |
| DE (1) | DE2220273C3 (enExample) |
| FR (1) | FR2134559B1 (enExample) |
| GB (1) | GB1387700A (enExample) |
| IT (1) | IT954475B (enExample) |
| NL (1) | NL169994C (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2615657A1 (de) * | 1975-04-11 | 1976-10-21 | Ici Ltd | Oxidationsverfahren, insbesondere zur herstellung von terephthalsaeure |
| US4185073A (en) * | 1976-07-26 | 1980-01-22 | Standard Oil Company (Indiana) | Apparatus for iso- or terephthalic acid production in and recovery from benzoic acid-water solvent system |
| US4081464A (en) * | 1976-07-26 | 1978-03-28 | Standard Oil Company | Iso- or terephthalic acid production in and recovery from benzoic acid-water solvent system |
| DE2714985C2 (de) * | 1977-04-04 | 1982-05-06 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Reinigung von Terephthalsäure |
| US4241220A (en) * | 1977-12-28 | 1980-12-23 | Mitsui Petrochemical Industries, Ltd. | Process for producing terephthalic acid |
| US6649263B2 (en) * | 2001-11-16 | 2003-11-18 | Honeywell International Inc. | Polyester resin and industrial yarn process |
| US7399882B2 (en) * | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) * | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) * | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) * | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) * | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) * | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) * | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) * | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) * | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7482482B2 (en) * | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) * | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060047153A1 (en) * | 2004-09-02 | 2006-03-02 | Wonders Alan G | Optimized liquid-phase oxidation |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| US7355068B2 (en) | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| KR20100095004A (ko) | 2007-12-03 | 2010-08-27 | 게보 인코포레이티드 | 재생 조성물 |
| US8193402B2 (en) * | 2007-12-03 | 2012-06-05 | Gevo, Inc. | Renewable compositions |
| BRPI1008287A2 (pt) * | 2009-02-24 | 2016-03-15 | Gevo Inc | métodos de preparação de butadieno e isopreno renováveis |
| US20110024354A1 (en) * | 2009-07-30 | 2011-02-03 | General Electric Company | Desalination system and method |
| MY159813A (en) | 2010-01-08 | 2017-02-15 | Gevo Inc | Integrated methods of preparing renewable chemicals |
| US8373012B2 (en) | 2010-05-07 | 2013-02-12 | Gevo, Inc. | Renewable jet fuel blendstock from isobutanol |
| TW201247596A (en) | 2011-04-19 | 2012-12-01 | Gevo Inc | Variations on prins-like chemistry to produce 2,5-dimethylhexadiene from isobutanol |
| DE102012105876A1 (de) | 2012-07-02 | 2014-01-02 | Oxea Gmbh | Verfahren zur Herstellung von Terephthalsäure und ihren Derivaten |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE550529A (enExample) * | 1955-08-24 | |||
| US3064044A (en) * | 1957-08-15 | 1962-11-13 | Standard Oil Co | Multistage oxidation system for preparing dicarboxylic acid |
| US3170768A (en) * | 1959-04-22 | 1965-02-23 | Standard Oil Co | System for continuous preparation of terephthalic acid |
| US3210416A (en) * | 1960-09-22 | 1965-10-05 | Standard Oil Co | Manufacture of benzoic acid from toluene |
| DE1443149B2 (de) * | 1960-09-30 | 1976-06-10 | Standard Oil Co., Chicago, IH. (V.St.A.) | Verfahren zur kontinuierlichen gewinnung reiner terephthalsaeure aus einem reaktionsgemisch |
| FR1413057A (fr) * | 1963-01-16 | 1965-10-08 | Inst Francais Du Petrole | Procédé de fabrication d'acide téréphtalique |
| BE670307A (enExample) * | 1964-12-14 | 1900-01-01 | ||
| US3507913A (en) * | 1966-02-14 | 1970-04-21 | Mitsui Petrochemical Ind | Method of manufacture of terephthalic acid |
-
1971
- 1971-04-26 JP JP2735971A patent/JPS5328419B1/ja active Pending
-
1972
- 1972-04-24 IT IT49813/72A patent/IT954475B/it active
- 1972-04-25 BE BE782619A patent/BE782619A/xx not_active IP Right Cessation
- 1972-04-25 GB GB1922472A patent/GB1387700A/en not_active Expired
- 1972-04-25 DE DE2220273A patent/DE2220273C3/de not_active Expired
- 1972-04-26 FR FR7214900A patent/FR2134559B1/fr not_active Expired
- 1972-04-26 NL NLAANVRAGE7205637,A patent/NL169994C/xx not_active IP Right Cessation
- 1972-04-26 US US247711A patent/US3887612A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE2220273A1 (de) | 1972-11-09 |
| FR2134559B1 (enExample) | 1975-06-13 |
| GB1387700A (en) | 1975-03-19 |
| FR2134559A1 (enExample) | 1972-12-08 |
| NL7205637A (enExample) | 1972-10-30 |
| BE782619A (fr) | 1972-08-16 |
| US3887612A (en) | 1975-06-03 |
| JPS5328419B1 (enExample) | 1978-08-15 |
| IT954475B (it) | 1973-08-30 |
| DE2220273B2 (de) | 1980-08-21 |
| NL169994B (nl) | 1982-04-16 |
| NL169994C (nl) | 1982-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2220273C3 (de) | Verfahren zur Gewinnung von Terephthalsäure aus einer durch Flüssig-Phasenoxidation anfallenden rohen Terephthalsäuresuspension | |
| DE69805786T2 (de) | Verfahren zur vorbereitung von 2,6-naphthalindicarbonsaüre | |
| DE2708034A1 (de) | Verfahren und vorrichtung zur herstellung von aromatischen dicarbonsaeuren | |
| DE69924523T2 (de) | Verfahren zur herstellung aromatischer carbonsäuren | |
| DE3111335A1 (de) | "verfahren zur herstellung von terephthalsaeure" | |
| DE2905805A1 (de) | Vorrichtung zur herstellung aromatischer carbonsaeuren | |
| DE2416177B2 (de) | Verfahren zur rueckgewinnung des schwermetall-oxidationskatalysators aus einem gemisch, das durch kontinuierliche oxidation von p-xylol erhalten worden ist | |
| DE2436177A1 (de) | Verfahren zur herstellung von benzolcarbonsaeuren durch oxidation von alkylbenzolen in fluessiger phase | |
| DE2856529C2 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE2627475A1 (de) | Verfahren zur herstellung von terephthalsaeure | |
| DE2154147C3 (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE2534161C2 (de) | Verfahren zur Herstellung von Terephthalsäure mit hoher Reinheit | |
| DE1593539A1 (de) | Verfahren zur Herstellung reiner aromatischer Di- und Polycarbonsaeuren | |
| DE1493191B2 (de) | Verfahren zur Herstellung von Benzolpolycarbonsäuren | |
| DE2605363C3 (de) | Verfahren zur Herstellung von Phthalsäure | |
| DE2540331C3 (de) | Verfahren zur Herstellung von Terephthalsäure oder Isophthalsäure | |
| DE2703161A1 (de) | Verfahren zur herstellung von hochgradig reiner terephthalsaeure | |
| DE1270030B (de) | Verfahren zur Reinigung von Terephthalsaeure | |
| DE2341147B2 (de) | Verfahren zur herstellung von benzoesaeure | |
| DE2257752A1 (de) | Verfahren zur herstellung von terephthalsaeure | |
| DE1940319C3 (de) | Verfahren zur Gewinnung der Naphthalin-2,6-dicarbonsäure aus dem ein Dialkalisalz der Naphthalin-2,6dicarbonsäure enthaltenden Produkt der thermischen Umlagerung oder Disproportionierung von Alkalisalzen geeigneter Naphthalincarbonsäuren | |
| DE1793415A1 (de) | Kontinuierliches Verfahren zur Herstellung von aromatischen Dicarbonsaeuren | |
| DE60025373T2 (de) | Verfahren zur verringerung des kaliums in einem integrierten prozess zur herstellung von 2,6-naphthalenedicarbonsäure | |
| AT256079B (de) | Verfahren zur Herstellung von Terephthalsäure | |
| DE2743004A1 (de) | Verfahren zur herstellung aromatischer carbonsaeuren oder deren methylester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: KOHLER, M., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: SOLF, A., DR.-ING., 8000 MUENCHEN ZAPF, C., DIPL.-ING., PAT.-ANW., 5600 WUPPERTAL |
|
| 8339 | Ceased/non-payment of the annual fee |