GB1387700A - Process for preparing high purity terephthalic acid - Google Patents
Process for preparing high purity terephthalic acidInfo
- Publication number
- GB1387700A GB1387700A GB1922472A GB1922472A GB1387700A GB 1387700 A GB1387700 A GB 1387700A GB 1922472 A GB1922472 A GB 1922472A GB 1922472 A GB1922472 A GB 1922472A GB 1387700 A GB1387700 A GB 1387700A
- Authority
- GB
- United Kingdom
- Prior art keywords
- slurry
- terephthalic acid
- oxidation
- april
- vessel
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 title abstract 12
- 238000004519 manufacturing process Methods 0.000 title 1
- 239000002002 slurry Substances 0.000 abstract 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 abstract 6
- 238000000034 method Methods 0.000 abstract 3
- 238000007254 oxidation reaction Methods 0.000 abstract 3
- 239000002245 particle Substances 0.000 abstract 3
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 abstract 2
- 230000003647 oxidation Effects 0.000 abstract 2
- 238000003756 stirring Methods 0.000 abstract 2
- 239000003054 catalyst Substances 0.000 abstract 1
- 229910017052 cobalt Inorganic materials 0.000 abstract 1
- 239000010941 cobalt Substances 0.000 abstract 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 abstract 1
- BZRRQSJJPUGBAA-UHFFFAOYSA-L cobalt(ii) bromide Chemical compound Br[Co]Br BZRRQSJJPUGBAA-UHFFFAOYSA-L 0.000 abstract 1
- RJYMRRJVDRJMJW-UHFFFAOYSA-L dibromomanganese Chemical class Br[Mn]Br RJYMRRJVDRJMJW-UHFFFAOYSA-L 0.000 abstract 1
- 229940071125 manganese acetate Drugs 0.000 abstract 1
- UOGMEBQRZBEZQT-UHFFFAOYSA-L manganese(2+);diacetate Chemical compound [Mn+2].CC([O-])=O.CC([O-])=O UOGMEBQRZBEZQT-UHFFFAOYSA-L 0.000 abstract 1
- 239000012452 mother liquor Substances 0.000 abstract 1
- 239000003348 petrochemical agent Substances 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/16—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation
- C07C51/21—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen
- C07C51/255—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting
- C07C51/265—Preparation of carboxylic acids or their salts, halides or anhydrides by oxidation with molecular oxygen of compounds containing six-membered aromatic rings without ring-splitting having alkyl side chains which are oxidised to carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/42—Separation; Purification; Stabilisation; Use of additives
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2735971A JPS5328419B1 (enExample) | 1971-04-26 | 1971-04-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1387700A true GB1387700A (en) | 1975-03-19 |
Family
ID=12218841
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB1922472A Expired GB1387700A (en) | 1971-04-26 | 1972-04-25 | Process for preparing high purity terephthalic acid |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3887612A (enExample) |
| JP (1) | JPS5328419B1 (enExample) |
| BE (1) | BE782619A (enExample) |
| DE (1) | DE2220273C3 (enExample) |
| FR (1) | FR2134559B1 (enExample) |
| GB (1) | GB1387700A (enExample) |
| IT (1) | IT954475B (enExample) |
| NL (1) | NL169994C (enExample) |
Families Citing this family (41)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1063362B (it) * | 1975-04-11 | 1985-02-11 | Ici Ltd | Processo di ossidazione di p-xilene ad acido tereftalico |
| US4185073A (en) * | 1976-07-26 | 1980-01-22 | Standard Oil Company (Indiana) | Apparatus for iso- or terephthalic acid production in and recovery from benzoic acid-water solvent system |
| US4081464A (en) * | 1976-07-26 | 1978-03-28 | Standard Oil Company | Iso- or terephthalic acid production in and recovery from benzoic acid-water solvent system |
| DE2714985C2 (de) * | 1977-04-04 | 1982-05-06 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Reinigung von Terephthalsäure |
| DE2856529C2 (de) * | 1977-12-28 | 1982-09-09 | Mitsui Petrochemical Industries Ltd., Tokyo | Verfahren zur Herstellung von Terephthalsäure |
| US6649263B2 (en) * | 2001-11-16 | 2003-11-18 | Honeywell International Inc. | Polyester resin and industrial yarn process |
| US7482482B2 (en) * | 2004-09-02 | 2009-01-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692037B2 (en) * | 2004-09-02 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US20060047153A1 (en) * | 2004-09-02 | 2006-03-02 | Wonders Alan G | Optimized liquid-phase oxidation |
| US7582793B2 (en) | 2004-09-02 | 2009-09-01 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608733B2 (en) * | 2004-09-02 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572932B2 (en) * | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7608732B2 (en) * | 2005-03-08 | 2009-10-27 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7507857B2 (en) * | 2004-09-02 | 2009-03-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7381836B2 (en) * | 2004-09-02 | 2008-06-03 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7741515B2 (en) * | 2004-09-02 | 2010-06-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7586000B2 (en) * | 2004-09-02 | 2009-09-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7589231B2 (en) * | 2004-09-02 | 2009-09-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7361784B2 (en) * | 2004-09-02 | 2008-04-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7390921B2 (en) * | 2004-09-02 | 2008-06-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7495125B2 (en) * | 2004-09-02 | 2009-02-24 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7563926B2 (en) * | 2004-09-02 | 2009-07-21 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7910769B2 (en) * | 2004-09-02 | 2011-03-22 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7692036B2 (en) | 2004-11-29 | 2010-04-06 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7683210B2 (en) * | 2004-09-02 | 2010-03-23 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7504535B2 (en) | 2004-09-02 | 2009-03-17 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7568361B2 (en) * | 2004-09-02 | 2009-08-04 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7572936B2 (en) | 2004-09-02 | 2009-08-11 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7371894B2 (en) * | 2004-09-02 | 2008-05-13 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7399882B2 (en) * | 2004-09-02 | 2008-07-15 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7884232B2 (en) * | 2005-06-16 | 2011-02-08 | Eastman Chemical Company | Optimized liquid-phase oxidation |
| US7355068B2 (en) * | 2006-01-04 | 2008-04-08 | Eastman Chemical Company | Oxidation system with internal secondary reactor |
| US7358389B2 (en) * | 2006-01-04 | 2008-04-15 | Eastman Chemical Company | Oxidation system employing internal structure for enhanced hydrodynamics |
| CN101952398B (zh) | 2007-12-03 | 2014-05-21 | 格沃股份有限公司 | 可再生组合物 |
| US8193402B2 (en) * | 2007-12-03 | 2012-06-05 | Gevo, Inc. | Renewable compositions |
| CA2753037A1 (en) * | 2009-02-24 | 2010-09-02 | Gevo, Inc. | Methods of preparing renewable butadiene and renewable isoprene |
| US20110024354A1 (en) * | 2009-07-30 | 2011-02-03 | General Electric Company | Desalination system and method |
| US8450543B2 (en) | 2010-01-08 | 2013-05-28 | Gevo, Inc. | Integrated methods of preparing renewable chemicals |
| EP2566830B1 (en) | 2010-05-07 | 2017-03-22 | GEVO, Inc. | Renewable jet fuel blendstock from isobutanol |
| WO2012145495A2 (en) | 2011-04-19 | 2012-10-26 | Gevo, Inc. | Variations on prins-like chemistry to produce 2,5-dimethylhexadiene from isobutanol |
| DE102012105876A1 (de) | 2012-07-02 | 2014-01-02 | Oxea Gmbh | Verfahren zur Herstellung von Terephthalsäure und ihren Derivaten |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE550529A (enExample) * | 1955-08-24 | |||
| US3064044A (en) * | 1957-08-15 | 1962-11-13 | Standard Oil Co | Multistage oxidation system for preparing dicarboxylic acid |
| US3170768A (en) * | 1959-04-22 | 1965-02-23 | Standard Oil Co | System for continuous preparation of terephthalic acid |
| US3210416A (en) * | 1960-09-22 | 1965-10-05 | Standard Oil Co | Manufacture of benzoic acid from toluene |
| DE1443149B2 (de) * | 1960-09-30 | 1976-06-10 | Standard Oil Co., Chicago, IH. (V.St.A.) | Verfahren zur kontinuierlichen gewinnung reiner terephthalsaeure aus einem reaktionsgemisch |
| FR1413057A (fr) * | 1963-01-16 | 1965-10-08 | Inst Francais Du Petrole | Procédé de fabrication d'acide téréphtalique |
| BE670307A (enExample) * | 1964-12-14 | 1900-01-01 | ||
| US3507913A (en) * | 1966-02-14 | 1970-04-21 | Mitsui Petrochemical Ind | Method of manufacture of terephthalic acid |
-
1971
- 1971-04-26 JP JP2735971A patent/JPS5328419B1/ja active Pending
-
1972
- 1972-04-24 IT IT49813/72A patent/IT954475B/it active
- 1972-04-25 DE DE2220273A patent/DE2220273C3/de not_active Expired
- 1972-04-25 GB GB1922472A patent/GB1387700A/en not_active Expired
- 1972-04-25 BE BE782619A patent/BE782619A/xx not_active IP Right Cessation
- 1972-04-26 US US247711A patent/US3887612A/en not_active Expired - Lifetime
- 1972-04-26 NL NLAANVRAGE7205637,A patent/NL169994C/xx not_active IP Right Cessation
- 1972-04-26 FR FR7214900A patent/FR2134559B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5328419B1 (enExample) | 1978-08-15 |
| BE782619A (fr) | 1972-08-16 |
| DE2220273C3 (de) | 1981-08-20 |
| IT954475B (it) | 1973-08-30 |
| FR2134559A1 (enExample) | 1972-12-08 |
| DE2220273B2 (de) | 1980-08-21 |
| NL7205637A (enExample) | 1972-10-30 |
| DE2220273A1 (de) | 1972-11-09 |
| NL169994B (nl) | 1982-04-16 |
| US3887612A (en) | 1975-06-03 |
| NL169994C (nl) | 1982-09-16 |
| FR2134559B1 (enExample) | 1975-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1387700A (en) | Process for preparing high purity terephthalic acid | |
| US3584039A (en) | Fiber-grade terephthalic acid by catalytic hydrogen treatment of dissolved impure terephthalic acid | |
| US3845121A (en) | Process for separating carbonylation products from reaction mixture without catalyst decomposition | |
| US4447646A (en) | Process for the purification of terephthalic acid | |
| GB1004895A (en) | Process for the production of isophthalic and terephthalic acids | |
| US3772383A (en) | Process for preparing phenyl esters of aliphatic carboxylic acids | |
| GB1237298A (en) | Production of terephthalic and/or isophthalic acid | |
| GB1202509A (en) | Production of terephthalic acid diesters | |
| GB1350874A (en) | Continuous production of terephthalic acid | |
| GB1152575A (en) | Purification of Aromatic Polycarboxylic Acids. | |
| SE8207342D0 (sv) | Forfarande for atervinning och ateranvendning av kobolt- och/eller mangankatalysatorbestandsdelar | |
| US4820862A (en) | Process for the preparation of dimethyl terephthalate | |
| US3361832A (en) | Conversion of acids to alcohols | |
| US3171856A (en) | Acid purification process | |
| US4212995A (en) | Process for treatment by liquid cyclone for production of terephthalic acid suspension having reduced impurity content | |
| GB1423030A (en) | Process for producing dl-tartaric acid | |
| US4716245A (en) | Process for producing 2,6-naphthalenedicarboxylic acid | |
| US3492340A (en) | Preparation of vinyl acetate and regeneration of cupric acid salt catalyst | |
| US2286559A (en) | Oxidation of alicyclic ketones | |
| GB1577019A (en) | Process for producing high quality terephthalic acid | |
| US2887511A (en) | Preparation of aromatic acids by oxidation | |
| US3284493A (en) | Process for the conversion of methyl-substituted benzene compounds to carboxylic acids | |
| US3644506A (en) | Preparation of aromatic carboxylic acids | |
| GB1292512A (en) | Purifying and compressing ketene | |
| GB1181369A (en) | Method for Purifying Dimethyl Terephthalate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |