DE2209891C3 - 9,10-Dihydro-thieno[3.2-b][f][4H]benzazepine sowie Verfahren zu deren Herstellung - Google Patents
9,10-Dihydro-thieno[3.2-b][f][4H]benzazepine sowie Verfahren zu deren HerstellungInfo
- Publication number
- DE2209891C3 DE2209891C3 DE2209891A DE2209891A DE2209891C3 DE 2209891 C3 DE2209891 C3 DE 2209891C3 DE 2209891 A DE2209891 A DE 2209891A DE 2209891 A DE2209891 A DE 2209891A DE 2209891 C3 DE2209891 C3 DE 2209891C3
- Authority
- DE
- Germany
- Prior art keywords
- thieno
- dihydro
- acid
- bromo
- thiophene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- GZDFNOOZOGEXDS-UHFFFAOYSA-N 4H-1-benzazepine Chemical class N=1C=CCC=C2C=1C=CC=C2 GZDFNOOZOGEXDS-UHFFFAOYSA-N 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 11
- WMUZDBZPDLHUMW-UHFFFAOYSA-N (2-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1[N+]([O-])=O WMUZDBZPDLHUMW-UHFFFAOYSA-N 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 229910052739 hydrogen Inorganic materials 0.000 claims 1
- 239000001257 hydrogen Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 7
- 239000005977 Ethylene Substances 0.000 description 7
- 238000004458 analytical method Methods 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- KJVCGZDACFKAHF-UHFFFAOYSA-N 1-(3-bromothiophen-2-yl)-2-(2-nitrophenyl)ethanone Chemical compound [O-][N+](=O)C1=CC=CC=C1CC(=O)C1=C(Br)C=CS1 KJVCGZDACFKAHF-UHFFFAOYSA-N 0.000 description 5
- DQFQCHIDRBIESA-UHFFFAOYSA-N 1-benzazepine Chemical compound N1C=CC=CC2=CC=CC=C12 DQFQCHIDRBIESA-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- -1 aromatic hydrocarbon Haloalkane Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229930192474 thiophene Natural products 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- BKTDBYAOZVFUNR-UHFFFAOYSA-N 2-(2-nitrophenyl)acetyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1CC(Cl)=O BKTDBYAOZVFUNR-UHFFFAOYSA-N 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 3
- XCMISAPCWHTVNG-UHFFFAOYSA-N 3-bromothiophene Chemical compound BrC=1C=CSC=1 XCMISAPCWHTVNG-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 3
- PYCOGYYQXHAGAA-UHFFFAOYSA-N 1-(3-bromothiophen-2-yl)-2-(4-chloro-2-nitrophenyl)ethanone Chemical compound BrC1=C(SC=C1)C(CC1=C(C=C(C=C1)Cl)[N+](=O)[O-])=O PYCOGYYQXHAGAA-UHFFFAOYSA-N 0.000 description 2
- IKHPFVMHMNYQDQ-UHFFFAOYSA-N 2-(2-aminophenyl)-1-(3-bromothiophen-2-yl)ethanone Chemical compound BrC1=C(SC=C1)C(CC1=C(C=CC=C1)N)=O IKHPFVMHMNYQDQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000002981 blocking agent Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical group 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- ZUXPELAHJQSZTE-UHFFFAOYSA-N 1-(3-bromothiophen-2-yl)ethanone Chemical class CC(=O)C=1SC=CC=1Br ZUXPELAHJQSZTE-UHFFFAOYSA-N 0.000 description 1
- FLZUSUKBKOZJLG-UHFFFAOYSA-N 2-(4-chloro-2-nitrophenyl)acetic acid Chemical compound OC(=O)CC1=CC=C(Cl)C=C1[N+]([O-])=O FLZUSUKBKOZJLG-UHFFFAOYSA-N 0.000 description 1
- IWBFYTOHGZYDFG-UHFFFAOYSA-N BrC1=C(SC=C1)C(CC1=C(C=C(C=C1)Cl)N)=O Chemical compound BrC1=C(SC=C1)C(CC1=C(C=C(C=C1)Cl)N)=O IWBFYTOHGZYDFG-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical class [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229910021550 Vanadium Chloride Inorganic materials 0.000 description 1
- WXOQGOXTUJOXCA-UHFFFAOYSA-N [I].[Cu] Chemical compound [I].[Cu] WXOQGOXTUJOXCA-UHFFFAOYSA-N 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N beta-phenethyl acetate Natural products CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- 150000004662 dithiols Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- RPESBQCJGHJMTK-UHFFFAOYSA-I pentachlorovanadium Chemical compound [Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[V+5] RPESBQCJGHJMTK-UHFFFAOYSA-I 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D495/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms
- C07D495/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having sulfur atoms as the only ring hetero atoms in which the condensed system contains two hetero rings
- C07D495/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/56—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups bound to carbon atoms of six-membered aromatic rings and carboxyl groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/28—Halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7106916A FR2128029B1 (enExample) | 1971-03-01 | 1971-03-01 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2209891A1 DE2209891A1 (de) | 1972-09-07 |
| DE2209891B2 DE2209891B2 (de) | 1980-07-24 |
| DE2209891C3 true DE2209891C3 (de) | 1981-04-30 |
Family
ID=9072648
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2209891A Expired DE2209891C3 (de) | 1971-03-01 | 1972-03-01 | 9,10-Dihydro-thieno[3.2-b][f][4H]benzazepine sowie Verfahren zu deren Herstellung |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3767676A (enExample) |
| JP (1) | JPS554111B1 (enExample) |
| AT (1) | AT315183B (enExample) |
| AU (1) | AU461337B2 (enExample) |
| BE (1) | BE779964A (enExample) |
| CA (1) | CA989826A (enExample) |
| CH (1) | CH550197A (enExample) |
| DD (1) | DD96709A5 (enExample) |
| DE (1) | DE2209891C3 (enExample) |
| DK (1) | DK136868B (enExample) |
| ES (1) | ES400254A1 (enExample) |
| FI (1) | FI52584C (enExample) |
| FR (1) | FR2128029B1 (enExample) |
| GB (1) | GB1380242A (enExample) |
| HU (1) | HU163927B (enExample) |
| IL (1) | IL38794A (enExample) |
| NL (1) | NL7202672A (enExample) |
| SE (1) | SE386679B (enExample) |
| SU (1) | SU434656A3 (enExample) |
| ZA (1) | ZA72972B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW200808810A (en) * | 2006-02-23 | 2008-02-16 | Novartis Ag | Organic compounds |
-
1971
- 1971-03-01 FR FR7106916A patent/FR2128029B1/fr not_active Expired
-
1972
- 1972-02-15 ZA ZA720972A patent/ZA72972B/xx unknown
- 1972-02-16 CH CH218772A patent/CH550197A/fr not_active IP Right Cessation
- 1972-02-18 IL IL38794A patent/IL38794A/xx unknown
- 1972-02-28 US US00230123A patent/US3767676A/en not_active Expired - Lifetime
- 1972-02-29 HU HURO646A patent/HU163927B/hu unknown
- 1972-02-29 AU AU39459/72A patent/AU461337B2/en not_active Expired
- 1972-02-29 ES ES400254A patent/ES400254A1/es not_active Expired
- 1972-02-29 SE SE7202534A patent/SE386679B/xx unknown
- 1972-02-29 CA CA135,882A patent/CA989826A/fr not_active Expired
- 1972-02-29 DD DD161183A patent/DD96709A5/xx unknown
- 1972-02-29 BE BE779964A patent/BE779964A/xx unknown
- 1972-02-29 FI FI720528A patent/FI52584C/fi active
- 1972-03-01 JP JP2069272A patent/JPS554111B1/ja active Pending
- 1972-03-01 DE DE2209891A patent/DE2209891C3/de not_active Expired
- 1972-03-01 SU SU1753758A patent/SU434656A3/ru active
- 1972-03-01 NL NL7202672A patent/NL7202672A/xx not_active Application Discontinuation
- 1972-03-01 DK DK93872AA patent/DK136868B/da unknown
- 1972-03-01 GB GB965372A patent/GB1380242A/en not_active Expired
- 1972-03-01 AT AT168672A patent/AT315183B/de active
Also Published As
| Publication number | Publication date |
|---|---|
| BE779964A (fr) | 1972-08-29 |
| HU163927B (enExample) | 1973-11-28 |
| DE2209891B2 (de) | 1980-07-24 |
| FI52584B (enExample) | 1977-06-30 |
| AU461337B2 (en) | 1975-05-06 |
| SE386679B (sv) | 1976-08-16 |
| ES400254A1 (es) | 1974-12-16 |
| DK136868B (da) | 1977-12-05 |
| GB1380242A (en) | 1975-01-08 |
| FI52584C (fi) | 1977-10-10 |
| AU3945972A (en) | 1973-08-30 |
| IL38794A (en) | 1975-05-22 |
| FR2128029B1 (enExample) | 1974-08-02 |
| DD96709A5 (enExample) | 1973-04-05 |
| DE2209891A1 (de) | 1972-09-07 |
| IL38794A0 (en) | 1972-04-27 |
| SU434656A3 (ru) | 1974-06-30 |
| US3767676A (en) | 1973-10-23 |
| NL7202672A (enExample) | 1972-09-05 |
| AT315183B (de) | 1974-05-10 |
| ZA72972B (en) | 1973-03-28 |
| JPS554111B1 (enExample) | 1980-01-29 |
| DK136868C (enExample) | 1978-05-08 |
| FR2128029A1 (enExample) | 1972-10-20 |
| CH550197A (fr) | 1974-06-14 |
| CA989826A (fr) | 1976-05-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2614406C2 (enExample) | ||
| DE2914494A1 (de) | Iminochinazoline, verfahren zu deren herstellung sowie verfahren zur herstellung von 6,7-dichlor-1,5-dihydroimidazo eckige klammer auf 2,1b eckige klammer zu -chinazolin-2(3h)-on | |
| Anderson | Pyrrole Chemistry: I. Substitution Reactions of 1-METHYLPYRROLE | |
| EP0496238A1 (de) | Substituierte Benzoxazepine und Benzthiazepine, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2727802A1 (de) | Sulfamoyl-arylketone und verfahren zu ihrer herstellung | |
| DE2309599A1 (de) | Verfahren zur herstellung von 7-acylamino-desacetoxy-cephalosporansaeurederivaten | |
| DE2209891C3 (de) | 9,10-Dihydro-thieno[3.2-b][f][4H]benzazepine sowie Verfahren zu deren Herstellung | |
| DE2533924C3 (de) | Verfahren zur Herstellung von 6- Aryl-4H-striazolo [3,4-c] thieno [2,3-e] 1,4-diazepinen | |
| DE3028369A1 (de) | Verfahren zur herstellung von 7-alkoxycarbonyl-6,8-dimethyl-4-hydroxymethyl-1-phthalazon und die dabei auftretenden zwischenprodukte | |
| DE2320040A1 (de) | Verfahren zur herstellung von 7acylamino-desacetoxy-cephalosporansaeureester | |
| DE2423721A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| DE2443086A1 (de) | Verfahren zur herstellung neuer, heterocyclischer verbindungen | |
| DE2302672A1 (de) | 5-aroylfurane, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2446256B2 (de) | Verfahren zur herstellung von hexahydrothieno eckige klammer auf 3,4- d eckige klammer zu -imidazol-2,4-dionen | |
| DE2600768C2 (de) | Verfahren zur Herstellung von 6,11-Dihydro-11-oxodibenz[b,e]-oxepin-alkansäuren | |
| DE2729817C2 (de) | Verfahren zur Herstellung von dl- 6a-10a-cis-1-Hydroxy-3-alkylsubstituierten-6,6-dimethyl-6,6a,7,8,10,10a-hexahydro-9H-dibenzo[b,d]-pyran-9-onen | |
| DE2416594C2 (de) | Verfahren zur Herstellung vn 2, 2',3,3'-Tetracarbonsäurediphenylätherdianhydrid | |
| DE2757281A1 (de) | Verfahren zur herstellung von 1-hydroxy-aporphinderivaten | |
| DE1770421C3 (de) | Verfahren zur Herstellung von 1,3-Dihydro-2H-1,4-benzodiazepin-2-onderivaten | |
| DE1668387C3 (de) | S-Methylsulfonyl-S-hydroxy-S-(3-dimethyl-aminopropyl)-5H-dibenzo eckige Klammer auf a, d eckige Klammer zu -cycloheptene und Verfahren zu deren Herstellung | |
| LU86853A1 (de) | Neue 8-beziehungsweise 1,8-substituierte ergolenderivate und verfahren zu ihrer herstellung | |
| DE1695797B2 (de) | 4-(2-thienyl)-1h-chinazolinon-(2) - e, verfahren zu ihrer herstellung und pharmazeutische zubereitungen | |
| DE3325456C2 (enExample) | ||
| AT263026B (de) | Verfahren zur Herstellung von neuen Phenthiazinderivaten | |
| DE2058234C3 (de) | (+Vcis-U-Dibenzyl-hexahydro-lH- thieno [3,4-d] imidazol-2,4-dion, Verfahren zu seiner Herstellung und dessen Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| BI | Miscellaneous see part 2 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee | ||
| 8339 | Ceased/non-payment of the annual fee |