DE2209872A1 - - Google Patents
Info
- Publication number
- DE2209872A1 DE2209872A1 DE19722209872 DE2209872A DE2209872A1 DE 2209872 A1 DE2209872 A1 DE 2209872A1 DE 19722209872 DE19722209872 DE 19722209872 DE 2209872 A DE2209872 A DE 2209872A DE 2209872 A1 DE2209872 A1 DE 2209872A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- group
- quinazolinone
- chloride
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 claims description 30
- -1 p-toluenesulfonamido Chemical group 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 11
- HQQTZCPKNZVLFF-UHFFFAOYSA-N 4h-1,2-benzoxazin-3-one Chemical compound C1=CC=C2ONC(=O)CC2=C1 HQQTZCPKNZVLFF-UHFFFAOYSA-N 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 238000007639 printing Methods 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000000732 arylene group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 3
- WZTDFXZRAYNVAV-UHFFFAOYSA-N N-[2-(4-oxo-3H-quinazolin-2-yl)phenyl]benzenesulfonamide Chemical compound C1(=CC=CC=C1)S(=O)(=O)NC1=C(C=CC=C1)C1=NC2=CC=CC=C2C(N1)=O WZTDFXZRAYNVAV-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 230000005284 excitation Effects 0.000 claims 1
- 125000004957 naphthylene group Chemical group 0.000 claims 1
- 230000005855 radiation Effects 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 30
- 239000000047 product Substances 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 15
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 13
- 239000000155 melt Substances 0.000 description 13
- 239000000203 mixture Substances 0.000 description 13
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 239000000976 ink Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 9
- 238000001953 recrystallisation Methods 0.000 description 9
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 8
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- 239000000908 ammonium hydroxide Substances 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000003973 paint Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical compound NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- LIVHLIWSCIZRJU-UHFFFAOYSA-N 4-methyl-n-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC=CC=C1C1=NC2=CC=CC=C2C(=O)O1 LIVHLIWSCIZRJU-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001266 acyl halides Chemical class 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000007850 fluorescent dye Substances 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- GBXDLFFVJWGTEY-UHFFFAOYSA-N n-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzamide Chemical compound C=1C=CC=C(C=2OC(=O)C3=CC=CC=C3N=2)C=1NC(=O)C1=CC=CC=C1 GBXDLFFVJWGTEY-UHFFFAOYSA-N 0.000 description 2
- RWGRZFIQGUSROZ-UHFFFAOYSA-N n-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=CC=C1C1=NC2=CC=CC=C2C(=O)O1 RWGRZFIQGUSROZ-UHFFFAOYSA-N 0.000 description 2
- 238000007645 offset printing Methods 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- ZCKZLYLHZIZZLZ-UHFFFAOYSA-N 1-methylnaphthalene-2-carbonyl chloride Chemical compound C1=CC=C2C(C)=C(C(Cl)=O)C=CC2=C1 ZCKZLYLHZIZZLZ-UHFFFAOYSA-N 0.000 description 1
- NFKAWBGFIMBUMB-UHFFFAOYSA-N 1-phenylpentan-2-one Chemical compound CCCC(=O)CC1=CC=CC=C1 NFKAWBGFIMBUMB-UHFFFAOYSA-N 0.000 description 1
- WNAJXPYVTFYEST-UHFFFAOYSA-N 2-Amino-3-methylbenzoate Chemical compound CC1=CC=CC(C(O)=O)=C1N WNAJXPYVTFYEST-UHFFFAOYSA-N 0.000 description 1
- UMKSAURFQFUULT-UHFFFAOYSA-N 2-Amino-5-methoxybenzoic acid Chemical compound COC1=CC=C(N)C(C(O)=O)=C1 UMKSAURFQFUULT-UHFFFAOYSA-N 0.000 description 1
- CJUZTHHXEUFUPA-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]-5-chlorobenzoic acid Chemical compound NC1=CC=CC=C1C(=O)NC1=CC=C(Cl)C=C1C(O)=O CJUZTHHXEUFUPA-UHFFFAOYSA-N 0.000 description 1
- KUHAYJJXXGBYBW-UHFFFAOYSA-N 2-amino-3-fluorobenzoic acid Chemical compound NC1=C(F)C=CC=C1C(O)=O KUHAYJJXXGBYBW-UHFFFAOYSA-N 0.000 description 1
- BNNICQAVXPXQAH-UHFFFAOYSA-N 2-amino-4-bromobenzoic acid Chemical compound NC1=CC(Br)=CC=C1C(O)=O BNNICQAVXPXQAH-UHFFFAOYSA-N 0.000 description 1
- LHMILTWCGKFWAI-UHFFFAOYSA-N 2-amino-4-ethoxybenzoic acid Chemical compound CCOC1=CC=C(C(O)=O)C(N)=C1 LHMILTWCGKFWAI-UHFFFAOYSA-N 0.000 description 1
- LGPVTNAJFDUWLF-UHFFFAOYSA-N 2-amino-4-fluorobenzoic acid Chemical compound NC1=CC(F)=CC=C1C(O)=O LGPVTNAJFDUWLF-UHFFFAOYSA-N 0.000 description 1
- HHNWXQCVWVVVQZ-UHFFFAOYSA-N 2-amino-4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C(N)=C1 HHNWXQCVWVVVQZ-UHFFFAOYSA-N 0.000 description 1
- RPGKFFKUTVJVPY-UHFFFAOYSA-N 2-amino-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(N)=C1 RPGKFFKUTVJVPY-UHFFFAOYSA-N 0.000 description 1
- KYWPWICSJIFKRC-UHFFFAOYSA-N 2-amino-4-propylbenzoic acid Chemical compound CCCC1=CC=C(C(O)=O)C(N)=C1 KYWPWICSJIFKRC-UHFFFAOYSA-N 0.000 description 1
- CUKXRHLWPSBCTI-UHFFFAOYSA-N 2-amino-5-bromobenzoic acid Chemical compound NC1=CC=C(Br)C=C1C(O)=O CUKXRHLWPSBCTI-UHFFFAOYSA-N 0.000 description 1
- SWFLRTCKPHKGSR-UHFFFAOYSA-N 2-amino-5-butylbenzoic acid Chemical compound CCCCC1=CC=C(N)C(C(O)=O)=C1 SWFLRTCKPHKGSR-UHFFFAOYSA-N 0.000 description 1
- NBUUUJWWOARGNW-UHFFFAOYSA-N 2-amino-5-methylbenzoic acid Chemical compound CC1=CC=C(N)C(C(O)=O)=C1 NBUUUJWWOARGNW-UHFFFAOYSA-N 0.000 description 1
- BNQPROAXWQCNKO-UHFFFAOYSA-N 2-amino-6-bromobenzoic acid Chemical compound NC1=CC=CC(Br)=C1C(O)=O BNQPROAXWQCNKO-UHFFFAOYSA-N 0.000 description 1
- SZCPTRGBOVXVCA-UHFFFAOYSA-N 2-amino-6-chlorobenzoic acid Chemical compound NC1=CC=CC(Cl)=C1C(O)=O SZCPTRGBOVXVCA-UHFFFAOYSA-N 0.000 description 1
- XZZRBIJOVBNMIT-UHFFFAOYSA-N 2-amino-6-ethylbenzoic acid Chemical compound CCC1=CC=CC(N)=C1C(O)=O XZZRBIJOVBNMIT-UHFFFAOYSA-N 0.000 description 1
- RWSFZKWMVWPDGZ-UHFFFAOYSA-N 2-amino-6-fluorobenzoic acid Chemical compound NC1=CC=CC(F)=C1C(O)=O RWSFZKWMVWPDGZ-UHFFFAOYSA-N 0.000 description 1
- PSQOLYZSEHSFLC-UHFFFAOYSA-N 2-amino-6-iodobenzoic acid Chemical compound NC1=CC=CC(I)=C1C(O)=O PSQOLYZSEHSFLC-UHFFFAOYSA-N 0.000 description 1
- DYZDIWNRWSNVPT-UHFFFAOYSA-N 2-amino-6-methoxybenzoic acid Chemical compound COC1=CC=CC(N)=C1C(O)=O DYZDIWNRWSNVPT-UHFFFAOYSA-N 0.000 description 1
- XHYVBIXKORFHFM-UHFFFAOYSA-N 2-amino-6-methylbenzoic acid Chemical compound CC1=CC=CC(N)=C1C(O)=O XHYVBIXKORFHFM-UHFFFAOYSA-N 0.000 description 1
- RWUTXZOKQFXNQM-UHFFFAOYSA-N 2-butyloctanoyl chloride Chemical compound CCCCCCC(C(Cl)=O)CCCC RWUTXZOKQFXNQM-UHFFFAOYSA-N 0.000 description 1
- ZPMWWAIBJJFPPQ-UHFFFAOYSA-N 2-ethoxyacetyl chloride Chemical compound CCOCC(Cl)=O ZPMWWAIBJJFPPQ-UHFFFAOYSA-N 0.000 description 1
- PJGFNNXYKMSCCU-UHFFFAOYSA-N 2-ethylbenzoyl chloride Chemical compound CCC1=CC=CC=C1C(Cl)=O PJGFNNXYKMSCCU-UHFFFAOYSA-N 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- DUNNNVSEUCJEOY-UHFFFAOYSA-N 2-methoxyethanesulfonyl chloride Chemical compound COCCS(Cl)(=O)=O DUNNNVSEUCJEOY-UHFFFAOYSA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- LYWWXYXEBZWIFY-UHFFFAOYSA-N 2-propylbenzoyl chloride Chemical compound CCCC1=CC=CC=C1C(Cl)=O LYWWXYXEBZWIFY-UHFFFAOYSA-N 0.000 description 1
- SFDGJDBLYNJMFI-UHFFFAOYSA-N 3,1-benzoxazin-4-one Chemical compound C1=CC=C2C(=O)OC=NC2=C1 SFDGJDBLYNJMFI-UHFFFAOYSA-N 0.000 description 1
- SXOPCLUOUFQBJV-UHFFFAOYSA-N 3-methoxyanthranilic acid Chemical compound COC1=CC=CC(C(O)=O)=C1N SXOPCLUOUFQBJV-UHFFFAOYSA-N 0.000 description 1
- JHJKSEKUZNJKGO-UHFFFAOYSA-N 3-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=CC(S(Cl)(=O)=O)=C1 JHJKSEKUZNJKGO-UHFFFAOYSA-N 0.000 description 1
- YHOYYHYBFSYOSQ-UHFFFAOYSA-N 3-methylbenzoyl chloride Chemical compound CC1=CC=CC(C(Cl)=O)=C1 YHOYYHYBFSYOSQ-UHFFFAOYSA-N 0.000 description 1
- KMGCTFHTBKBITO-UHFFFAOYSA-N 4-butoxybenzoyl chloride Chemical compound CCCCOC1=CC=C(C(Cl)=O)C=C1 KMGCTFHTBKBITO-UHFFFAOYSA-N 0.000 description 1
- OUOWCSJYDCPVDM-UHFFFAOYSA-N 4-butylbenzoyl chloride Chemical compound CCCCC1=CC=C(C(Cl)=O)C=C1 OUOWCSJYDCPVDM-UHFFFAOYSA-N 0.000 description 1
- LACFLXDRFOQEFZ-UHFFFAOYSA-N 4-ethylbenzenesulfonyl chloride Chemical compound CCC1=CC=C(S(Cl)(=O)=O)C=C1 LACFLXDRFOQEFZ-UHFFFAOYSA-N 0.000 description 1
- DTJVECUKADWGMO-UHFFFAOYSA-N 4-methoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1 DTJVECUKADWGMO-UHFFFAOYSA-N 0.000 description 1
- AEUOWSIJWYQOJG-UHFFFAOYSA-N 4-methoxynaphthalene-1-sulfonyl chloride Chemical compound C1=CC=C2C(OC)=CC=C(S(Cl)(=O)=O)C2=C1 AEUOWSIJWYQOJG-UHFFFAOYSA-N 0.000 description 1
- PJUVRKPTCSHXQT-UHFFFAOYSA-N 4-methyl-n-[2-(4-oxo-1h-quinazolin-2-yl)phenyl]benzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC=CC=C1C1=NC(=O)C2=CC=CC=C2N1 PJUVRKPTCSHXQT-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical compound CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- LHYZGURMLPSRFU-UHFFFAOYSA-N 4-propoxybenzenesulfonyl chloride Chemical compound CCCOC1=CC=C(S(Cl)(=O)=O)C=C1 LHYZGURMLPSRFU-UHFFFAOYSA-N 0.000 description 1
- FKAPQNQLKYYUAE-UHFFFAOYSA-N 4-propoxybenzoyl chloride Chemical compound CCCOC1=CC=C(C(Cl)=O)C=C1 FKAPQNQLKYYUAE-UHFFFAOYSA-N 0.000 description 1
- FPQMGQZTBWIHDN-UHFFFAOYSA-N 5-fluoroanthranilic acid Chemical compound NC1=CC=C(F)C=C1C(O)=O FPQMGQZTBWIHDN-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- VCUFZILGIRCDQQ-KRWDZBQOSA-N N-[[(5S)-2-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-oxazolidin-5-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C1O[C@H](CN1C1=CC2=C(NC(O2)=O)C=C1)CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F VCUFZILGIRCDQQ-KRWDZBQOSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- FXXACINHVKSMDR-UHFFFAOYSA-N acetyl bromide Chemical compound CC(Br)=O FXXACINHVKSMDR-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- LEKJTGQWLAUGQA-UHFFFAOYSA-N acetyl iodide Chemical compound CC(I)=O LEKJTGQWLAUGQA-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- CGWWQPZGKPHLBU-UHFFFAOYSA-N benzenesulfonyl bromide Chemical compound BrS(=O)(=O)C1=CC=CC=C1 CGWWQPZGKPHLBU-UHFFFAOYSA-N 0.000 description 1
- IDIPWEYIBKUDNY-UHFFFAOYSA-N benzenesulfonyl fluoride Chemical compound FS(=O)(=O)C1=CC=CC=C1 IDIPWEYIBKUDNY-UHFFFAOYSA-N 0.000 description 1
- AQIHMSVIAGNIDM-UHFFFAOYSA-N benzoyl bromide Chemical compound BrC(=O)C1=CC=CC=C1 AQIHMSVIAGNIDM-UHFFFAOYSA-N 0.000 description 1
- HPMLGNIUXVXALD-UHFFFAOYSA-N benzoyl fluoride Chemical compound FC(=O)C1=CC=CC=C1 HPMLGNIUXVXALD-UHFFFAOYSA-N 0.000 description 1
- WPCXDBCEDWUSOU-UHFFFAOYSA-N benzoyl iodide Chemical compound IC(=O)C1=CC=CC=C1 WPCXDBCEDWUSOU-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- WMWXXXSCZVGQAR-UHFFFAOYSA-N dialuminum;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3] WMWXXXSCZVGQAR-UHFFFAOYSA-N 0.000 description 1
- AOMUALOCHQKUCD-UHFFFAOYSA-N dodecyl 4-chloro-3-[[3-(4-methoxyphenyl)-3-oxopropanoyl]amino]benzoate Chemical compound CCCCCCCCCCCCOC(=O)C1=CC=C(Cl)C(NC(=O)CC(=O)C=2C=CC(OC)=CC=2)=C1 AOMUALOCHQKUCD-UHFFFAOYSA-N 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- FRYHCSODNHYDPU-UHFFFAOYSA-N ethanesulfonyl chloride Chemical compound CCS(Cl)(=O)=O FRYHCSODNHYDPU-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- ITYJDNHFRZSTJY-UHFFFAOYSA-N methanesulfonyl bromide Chemical compound CS(Br)(=O)=O ITYJDNHFRZSTJY-UHFFFAOYSA-N 0.000 description 1
- KNWQLFOXPQZGPX-UHFFFAOYSA-N methanesulfonyl fluoride Chemical compound CS(F)(=O)=O KNWQLFOXPQZGPX-UHFFFAOYSA-N 0.000 description 1
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- JDAZMGXABFGPAI-UHFFFAOYSA-N n-[2-(4-oxo-1h-quinazolin-2-yl)phenyl]benzamide Chemical compound C=1C=CC=C(C=2NC3=CC=CC=C3C(=O)N=2)C=1NC(=O)C1=CC=CC=C1 JDAZMGXABFGPAI-UHFFFAOYSA-N 0.000 description 1
- HFLJZGUOTHQWKM-UHFFFAOYSA-N n-[2-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide Chemical compound N=1C2=CC=CC=C2C(=O)OC=1C1=CC=CC=C1NS(=O)(=O)C1=CC=CC=C1 HFLJZGUOTHQWKM-UHFFFAOYSA-N 0.000 description 1
- NSNPSJGHTQIXDO-UHFFFAOYSA-N naphthalene-1-carbonyl chloride Chemical compound C1=CC=C2C(C(=O)Cl)=CC=CC2=C1 NSNPSJGHTQIXDO-UHFFFAOYSA-N 0.000 description 1
- XNLBCXGRQWUJLU-UHFFFAOYSA-N naphthalene-2-carbonyl chloride Chemical compound C1=CC=CC2=CC(C(=O)Cl)=CC=C21 XNLBCXGRQWUJLU-UHFFFAOYSA-N 0.000 description 1
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 1
- WIVNTNLDTMNDNO-UHFFFAOYSA-N octane-1-sulfonyl chloride Chemical compound CCCCCCCCS(Cl)(=O)=O WIVNTNLDTMNDNO-UHFFFAOYSA-N 0.000 description 1
- REEZZSHJLXOIHL-UHFFFAOYSA-N octanoyl chloride Chemical compound CCCCCCCC(Cl)=O REEZZSHJLXOIHL-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 239000006097 ultraviolet radiation absorber Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K11/00—Luminescent, e.g. electroluminescent, chemiluminescent materials
- C09K11/06—Luminescent, e.g. electroluminescent, chemiluminescent materials containing organic luminescent materials
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/04—1,3-Oxazines; Hydrogenated 1,3-oxazines
- C07D265/12—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems
- C07D265/14—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D265/20—1,3-Oxazines; Hydrogenated 1,3-oxazines condensed with carbocyclic rings or ring systems condensed with one six-membered ring with hetero atoms directly attached in position 4
- C07D265/22—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Luminescent Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11996471A | 1971-03-01 | 1971-03-01 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2209872A1 true DE2209872A1 (enExample) | 1972-09-07 |
| DE2209872C2 DE2209872C2 (de) | 1982-12-02 |
Family
ID=22387457
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2209872A Expired DE2209872C2 (de) | 1971-03-01 | 1972-03-01 | Phenylchinazolinone |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3740402A (enExample) |
| JP (1) | JPS5431475B1 (enExample) |
| CA (1) | CA920594A (enExample) |
| DE (1) | DE2209872C2 (enExample) |
| FR (1) | FR2128359B1 (enExample) |
| GB (1) | GB1347455A (enExample) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4324682A (en) * | 1970-12-18 | 1982-04-13 | American Cyanamid Company | Encapsulated fluorescent composition |
| US3892972A (en) * | 1971-03-01 | 1975-07-01 | American Cyanamid Co | Method of producing a luminescent surface containing substituted sulfonamido and carboxamido phenyl quinazolones |
| US4238524A (en) * | 1978-03-06 | 1980-12-09 | American Optical Corporation | Process for identification marking clear plastic articles |
| US4243694A (en) * | 1978-06-26 | 1981-01-06 | Whittaker Corporation | Jet ink process and ink composition fluorescent in ultraviolet light |
| DE2914915A1 (de) * | 1979-04-12 | 1980-10-30 | Basf Ag | 4h-3,1-benzoxazinderivate |
| US5206321A (en) * | 1991-10-03 | 1993-04-27 | The Dow Chemical Company | Polycyanates containing mesogenic moieties as lateral substituents |
| US5277839A (en) * | 1992-06-03 | 1994-01-11 | Litton Industrial Automation Automated Vehicles | Guidepath material |
| WO2002028841A2 (en) * | 2000-10-02 | 2002-04-11 | Molecular Probes, Inc. | Reagents for labeling biomolecules having aldehyde or ketone moieties |
| US7192471B2 (en) * | 2004-09-24 | 2007-03-20 | Honeywell International Inc. | Aryl-ureido benzoxazinone compounds |
| US7740693B2 (en) * | 2007-10-01 | 2010-06-22 | Honeywell International Inc. | Organic fluorescent sulfonyl ureido benzoxazinone pigments |
| GB2472371B (en) | 2009-04-24 | 2011-10-26 | Selectamark Security Systems Plc | Synthetic nucleotide containing compositions for use in security marking of property and/or for marking a thief or attacker |
| CN103012291B (zh) * | 2012-12-17 | 2014-09-03 | 中山大学 | 一种2-苯基喹唑啉衍生物及其制备方法与在制备抗癌药物中的应用 |
| US20150132575A1 (en) * | 2013-11-14 | 2015-05-14 | Honeywell International Inc. | Luminescent fibers, articles including the same, and methods of forming the same |
| US10544360B2 (en) | 2014-09-24 | 2020-01-28 | Merck Patent Gmbh | Materials for organic electroluminescent devices |
| RU2700579C1 (ru) * | 2019-03-01 | 2019-09-18 | Общество с ограниченной ответственностью Фирма "ОЛБО" | Способ получения 2-(о-арилсульфониламинофенил)-4(3Н)-хиназолинонов |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US26565A (en) * | 1859-12-27 | Improved register for railroad-cars | ||
| US3169129A (en) * | 1963-05-10 | 1965-02-09 | American Cyanamid Co | 2-ortho-hydroxy-phenyl-4-(3h)-quinazolinones |
| US3269955A (en) * | 1963-05-10 | 1966-08-30 | American Cyanamid Co | Method for emitting fluorescent light using fluorescent quinazolones |
-
1971
- 1971-03-01 US US00119964A patent/US3740402A/en not_active Expired - Lifetime
-
1972
- 1972-01-28 GB GB414072A patent/GB1347455A/en not_active Expired
- 1972-01-28 CA CA133440A patent/CA920594A/en not_active Expired
- 1972-02-24 FR FR7206318A patent/FR2128359B1/fr not_active Expired
- 1972-03-01 DE DE2209872A patent/DE2209872C2/de not_active Expired
- 1972-03-01 JP JP2142672A patent/JPS5431475B1/ja active Pending
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US26565A (en) * | 1859-12-27 | Improved register for railroad-cars | ||
| US3169129A (en) * | 1963-05-10 | 1965-02-09 | American Cyanamid Co | 2-ortho-hydroxy-phenyl-4-(3h)-quinazolinones |
| US3269955A (en) * | 1963-05-10 | 1966-08-30 | American Cyanamid Co | Method for emitting fluorescent light using fluorescent quinazolones |
Non-Patent Citations (1)
| Title |
|---|
| J. Chem. Soc. 1960, (12), 4970 * |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2128359A1 (enExample) | 1972-10-20 |
| GB1347455A (en) | 1974-02-27 |
| FR2128359B1 (enExample) | 1977-01-14 |
| US3740402A (en) | 1973-06-19 |
| CA920594A (en) | 1973-02-06 |
| DE2209872C2 (de) | 1982-12-02 |
| JPS5431475B1 (enExample) | 1979-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2209872A1 (enExample) | ||
| US3892972A (en) | Method of producing a luminescent surface containing substituted sulfonamido and carboxamido phenyl quinazolones | |
| DE1769668C3 (de) | Verwendung von Thiazolderivaten als optische Aufheller | |
| DE2357830A1 (de) | Metall-chelat-pigmente | |
| DE2236250C2 (de) | Neue Disazo-Pigmente, deren Herstellung und Verwendung | |
| DE859313C (de) | Verfahren zur Herstellung von Bis-[2-morpholino-4-amino-1, 3, 5-triazyl-(6)]-4, 4''-diaminostilbendisulfon- und -dicarbonsaeuren | |
| DE1569753C3 (de) | Komplexverbindungen der Kobaltphthalocyaninreihe | |
| EP0854144A1 (de) | Herstellung von Perylen-3,4-dicarbon-säureanhydriden | |
| DE2064683A1 (de) | 2 5 Bis(2 benzazolyl)hydrochinon verbindungen | |
| DE2151723B2 (de) | Indigoide Pigmente, ihre Herste! lung und Verwendung | |
| DE2230601A1 (de) | Chinophthalonpigmente und deren herstellung | |
| DE1950600A1 (de) | Verfahren zur Herstellung von Benzimidazoisochinolon-aldehyden | |
| DE2030783A1 (de) | Neue Farbstoffe, insbesondere zum Far ben hydrophober Fasern geeignet | |
| DE1266425C2 (de) | Verfahren zur herstellung von anthrachinon-dispersionsfarbstoffen und deren verwendung | |
| DE69007671T2 (de) | Diarylid-/Disazopyrazolon-Pigmentzusammensetzungen. | |
| DE2441759C2 (de) | Photochrome 3-Arylbernsteinsäureanhydride oder -imide und Verfahren zu ihrer Herstellung | |
| DE2025111A1 (de) | Substituierte Azomethinverbindungen | |
| DE69720475T2 (de) | 1:2 eisenkomplex-azofarbstoffe | |
| DE2237372B2 (de) | Heterocyclische Farbstoffe, ihre Herstellung und ihre Verwendung | |
| DE1928437A1 (de) | Neue Azoverbindungen und Verfahren zu deren Herstellung | |
| DE2262794A1 (de) | Styrylfarbstoffe und verfahren zu ihrer herstellung | |
| DE2025078B2 (de) | Die Pigmentform einer Azomethinverbindung | |
| DE2850782C2 (de) | Verfahren zur Herstellung von 3-Iminohalogenisoindolin-1-on-Derivaten | |
| CH627771A5 (de) | Neue stabile modifikation eines isoindolinonpigmentes. | |
| DE2114299C3 (de) | 2-(Phenylazo)-2,4-dimethylvaleronitril-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8328 | Change in the person/name/address of the agent | ||
| 8339 | Ceased/non-payment of the annual fee |