DE2160588B2 - Monoazofarbstoffe und Verfahren zum Färben von Fasermaterialien - Google Patents
Monoazofarbstoffe und Verfahren zum Färben von FasermaterialienInfo
- Publication number
- DE2160588B2 DE2160588B2 DE19712160588 DE2160588A DE2160588B2 DE 2160588 B2 DE2160588 B2 DE 2160588B2 DE 19712160588 DE19712160588 DE 19712160588 DE 2160588 A DE2160588 A DE 2160588A DE 2160588 B2 DE2160588 B2 DE 2160588B2
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- indole
- amino
- amide
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000975 dye Substances 0.000 title claims description 21
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title claims description 5
- 238000004043 dyeing Methods 0.000 title description 4
- 238000000034 method Methods 0.000 title description 3
- 239000002657 fibrous material Substances 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 5
- 239000000460 chlorine Chemical group 0.000 description 32
- BHNHHSOHWZKFOX-UHFFFAOYSA-N 2-methyl-1H-indole Chemical compound C1=CC=C2NC(C)=CC2=C1 BHNHHSOHWZKFOX-UHFFFAOYSA-N 0.000 description 22
- -1 ^ -phenylethyl Chemical group 0.000 description 16
- SJCTXIKOXTUQHC-UHFFFAOYSA-N 4-amino-2,5-dichlorobenzenesulfonic acid Chemical compound NC1=CC(Cl)=C(S(O)(=O)=O)C=C1Cl SJCTXIKOXTUQHC-UHFFFAOYSA-N 0.000 description 13
- 229910052801 chlorine Inorganic materials 0.000 description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 150000001408 amides Chemical class 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- FOUDIUBFAMPYQA-UHFFFAOYSA-N 4-amino-3,5-dichlorobenzenesulfonic acid Chemical compound NC1=C(Cl)C=C(S(O)(=O)=O)C=C1Cl FOUDIUBFAMPYQA-UHFFFAOYSA-N 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 8
- 239000004952 Polyamide Substances 0.000 description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- 229920002647 polyamide Polymers 0.000 description 7
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 6
- 125000004093 cyano group Chemical group *C#N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- SFWZZSXCWQTORH-UHFFFAOYSA-N 1-methyl-2-phenylindole Chemical compound C=1C2=CC=CC=C2N(C)C=1C1=CC=CC=C1 SFWZZSXCWQTORH-UHFFFAOYSA-N 0.000 description 4
- XNIOWJUQPMKCIJ-UHFFFAOYSA-N 2-(benzylamino)ethanol Chemical compound OCCNCC1=CC=CC=C1 XNIOWJUQPMKCIJ-UHFFFAOYSA-N 0.000 description 4
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- YPECXEWEXWBMNK-UHFFFAOYSA-N 4-amino-2-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(Cl)=C1 YPECXEWEXWBMNK-UHFFFAOYSA-N 0.000 description 3
- HMMQIMABXGTJJB-UHFFFAOYSA-N 4-amino-3-(trifluoromethyl)benzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1C(F)(F)F HMMQIMABXGTJJB-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000012209 synthetic fiber Substances 0.000 description 3
- 229920002994 synthetic fiber Polymers 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- WPOHVHKEDGUEPZ-UHFFFAOYSA-N 2-(2-phenylethylamino)ethanol Chemical compound OCCNCCC1=CC=CC=C1 WPOHVHKEDGUEPZ-UHFFFAOYSA-N 0.000 description 2
- MIJDSYMOBYNHOT-UHFFFAOYSA-N 2-(ethylamino)ethanol Chemical compound CCNCCO MIJDSYMOBYNHOT-UHFFFAOYSA-N 0.000 description 2
- YZKUEVLTJBFTCA-UHFFFAOYSA-N 2-methyl-1H-indole 2-phenyl-1H-indole Chemical compound C1=CC=C2NC(C)=CC2=C1.N1C2=CC=CC=C2C=C1C1=CC=CC=C1 YZKUEVLTJBFTCA-UHFFFAOYSA-N 0.000 description 2
- ZQJXSIOFSZYGMH-UHFFFAOYSA-N 3-(benzylamino)propan-1-ol Chemical compound OCCCNCC1=CC=CC=C1 ZQJXSIOFSZYGMH-UHFFFAOYSA-N 0.000 description 2
- KRGXWTOLFOPIKV-UHFFFAOYSA-N 3-(methylamino)propan-1-ol Chemical compound CNCCCO KRGXWTOLFOPIKV-UHFFFAOYSA-N 0.000 description 2
- NAXUFNXWXFZVSI-UHFFFAOYSA-N 4-aminobutan-2-ol Chemical compound CC(O)CCN NAXUFNXWXFZVSI-UHFFFAOYSA-N 0.000 description 2
- WUVWAXJXPRYUME-UHFFFAOYSA-N 5-chloro-2-methyl-1h-indole Chemical compound ClC1=CC=C2NC(C)=CC2=C1 WUVWAXJXPRYUME-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- DBMKWRAEFMXBCX-UHFFFAOYSA-N 1-chlorosulfonyloxy-2-nitrobenzene Chemical class [O-][N+](=O)C1=CC=CC=C1OS(Cl)(=O)=O DBMKWRAEFMXBCX-UHFFFAOYSA-N 0.000 description 1
- RAKSXVONTIQCGY-UHFFFAOYSA-N 1-ethyl-2-phenylindole Chemical compound C=1C2=CC=CC=C2N(CC)C=1C1=CC=CC=C1 RAKSXVONTIQCGY-UHFFFAOYSA-N 0.000 description 1
- BLRHMMGNCXNXJL-UHFFFAOYSA-N 1-methylindole Chemical compound C1=CC=C2N(C)C=CC2=C1 BLRHMMGNCXNXJL-UHFFFAOYSA-N 0.000 description 1
- GGPKAAYMCSXMFC-UHFFFAOYSA-N 2,5-dimethyl-1H-indole 2-methyl-1H-indole Chemical compound C1=CC=C2NC(C)=CC2=C1.CC1=CC=C2NC(C)=CC2=C1 GGPKAAYMCSXMFC-UHFFFAOYSA-N 0.000 description 1
- ZFLFWZRPMDXJCW-UHFFFAOYSA-N 2,5-dimethyl-1h-indole Chemical compound CC1=CC=C2NC(C)=CC2=C1 ZFLFWZRPMDXJCW-UHFFFAOYSA-N 0.000 description 1
- KDISEFXCEKAPKF-UHFFFAOYSA-N 2-(3-ethylanilino)ethanol Chemical compound CCC1=CC=CC(NCCO)=C1 KDISEFXCEKAPKF-UHFFFAOYSA-N 0.000 description 1
- QOVGKNPMRTVWRM-UHFFFAOYSA-N 2-(3-methoxyanilino)ethanol Chemical compound COC1=CC=CC(NCCO)=C1 QOVGKNPMRTVWRM-UHFFFAOYSA-N 0.000 description 1
- GZCPEUOCUUNCLZ-UHFFFAOYSA-N 2-(3-methylanilino)ethanol Chemical compound CC1=CC=CC(NCCO)=C1 GZCPEUOCUUNCLZ-UHFFFAOYSA-N 0.000 description 1
- BCLSJHWBDUYDTR-UHFFFAOYSA-N 2-(propylamino)ethanol Chemical compound CCCNCCO BCLSJHWBDUYDTR-UHFFFAOYSA-N 0.000 description 1
- YAZSBRQTAHVVGE-UHFFFAOYSA-N 2-aminobenzenesulfonamide Chemical class NC1=CC=CC=C1S(N)(=O)=O YAZSBRQTAHVVGE-UHFFFAOYSA-N 0.000 description 1
- JZTNGVNIHZRQFG-UHFFFAOYSA-N 2-methyl-1H-indole 1-methyl-2-phenylindole Chemical compound C1=CC=C2NC(C)=CC2=C1.C=1C2=CC=CC=C2N(C)C=1C1=CC=CC=C1 JZTNGVNIHZRQFG-UHFFFAOYSA-N 0.000 description 1
- PVKJYCITKPSXJJ-UHFFFAOYSA-N 2-methyl-1h-indole-5-carbonitrile Chemical compound N#CC1=CC=C2NC(C)=CC2=C1 PVKJYCITKPSXJJ-UHFFFAOYSA-N 0.000 description 1
- FBXBSCUQZWUZDD-UHFFFAOYSA-N 3-(ethylamino)propan-1-ol Chemical compound CCNCCCO FBXBSCUQZWUZDD-UHFFFAOYSA-N 0.000 description 1
- XJQRCFRVWZHIPN-UHFFFAOYSA-N 3-amino-4-chlorobenzenesulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1Cl XJQRCFRVWZHIPN-UHFFFAOYSA-N 0.000 description 1
- FLIOATBXVNLPLK-UHFFFAOYSA-N 3-amino-4-methoxybenzenesulfonic acid Chemical compound COC1=CC=C(S(O)(=O)=O)C=C1N FLIOATBXVNLPLK-UHFFFAOYSA-N 0.000 description 1
- CVCDGQVQQGSYMK-UHFFFAOYSA-N 4-(methylamino)butan-2-ol Chemical compound CNCCC(C)O CVCDGQVQQGSYMK-UHFFFAOYSA-N 0.000 description 1
- NEECEUZBAHTVIN-UHFFFAOYSA-N 4-amino-3-chlorobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1Cl NEECEUZBAHTVIN-UHFFFAOYSA-N 0.000 description 1
- BGMUQSQTQVRFMT-UHFFFAOYSA-N 4-amino-3-ethoxybenzenesulfonic acid Chemical compound CCOC1=CC(S(O)(=O)=O)=CC=C1N BGMUQSQTQVRFMT-UHFFFAOYSA-N 0.000 description 1
- DFFMMDIDNCWQIV-UHFFFAOYSA-N 4-amino-3-methoxybenzenesulfonic acid Chemical compound COC1=CC(S(O)(=O)=O)=CC=C1N DFFMMDIDNCWQIV-UHFFFAOYSA-N 0.000 description 1
- WQTCZINVPXJNEL-UHFFFAOYSA-N 4-amino-3-methylbenzenesulfonic acid Chemical compound CC1=CC(S(O)(=O)=O)=CC=C1N WQTCZINVPXJNEL-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- WUHIKCJBSKWNIC-UHFFFAOYSA-N 5-ethoxy-2-methyl-1h-indole Chemical compound CCOC1=CC=C2NC(C)=CC2=C1 WUHIKCJBSKWNIC-UHFFFAOYSA-N 0.000 description 1
- HVTYCKBLOMQBMF-UHFFFAOYSA-N 5-ethoxy-2-phenyl-1h-indole Chemical compound C=1C2=CC(OCC)=CC=C2NC=1C1=CC=CC=C1 HVTYCKBLOMQBMF-UHFFFAOYSA-N 0.000 description 1
- NNJZGKJLPCDYQB-UHFFFAOYSA-N 6-chloro-2-methyl-1h-indole Chemical compound C1=C(Cl)C=C2NC(C)=CC2=C1 NNJZGKJLPCDYQB-UHFFFAOYSA-N 0.000 description 1
- TZWFTICPUNKLRO-UHFFFAOYSA-N 7-methoxy-2,4-dimethyl-1h-indole Chemical compound COC1=CC=C(C)C2=C1NC(C)=C2 TZWFTICPUNKLRO-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WMKMBRJSVXIXFY-UHFFFAOYSA-N CC(NC(C=CC=C1)=C1OS(Cl)(=O)=O)=O Chemical class CC(NC(C=CC=C1)=C1OS(Cl)(=O)=O)=O WMKMBRJSVXIXFY-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 229920002292 Nylon 6 Polymers 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/523—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl amido or hydroxyalkyl amino sulfonyl group, a quaternised or non-quaternised amino alkyl sulfonyl amido group, or a substituted alkyl amino sulfonyl group, or a halogen alkyl sulfonyl amido or halogen alkyl amino sulfonyl group or a vinyl sulfonylamido or a substituted vinyl sulfonamido group
- C09B62/527—Azo dyes
- C09B62/53—Monoazo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE792357D BE792357A (fr) | 1971-12-07 | Colorants mono-azoiques | |
| DE19712160588 DE2160588B2 (de) | 1971-12-07 | 1971-12-07 | Monoazofarbstoffe und Verfahren zum Färben von Fasermaterialien |
| NL7216369A NL7216369A (enExample) | 1971-12-07 | 1972-12-01 | |
| JP11990872A JPS4865225A (enExample) | 1971-12-07 | 1972-12-01 | |
| CH1766172A CH568439B5 (enExample) | 1971-12-07 | 1972-12-05 | |
| IT3251872A IT971570B (it) | 1971-12-07 | 1972-12-05 | Coloranti monoazoici |
| CH1766172D CH1766172A4 (enExample) | 1971-12-07 | 1972-12-05 | |
| CH928574A CH562297A5 (enExample) | 1971-12-07 | 1972-12-05 | |
| GB5627172A GB1384472A (en) | 1971-12-07 | 1972-12-06 | Monoazo dyestuffs |
| FR7243597A FR2162548B1 (enExample) | 1971-12-07 | 1972-12-07 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712160588 DE2160588B2 (de) | 1971-12-07 | 1971-12-07 | Monoazofarbstoffe und Verfahren zum Färben von Fasermaterialien |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2160588A1 DE2160588A1 (de) | 1973-06-14 |
| DE2160588B2 true DE2160588B2 (de) | 1980-05-08 |
Family
ID=5827224
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712160588 Withdrawn DE2160588B2 (de) | 1971-12-07 | 1971-12-07 | Monoazofarbstoffe und Verfahren zum Färben von Fasermaterialien |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS4865225A (enExample) |
| BE (1) | BE792357A (enExample) |
| CH (3) | CH568439B5 (enExample) |
| DE (1) | DE2160588B2 (enExample) |
| FR (1) | FR2162548B1 (enExample) |
| GB (1) | GB1384472A (enExample) |
| IT (1) | IT971570B (enExample) |
| NL (1) | NL7216369A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2708188C2 (de) | 1977-02-25 | 1979-02-08 | Bayer Ag, 5090 Leverkusen | Stabilisierung anionischer Indolfarbstoffe |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1350473A (fr) * | 1963-03-13 | 1964-01-24 | Bayer Ag | Colorants monoazoïques, et procédé pour les préparer |
| FR1366250A (fr) * | 1963-06-21 | 1964-07-10 | Basf Ag | Colorants azoïques solubles dans l'eau, renfermant un copulant indolique |
-
0
- BE BE792357D patent/BE792357A/xx unknown
-
1971
- 1971-12-07 DE DE19712160588 patent/DE2160588B2/de not_active Withdrawn
-
1972
- 1972-12-01 NL NL7216369A patent/NL7216369A/xx unknown
- 1972-12-01 JP JP11990872A patent/JPS4865225A/ja active Pending
- 1972-12-05 CH CH1766172A patent/CH568439B5/xx not_active IP Right Cessation
- 1972-12-05 CH CH928574A patent/CH562297A5/xx not_active IP Right Cessation
- 1972-12-05 IT IT3251872A patent/IT971570B/it active
- 1972-12-05 CH CH1766172D patent/CH1766172A4/xx unknown
- 1972-12-06 GB GB5627172A patent/GB1384472A/en not_active Expired
- 1972-12-07 FR FR7243597A patent/FR2162548B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1384472A (en) | 1975-02-19 |
| IT971570B (it) | 1974-05-10 |
| FR2162548B1 (enExample) | 1976-10-29 |
| CH1766172A4 (enExample) | 1975-04-15 |
| BE792357A (fr) | 1973-06-06 |
| CH562297A5 (enExample) | 1975-05-30 |
| CH568439B5 (enExample) | 1975-10-31 |
| NL7216369A (enExample) | 1973-06-12 |
| FR2162548A1 (enExample) | 1973-07-20 |
| DE2160588A1 (de) | 1973-06-14 |
| JPS4865225A (enExample) | 1973-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2443485C2 (de) | Disazofarbstoffe und deren Verwendung | |
| DE2302582C3 (de) | Wasserlösliche Azofarbstoffe der Diamino-pyrimidin-Reihe, Verfahren zu ihrer Herstellung und Farbstoffzubereitungen | |
| DE2531445C3 (de) | Sulfogruppenfreie wasserlösliche Azofarbstoffe und deren Verwendung zum Färben und/oder Bedrucken von synthetischen Textilfasern | |
| DE2801951A1 (de) | Azofarbstoffe | |
| DE2349457A1 (de) | Wasserloesliche monoazofarbstoffe | |
| DE2160588B2 (de) | Monoazofarbstoffe und Verfahren zum Färben von Fasermaterialien | |
| DE2203460C3 (de) | Monoazofarbstoffe und Verfahren zum Färben und Bedrucken | |
| EP0035671B1 (de) | Wasserunlösliche Azofarbstoffe, Verfahren zu ihrer Herstellung und Verwendung zum Färben und Bedrucken von synthetischem, hydrophobem Fasermaterial | |
| EP0039054A1 (de) | Wasserunlösliche Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2453209C2 (de) | Disazofarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1644175B2 (de) | Sulfonsäure- und carbonsäurefreie Azofarbstoffe, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2533723A1 (de) | Monoazofarbstoffe | |
| EP0054858B1 (de) | Saure Azofarbstoffe mit Imidazopyridin-Kupplungskomponenten sowie deren Herstellung und Verwendung zum Färben von Polyamidfasern | |
| DE1925288B2 (de) | Sulfonsaeuregruppenfreie disazofarbstoffe, ihre herstellung und verwendung zum faerben stickstoffhaltiger fasermaterialien | |
| DE2239814C2 (de) | Monoazofarbstoffe und ihre Verwendung | |
| DE2716503A1 (de) | Azofarbstoff-zwischenprodukt | |
| DE2202132C3 (de) | Monoazofarbstoffe, und Verfahren zu deren Herstellung und ihre Verwendung | |
| DE2054343C3 (de) | Wasserlösliche Monoazofarbstoffe und deren Verwendung zum Färben von Fasermaterialien aus synthetischen Polyamiden | |
| DE2159802C3 (de) | Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2347124A1 (de) | Azoverbindungen | |
| DE2051023A1 (en) | Mono and dis-azo dyes - of the benzimidazole series contg sulphonic acid gps | |
| DE2263295A1 (de) | Monoazofarbstoffe | |
| DE1644122B2 (de) | Sulfonsaeure- und carbonsaeuregruppenfreie wasserunloesliche monoazofarbstoffe und verfahren zu ihrer herstellung | |
| DE1923999C (de) | Verfahren zur Herstellung von Azoverbindungen und deren Verwendung zum Färben von Polyamiden und Leder | |
| DE1644094C3 (de) | Wasserunlösliche Azofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| BHN | Withdrawal |