DE2157259C3 - Rammbohrgerät - Google Patents
RammbohrgerätInfo
- Publication number
- DE2157259C3 DE2157259C3 DE19712157259 DE2157259A DE2157259C3 DE 2157259 C3 DE2157259 C3 DE 2157259C3 DE 19712157259 DE19712157259 DE 19712157259 DE 2157259 A DE2157259 A DE 2157259A DE 2157259 C3 DE2157259 C3 DE 2157259C3
- Authority
- DE
- Germany
- Prior art keywords
- housing
- ram
- collar
- ram boring
- piston
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000005553 drilling Methods 0.000 title claims description 68
- 238000009527 percussion Methods 0.000 claims description 84
- 230000001681 protective effect Effects 0.000 claims description 28
- 238000006073 displacement reaction Methods 0.000 claims description 25
- 230000008719 thickening Effects 0.000 claims description 18
- 230000006835 compression Effects 0.000 claims description 10
- 238000007906 compression Methods 0.000 claims description 10
- 235000001674 Agaricus brunnescens Nutrition 0.000 claims description 8
- 239000000872 buffer Substances 0.000 claims description 8
- 238000005520 cutting process Methods 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 240000007313 Tilia cordata Species 0.000 claims description 3
- 238000003825 pressing Methods 0.000 claims description 2
- 238000004904 shortening Methods 0.000 claims 2
- 239000011343 solid material Substances 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims 1
- 239000002689 soil Substances 0.000 description 7
- 230000001133 acceleration Effects 0.000 description 4
- 230000008901 benefit Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 238000009423 ventilation Methods 0.000 description 3
- 238000010276 construction Methods 0.000 description 2
- 238000013016 damping Methods 0.000 description 2
- 238000007789 sealing Methods 0.000 description 2
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical compound IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- 241000937413 Axia Species 0.000 description 1
- 241000251131 Sphyrna Species 0.000 description 1
- 238000009412 basement excavation Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000002045 lasting effect Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E21—EARTH OR ROCK DRILLING; MINING
- E21B—EARTH OR ROCK DRILLING; OBTAINING OIL, GAS, WATER, SOLUBLE OR MELTABLE MATERIALS OR A SLURRY OF MINERALS FROM WELLS
- E21B7/00—Special methods or apparatus for drilling
- E21B7/26—Drilling without earth removal, e.g. with self-propelled burrowing devices
-
- E—FIXED CONSTRUCTIONS
- E21—EARTH OR ROCK DRILLING; MINING
- E21B—EARTH OR ROCK DRILLING; OBTAINING OIL, GAS, WATER, SOLUBLE OR MELTABLE MATERIALS OR A SLURRY OF MINERALS FROM WELLS
- E21B4/00—Drives for drilling, used in the borehole
- E21B4/06—Down-hole impacting means, e.g. hammers
- E21B4/14—Fluid operated hammers
- E21B4/145—Fluid operated hammers of the self propelled-type, e.g. with a reverse mode to retract the device from the hole
Landscapes
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Mining & Mineral Resources (AREA)
- Physics & Mathematics (AREA)
- Environmental & Geological Engineering (AREA)
- Fluid Mechanics (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geochemistry & Mineralogy (AREA)
- Mechanical Engineering (AREA)
- Earth Drilling (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712157259 DE2157259C3 (de) | 1971-11-18 | 1971-11-18 | Rammbohrgerät |
| JP11551072A JPS5418486B2 (enExample) | 1971-11-18 | 1972-11-17 | |
| US307573A US3865200A (en) | 1971-11-18 | 1972-11-17 | Burrowing apparatus |
| FR7241742A FR2161732A5 (enExample) | 1971-11-18 | 1972-11-20 | |
| GB5353972A GB1392868A (en) | 1971-11-18 | 1972-11-20 | Pneumatic burrowing apparatus |
| KE2577*UA KE2577A (en) | 1971-11-18 | 1975-11-05 | Pneumatic burrowing apparatus |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712157259 DE2157259C3 (de) | 1971-11-18 | 1971-11-18 | Rammbohrgerät |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2157259B1 DE2157259B1 (de) | 1972-11-09 |
| DE2157259C3 true DE2157259C3 (de) | 1973-06-07 |
Family
ID=5825481
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712157259 Expired DE2157259C3 (de) | 1971-11-18 | 1971-11-18 | Rammbohrgerät |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3865200A (enExample) |
| JP (1) | JPS5418486B2 (enExample) |
| DE (1) | DE2157259C3 (enExample) |
| FR (1) | FR2161732A5 (enExample) |
| GB (1) | GB1392868A (enExample) |
| KE (1) | KE2577A (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2634066A1 (de) * | 1976-07-29 | 1978-02-02 | Paul Schmidt | Steuervorrichtung fuer den vor- und ruecklauf von selbstgetriebenen pneumatischen rammbohrgeraeten |
| DE3200214A1 (de) * | 1982-01-07 | 1983-07-14 | Paul 5940 Lennestadt Schmidt | Selbstgetriebenes rammbohrgeraet |
| DE3710162C1 (de) * | 1987-03-27 | 1988-09-29 | Helmuth Dipl-Ing Roemer | Rammbohrgeraet mit beweglichem Meissel |
| DE3813236C1 (en) * | 1988-04-20 | 1989-07-27 | Paul 5940 Lennestadt De Schmidt | Self-propelled ram borer |
| DE3900122A1 (de) * | 1989-01-04 | 1990-07-05 | Schmidt Paul | Rammbohrgeraet |
| DE3911467A1 (de) * | 1989-04-08 | 1990-10-11 | Tracto Technik | Selbstantreibbares rammbohrgeraet, insbesondere fuer die herstellung von rohrfoermigen erdbohrungen |
| DE102004032551A1 (de) * | 2004-07-06 | 2006-01-26 | Tracto-Technik Gmbh | Bohrkopf und Verfahren zum Erzeugen oder Aufweiten eines Bohrlochs über eine schlagend vorgetriebene Vorrichtung |
| DE19881185C5 (de) * | 1997-08-22 | 2008-07-10 | Karl Storz Gmbh & Co. Kg | Vorrichtung zur Zertrümmerung von Konkrementen |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1501582A (en) * | 1975-05-31 | 1978-02-15 | Jenne & Strahm Ag | Boring tools |
| AT334831B (de) * | 1975-07-08 | 1976-02-10 | Inst Gornogo Dela Sibirskogo O | Umkehrbare pressluft-schlagvorrichtung zur bildung von bohrlochern im boden durch verdichten desselben |
| SU652279A1 (ru) * | 1975-10-01 | 1979-03-15 | Институт Горного Дела Со Ан Ссср | Устройство ударного действи дл образовани скважин в грунте |
| DE2558685A1 (de) * | 1975-12-24 | 1977-07-07 | Paul Schmidt | Rammbohrgeraet |
| DE2605010C2 (de) * | 1976-02-10 | 1983-11-03 | Paul 5940 Lennestadt Schmidt | Starthilfe für Rammbohrgeräte |
| US4298074A (en) * | 1976-08-09 | 1981-11-03 | American Safety Equipment Corporation | Surgical device using impulse motor |
| DE2820785C2 (de) * | 1978-05-12 | 1986-10-02 | Paul 5940 Lennestadt Schmidt | Ventilsteuerung für Rammbohrgeräte |
| JPS6126457Y2 (enExample) * | 1978-09-30 | 1986-08-08 | ||
| JPS585758Y2 (ja) * | 1978-12-15 | 1983-01-31 | 株式会社小松製作所 | 管埋設用掘進機 |
| DE2911837C2 (de) * | 1979-03-26 | 1986-09-11 | Paul 5940 Lennestadt Schmidt | Steuerung für selbstgetriebene Rammbohrgeräte |
| DE3124524C2 (de) * | 1981-06-23 | 1985-08-01 | Gustav Dr.-Ing. 4300 Essen Jenne | Rammvorrichtung für selbstgetriebene pneumatische Rammbohrgeräte |
| US4605339A (en) * | 1981-07-29 | 1986-08-12 | Roger Bullivant Of Texas, Inc. | Situ pile construction in ground liable to uplift |
| GB2111565B (en) * | 1981-12-15 | 1985-10-02 | British Telecomm | Self propelled reversible boring ram |
| FR1094604A (enExample) * | 1982-03-10 | 1955-05-23 | ||
| GB2134152B (en) * | 1983-01-22 | 1986-05-08 | Kayes Engineering Limited | Improvements in and relating to impact-action self-propelled mechanism for driving holes in the earth |
| SU1313972A1 (ru) * | 1983-06-08 | 1987-05-30 | Институт Горного Дела Со Ан Ссср | Реверсивное устройство ударного действи дл проходки скважин в грунте |
| SU1305272A1 (ru) * | 1985-02-21 | 1987-04-23 | Институт Горного Дела Со Ан Ссср | Реверсивное устройство дл проходки скважин в грунте |
| US4596292A (en) * | 1985-04-18 | 1986-06-24 | The Stanley Works | Subsoil penetrating apparatus |
| JPS61282587A (ja) * | 1985-06-05 | 1986-12-12 | 極東開発工業株式会社 | 逆進可能な地中貫孔機 |
| DE3533995A1 (de) * | 1985-09-24 | 1987-04-16 | Tracto Technik | Rammbohrgeraet mit schlagmesserkolben |
| GB8605009D0 (en) * | 1986-02-28 | 1986-04-09 | Roxbury Ltd | Soil displacement tools |
| DE8700076U1 (de) * | 1987-01-02 | 1987-02-19 | Hemmerle, Rainer, 5940 Lennestadt | Rammbohrgerät |
| FR2615880B1 (fr) * | 1987-06-01 | 1989-12-15 | Sade Travaux Hydraulique | Procede pour integrer a un terrain vertical en pente ou en contre-pente des ossatures de consolidation ou autres et outillage pour sa mise en oeuvre |
| DE3825800A1 (de) * | 1988-07-29 | 1990-02-01 | Schmidt Paul | Rammbohrgeraet |
| DE3833882C2 (de) * | 1988-10-05 | 1996-07-04 | Tracto Technik | Rammbohrgerät |
| DE3840923C2 (de) * | 1988-12-05 | 1994-03-24 | Schmidt Paul | Rammbohrgerät |
| DE3910515A1 (de) * | 1989-04-01 | 1990-10-04 | Tracto Technik | Selbstantreibbare rammbohrvorrichtung, insbesondere zur herstellung von rohrfoermigen erdbohrungen |
| US5226487A (en) * | 1990-02-07 | 1993-07-13 | Mbs Advanced Engineering Systems | Pneumopercussive machine |
| US5031706A (en) * | 1990-02-07 | 1991-07-16 | Mbs Advanced Engineering Systems | Pneumopercussive soil penetrating machine |
| US5172771A (en) * | 1990-11-06 | 1992-12-22 | Charles Machine Works, Inc. | Reversible impact-operated boring tool |
| US5311950A (en) * | 1993-04-19 | 1994-05-17 | Spektor Michael B | Differential pneumopercussive reversible self-propelled soil penetrating machine |
| US5337837A (en) * | 1993-06-17 | 1994-08-16 | Earth Tool Corporation | Dual-diameter pneumatic ground piercing tool |
| US5465797A (en) * | 1994-02-22 | 1995-11-14 | Earth Tool Corporation | Pneumatic ground piercing tool with detachable head |
| US5467831A (en) * | 1994-08-22 | 1995-11-21 | Spektor; Michael B. | Monotube differential pneumopercussive reversible self-propelled soil penetrating machine with stabilizers |
| DE19617603C1 (de) * | 1996-05-02 | 1997-09-18 | Tracto Technik | Umsteuerbares Rammbohrgerät |
| FI965300A7 (fi) * | 1996-12-31 | 1998-07-01 | Tamrock Oy | Työkalu iskulaitetta varten |
| DE19725052C2 (de) * | 1997-06-13 | 1999-10-28 | Tracto Technik | Bohrgerät |
| US6488105B1 (en) * | 1999-01-04 | 2002-12-03 | California Institute Of Technology | Method and apparatus for subsurface exploration |
| GB0010212D0 (en) * | 2000-04-26 | 2000-06-14 | Euro Iseki Ltd | Backreaming tool |
| US7226246B2 (en) | 2000-06-15 | 2007-06-05 | Geotechnical Reinforcement, Inc. | Apparatus and method for building support piers from one or successive lifts formed in a soil matrix |
| US9169611B2 (en) | 2000-06-15 | 2015-10-27 | Geopier Foundation Company, Inc. | Method and apparatus for building support piers from one or more successive lifts formed in a soil matrix |
| US8152415B2 (en) * | 2000-06-15 | 2012-04-10 | Geopier Foundation Company, Inc. | Method and apparatus for building support piers from one or more successive lifts formed in a soil matrix |
| DE10101731C2 (de) * | 2001-01-15 | 2003-09-18 | Tracto Technik | Bohrkopf und Bohrverfahren für ein Horizontalbohrgerät |
| DE10112985B4 (de) * | 2001-03-17 | 2006-03-02 | Tracto-Technik Gmbh | Schlagbohrkopf und ein Verfahren zum Horizontalbohren mit einem Schlaggerät |
| US20060088384A1 (en) * | 2004-10-22 | 2006-04-27 | Putnam Samuel W | Stored energy coupling and pipe bursting apparatus |
| US7273113B2 (en) * | 2005-03-16 | 2007-09-25 | Spektor Michael B | Reversible penetrating machine with a differential air distributing mechanism |
| US7836976B2 (en) * | 2005-10-20 | 2010-11-23 | Allied Construction Products, L.L.C. | Underground piercing tool |
| US7681658B2 (en) | 2007-11-06 | 2010-03-23 | Maurice DUVAL | Pneumatic impact tool |
| US20160158819A1 (en) * | 2014-12-03 | 2016-06-09 | Paul E. Johnson | Compact Pneumatic Auto Body Hammer with Fine Control of Impact Force |
| US9115542B1 (en) * | 2015-04-14 | 2015-08-25 | GDD Associates, Trustee for Geo-diving device CRT Trust | Geo-diving device |
| DE102019000932B4 (de) | 2019-02-11 | 2024-08-22 | Tracto-Technik Gmbh & Co. Kg | Vorrichtung zum Bohren in Erdreich und Verfahren zum Warten einer Vorrichtung zum Bohren in Erdreich |
| DE202024100744U1 (de) * | 2024-02-16 | 2024-03-19 | Tiefbau Alteilges Gl-Ka-Ro-Bau GmbH & Co. KG | Vorrichtung zur grabenlosen Verlegung von Rohren, Leitungen und dergleichen |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US955899A (en) * | 1908-03-02 | 1910-04-26 | Olin S Proctor | Electric rock-drill. |
| US1932068A (en) * | 1930-07-22 | 1933-10-24 | Hydrauger Corp Ltd | Earth boring apparatus |
| US2101608A (en) * | 1934-08-13 | 1937-12-07 | Gas Tool Patents Corp | Internal combustion hammer |
| US2424108A (en) * | 1943-05-31 | 1947-07-15 | Shell Dev | Hydraulic ram system |
| US2936743A (en) * | 1956-11-19 | 1960-05-17 | Stirling A Colgate | Internal combustion apparatus |
| US3137483A (en) * | 1958-01-24 | 1964-06-16 | Zinkiewicz Wiktor | Ground burrowing device |
| DE1294891B (de) * | 1962-11-23 | 1969-05-08 | Dom Techniczno Handlowy Przed | Selbstgetriebenes pneumatisches Rammbohrgeraet |
| US3375885A (en) * | 1965-09-13 | 1968-04-02 | California Inst Res Found | Burrowing apparatus |
| US3465834A (en) * | 1968-03-18 | 1969-09-09 | Bell Telephone Labor Inc | Guided subterranean penetrator systems |
| US3559753A (en) * | 1969-05-21 | 1971-02-02 | Ilmar Meri | Percussion tool |
-
1971
- 1971-11-18 DE DE19712157259 patent/DE2157259C3/de not_active Expired
-
1972
- 1972-11-17 US US307573A patent/US3865200A/en not_active Expired - Lifetime
- 1972-11-17 JP JP11551072A patent/JPS5418486B2/ja not_active Expired
- 1972-11-20 FR FR7241742A patent/FR2161732A5/fr not_active Expired
- 1972-11-20 GB GB5353972A patent/GB1392868A/en not_active Expired
-
1975
- 1975-11-05 KE KE2577*UA patent/KE2577A/xx unknown
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2634066A1 (de) * | 1976-07-29 | 1978-02-02 | Paul Schmidt | Steuervorrichtung fuer den vor- und ruecklauf von selbstgetriebenen pneumatischen rammbohrgeraeten |
| DE3200214A1 (de) * | 1982-01-07 | 1983-07-14 | Paul 5940 Lennestadt Schmidt | Selbstgetriebenes rammbohrgeraet |
| DE3710162C1 (de) * | 1987-03-27 | 1988-09-29 | Helmuth Dipl-Ing Roemer | Rammbohrgeraet mit beweglichem Meissel |
| DE3813236C1 (en) * | 1988-04-20 | 1989-07-27 | Paul 5940 Lennestadt De Schmidt | Self-propelled ram borer |
| DE3900122A1 (de) * | 1989-01-04 | 1990-07-05 | Schmidt Paul | Rammbohrgeraet |
| DE3911467A1 (de) * | 1989-04-08 | 1990-10-11 | Tracto Technik | Selbstantreibbares rammbohrgeraet, insbesondere fuer die herstellung von rohrfoermigen erdbohrungen |
| DE19881185C5 (de) * | 1997-08-22 | 2008-07-10 | Karl Storz Gmbh & Co. Kg | Vorrichtung zur Zertrümmerung von Konkrementen |
| DE102004032551A1 (de) * | 2004-07-06 | 2006-01-26 | Tracto-Technik Gmbh | Bohrkopf und Verfahren zum Erzeugen oder Aufweiten eines Bohrlochs über eine schlagend vorgetriebene Vorrichtung |
| DE102004032551B4 (de) * | 2004-07-06 | 2015-07-23 | Tracto-Technik Gmbh | Bohrkopf |
Also Published As
| Publication number | Publication date |
|---|---|
| US3865200A (en) | 1975-02-11 |
| JPS4872001A (enExample) | 1973-09-28 |
| JPS5418486B2 (enExample) | 1979-07-07 |
| DE2157259B1 (de) | 1972-11-09 |
| GB1392868A (en) | 1975-05-07 |
| FR2161732A5 (enExample) | 1973-07-06 |
| KE2577A (en) | 1975-11-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2157259C3 (de) | Rammbohrgerät | |
| DE3533995C2 (enExample) | ||
| DE69709862T2 (de) | Hydraulische vorrichtung zur integration in einen rohrstrang | |
| DE3633749C2 (de) | Druckluft-Schlagbohrverfahren und Druckluft-Schlagbohrvorrichtung zur Durchführung desselben | |
| DE2527595C2 (de) | Umkehrbare Schlagvorrichtung zur Herstellung von Bohrlöchern durch Verdrängen und Verdichten von Erdreich | |
| DE3710162C1 (de) | Rammbohrgeraet mit beweglichem Meissel | |
| DE2340751B1 (de) | Steuervorrichtung fuer den Vor-und Ruecklauf von Rammbohrgeraeten | |
| EP0548588B1 (de) | Vorrichtung zur Herstellung von Erdbohrungen | |
| DE19539412C2 (de) | Umkehrbares pneumatisches Bodenstechwerkzeug und Verfahren zu dessen Betrieb | |
| DE4134956A1 (de) | Drucklufthammer | |
| EP0703345A2 (de) | Rammbohrvorrichtung | |
| DE2558842A1 (de) | Selbstgetriebenes pneumatisches rammbohrgeraet, insbesondere fuer erdbohrungen | |
| DE3315132A1 (de) | Selbststeuernde umsteuerbare bohrramme | |
| DE69824641T2 (de) | Baggerschaufel mit einem schlagwerkzeug | |
| DE3124524C2 (de) | Rammvorrichtung für selbstgetriebene pneumatische Rammbohrgeräte | |
| DE19725628C1 (de) | Bohrvorrichtung | |
| DE2558685A1 (de) | Rammbohrgeraet | |
| DE10106942B4 (de) | Pneumatisches Bodenstechwerkzeug mit beweglichem Meißelkopf | |
| DE102009038383B4 (de) | Rammbohrvorrichtung | |
| DE4308547C1 (de) | Verfahren und Vorrichtung zum Verlegen von Rohren durch Pressen und gleichzeitiges Rammen | |
| DE19508542A1 (de) | Schlaggerät | |
| DE4415281C2 (de) | Fluidbetätigter Schlaghammer mit umkehrbarer Schlagrichtung | |
| DE3027990C2 (enExample) | ||
| DE2655541C3 (de) | Verfahren und Anordnung für das vertikale Eintreiben von Rohren | |
| DE4404009C1 (de) | Fluidbetätigter Schlaghammer |