DE2155986A1 - Chromogene amino-substituierte Fluoran-Verbindungen - Google Patents
Chromogene amino-substituierte Fluoran-VerbindungenInfo
- Publication number
- DE2155986A1 DE2155986A1 DE19712155986 DE2155986A DE2155986A1 DE 2155986 A1 DE2155986 A1 DE 2155986A1 DE 19712155986 DE19712155986 DE 19712155986 DE 2155986 A DE2155986 A DE 2155986A DE 2155986 A1 DE2155986 A1 DE 2155986A1
- Authority
- DE
- Germany
- Prior art keywords
- diethylamino
- group
- hydrogen
- methyl
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 Amino-Substituted Fluoran Compounds Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 239000003593 chromogenic compound Substances 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 239000012445 acidic reagent Substances 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims 3
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 238000002844 melting Methods 0.000 description 13
- 230000008018 melting Effects 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 9
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012043 crude product Substances 0.000 description 4
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- LUSZGTFNYDARNI-UHFFFAOYSA-N Sesamol Chemical compound OC1=CC=C2OCOC2=C1 LUSZGTFNYDARNI-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- VTUOVBVMHPBQLX-UHFFFAOYSA-N benzene heptane Chemical compound CCCCCCC.C1=CC=CC=C1.C1=CC=CC=C1 VTUOVBVMHPBQLX-UHFFFAOYSA-N 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 150000002222 fluorine compounds Chemical class 0.000 description 2
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical class F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- FWQHNLCNFPYBCA-UHFFFAOYSA-N fluoran Chemical compound C12=CC=CC=C2OC2=CC=CC=C2C11OC(=O)C2=CC=CC=C21 FWQHNLCNFPYBCA-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- KNWQLFOXPQZGPX-UHFFFAOYSA-N methanesulfonyl fluoride Chemical compound CS(F)(=O)=O KNWQLFOXPQZGPX-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920003217 poly(methylsilsesquioxane) Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- OVYWMEWYEJLIER-UHFFFAOYSA-N quinolin-6-ol Chemical compound N1=CC=CC2=CC(O)=CC=C21 OVYWMEWYEJLIER-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- WPPDXAHGCGPUPK-UHFFFAOYSA-N red 2 Chemical compound C1=CC=CC=C1C(C1=CC=CC=C11)=C(C=2C=3C4=CC=C5C6=CC=C7C8=C(C=9C=CC=CC=9)C9=CC=CC=C9C(C=9C=CC=CC=9)=C8C8=CC=C(C6=C87)C(C=35)=CC=2)C4=C1C1=CC=CC=C1 WPPDXAHGCGPUPK-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229960001866 silicon dioxide Drugs 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B11/00—Diaryl- or thriarylmethane dyes
- C09B11/04—Diaryl- or thriarylmethane dyes derived from triarylmethanes, i.e. central C-atom is substituted by amino, cyano, alkyl
- C09B11/10—Amino derivatives of triarylmethanes
- C09B11/24—Phthaleins containing amino groups ; Phthalanes; Fluoranes; Phthalides; Rhodamine dyes; Phthaleins having heterocyclic aryl rings; Lactone or lactame forms of triarylmethane dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Color Printing (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9009870A | 1970-11-16 | 1970-11-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2155986A1 true DE2155986A1 (de) | 1972-05-31 |
Family
ID=22221329
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712155986 Pending DE2155986A1 (de) | 1970-11-16 | 1971-11-11 | Chromogene amino-substituierte Fluoran-Verbindungen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3787325A (enExample) |
| JP (3) | JPS5525997B1 (enExample) |
| AU (1) | AU463959B2 (enExample) |
| BE (1) | BE775359R (enExample) |
| CH (1) | CH573466A5 (enExample) |
| DE (1) | DE2155986A1 (enExample) |
| FR (1) | FR2116394B2 (enExample) |
| GB (1) | GB1316909A (enExample) |
| IT (1) | IT998040B (enExample) |
| ZA (1) | ZA717298B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5348124B2 (enExample) * | 1971-08-21 | 1978-12-27 | ||
| BE793349A (fr) * | 1971-12-24 | 1973-04-16 | Hodogaya Chemical Co Ltd | Composes de fluorane et papiers de copie sensibles a la pression en contenant |
| JPS49119718A (enExample) * | 1973-03-23 | 1974-11-15 | ||
| DE2338954A1 (de) * | 1973-08-01 | 1975-02-20 | Basf Ag | Lactone der benzazaxanthenreihe und farbbildner fuer kopierverfahren |
| JPH03392A (ja) * | 1989-05-29 | 1991-01-07 | Hitachi Constr Mach Co Ltd | 油圧作業機におけるパイロット配管の運転室出口部構造 |
| KR102727968B1 (ko) * | 2019-05-29 | 2024-11-07 | 현대자동차주식회사 | 연료전지용 개질기의 운전 제어 시스템 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US656426A (en) * | 1899-12-06 | 1900-08-21 | Farbwerke Vormals Meister Lucius & Bruening | Rhodolalkyletherester. |
| US2153059A (en) * | 1936-02-26 | 1939-04-04 | Gen Aniline Works Inc | Chromable dyestuffs of the triarylmethane series and process of preparing them |
| US2335703A (en) * | 1941-03-19 | 1943-11-30 | Ind Proquifa S A | Preparation of disodium dibromhydroximercurifluorescein |
| GB658379A (en) * | 1948-12-24 | 1951-10-10 | Ncr Co | Record material for the production of visible records |
| US2937186A (en) * | 1958-04-29 | 1960-05-17 | Univ Kansas Res Foundation | Isothiocyanate compounds and means of producing the same |
| US3185696A (en) * | 1959-03-12 | 1965-05-25 | Jack M Tien | 3', 6'-diaminofluoran derivatives of gamma-lactam |
-
1970
- 1970-11-16 US US00090098A patent/US3787325A/en not_active Expired - Lifetime
-
1971
- 1971-11-01 ZA ZA717298A patent/ZA717298B/xx unknown
- 1971-11-01 GB GB5066671A patent/GB1316909A/en not_active Expired
- 1971-11-05 IT IT30742/71A patent/IT998040B/it active
- 1971-11-08 AU AU35436/71A patent/AU463959B2/en not_active Expired
- 1971-11-11 DE DE19712155986 patent/DE2155986A1/de active Pending
- 1971-11-15 JP JP9142971A patent/JPS5525997B1/ja active Pending
- 1971-11-15 FR FR717140708A patent/FR2116394B2/fr not_active Expired
- 1971-11-16 BE BE775359A patent/BE775359R/xx active
- 1971-11-16 CH CH1660971A patent/CH573466A5/xx not_active IP Right Cessation
-
1979
- 1979-10-26 JP JP13859979A patent/JPS5633983A/ja active Granted
- 1979-10-26 JP JP13860079A patent/JPS5633984A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5650878B2 (enExample) | 1981-12-01 |
| AU463959B2 (en) | 1975-08-14 |
| US3787325A (en) | 1974-01-22 |
| BE775359R (fr) | 1972-03-16 |
| JPS5525997B1 (enExample) | 1980-07-10 |
| JPS5650879B2 (enExample) | 1981-12-01 |
| AU3543671A (en) | 1973-05-17 |
| GB1316909A (en) | 1973-05-16 |
| ZA717298B (en) | 1972-07-26 |
| FR2116394B2 (enExample) | 1973-06-29 |
| JPS5633983A (en) | 1981-04-04 |
| CH573466A5 (enExample) | 1976-03-15 |
| JPS5633984A (en) | 1981-04-04 |
| FR2116394A2 (enExample) | 1972-07-13 |
| IT998040B (it) | 1976-01-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0770116B1 (de) | Diaryl-2h-naphthopyrane | |
| DE2166141C3 (de) | Indikatorfarbstoffe | |
| DE2150787B2 (de) | Neue N.N'-Diaryloxamide, ihre Herstellung und Verwendung als Stabilisatoren für organische Materialien | |
| DE2532224A1 (de) | Photochromatische verbindungen und verfahren zu ihrer herstellung | |
| DE3048167A1 (de) | Xanthen-verbindungen | |
| DE2514759C3 (de) | Verfahren zur Herstellung von 233-Trimethylindolenin | |
| DE2261984A1 (de) | Verfahren zur herstellung von fluoranverbindungen | |
| DE2031490C3 (de) | Di-fluoranverbindungen | |
| DE2215048C3 (de) | Verfahren zur Herstellung von 2-[Bis-(4,4'-dialkylamino)-benzhydryl)-5-aminobenzoesäuren | |
| DE2263292C3 (de) | Fluoranverbindungen und druckempfindliches Kopierpapier | |
| DE2164183C3 (de) | Verfahren zur Herstellung von Chromenverbindungen | |
| CH660491A5 (de) | Verfahren zur herstellung von triarylmethanverbindungen. | |
| CH424753A (de) | Verfahren zur Herstellung von Spirilloxanthin | |
| AT227697B (de) | Verfahren zur Herstellung von neuen Derivaten des 3'-methyl-spiro-[2H-1-β-naphthopyran-2,2'-(2'H-1'-benzopyrans)] | |
| DE2110343C3 (de) | Verfahren zur Herstellung eines Indophenol | |
| DE2018279C3 (de) | 3-Dialkylamino-7-phenylfluorane | |
| DE1543876A1 (de) | Verfahren zur Herstellung neuer Phenolformiate | |
| DE2001864C3 (de) | Basisch substituierte Furanverbindungen | |
| DD234666A1 (de) | Verfahren zur herstellung von einfachen und substituierten 4-dimethylamino-alpha-halogenstilbenen | |
| DE2400821C2 (de) | Benzylanthrachinone und (p-Benzyl)benzylanthrachinone | |
| DE1930334A1 (de) | Substituierte Bis-(2-hydroxy-4-methyl-5-methylthiophenyl)methane und Verfahren zu deren Herstellung | |
| AT95240B (de) | Verfahren zur Herstellung von 1-Arylamido-2-naphtholen. | |
| AT213398B (de) | Verfahren zur Herstellung von neuen 4-Oxo-1,2,3,4-tetrahydronaphthalinverbindungen | |
| DE2065643C3 (de) | Basisch substituierte Furanverbindungen | |
| DE2349803A1 (de) | Organische luminophore und verfahren zu ihrer herstellung |