DE2153365A1 - Verfahren zur Herstellung neuer heterocychscher Verbindungen - Google Patents
Verfahren zur Herstellung neuer heterocychscher VerbindungenInfo
- Publication number
- DE2153365A1 DE2153365A1 DE19712153365 DE2153365A DE2153365A1 DE 2153365 A1 DE2153365 A1 DE 2153365A1 DE 19712153365 DE19712153365 DE 19712153365 DE 2153365 A DE2153365 A DE 2153365A DE 2153365 A1 DE2153365 A1 DE 2153365A1
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- formula
- ethyl ester
- toluene
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000002360 preparation method Methods 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 6
- 150000002391 heterocyclic compounds Chemical class 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 30
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 69
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 37
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 20
- 239000000203 mixture Substances 0.000 description 17
- 239000000243 solution Substances 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 10
- 235000019341 magnesium sulphate Nutrition 0.000 description 10
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 125000004494 ethyl ester group Chemical group 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 4
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- -1 methoxyphenyl Chemical group 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- RTSQTHXAGCRMNU-UHFFFAOYSA-N 4-hydroxy-5-phenylthiophene-3-carboxylic acid Chemical compound OC1=C(SC=C1C(=O)O)C1=CC=CC=C1 RTSQTHXAGCRMNU-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- FFEOIDJHWOHWRD-UHFFFAOYSA-N ethyl 5-(4-fluorophenyl)-4-hydroxythiophene-3-carboxylate Chemical compound C(C)OC(=O)C=1C(=C(SC1)C1=CC=C(C=C1)F)O FFEOIDJHWOHWRD-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- LXXNWCFBZHKFPT-UHFFFAOYSA-N Ethyl 2-mercaptopropionate Chemical compound CCOC(=O)C(C)S LXXNWCFBZHKFPT-UHFFFAOYSA-N 0.000 description 1
- CJQWLNNCQIHKHP-UHFFFAOYSA-N Ethyl 3-mercaptopropanoic acid Chemical compound CCOC(=O)CCS CJQWLNNCQIHKHP-UHFFFAOYSA-N 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 235000010678 Paulownia tomentosa Nutrition 0.000 description 1
- 240000002834 Paulownia tomentosa Species 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- UTWBWFXECVFDPZ-UHFFFAOYSA-N ethyl 2-(4-chlorophenyl)acetate Chemical compound CCOC(=O)CC1=CC=C(Cl)C=C1 UTWBWFXECVFDPZ-UHFFFAOYSA-N 0.000 description 1
- VMWJHHAOVXQCLE-UHFFFAOYSA-N ethyl 2-(4-fluorophenyl)acetate Chemical compound CCOC(=O)CC1=CC=C(F)C=C1 VMWJHHAOVXQCLE-UHFFFAOYSA-N 0.000 description 1
- XIKHDQBZFLTULT-UHFFFAOYSA-N ethyl 4-hydroxy-5-(4-methoxyphenyl)thiophene-3-carboxylate Chemical compound C(C)OC(=O)C=1C(=C(SC1)C1=CC=C(C=C1)OC)O XIKHDQBZFLTULT-UHFFFAOYSA-N 0.000 description 1
- VMMTYCGCFUOXRF-UHFFFAOYSA-N ethyl 4-hydroxy-5-phenylthiophene-3-carboxylate Chemical compound C(C)OC(=O)C=1C(=C(SC1)C1=CC=CC=C1)O VMMTYCGCFUOXRF-UHFFFAOYSA-N 0.000 description 1
- PEQYRSZTDROSJS-UHFFFAOYSA-N ethyl 5-(3-chlorophenyl)-4-hydroxythiophene-3-carboxylate Chemical compound C(C)OC(=O)C1=CSC(=C1O)C1=CC(=CC=C1)Cl PEQYRSZTDROSJS-UHFFFAOYSA-N 0.000 description 1
- JZGZKRJVTIRPOK-UHFFFAOYSA-N ethyl thiophene-2-carboxylate Chemical compound CCOC(=O)C1=CC=CS1 JZGZKRJVTIRPOK-UHFFFAOYSA-N 0.000 description 1
- OYSLMAQEMAJMCL-UHFFFAOYSA-N ethyl thiophene-3-carboxylate Chemical compound CCOC(=O)C=1C=CSC=1 OYSLMAQEMAJMCL-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- YNVOMSDITJMNET-UHFFFAOYSA-N thiophene-3-carboxylic acid Chemical compound OC(=O)C=1C=CSC=1 YNVOMSDITJMNET-UHFFFAOYSA-N 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1606470A CH535778A (de) | 1970-10-30 | 1970-10-30 | Verfahren zur Herstellung neuer Thiophenderivate |
| CH988871A CH570397A5 (en) | 1971-07-06 | 1971-07-06 | 2-phenyl-3-hydroxy-4-thiophene carboxylic acid derivs - as anti inflammatory and analgesic agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2153365A1 true DE2153365A1 (de) | 1972-05-04 |
Family
ID=25705469
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712153365 Pending DE2153365A1 (de) | 1970-10-30 | 1971-10-27 | Verfahren zur Herstellung neuer heterocychscher Verbindungen |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE774650A (enExample) |
| DD (1) | DD95394A5 (enExample) |
| DE (1) | DE2153365A1 (enExample) |
| DK (1) | DK128741C (enExample) |
| ES (1) | ES396447A1 (enExample) |
| FR (1) | FR2111954B1 (enExample) |
| GB (1) | GB1368276A (enExample) |
| NL (1) | NL7114479A (enExample) |
| SE (1) | SE381262B (enExample) |
-
1971
- 1971-10-21 NL NL7114479A patent/NL7114479A/xx unknown
- 1971-10-27 GB GB4987971A patent/GB1368276A/en not_active Expired
- 1971-10-27 DE DE19712153365 patent/DE2153365A1/de active Pending
- 1971-10-28 SE SE1372671A patent/SE381262B/xx unknown
- 1971-10-28 ES ES396447A patent/ES396447A1/es not_active Expired
- 1971-10-28 BE BE774650A patent/BE774650A/xx unknown
- 1971-10-28 DK DK528171A patent/DK128741C/da active
- 1971-10-29 DD DD15864071A patent/DD95394A5/xx unknown
- 1971-10-29 FR FR7138880A patent/FR2111954B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2111954A1 (enExample) | 1972-06-09 |
| DD95394A5 (enExample) | 1973-02-05 |
| DK128741B (enExample) | 1974-06-24 |
| GB1368276A (en) | 1974-09-25 |
| DK128741C (da) | 1974-11-04 |
| SE381262B (sv) | 1975-12-01 |
| BE774650A (fr) | 1972-04-28 |
| FR2111954B1 (enExample) | 1975-08-01 |
| ES396447A1 (es) | 1975-01-16 |
| NL7114479A (enExample) | 1972-05-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2835701C2 (de) | Cycloalkylidenmethylphenylessigsäurederivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische Zusammensetzungen | |
| DE2310031A1 (de) | Substituierte 1-benzyl-indazol-3carbonsaeuren | |
| DE1942755A1 (de) | 1,2,3,11b-Tetrahydropyrido[3,4,5-m,n]thioxanthene,deren Saeureadditionssalze und Verfahren zu ihrer Herstellung | |
| DE2243550B2 (de) | OrganosUicium- und Organogermaniumverbindungen und sie enthaltende Arzneimittel | |
| DE2224655A1 (de) | Tricyclische Verbindungen und Verfahren zu deren Herstellung | |
| DE2448438A1 (de) | 2-substituierte und 2,2-disubstituierte eckige klammer auf 1,3-dioxoindanyloxy(oder -thio) eckige klammer zu -alkancarbonsaeuren und verfahren zur herstellung derselben | |
| DE2817661A1 (de) | Neue isoindolinderivate, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische zubereitungen | |
| AT391316B (de) | Neue thienyloxy-alkylamin-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE3129718C2 (enExample) | ||
| DE2153365A1 (de) | Verfahren zur Herstellung neuer heterocychscher Verbindungen | |
| DE2640884A1 (de) | Neue entzuendungshemmende l-oxo-isoindolin-derivate und verfahren zu ihrer herstellung | |
| DE2642877A1 (de) | Substituierte 2-nitro-3-phenylbenzofuranverbindungen | |
| DE2039426B2 (enExample) | ||
| DE2021747A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| DE2656750C2 (de) | In 5-Stellung substituierte 2-Indancarbonsäuren, Verfahren zu deren LIPHA-Herstellung und sie enthaltende Arzneimittel | |
| DE2024049B2 (de) | Alpha-(3,4-dihydroxyphenyl)-alpha(2-piperidinyl)-methanol | |
| AT321302B (de) | Verfahren zur Herstellung von neuen Aminophenylketonderivaten und ihren Säureadditionssalzen | |
| AT374166B (de) | Verfahren zur herstellung von neuen indan-1 -carbonsaeure-derivaten und deren salzen | |
| DE2021690A1 (de) | Verfahren zur Herstellung neuer heterocyclischer Verbindungen | |
| CH570397A5 (en) | 2-phenyl-3-hydroxy-4-thiophene carboxylic acid derivs - as anti inflammatory and analgesic agents | |
| DE2312256C3 (de) | 5-Pyrazol-essigsäurederivate, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| DE2237361A1 (de) | (5-indolyloxy)-essigsaeure-derivate und verfahren zur herstellung derselben | |
| DE2404924A1 (de) | Ergolinderivate | |
| DE2118365C3 (de) | m-Benzoylphenylessigsäureester, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| AT346836B (de) | Verfahren zur herstellung von neuen, substituierten 2-alkyl-5-indanessigsaeuren und von deren salzen |