DE2144080C2 - 4-Acylaminopiperidinderivate, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen, welche diese Verbindungen enthalten - Google Patents
4-Acylaminopiperidinderivate, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen, welche diese Verbindungen enthaltenInfo
- Publication number
- DE2144080C2 DE2144080C2 DE2144080A DE2144080A DE2144080C2 DE 2144080 C2 DE2144080 C2 DE 2144080C2 DE 2144080 A DE2144080 A DE 2144080A DE 2144080 A DE2144080 A DE 2144080A DE 2144080 C2 DE2144080 C2 DE 2144080C2
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- benzamidopiperidine
- phenyl
- radical
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 173
- 238000000034 method Methods 0.000 title claims description 30
- 239000000825 pharmaceutical preparation Substances 0.000 title description 7
- 238000004519 manufacturing process Methods 0.000 title description 3
- -1 1,2,3,4-tetrahydronaphthyl Chemical group 0.000 claims description 97
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 42
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 20
- 125000001544 thienyl group Chemical group 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000002252 acyl group Chemical group 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 238000006683 Mannich reaction Methods 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 4
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims description 3
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000005059 halophenyl group Chemical group 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 3
- 125000005493 quinolyl group Chemical group 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 2
- 239000005977 Ethylene Substances 0.000 claims description 2
- 230000002152 alkylating effect Effects 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 2
- 125000005605 benzo group Chemical group 0.000 claims description 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 230000003213 activating effect Effects 0.000 claims 1
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 154
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 126
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 114
- 238000002844 melting Methods 0.000 description 100
- 230000008018 melting Effects 0.000 description 100
- 238000004458 analytical method Methods 0.000 description 97
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 82
- 239000000203 mixture Substances 0.000 description 63
- 239000000243 solution Substances 0.000 description 61
- JMQDNLCNCDSHNC-UHFFFAOYSA-N n-piperidin-4-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)NC1CCNCC1 JMQDNLCNCDSHNC-UHFFFAOYSA-N 0.000 description 58
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 58
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 57
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 52
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 52
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 46
- 229910000027 potassium carbonate Inorganic materials 0.000 description 41
- 239000007787 solid Substances 0.000 description 39
- 235000019441 ethanol Nutrition 0.000 description 37
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 36
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 32
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 32
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 30
- 238000001953 recrystallisation Methods 0.000 description 26
- 238000003756 stirring Methods 0.000 description 25
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- 239000000706 filtrate Substances 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 239000004480 active ingredient Substances 0.000 description 18
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 18
- ITNXJLXLFAFOHO-UHFFFAOYSA-N n-piperidin-1-ylbenzamide Chemical compound C=1C=CC=CC=1C(=O)NN1CCCCC1 ITNXJLXLFAFOHO-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 150000003254 radicals Chemical class 0.000 description 16
- 239000003826 tablet Substances 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 13
- 239000011541 reaction mixture Substances 0.000 description 13
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 239000000284 extract Substances 0.000 description 11
- 239000010410 layer Substances 0.000 description 11
- 238000001816 cooling Methods 0.000 description 10
- 238000001704 evaporation Methods 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000012279 sodium borohydride Substances 0.000 description 8
- 229910000033 sodium borohydride Inorganic materials 0.000 description 8
- 230000002378 acidificating effect Effects 0.000 description 7
- 230000003276 anti-hypertensive effect Effects 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 6
- 239000008101 lactose Substances 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 239000003208 petroleum Substances 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 229920002261 Corn starch Polymers 0.000 description 5
- 241000699666 Mus <mouse, genus> Species 0.000 description 5
- 239000008120 corn starch Substances 0.000 description 5
- 230000001077 hypotensive effect Effects 0.000 description 5
- 231100000419 toxicity Toxicity 0.000 description 5
- 230000001988 toxicity Effects 0.000 description 5
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000012458 free base Substances 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- NOMPHPRJDQKAFF-UHFFFAOYSA-N n-[1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl]benzamide Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 NOMPHPRJDQKAFF-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000012258 stirred mixture Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000001665 trituration Methods 0.000 description 4
- FQBUESDFNJJZHK-UHFFFAOYSA-N 4-(4-aminopiperidin-1-yl)-1-phenylbutan-1-one Chemical compound C1CC(N)CCN1CCCC(=O)C1=CC=CC=C1 FQBUESDFNJJZHK-UHFFFAOYSA-N 0.000 description 3
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 229930040373 Paraformaldehyde Natural products 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000008064 anhydrides Chemical class 0.000 description 3
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 230000034994 death Effects 0.000 description 3
- 231100000517 death Toxicity 0.000 description 3
- 229960004042 diazoxide Drugs 0.000 description 3
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- LAAJYNCMRTWBFL-UHFFFAOYSA-N n-[1-(2-naphthalen-2-ylethyl)piperidin-4-yl]benzamide Chemical compound C1CN(CCC=2C=C3C=CC=CC3=CC=2)CCC1NC(=O)C1=CC=CC=C1 LAAJYNCMRTWBFL-UHFFFAOYSA-N 0.000 description 3
- VVSOHUNZJUMVHS-UHFFFAOYSA-N n-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)CCCN(CC1)CCC1NC(=O)C1=CC=CC=C1 VVSOHUNZJUMVHS-UHFFFAOYSA-N 0.000 description 3
- 229920002866 paraformaldehyde Polymers 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- NZVZVGPYTICZBZ-UHFFFAOYSA-N 1-benzylpiperidine Chemical compound C=1C=CC=CC=1CN1CCCCC1 NZVZVGPYTICZBZ-UHFFFAOYSA-N 0.000 description 2
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 2
- RDOBRNOEPGSNQE-UHFFFAOYSA-N 2-(5-phenylthiophen-2-yl)ethanol Chemical compound S1C(CCO)=CC=C1C1=CC=CC=C1 RDOBRNOEPGSNQE-UHFFFAOYSA-N 0.000 description 2
- JRQAAYVLPPGEHT-UHFFFAOYSA-N 2-bromoethylcyclohexane Chemical compound BrCCC1CCCCC1 JRQAAYVLPPGEHT-UHFFFAOYSA-N 0.000 description 2
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 2
- KKZPDPNTMKHMNU-UHFFFAOYSA-N 3-(2-bromoethyl)-1h-indene Chemical compound C1=CC=C2C(CCBr)=CCC2=C1 KKZPDPNTMKHMNU-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000036772 blood pressure Effects 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- RVOJTCZRIKWHDX-UHFFFAOYSA-N cyclohexanecarbonyl chloride Chemical compound ClC(=O)C1CCCCC1 RVOJTCZRIKWHDX-UHFFFAOYSA-N 0.000 description 2
- 210000003298 dental enamel Anatomy 0.000 description 2
- 229940043279 diisopropylamine Drugs 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- YYTXLQXRYOISOG-UHFFFAOYSA-N n-(1-phenacylpiperidin-4-yl)benzamide Chemical compound C=1C=CC=CC=1C(=O)CN(CC1)CCC1NC(=O)C1=CC=CC=C1 YYTXLQXRYOISOG-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- ZEBXFHDDNIYGNP-UHFFFAOYSA-N n-[1-(2-quinolin-2-ylethyl)piperidin-4-yl]benzamide Chemical compound C1CN(CCC=2N=C3C=CC=CC3=CC=2)CCC1NC(=O)C1=CC=CC=C1 ZEBXFHDDNIYGNP-UHFFFAOYSA-N 0.000 description 2
- TVPNTPQBYXOCDQ-UHFFFAOYSA-N n-[1-[2-(2-nitrophenyl)ethyl]piperidin-4-yl]benzamide Chemical compound [O-][N+](=O)C1=CC=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 TVPNTPQBYXOCDQ-UHFFFAOYSA-N 0.000 description 2
- PGOHAEXEJLMTOL-UHFFFAOYSA-N n-[1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=C(OC)C(OC)=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 PGOHAEXEJLMTOL-UHFFFAOYSA-N 0.000 description 2
- DXNWITJLZXXVKZ-UHFFFAOYSA-N n-[1-[2-(4-nitrophenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 DXNWITJLZXXVKZ-UHFFFAOYSA-N 0.000 description 2
- CRFWZMORNUMDHW-UHFFFAOYSA-N n-[1-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-oxopropyl]piperidin-4-yl]benzamide Chemical compound C=1C=C2OCCOC2=CC=1C(=O)CCN(CC1)CCC1NC(=O)C1=CC=CC=C1 CRFWZMORNUMDHW-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000008188 pellet Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000008174 sterile solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- ZRSGZIMDIHBXIN-UHFFFAOYSA-N 1,3-benzodioxole-5-carbonyl chloride Chemical compound ClC(=O)C1=CC=C2OCOC2=C1 ZRSGZIMDIHBXIN-UHFFFAOYSA-N 0.000 description 1
- ITKBNCGVSDPRHR-UHFFFAOYSA-N 1,3-dichloro-1,3-bis(3,4-dichlorophenyl)propan-2-one Chemical compound ClC=1C=C(C=CC=1Cl)C(Cl)C(=O)C(C1=CC(=C(C=C1)Cl)Cl)Cl ITKBNCGVSDPRHR-UHFFFAOYSA-N 0.000 description 1
- PBRPKYRJVDJZTF-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-methoxybenzene Chemical compound COC1=CC=CC=C1OCCBr PBRPKYRJVDJZTF-UHFFFAOYSA-N 0.000 description 1
- SJLIPOVZERLCNL-UHFFFAOYSA-N 1-(2-bromoethyl)-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1CCBr SJLIPOVZERLCNL-UHFFFAOYSA-N 0.000 description 1
- NTURQZFFJDCTMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(CCBr)C=C1 NTURQZFFJDCTMZ-UHFFFAOYSA-N 0.000 description 1
- GPHCPUFIWQJZOI-UHFFFAOYSA-N 1-(2-bromoethyl)naphthalene Chemical compound C1=CC=C2C(CCBr)=CC=CC2=C1 GPHCPUFIWQJZOI-UHFFFAOYSA-N 0.000 description 1
- DBDVAKGHPZJLTH-UHFFFAOYSA-N 1-(2-phenylethyl)piperidine Chemical class C1CCCCN1CCC1=CC=CC=C1 DBDVAKGHPZJLTH-UHFFFAOYSA-N 0.000 description 1
- ICLUABGTJWXERF-UHFFFAOYSA-N 1-(3-bromopropoxy)naphthalene Chemical compound C1=CC=C2C(OCCCBr)=CC=CC2=C1 ICLUABGTJWXERF-UHFFFAOYSA-N 0.000 description 1
- WJKPUMBLABGUCQ-UHFFFAOYSA-N 1-(4-bromophenyl)-4-chlorobutan-1-one Chemical compound ClCCCC(=O)C1=CC=C(Br)C=C1 WJKPUMBLABGUCQ-UHFFFAOYSA-N 0.000 description 1
- YHBIAULFCXQLFS-UHFFFAOYSA-N 1-(4-chloro-4-fluorocyclohexa-1,5-dien-1-yl)butan-1-one Chemical compound CCCC(=O)C1=CCC(F)(Cl)C=C1 YHBIAULFCXQLFS-UHFFFAOYSA-N 0.000 description 1
- RDEUNWFXSVDHCI-UHFFFAOYSA-N 1-benzylpiperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(N)CCN1CC1=CC=CC=C1 RDEUNWFXSVDHCI-UHFFFAOYSA-N 0.000 description 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- ZVVJOJMCXYDDEW-UHFFFAOYSA-N 1-chloro-3-naphthalen-1-yloxypropan-2-ol Chemical compound C1=CC=C2C(OCC(CCl)O)=CC=CC2=C1 ZVVJOJMCXYDDEW-UHFFFAOYSA-N 0.000 description 1
- LHBQGXZUVXFJRH-UHFFFAOYSA-N 1-hydroxybut-3-en-2-one Chemical compound OCC(=O)C=C LHBQGXZUVXFJRH-UHFFFAOYSA-N 0.000 description 1
- JNXIFVSGXLGULI-UHFFFAOYSA-N 2,5-dimethyl-1-phenylpyrrole Chemical compound CC1=CC=C(C)N1C1=CC=CC=C1 JNXIFVSGXLGULI-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- ZWMPYIRPUBVKPN-UHFFFAOYSA-N 2-(2-bromoethyl)-1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1CCBr ZWMPYIRPUBVKPN-UHFFFAOYSA-N 0.000 description 1
- DNJYJMDQLURVBB-UHFFFAOYSA-N 2-(2-bromoethyl)naphthalene Chemical compound C1=CC=CC2=CC(CCBr)=CC=C21 DNJYJMDQLURVBB-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- OHFBPYBLQIIASS-UHFFFAOYSA-N 2-(4-chloro-2,4-dimethylcyclohexa-1,5-dien-1-yl)-1-phenylbutan-1-one Chemical compound CC=1CC(C)(Cl)C=CC=1C(CC)C(=O)C1=CC=CC=C1 OHFBPYBLQIIASS-UHFFFAOYSA-N 0.000 description 1
- DNRJTBAOUJJKDY-UHFFFAOYSA-N 2-Acetyl-3,5,5,6,8,8-hexamethyl-5,6,7,8- tetrahydronaphthalene Chemical compound CC(=O)C1=C(C)C=C2C(C)(C)C(C)CC(C)(C)C2=C1 DNRJTBAOUJJKDY-UHFFFAOYSA-N 0.000 description 1
- XXZCIYUJYUESMD-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(morpholin-4-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCOCC1 XXZCIYUJYUESMD-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- JJFOBACUIRKUPN-UHFFFAOYSA-N 2-bromoethoxybenzene Chemical compound BrCCOC1=CC=CC=C1 JJFOBACUIRKUPN-UHFFFAOYSA-N 0.000 description 1
- NVYOCAOZCSNIHR-UHFFFAOYSA-N 2-bromopropylbenzene Chemical compound CC(Br)CC1=CC=CC=C1 NVYOCAOZCSNIHR-UHFFFAOYSA-N 0.000 description 1
- LWTJEJCZJFZKEL-UHFFFAOYSA-N 2-chloro-3',4'-dihydroxyacetophenone Chemical compound OC1=CC=C(C(=O)CCl)C=C1O LWTJEJCZJFZKEL-UHFFFAOYSA-N 0.000 description 1
- VYFBHWULXQSKTD-UHFFFAOYSA-N 2-chloro-n-[1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=C(OC)C(OC)=CC=C1CCN1CCC(NC(=O)C=2C(=CC=CC=2)Cl)CC1 VYFBHWULXQSKTD-UHFFFAOYSA-N 0.000 description 1
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- GSFNQBFZFXUTBN-UHFFFAOYSA-N 2-chlorothiophene Chemical compound ClC1=CC=CS1 GSFNQBFZFXUTBN-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- RXWNCMHRJCOWDK-UHFFFAOYSA-N 2-naphthalen-1-ylethanol Chemical compound C1=CC=C2C(CCO)=CC=CC2=C1 RXWNCMHRJCOWDK-UHFFFAOYSA-N 0.000 description 1
- 125000005979 2-naphthyloxy group Chemical group 0.000 description 1
- ITESSSIUDOPQKI-UHFFFAOYSA-N 2-phenyl-n-piperidin-1-ylacetamide Chemical compound C1CCCCN1NC(=O)CC1=CC=CC=C1 ITESSSIUDOPQKI-UHFFFAOYSA-N 0.000 description 1
- PJRGDKFLFAYRBV-UHFFFAOYSA-N 2-phenylthiophene Chemical compound C1=CSC(C=2C=CC=CC=2)=C1 PJRGDKFLFAYRBV-UHFFFAOYSA-N 0.000 description 1
- VSWICNJIUPRZIK-UHFFFAOYSA-N 2-piperideine Chemical compound C1CNC=CC1 VSWICNJIUPRZIK-UHFFFAOYSA-N 0.000 description 1
- 125000000389 2-pyrrolyl group Chemical group [H]N1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- VPDAGUVEZGEHJJ-UHFFFAOYSA-N 2-quinolin-2-ylethanol Chemical compound C1=CC=CC2=NC(CCO)=CC=C21 VPDAGUVEZGEHJJ-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- RGUXEWWHSQGVRZ-UHFFFAOYSA-N 3,3-diethoxyprop-1-yne Chemical compound CCOC(C#C)OCC RGUXEWWHSQGVRZ-UHFFFAOYSA-N 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- IHKSIYHMJHEJOS-UHFFFAOYSA-N 3-(2-bromoethyl)-2,3-dihydro-1,4-benzodioxine Chemical compound C1=CC=C2OC(CCBr)COC2=C1 IHKSIYHMJHEJOS-UHFFFAOYSA-N 0.000 description 1
- AWNRGBYUHUSASE-UHFFFAOYSA-N 3-(3-bromopropyl)-1h-indene Chemical compound C1=CC=C2C(CCCBr)=CCC2=C1 AWNRGBYUHUSASE-UHFFFAOYSA-N 0.000 description 1
- XMZQWZJMTBCUFT-UHFFFAOYSA-N 3-bromopropylbenzene Chemical compound BrCCCC1=CC=CC=C1 XMZQWZJMTBCUFT-UHFFFAOYSA-N 0.000 description 1
- NLQJAQIXEFYSKJ-UHFFFAOYSA-N 3-chloro-1-(2,3-dihydro-1,4-benzodioxin-6-yl)propan-1-one Chemical compound O1CCOC2=CC(C(=O)CCCl)=CC=C21 NLQJAQIXEFYSKJ-UHFFFAOYSA-N 0.000 description 1
- KTJRGPZVSKWRTJ-UHFFFAOYSA-N 3-chloro-1-phenylpropan-1-one Chemical compound ClCCC(=O)C1=CC=CC=C1 KTJRGPZVSKWRTJ-UHFFFAOYSA-N 0.000 description 1
- RUQIUASLAXJZIE-UHFFFAOYSA-N 3-methoxybenzoyl chloride Chemical compound COC1=CC=CC(C(Cl)=O)=C1 RUQIUASLAXJZIE-UHFFFAOYSA-N 0.000 description 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- NXNNJSPCPKSLRT-UHFFFAOYSA-N 4-(2-bromoethyl)-1,2-dimethylbenzene Chemical compound CC1=CC=C(CCBr)C=C1C NXNNJSPCPKSLRT-UHFFFAOYSA-N 0.000 description 1
- BOBYPEPSZXBOEZ-UHFFFAOYSA-N 4-(2-iodoethyl)-1,2-dimethoxybenzene Chemical compound COC1=CC=C(CCI)C=C1OC BOBYPEPSZXBOEZ-UHFFFAOYSA-N 0.000 description 1
- JCDGWDMOGQNRCO-UHFFFAOYSA-N 4-(4-aminopiperidin-1-yl)-1-phenylbutan-1-one;dihydrochloride Chemical compound Cl.Cl.C1CC(N)CCN1CCCC(=O)C1=CC=CC=C1 JCDGWDMOGQNRCO-UHFFFAOYSA-N 0.000 description 1
- RMNFNJLSEHCPTJ-UHFFFAOYSA-N 4-(4-methoxyphenyl)butanoyl chloride Chemical compound COC1=CC=C(CCCC(Cl)=O)C=C1 RMNFNJLSEHCPTJ-UHFFFAOYSA-N 0.000 description 1
- UEJQTBKTWJQBRN-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole Chemical compound ClCC1=CSC(C=2C=CC(Cl)=CC=2)=N1 UEJQTBKTWJQBRN-UHFFFAOYSA-N 0.000 description 1
- NUKYPUAOHBNCPY-UHFFFAOYSA-N 4-aminopyridine Chemical compound NC1=CC=NC=C1 NUKYPUAOHBNCPY-UHFFFAOYSA-N 0.000 description 1
- XPBQQAHIVODAIC-UHFFFAOYSA-N 4-bromobutylbenzene Chemical compound BrCCCCC1=CC=CC=C1 XPBQQAHIVODAIC-UHFFFAOYSA-N 0.000 description 1
- UKCHLVFIVJBCKE-UHFFFAOYSA-N 4-chloro-1-(4-chlorophenyl)butan-1-one Chemical compound ClCCCC(=O)C1=CC=C(Cl)C=C1 UKCHLVFIVJBCKE-UHFFFAOYSA-N 0.000 description 1
- HXAOUYGZEOZTJO-UHFFFAOYSA-N 4-chloro-1-(4-fluorophenyl)butan-1-one Chemical compound FC1=CC=C(C(=O)CCCCl)C=C1 HXAOUYGZEOZTJO-UHFFFAOYSA-N 0.000 description 1
- RBYNNFPVKRNXIH-UHFFFAOYSA-N 4-chloro-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-1-one Chemical compound C1CCCC2=CC(C(=O)CCCCl)=CC=C21 RBYNNFPVKRNXIH-UHFFFAOYSA-N 0.000 description 1
- XIXRRNDTHSYQCG-UHFFFAOYSA-N 4-chloro-n-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]benzamide Chemical compound C1=CC(Cl)=CC=C1C(=O)NC1CCN(CCCC(=O)C=2C=CC=CC=2)CC1 XIXRRNDTHSYQCG-UHFFFAOYSA-N 0.000 description 1
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- XGETZEUSOSEUDY-UHFFFAOYSA-N 4-hydroxy-4-(nitromethyl)cyclohexan-1-one Chemical compound [O-][N+](=O)CC1(O)CCC(=O)CC1 XGETZEUSOSEUDY-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- LVILGAOSPDLNRM-UHFFFAOYSA-N 4-methylpyrimidine Chemical compound CC1=CC=NC=N1 LVILGAOSPDLNRM-UHFFFAOYSA-N 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical compound [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- LGAAWMCNBATHDY-UHFFFAOYSA-N 5-(2-chloroethyl)-1,2,3-trimethoxybenzene Chemical compound COC1=CC(CCCl)=CC(OC)=C1OC LGAAWMCNBATHDY-UHFFFAOYSA-N 0.000 description 1
- DWSUJONSJJTODA-UHFFFAOYSA-N 5-(chloromethyl)-1,3-benzodioxole Chemical compound ClCC1=CC=C2OCOC2=C1 DWSUJONSJJTODA-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BDDGYTNPRKKSNI-UHFFFAOYSA-K C(CCCCCCCCCCCCCCCCC)(=O)[O-].[Mg+2].C([O-])([O-])=O.[Mg+2] Chemical compound C(CCCCCCCCCCCCCCCCC)(=O)[O-].[Mg+2].C([O-])([O-])=O.[Mg+2] BDDGYTNPRKKSNI-UHFFFAOYSA-K 0.000 description 1
- REYSQBSHLWSZRW-UHFFFAOYSA-N CC1(N(CC2)CCC2NC(C2=CC=CC=C2)=O)OC(C=CC=C2)=C2OC1 Chemical compound CC1(N(CC2)CCC2NC(C2=CC=CC=C2)=O)OC(C=CC=C2)=C2OC1 REYSQBSHLWSZRW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- HSFJXUFOXVQBKL-UHFFFAOYSA-N ClC1(C(=O)Cl)CC=C(C=C1)Cl Chemical compound ClC1(C(=O)Cl)CC=C(C=C1)Cl HSFJXUFOXVQBKL-UHFFFAOYSA-N 0.000 description 1
- LITXRODXDXHQJX-UHFFFAOYSA-N ClCCC1=C(N=C(S1)C1=CC=CC=C1)C1=CC=C(C=C1)Cl Chemical compound ClCCC1=C(N=C(S1)C1=CC=CC=C1)C1=CC=C(C=C1)Cl LITXRODXDXHQJX-UHFFFAOYSA-N 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 208000001953 Hypotension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CAVBVVVUDRDICY-UHFFFAOYSA-N N-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]thiophene-2-carboxamide Chemical compound C1(=CC=CC=C1)C(CCCN1CCC(CC1)NC(=O)C=1SC=CC1)=O CAVBVVVUDRDICY-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- QKERXQSRBCZZMD-UHFFFAOYSA-N O=C(C1=CC=CC=C1)NC1CCN(CCC2=CC=C(C3=CC=CC=C3)S2)CC1 Chemical compound O=C(C1=CC=CC=C1)NC1CCN(CCC2=CC=C(C3=CC=CC=C3)S2)CC1 QKERXQSRBCZZMD-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000012223 aqueous fraction Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000005870 benzindolyl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000007891 compressed tablet Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000001186 cumulative effect Effects 0.000 description 1
- 229940076286 cupric acetate Drugs 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 230000035487 diastolic blood pressure Effects 0.000 description 1
- NSNHWTBQMQIDCF-UHFFFAOYSA-N dihydrate;hydrochloride Chemical compound O.O.Cl NSNHWTBQMQIDCF-UHFFFAOYSA-N 0.000 description 1
- VZMQWZVOXMCQKY-UHFFFAOYSA-L dimagnesium;octadecanoate Chemical compound [Mg+2].[Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O VZMQWZVOXMCQKY-UHFFFAOYSA-L 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 1
- UIEBECFSUGIJLK-UHFFFAOYSA-N ethyl 3-(4-benzamidopiperidin-1-yl)propanoate Chemical compound C(C)OC(=O)CCN1CCC(CC1)NC(C1=CC=CC=C1)=O UIEBECFSUGIJLK-UHFFFAOYSA-N 0.000 description 1
- FQTIYMRSUOADDK-UHFFFAOYSA-N ethyl 3-bromopropanoate Chemical compound CCOC(=O)CCBr FQTIYMRSUOADDK-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 229960004979 fampridine Drugs 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 238000007871 hydride transfer reaction Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- FYSSYOCJFZSKNW-UHFFFAOYSA-N hydron;naphthalen-1-ylhydrazine;chloride Chemical compound [Cl-].C1=CC=C2C(N[NH3+])=CC=CC2=C1 FYSSYOCJFZSKNW-UHFFFAOYSA-N 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 208000021822 hypotensive Diseases 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000013081 microcrystal Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- OSLLQJJYDQDLHJ-UHFFFAOYSA-N n-[1-(1,3-benzodioxol-5-ylmethyl)piperidin-4-yl]benzamide Chemical compound C1CN(CC=2C=C3OCOC3=CC=2)CCC1NC(=O)C1=CC=CC=C1 OSLLQJJYDQDLHJ-UHFFFAOYSA-N 0.000 description 1
- IWOASJMCFBFUFF-UHFFFAOYSA-N n-[1-(1-phenylbutan-2-yl)piperidin-4-yl]benzamide Chemical compound C1CC(NC(=O)C=2C=CC=CC=2)CCN1C(CC)CC1=CC=CC=C1 IWOASJMCFBFUFF-UHFFFAOYSA-N 0.000 description 1
- KTBWGGXVLCCQBG-UHFFFAOYSA-N n-[1-(1-phenylpropan-2-yl)piperidin-4-yl]benzamide Chemical compound C1CC(NC(=O)C=2C=CC=CC=2)CCN1C(C)CC1=CC=CC=C1 KTBWGGXVLCCQBG-UHFFFAOYSA-N 0.000 description 1
- WDFNEZORUZGMFR-UHFFFAOYSA-N n-[1-(2-cyclohexylethyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(CC1)CCN1CCC1CCCCC1 WDFNEZORUZGMFR-UHFFFAOYSA-N 0.000 description 1
- ZHEUHTXEJVQYSU-UHFFFAOYSA-N n-[1-(2-cyclopentylethyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(CC1)CCN1CCC1CCCC1 ZHEUHTXEJVQYSU-UHFFFAOYSA-N 0.000 description 1
- RMVICHLBWNSMIG-UHFFFAOYSA-N n-[1-(2-hydroxy-2-phenylethyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(O)CN(CC1)CCC1NC(=O)C1=CC=CC=C1 RMVICHLBWNSMIG-UHFFFAOYSA-N 0.000 description 1
- JZYFHKXXPAAKLT-UHFFFAOYSA-N n-[1-(2-hydroxy-3-naphthalen-1-yloxypropyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC2=CC=CC=C2C=1OCC(O)CN(CC1)CCC1NC(=O)C1=CC=CC=C1 JZYFHKXXPAAKLT-UHFFFAOYSA-N 0.000 description 1
- HLTSUIQKDFBZMY-UHFFFAOYSA-N n-[1-(2-phenylbutyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(CC)CN(CC1)CCC1NC(=O)C1=CC=CC=C1 HLTSUIQKDFBZMY-UHFFFAOYSA-N 0.000 description 1
- WUNYEVZKOWMZPJ-UHFFFAOYSA-N n-[1-(2-phenylpropyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(C)CN(CC1)CCC1NC(=O)C1=CC=CC=C1 WUNYEVZKOWMZPJ-UHFFFAOYSA-N 0.000 description 1
- HYBUADNEYBDTFI-UHFFFAOYSA-N n-[1-(2-pyridin-4-ylethyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(CC1)CCN1CCC1=CC=NC=C1 HYBUADNEYBDTFI-UHFFFAOYSA-N 0.000 description 1
- YGYABKPFQDOQAU-UHFFFAOYSA-N n-[1-(3-naphthalen-1-yloxypropyl)piperidin-4-yl]benzamide Chemical compound C1CN(CCCOC=2C3=CC=CC=C3C=CC=2)CCC1NC(=O)C1=CC=CC=C1 YGYABKPFQDOQAU-UHFFFAOYSA-N 0.000 description 1
- FYPITWSQGQKDBS-UHFFFAOYSA-N n-[1-(3-naphthalen-2-yloxypropyl)piperidin-4-yl]benzamide Chemical compound C1CN(CCCOC=2C=C3C=CC=CC3=CC=2)CCC1NC(=O)C1=CC=CC=C1 FYPITWSQGQKDBS-UHFFFAOYSA-N 0.000 description 1
- FMUKUMPHPSNRDV-UHFFFAOYSA-N n-[1-(3-oxo-3-phenylpropyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)CCN(CC1)CCC1NC(=O)C1=CC=CC=C1 FMUKUMPHPSNRDV-UHFFFAOYSA-N 0.000 description 1
- XWWMUCCLWNBPFP-UHFFFAOYSA-N n-[1-(3-phenylbutan-2-yl)piperidin-4-yl]benzamide Chemical compound C1CC(NC(=O)C=2C=CC=CC=2)CCN1C(C)C(C)C1=CC=CC=C1 XWWMUCCLWNBPFP-UHFFFAOYSA-N 0.000 description 1
- OPORTZAGXXDZJJ-UHFFFAOYSA-N n-[1-(3-phenylpropyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(CC1)CCN1CCCC1=CC=CC=C1 OPORTZAGXXDZJJ-UHFFFAOYSA-N 0.000 description 1
- TZLRHEJWKZLWPE-UHFFFAOYSA-N n-[1-(4,4-diethoxybut-2-ynyl)piperidin-4-yl]benzamide Chemical compound C1CN(CC#CC(OCC)OCC)CCC1NC(=O)C1=CC=CC=C1 TZLRHEJWKZLWPE-UHFFFAOYSA-N 0.000 description 1
- MMHGAXNRLORWPW-UHFFFAOYSA-N n-[1-(4,4-diethoxybutyl)piperidin-4-yl]benzamide Chemical compound C1CN(CCCC(OCC)OCC)CCC1NC(=O)C1=CC=CC=C1 MMHGAXNRLORWPW-UHFFFAOYSA-N 0.000 description 1
- WSGHMOIYYVEDCZ-UHFFFAOYSA-N n-[1-(4-hydroxy-3-oxobutyl)piperidin-4-yl]benzamide Chemical compound C1CN(CCC(=O)CO)CCC1NC(=O)C1=CC=CC=C1 WSGHMOIYYVEDCZ-UHFFFAOYSA-N 0.000 description 1
- NGZAUSSKKHHKNA-UHFFFAOYSA-N n-[1-(4-naphthalen-2-yl-4-oxobutyl)piperidin-4-yl]benzamide Chemical compound C=1C=C2C=CC=CC2=CC=1C(=O)CCCN(CC1)CCC1NC(=O)C1=CC=CC=C1 NGZAUSSKKHHKNA-UHFFFAOYSA-N 0.000 description 1
- DRPPUBBFDGBHBJ-UHFFFAOYSA-N n-[1-(4-oxo-4-phenylbutyl)piperidin-4-yl]cyclohexanecarboxamide Chemical compound C1CCCCC1C(=O)NC(CC1)CCN1CCCC(=O)C1=CC=CC=C1 DRPPUBBFDGBHBJ-UHFFFAOYSA-N 0.000 description 1
- OISPDVJUGPLDDP-UHFFFAOYSA-N n-[1-(4-phenylbutyl)piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(CC1)CCN1CCCCC1=CC=CC=C1 OISPDVJUGPLDDP-UHFFFAOYSA-N 0.000 description 1
- UJGJBKNJDGNYGG-UHFFFAOYSA-N n-[1-[(5-acetamido-2-hydroxyphenyl)methyl]piperidin-4-yl]benzamide Chemical compound CC(=O)NC1=CC=C(O)C(CN2CCC(CC2)NC(=O)C=2C=CC=CC=2)=C1 UJGJBKNJDGNYGG-UHFFFAOYSA-N 0.000 description 1
- YQNAXWKYCRAJIG-UHFFFAOYSA-N n-[1-[2-(1,3-benzodioxol-5-yl)ethyl]piperidin-4-yl]benzamide Chemical compound C1CN(CCC=2C=C3OCOC3=CC=2)CCC1NC(=O)C1=CC=CC=C1 YQNAXWKYCRAJIG-UHFFFAOYSA-N 0.000 description 1
- VRBUABKNSJTKBG-UHFFFAOYSA-N n-[1-[2-(1h-benzo[g]indol-3-yl)ethyl]piperidin-4-yl]benzamide Chemical compound C1CN(CCC=2C3=C(C4=CC=CC=C4C=C3)NC=2)CCC1NC(=O)C1=CC=CC=C1 VRBUABKNSJTKBG-UHFFFAOYSA-N 0.000 description 1
- ZMWAZESLNXJTMF-UHFFFAOYSA-N n-[1-[2-(1h-imidazol-5-yl)ethyl]piperidin-4-yl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(CC1)CCN1CCC1=CNC=N1 ZMWAZESLNXJTMF-UHFFFAOYSA-N 0.000 description 1
- OUABLRUHVOJBPA-UHFFFAOYSA-N n-[1-[2-(2-aminophenyl)ethyl]piperidin-4-yl]benzamide Chemical compound NC1=CC=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 OUABLRUHVOJBPA-UHFFFAOYSA-N 0.000 description 1
- CZBNQXUFGZFLTR-UHFFFAOYSA-N n-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-yl]benzamide Chemical compound COC1=CC=CC=C1OCCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 CZBNQXUFGZFLTR-UHFFFAOYSA-N 0.000 description 1
- NFLBPXLGSUNKPY-UHFFFAOYSA-N n-[1-[2-(3,4,5-trimethoxyphenyl)ethyl]piperidin-4-yl]benzamide Chemical compound COC1=C(OC)C(OC)=CC(CCN2CCC(CC2)NC(=O)C=2C=CC=CC=2)=C1 NFLBPXLGSUNKPY-UHFFFAOYSA-N 0.000 description 1
- KXUNVVPAYNWVOA-UHFFFAOYSA-N n-[1-[2-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidin-4-yl]benzamide Chemical compound C=1C=C(Cl)C(Cl)=CC=1C(O)CN(CC1)CCC1NC(=O)C1=CC=CC=C1 KXUNVVPAYNWVOA-UHFFFAOYSA-N 0.000 description 1
- UTOROIDYJAIMSD-UHFFFAOYSA-N n-[1-[2-(3,4-dihydroxyphenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=C(O)C(O)=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 UTOROIDYJAIMSD-UHFFFAOYSA-N 0.000 description 1
- KFNDIQHBLCSZKE-UHFFFAOYSA-N n-[1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-yl]-1,3-benzodioxole-5-carboxamide Chemical compound C1=C(OC)C(OC)=CC=C1CCN1CCC(NC(=O)C=2C=C3OCOC3=CC=2)CC1 KFNDIQHBLCSZKE-UHFFFAOYSA-N 0.000 description 1
- JWBIPRXIQCSWFC-UHFFFAOYSA-N n-[1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-yl]acetamide Chemical compound C1=C(OC)C(OC)=CC=C1CCN1CCC(NC(C)=O)CC1 JWBIPRXIQCSWFC-UHFFFAOYSA-N 0.000 description 1
- LGBROUXOHMSSSW-UHFFFAOYSA-N n-[1-[2-(3,4-dimethoxyphenyl)ethyl]pyridin-1-ium-4-yl]acetamide;iodide Chemical compound [I-].C1=C(OC)C(OC)=CC=C1CC[N+]1=CC=C(NC(C)=O)C=C1 LGBROUXOHMSSSW-UHFFFAOYSA-N 0.000 description 1
- UWIJBSDELCGYMG-UHFFFAOYSA-N n-[1-[2-(3,4-dimethylphenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=C(C)C(C)=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 UWIJBSDELCGYMG-UHFFFAOYSA-N 0.000 description 1
- CJOPFYGBNBOMNK-UHFFFAOYSA-N n-[1-[2-(4-acetamidophenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=CC(NC(=O)C)=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 CJOPFYGBNBOMNK-UHFFFAOYSA-N 0.000 description 1
- JSEODGSYEAKZSA-UHFFFAOYSA-N n-[1-[2-(4-aminophenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=CC(N)=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 JSEODGSYEAKZSA-UHFFFAOYSA-N 0.000 description 1
- KAGGLPVNCFCHGG-UHFFFAOYSA-N n-[1-[2-(4-chlorophenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=CC(Cl)=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 KAGGLPVNCFCHGG-UHFFFAOYSA-N 0.000 description 1
- REGIQBRFDRFMKZ-UHFFFAOYSA-N n-[1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]benzamide Chemical compound C1=CC(OC)=CC=C1CCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 REGIQBRFDRFMKZ-UHFFFAOYSA-N 0.000 description 1
- LBFHYAVSLNRTPA-UHFFFAOYSA-N n-[1-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]piperidin-4-yl]benzamide Chemical compound C=1C=C2CCCCC2=CC=1C(=O)CN(CC1)CCC1NC(=O)C1=CC=CC=C1 LBFHYAVSLNRTPA-UHFFFAOYSA-N 0.000 description 1
- YOXZRTWIZLXWOJ-UHFFFAOYSA-N n-[1-[4-(2,4-dimethylphenyl)-4-oxobutyl]piperidin-4-yl]benzamide Chemical compound CC1=CC(C)=CC=C1C(=O)CCCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 YOXZRTWIZLXWOJ-UHFFFAOYSA-N 0.000 description 1
- IZGNNZJMDYUTHO-UHFFFAOYSA-N n-[1-[4-(4-bromophenyl)-4-oxobutyl]piperidin-4-yl]benzamide Chemical compound C1=CC(Br)=CC=C1C(=O)CCCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 IZGNNZJMDYUTHO-UHFFFAOYSA-N 0.000 description 1
- YNOKKGMRQZMPDA-UHFFFAOYSA-N n-[1-[4-(4-chlorophenyl)-4-oxobutyl]piperidin-4-yl]benzamide Chemical compound C1=CC(Cl)=CC=C1C(=O)CCCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 YNOKKGMRQZMPDA-UHFFFAOYSA-N 0.000 description 1
- AJVVAZFNUPMOTQ-UHFFFAOYSA-N n-[1-[4-(4-fluorophenyl)-4-hydroxybutyl]piperidin-4-yl]benzamide Chemical compound C=1C=C(F)C=CC=1C(O)CCCN(CC1)CCC1NC(=O)C1=CC=CC=C1 AJVVAZFNUPMOTQ-UHFFFAOYSA-N 0.000 description 1
- VNZMSFQOBHUXFH-UHFFFAOYSA-N n-[1-[4-(4-fluorophenyl)butyl]piperidin-4-yl]benzamide Chemical compound C1=CC(F)=CC=C1CCCCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 VNZMSFQOBHUXFH-UHFFFAOYSA-N 0.000 description 1
- VCQNDEODELTWDN-UHFFFAOYSA-N n-[1-[4-(4-methoxyphenyl)-4-oxobutyl]piperidin-4-yl]benzamide Chemical compound C1=CC(OC)=CC=C1C(=O)CCCN1CCC(NC(=O)C=2C=CC=CC=2)CC1 VCQNDEODELTWDN-UHFFFAOYSA-N 0.000 description 1
- KKTXMPSAXFNQGO-UHFFFAOYSA-N n-[1-[4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butyl]piperidin-4-yl]benzamide Chemical compound C=1C=C2CCCCC2=CC=1C(=O)CCCN(CC1)CCC1NC(=O)C1=CC=CC=C1 KKTXMPSAXFNQGO-UHFFFAOYSA-N 0.000 description 1
- XFIGZQXVMMSGEC-UHFFFAOYSA-N n-[1-methyl-1-(4-oxo-4-phenylbutyl)piperidin-1-ium-4-yl]benzamide;iodide Chemical compound [I-].C1CC(NC(=O)C=2C=CC=CC=2)CC[N+]1(C)CCCC(=O)C1=CC=CC=C1 XFIGZQXVMMSGEC-UHFFFAOYSA-N 0.000 description 1
- OQAKYHCGYGLHAZ-UHFFFAOYSA-N n-[4-(oxiran-2-ylmethoxy)phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1OCC1OC1 OQAKYHCGYGLHAZ-UHFFFAOYSA-N 0.000 description 1
- MNPZBYLCTOOFPY-UHFFFAOYSA-N n-piperidin-4-ylbenzamide;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C(=O)NC1CCNCC1 MNPZBYLCTOOFPY-UHFFFAOYSA-N 0.000 description 1
- BIJAWQUBRNHZGE-UHFFFAOYSA-N n-pyridin-4-ylacetamide Chemical compound CC(=O)NC1=CC=NC=C1 BIJAWQUBRNHZGE-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 239000012057 packaged powder Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- WRLGYAWRGXKSKG-UHFFFAOYSA-M phenobarbital sodium Chemical compound [Na+].C=1C=CC=CC=1C1(CC)C(=O)NC([O-])=NC1=O WRLGYAWRGXKSKG-UHFFFAOYSA-M 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- LWMPFIOTEAXAGV-UHFFFAOYSA-N piperidin-1-amine Chemical compound NN1CCCCC1 LWMPFIOTEAXAGV-UHFFFAOYSA-N 0.000 description 1
- 150000003053 piperidines Chemical class 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- MXXWOMGUGJBKIW-YPCIICBESA-N piperine Chemical compound C=1C=C2OCOC2=CC=1/C=C/C=C/C(=O)N1CCCCC1 MXXWOMGUGJBKIW-YPCIICBESA-N 0.000 description 1
- 229940075559 piperine Drugs 0.000 description 1
- WVWHRXVVAYXKDE-UHFFFAOYSA-N piperine Natural products O=C(C=CC=Cc1ccc2OCOc2c1)C3CCCCN3 WVWHRXVVAYXKDE-UHFFFAOYSA-N 0.000 description 1
- 235000019100 piperine Nutrition 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- DOKHEARVIDLSFF-UHFFFAOYSA-N prop-1-en-1-ol Chemical group CC=CO DOKHEARVIDLSFF-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 206010038464 renal hypertension Diseases 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- DAJSVUQLFFJUSX-UHFFFAOYSA-M sodium;dodecane-1-sulfonate Chemical compound [Na+].CCCCCCCCCCCCS([O-])(=O)=O DAJSVUQLFFJUSX-UHFFFAOYSA-M 0.000 description 1
- OTNVGWMVOULBFZ-UHFFFAOYSA-N sodium;hydrochloride Chemical compound [Na].Cl OTNVGWMVOULBFZ-UHFFFAOYSA-N 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 125000005650 substituted phenylene group Chemical group 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000035488 systolic blood pressure Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 1
- 239000008215 water for injection Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/75—Amino or imino radicals, acylated by carboxylic or carbonic acids, or by sulfur or nitrogen analogues thereof, e.g. carbamates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/50—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D333/52—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes
- C07D333/54—Benzo[b]thiophenes; Hydrogenated benzo[b]thiophenes with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
- C07D333/56—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4209070 | 1970-09-03 | ||
| GB3437671 | 1971-07-22 | ||
| US32368473A | 1973-01-15 | 1973-01-15 | |
| US524028A US3912741A (en) | 1970-09-03 | 1974-11-15 | 1-(Benzo{8 b{9 thienylalkyl)piperidines |
| US524161A US3917614A (en) | 1970-09-03 | 1974-11-15 | 1-Pyrrolyl alkylene-piperidines |
| US524027A US3907810A (en) | 1970-09-03 | 1974-11-15 | 1-Imidazolylalkylene-piperidines |
| US524030A US3910932A (en) | 1970-09-03 | 1974-11-15 | 1-Pyridylalkyl piperidines |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2144080A1 DE2144080A1 (de) | 1972-03-09 |
| DE2144080C2 true DE2144080C2 (de) | 1983-12-08 |
Family
ID=27562647
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2144080A Expired DE2144080C2 (de) | 1970-09-03 | 1971-09-02 | 4-Acylaminopiperidinderivate, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen, welche diese Verbindungen enthalten |
Country Status (11)
| Country | Link |
|---|---|
| US (4) | US3910932A (Direct) |
| AT (2) | AT316553B (Direct) |
| AU (1) | AU461209B2 (Direct) |
| BE (1) | BE772190A (Direct) |
| CA (1) | CA955252A (Direct) |
| CH (3) | CH593258A5 (Direct) |
| DE (1) | DE2144080C2 (Direct) |
| FR (1) | FR2105223B1 (Direct) |
| GB (1) | GB1345872A (Direct) |
| NL (1) | NL173954C (Direct) |
| SE (1) | SE402284B (Direct) |
Families Citing this family (50)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4046767A (en) * | 1970-09-03 | 1977-09-06 | John Wyeth & Brother Limited | Piperidino compounds |
| US4028365A (en) * | 1970-09-03 | 1977-06-07 | John Wyeth & Brother Limited | Benz[g]indolyl compounds |
| JPS5760335B2 (Direct) * | 1972-06-14 | 1982-12-18 | Sumitomo Chemical Co | |
| US4024147A (en) * | 1972-06-30 | 1977-05-17 | John Wyeth & Brother Limited | Heterocyclic compounds |
| US4061758A (en) * | 1972-06-30 | 1977-12-06 | John Wyeth & Brother Limited | Treating hypertension and central nervous system abnormalities |
| GB1459506A (en) * | 1974-02-18 | 1976-12-22 | Wyeth John & Brother Ltd | Piperidine derivatives |
| GB1593851A (en) * | 1976-10-27 | 1981-07-22 | Gallardo Antonio Sa | N-(4-piperidyl)-benzamides and pharmaceutical compositions containing them |
| GB1507462A (en) * | 1974-03-21 | 1978-04-12 | Gallardo Antonio Sa | N-heterocyclic substituted benzamides methods for their preparation and compositions containing them |
| DE2513136C3 (de) * | 1974-03-21 | 1981-04-30 | Anphar S.A., Madrid | N-(1-Benzylpiperid-4-yl)-benzamide, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate |
| US4069331A (en) * | 1974-05-16 | 1978-01-17 | Boehringer Ingelheim Gmbh | N-(p-fluorobenzoyl-n-propyl)-4-piperidylamides and salts thereof |
| GB1498884A (en) * | 1975-04-15 | 1978-01-25 | Wyeth John & Brother Ltd | Aminoacetamide-pyridyl-tetrahydropyridyl and-piperidyl derivatives |
| US4191683A (en) * | 1975-05-28 | 1980-03-04 | Ciba-Geigy Corporation | Derivatives of 4-aminopiperidine as stabilizers for polymers |
| US4027028A (en) * | 1975-11-10 | 1977-05-31 | Science Union Et Cie | Arylethers and pharmaceutical compositions |
| US4163789A (en) * | 1976-02-17 | 1979-08-07 | Anphar, S.A. | Anti-psychotic (cycloalkenylalkylpiperidino) benzamides |
| GB1574418A (en) * | 1976-11-16 | 1980-09-03 | Anphar Sa | Piperidine derivatives |
| GB1582239A (en) * | 1976-12-11 | 1981-01-07 | Wyeth John & Brother Ltd | Piperidin-4-yl ureas and thioureas |
| US4962115A (en) * | 1981-10-01 | 1990-10-09 | Janssen Pharmaceutica N.V. | Novel N-(3-hydroxy-4-piperidinyl)benzamide derivatives |
| FR2530632A1 (fr) * | 1982-07-26 | 1984-01-27 | Bouchara Emile | Nouveaux derives substitues du 2,5-diamino 1,4-diazole, leurs procedes de preparation et les compositions pharmaceutiques en renfermant |
| JPS6084281A (ja) * | 1983-09-14 | 1985-05-13 | Yoshitomi Pharmaceut Ind Ltd | 3−インド−ルカルボキサミド類 |
| JPS60123485A (ja) * | 1983-12-08 | 1985-07-02 | Yoshitomi Pharmaceut Ind Ltd | インド−ル−3−カルボキサミド誘導体 |
| JPS60142981A (ja) * | 1983-12-28 | 1985-07-29 | Yoshitomi Pharmaceut Ind Ltd | 3−インド−ルカルボキサミド誘導体 |
| US4569933A (en) * | 1984-04-13 | 1986-02-11 | Cornu Pierre Jean | Antihypertensive substituted derivatives of 2,5-diamino 1,4-diazole |
| ZA86171B (en) * | 1985-01-16 | 1986-08-27 | Hoffmann La Roche | Polycyclic salts |
| JP2832979B2 (ja) * | 1988-02-15 | 1998-12-09 | 武田薬品工業株式会社 | 不飽和カルボン酸アミド誘導体 |
| US5280032A (en) * | 1989-02-14 | 1994-01-18 | Toyama Chemical Co., Ltd. | 1,2-ethanediol derivative and salt thereof, process for producing the same, and cerebral function-improving agent comprising the same |
| US5070094A (en) * | 1989-09-05 | 1991-12-03 | G. D. Searle & Co. | N-benzyltropaneamides |
| US5053413A (en) * | 1989-09-05 | 1991-10-01 | G. D. Searle & Co. | N-benzylpiperidineisoindolinones |
| US5028616A (en) * | 1989-09-05 | 1991-07-02 | G. D. Searle & Co. | N-benzylpiperidine amides |
| US4992446A (en) * | 1989-09-05 | 1991-02-12 | G. D. Searle & Co. | Tricyclic quinolizine amides |
| US5098915A (en) * | 1989-09-05 | 1992-03-24 | G. D. Searle & Co. | Substituted N-benzylpiperidine amides |
| US5210090A (en) * | 1989-09-05 | 1993-05-11 | G. D. Searle & Co. | Substituted N-benzylpiperidine amides and cardiac regulatory compositions thereof |
| US6015819A (en) | 1992-11-13 | 2000-01-18 | Synaptic Pharmaceutical Corporation | Use of alpha-1C specific compounds to treat benign prostatic hyperplasia |
| US5403847A (en) * | 1992-11-13 | 1995-04-04 | Synaptic Pharmaceutical Corporation | Use of α1C specific compounds to treat benign prostatic hyperlasia |
| US5578611A (en) * | 1992-11-13 | 1996-11-26 | Synaptic Pharmaceutical Corporation | Use of α-1C specific compounds to treat benign prostatic hyperplasia |
| FI952450A7 (fi) * | 1992-11-20 | 1995-07-19 | Kaken Pharma Co Ltd | Asetamidijohdannainen |
| NZ523749A (en) | 2000-07-26 | 2005-03-24 | Smithkline Beecham P | Aminopiperidine quinolines and their azaisosteric analogues with antibacterial activity |
| FR2813306B1 (fr) * | 2000-08-23 | 2005-10-21 | Sanofi Synthelabo | Aminoalkybenzoyl-benzofurannes ou benzothiophenes, leur procede de preparation et les compositions les contenant |
| GB0101577D0 (en) | 2001-01-22 | 2001-03-07 | Smithkline Beecham Plc | Compounds |
| US7312212B2 (en) | 2002-01-29 | 2007-12-25 | Glaxo Group Limited | Aminopiperidine derivatives |
| WO2003064431A2 (en) | 2002-01-29 | 2003-08-07 | Glaxo Group Limited | Aminopiperidine compounds, process for their preparation, and pharmaceutical compositions containing them |
| AU2003218737B2 (en) | 2002-03-13 | 2008-04-10 | Janssen Pharmaceutica N.V. | Inhibitors of histone deacetylase |
| EA007270B1 (ru) | 2002-03-13 | 2006-08-25 | Янссен Фармацевтика Н.В. | Пиперазинил-, пиперидинил- и морфолинилпроизводные как новые ингибиторы гистондеацетилазы |
| CA2476067C (en) * | 2002-03-13 | 2011-09-20 | Janssen Pharmaceutica N.V. | Carbonylamino-derivatives as novel inhibitors of histone deacetylase |
| ES2306880T3 (es) | 2002-03-13 | 2008-11-16 | Janssen Pharmaceutica Nv | Derivados de sulfonilamino como inhibidores novedosos de la histona desacetilasa. |
| PL1781639T3 (pl) | 2004-07-28 | 2012-07-31 | Janssen Pharmaceutica Nv | Podstawione pochodne indolilo-alkiloaminowe jako nowe inhibitory deacetylazy histonowej |
| AU2006248938B2 (en) | 2005-05-18 | 2011-09-29 | Janssen Pharmaceutica N.V. | Substituted aminopropenyl piperidine or morpholine derivatives as novel inhibitors of histone deacetylase |
| US8101616B2 (en) | 2006-01-19 | 2012-01-24 | Janssen Pharmaceutica N.V. | Pyridine and pyrimidine derivatives as inhibitors of histone deacetylase |
| JP5247470B2 (ja) | 2006-01-19 | 2013-07-24 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | ヒストンデアセチラーゼのインヒビターとしてのピリジン及びピリミジン誘導体 |
| DE602007001190D1 (de) | 2006-01-19 | 2009-07-09 | Janssen Pharmaceutica Nv | Aminophenylderivate als neue inhibitoren von histondeacetylase |
| CA2635015C (en) | 2006-01-19 | 2014-06-03 | Janssen Pharmaceutica N.V. | Substituted indolyl-alkyl-amino-derivatives as inhibitors of histone deacetylase |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH437305A (de) * | 1963-07-03 | 1967-06-15 | Hoffmann La Roche | Verfahren zur Herstellung von substituierten Benzoesäureamiden |
| GB1221061A (en) * | 1967-01-18 | 1971-02-03 | May & Baker Ltd | Quaternary ammonium derivatives, their use as anthelmintics and methods for their preparation |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL267843A (Direct) * | 1960-08-03 | |||
| GB1154744A (en) * | 1966-05-17 | 1969-06-11 | Whitefin Holding Sa | Disubstituted Aminoethanols |
| US3855242A (en) * | 1967-12-15 | 1974-12-17 | Aspro Nicholas Ltd | Benzo{8 b{9 thienyl-alkyl-guanidines |
| DE2060816C3 (de) * | 1970-12-10 | 1980-09-04 | Merck Patent Gmbh, 6100 Darmstadt | 4-Phenylpiperidinderivate Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen enthaltend diese Verbindungen |
-
1970
- 1970-09-03 GB GB4209070A patent/GB1345872A/en not_active Expired
-
1971
- 1971-08-31 CA CA121,748A patent/CA955252A/en not_active Expired
- 1971-08-31 CH CH1280971A patent/CH593258A5/xx not_active IP Right Cessation
- 1971-08-31 CH CH1670775A patent/CH598218A5/xx not_active IP Right Cessation
- 1971-09-01 AT AT297873A patent/AT316553B/de not_active IP Right Cessation
- 1971-09-01 AT AT760671A patent/AT319239B/de not_active IP Right Cessation
- 1971-09-02 DE DE2144080A patent/DE2144080C2/de not_active Expired
- 1971-09-02 AU AU33005/71A patent/AU461209B2/en not_active Expired
- 1971-09-02 FR FR7131823A patent/FR2105223B1/fr not_active Expired
- 1971-09-03 BE BE772190A patent/BE772190A/xx not_active IP Right Cessation
- 1971-09-03 SE SE7111236A patent/SE402284B/xx unknown
- 1971-09-03 NL NLAANVRAGE7112176,A patent/NL173954C/xx not_active IP Right Cessation
-
1974
- 1974-11-15 US US524030A patent/US3910932A/en not_active Expired - Lifetime
- 1974-11-15 US US524161A patent/US3917614A/en not_active Expired - Lifetime
- 1974-11-15 US US524028A patent/US3912741A/en not_active Expired - Lifetime
- 1974-11-15 US US524027A patent/US3907810A/en not_active Expired - Lifetime
-
1975
- 1975-08-31 CH CH1670875A patent/CH598219A5/xx not_active IP Right Cessation
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH437305A (de) * | 1963-07-03 | 1967-06-15 | Hoffmann La Roche | Verfahren zur Herstellung von substituierten Benzoesäureamiden |
| GB1221061A (en) * | 1967-01-18 | 1971-02-03 | May & Baker Ltd | Quaternary ammonium derivatives, their use as anthelmintics and methods for their preparation |
Non-Patent Citations (2)
| Title |
|---|
| US-Z: J.Med.Chem. 7, 1964, 729 * |
| US-Z: J.Org.Chem. 26, 1961, 2740 * |
Also Published As
| Publication number | Publication date |
|---|---|
| CH598218A5 (Direct) | 1978-04-28 |
| AT316553B (de) | 1974-07-25 |
| SE402284B (sv) | 1978-06-26 |
| CA955252A (en) | 1974-09-24 |
| FR2105223A1 (Direct) | 1972-04-28 |
| BE772190A (fr) | 1972-01-17 |
| NL173954C (nl) | 1984-04-02 |
| AU3300571A (en) | 1973-03-08 |
| NL7112176A (Direct) | 1972-03-07 |
| CH598219A5 (Direct) | 1978-04-28 |
| US3912741A (en) | 1975-10-14 |
| US3910932A (en) | 1975-10-07 |
| US3917614A (en) | 1975-11-04 |
| AU461209B2 (en) | 1975-05-22 |
| FR2105223B1 (Direct) | 1975-10-10 |
| US3907810A (en) | 1975-09-23 |
| NL173954B (nl) | 1983-11-01 |
| DE2144080A1 (de) | 1972-03-09 |
| AT319239B (de) | 1974-12-10 |
| GB1345872A (en) | 1974-02-06 |
| CH593258A5 (Direct) | 1977-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1770460C3 (de) | In 3-Stellung durch einen heterocyclisch substituierten Alkyl- oder Acylrest substituierte bleiverbindungen und Verfahren zu ihrer Herstellung | |
| DE2144080A1 (de) | Heterocyclische Verbindungen, Verfahren zu ihrer Herstellung und ihrer Verwendung | |
| DE69103206T2 (de) | Neue Derivate des Aminopiperidins, Aminopyrrolidins und des Aminoperhydroazepins, Verfahren zur Herstellung und diese enthaltende Arzneimittel. | |
| DE60222248T2 (de) | Aminomethylgruppen enthaltende n-(arylsulfonyl)beta-aminosäure-derivate, verfahren zu deren herstellung sowie deren pharmazeutische zubereitungen | |
| DE1930818C3 (de) | 1-Substituierte 3- oder 4-Aroylpiperidine, Verfahren zu deren Herstellung und ihre Verwendung | |
| DE3781845T2 (de) | Benzimidazol-derivate. | |
| DE69130597T2 (de) | Arylalkylamine, Verfahren zur Herstellung und diese enthaltende Arzneimittel | |
| DE2705446C2 (Direct) | ||
| KR850000630B1 (ko) | 피페리딘 유도체의 제조방법 | |
| DE3889133T2 (de) | N-Heterocyclische N-(4-Piperidyl)-amide. | |
| US4029801A (en) | Pharmaceutical compositions and methods of treating hypertension | |
| DE2941880A1 (de) | Diphenylbutyl-piperazincarboxamide und diese enthaltende arzneimittel | |
| DE2513916A1 (de) | Substituierte benzamide | |
| DE19955794A1 (de) | Pyrrolidin-Derivate-CCR-3-Rezeptor-Antagonisten | |
| DE69838662T2 (de) | Morphinanderivate und ihre medizinische Anwendung | |
| DE19837386A1 (de) | CCR-3-Rezeptorantagonisten | |
| DE2302717A1 (de) | Heterocyclische verbindungen | |
| DE2157424A1 (de) | N,n'-disubstituierte cyclische diamine und verfahren zu deren herstellung | |
| US3117128A (en) | Certificate of correction | |
| DE2341965A1 (de) | N- eckige klammer auf 1-(omegaphenylalkyl)-piperidyl-4 eckige klammer zu -n-(alpha-pyridyl)-carbonsaeureamide, deren saeureadditionssalze, verfahren zu deren herstellung, sowie deren verwendung als arzneimittel | |
| DE69530988T2 (de) | Benzimidazolderivate mit dopaminerger wirkung | |
| DE1445603A1 (de) | Verfahren zur Herstellung von neuen Oxadiazolderivaten | |
| DE1445904A1 (de) | Verfahren zur Herstellung von 4-Imidazolidon-Verbindungen | |
| DE3109794A1 (de) | "bluthochdruck senkende amine" | |
| DE2719211A1 (de) | Arylalkylpiperidine, verfahren zu ihrer herstellung und sie enthaltende arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8125 | Change of the main classification |
Ipc: C07D211/58 |
|
| 8126 | Change of the secondary classification |
Free format text: C07D401/06 C07D401/12 C07D405/06 C07D405/12 C07D409/06 C07D409/12 A61K 31/445 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. DR.JUR. DR.RER.NAT. MARX, L., DIPL.-PHYS. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |