DE2138691A1 - Verfahren zur Herstellung von tertiär Butylaten - Google Patents
Verfahren zur Herstellung von tertiär ButylatenInfo
- Publication number
- DE2138691A1 DE2138691A1 DE19712138691 DE2138691A DE2138691A1 DE 2138691 A1 DE2138691 A1 DE 2138691A1 DE 19712138691 DE19712138691 DE 19712138691 DE 2138691 A DE2138691 A DE 2138691A DE 2138691 A1 DE2138691 A1 DE 2138691A1
- Authority
- DE
- Germany
- Prior art keywords
- metal
- mol
- reaction
- metal alcoholate
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 23
- 238000004519 manufacturing process Methods 0.000 title description 2
- 229910052751 metal Inorganic materials 0.000 claims description 36
- 239000002184 metal Substances 0.000 claims description 36
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 26
- 239000002904 solvent Substances 0.000 claims description 18
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 238000010992 reflux Methods 0.000 claims description 14
- 239000010955 niobium Substances 0.000 claims description 9
- 230000007717 exclusion Effects 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 6
- 239000000470 constituent Substances 0.000 claims description 6
- 229910052758 niobium Inorganic materials 0.000 claims description 6
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 6
- 230000000737 periodic effect Effects 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 229910052715 tantalum Inorganic materials 0.000 claims description 5
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 5
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 5
- 229910052721 tungsten Inorganic materials 0.000 claims description 5
- 239000010937 tungsten Substances 0.000 claims description 5
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 229910052735 hafnium Inorganic materials 0.000 claims description 3
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011733 molybdenum Substances 0.000 claims description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 2
- -1 alkyl radical Chemical group 0.000 claims description 2
- 239000012298 atmosphere Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 230000001681 protective effect Effects 0.000 claims description 2
- 239000010936 titanium Substances 0.000 claims description 2
- 229910052719 titanium Inorganic materials 0.000 claims description 2
- 229910052726 zirconium Inorganic materials 0.000 claims description 2
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims 1
- 230000035484 reaction time Effects 0.000 claims 1
- 239000003921 oil Substances 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- 239000012299 nitrogen atmosphere Substances 0.000 description 12
- 239000000047 product Substances 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- GRWPYGBKJYICOO-UHFFFAOYSA-N 2-methylpropan-2-olate;titanium(4+) Chemical compound [Ti+4].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-] GRWPYGBKJYICOO-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 229910001510 metal chloride Inorganic materials 0.000 description 3
- 239000003039 volatile agent Substances 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- SDTMFDGELKWGFT-UHFFFAOYSA-N 2-methylpropan-2-olate Chemical compound CC(C)(C)[O-] SDTMFDGELKWGFT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229910007926 ZrCl Inorganic materials 0.000 description 1
- PYFJJKOGSXZRNV-UHFFFAOYSA-N [W+6].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-] Chemical compound [W+6].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-].CC(C)(C)[O-] PYFJJKOGSXZRNV-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 150000001934 cyclohexanes Chemical class 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- LMHHRCOWPQNFTF-UHFFFAOYSA-N s-propan-2-yl azepane-1-carbothioate Chemical compound CC(C)SC(=O)N1CCCCCC1 LMHHRCOWPQNFTF-UHFFFAOYSA-N 0.000 description 1
- 239000000779 smoke Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C31/00—Saturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C31/28—Metal alcoholates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/68—Preparation of metal alcoholates
- C07C29/70—Preparation of metal alcoholates by converting hydroxy groups to O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1203070A CH536323A (de) | 1970-08-11 | 1970-08-11 | Verfahren zur Herstellung von tertiär-Butylaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2138691A1 true DE2138691A1 (de) | 1972-02-17 |
Family
ID=4379195
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712138691 Pending DE2138691A1 (de) | 1970-08-11 | 1971-08-03 | Verfahren zur Herstellung von tertiär Butylaten |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3772355A (enExample) |
| AT (1) | AT304575B (enExample) |
| BE (1) | BE771169A (enExample) |
| BR (1) | BR7105136D0 (enExample) |
| CH (1) | CH536323A (enExample) |
| CS (1) | CS154333B2 (enExample) |
| DE (1) | DE2138691A1 (enExample) |
| FR (1) | FR2104202A5 (enExample) |
| GB (1) | GB1310773A (enExample) |
| IL (1) | IL37424A (enExample) |
| NL (1) | NL7111012A (enExample) |
| PL (1) | PL71620B1 (enExample) |
| SU (1) | SU402202A3 (enExample) |
| ZA (1) | ZA715182B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3723713A1 (de) * | 1987-07-17 | 1989-01-26 | Huels Troisdorf | Alkoholfreie orthoester des zirkoniums und hafniums und verfahren zu deren herstellung |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3946056A (en) * | 1974-07-26 | 1976-03-23 | Owens-Illinois, Inc. | Method for producing stannic tertiary alkoxide |
| US4014911A (en) * | 1975-10-16 | 1977-03-29 | Stauffer Chemical Company | Method for preparing ethyl vanadate |
| US4014912A (en) * | 1975-10-16 | 1977-03-29 | Stauffer Chemical Company | Method for preparing organic vanadates |
| US4412956A (en) * | 1981-07-27 | 1983-11-01 | Stauffer Chemical Company | Process for forming alkyl vanadates using a catalyst |
| US4623738A (en) | 1985-04-22 | 1986-11-18 | Kenrich Petrochemicals, Inc. | Neoalkoxy organo-titanates and organo-zirconates useful as coupling and polymer processing agents |
| US4600789A (en) * | 1984-05-14 | 1986-07-15 | Kenrich Petrochemicals, Inc. | Neoalkoxy organo-titanate useful as coupling and polymer processing agents |
| US4568703A (en) * | 1984-07-27 | 1986-02-04 | Bp Chemicals Limited | Process for the production of polymers containing isocyanurate and or oxazolidone linkages |
| DE3522904A1 (de) * | 1985-06-27 | 1987-01-08 | Dynamit Nobel Ag | Verfahren zur herstellung von orthoestern des titans, zirkons oder hafniums |
| US4739086A (en) * | 1986-09-30 | 1988-04-19 | Ethyl Corporation | Production of organic vanadates |
| US7569285B2 (en) * | 1996-10-17 | 2009-08-04 | The Trustees Of Princeton University | Enhanced bonding layers on titanium materials |
| US7815963B2 (en) * | 1996-10-17 | 2010-10-19 | The Trustees Of Princeton University | Enhanced bonding layers on titanium materials |
| US6645644B1 (en) | 1996-10-17 | 2003-11-11 | The Trustees Of Princeton University | Enhanced bonding of phosphoric and phosphoric acids to oxidized substrates |
| US7396594B2 (en) * | 2002-06-24 | 2008-07-08 | The Trustees Of Princeton University | Carrier applied coating layers |
| US7507483B2 (en) * | 1997-02-04 | 2009-03-24 | Jeffrey Schwartz | Enhanced bonding layers on native oxide surfaces |
| US6146767A (en) * | 1996-10-17 | 2000-11-14 | The Trustees Of Princeton University | Self-assembled organic monolayers |
| US20060194008A1 (en) * | 1999-09-22 | 2006-08-31 | Princeton University | Devices with multiple surface functionality |
| JP2006517463A (ja) * | 2003-02-11 | 2006-07-27 | プリンストン ユニヴァーシティ | 表面に結合した、有機酸を用いた単分子層 |
| US7067169B2 (en) * | 2003-06-04 | 2006-06-27 | Chemat Technology Inc. | Coated implants and methods of coating |
| CA2629600C (en) | 2005-11-14 | 2011-11-01 | Biomet 3I, Inc. | Deposition of discrete nanoparticles on an implant surface |
| WO2009097218A1 (en) | 2008-01-28 | 2009-08-06 | Biomet 3I, Llc | Implant surface with increased hydrophilicity |
| US8641418B2 (en) | 2010-03-29 | 2014-02-04 | Biomet 3I, Llc | Titanium nano-scale etching on an implant surface |
| ES2671740T3 (es) | 2012-03-20 | 2018-06-08 | Biomet 3I, Llc | Superficie de tratamiento para una superficie de implante |
-
1970
- 1970-08-11 CH CH1203070A patent/CH536323A/de not_active IP Right Cessation
-
1971
- 1971-08-02 IL IL37424A patent/IL37424A/xx unknown
- 1971-08-03 DE DE19712138691 patent/DE2138691A1/de active Pending
- 1971-08-03 ZA ZA715182A patent/ZA715182B/xx unknown
- 1971-08-04 GB GB3663971A patent/GB1310773A/en not_active Expired
- 1971-08-06 US US00169837A patent/US3772355A/en not_active Expired - Lifetime
- 1971-08-09 AT AT693771A patent/AT304575B/de active
- 1971-08-09 PL PL1971149934A patent/PL71620B1/xx unknown
- 1971-08-09 SU SU1694919A patent/SU402202A3/ru active
- 1971-08-10 NL NL7111012A patent/NL7111012A/xx unknown
- 1971-08-10 CS CS580671A patent/CS154333B2/cs unknown
- 1971-08-10 FR FR7129280A patent/FR2104202A5/fr not_active Expired
- 1971-08-10 BR BR5136/71A patent/BR7105136D0/pt unknown
- 1971-08-11 BE BE771169A patent/BE771169A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3723713A1 (de) * | 1987-07-17 | 1989-01-26 | Huels Troisdorf | Alkoholfreie orthoester des zirkoniums und hafniums und verfahren zu deren herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| CH536323A (de) | 1973-04-30 |
| NL7111012A (enExample) | 1972-02-15 |
| CS154333B2 (enExample) | 1974-03-29 |
| IL37424A (en) | 1974-11-29 |
| BR7105136D0 (pt) | 1973-05-08 |
| IL37424A0 (en) | 1971-11-29 |
| AT304575B (de) | 1973-01-10 |
| GB1310773A (en) | 1973-03-21 |
| BE771169A (fr) | 1972-02-11 |
| PL71620B1 (enExample) | 1974-06-29 |
| FR2104202A5 (enExample) | 1972-04-14 |
| US3772355A (en) | 1973-11-13 |
| ZA715182B (en) | 1972-04-26 |
| SU402202A3 (enExample) | 1973-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2138691A1 (de) | Verfahren zur Herstellung von tertiär Butylaten | |
| DE69425176T2 (de) | Verfahren zur Herstellung von Alkylimidazolidone Acrylate | |
| DE2725255A1 (de) | Verfahren zur herstellung von dimethylaminoaethylmethacrylat | |
| DE69132113T2 (de) | Verfahren zum Aushärten eines Harzes | |
| DE3404949C1 (de) | Wasserloesliche Zirkonsaeureester | |
| DE2165302A1 (de) | Mittel zur Verminderung der Transpiration | |
| DE1249263B (de) | Verfah ren zur Herstellung vor substituierten 1,3 Dioxocyclopentanderivaten | |
| DE2439947A1 (de) | Verfahren zur herstellung von antimonglykoloxyd | |
| DE1618861B2 (de) | Verfahren zur herstellung von ungesaettigten esteralkoholen | |
| EP0092702B1 (de) | Verfahren zur Herstellung eines mit Wasser verdünnbaren, wärmehärtbaren, mit organischen Polyolen modifizierten Organopolysiloxans | |
| DE1668365A1 (de) | Keten-trialkylsilyl-acetale und Verfahren zu ihrer Herstellung | |
| DE2812365A1 (de) | Verfahren zur herstellung von estern von m-phenoxybenzylalkohol und von alpha- cyano- und alpha-aethinylderivaten davon mit carbonsaeuren | |
| DE2154439C3 (de) | Verfahren zur Herstellung von substituierten Delta alpha, beta-Butenoliden durch Cyclisierung von 4-Acyloxybuten-2 -Säureestern | |
| DE969174C (de) | Verfahren zur Herstellung von als Weichmacher fuer Phenoplaste und Cellulosederivate geeigneten Estern | |
| AT201860B (de) | Verfahren zur Herstellung aluminiumhaltiger Kunstharze | |
| DE2826495A1 (de) | Bis-hydroxy-diester von hydroxypivalylhydroxypivalat sowie ihre herstellung und verwendung | |
| DE743075C (de) | Verfahren zur Herstellung von Verbindungen der Tetrahydropyranreihe | |
| DE911371C (de) | Verfahren zur Herstellung von Estern der Bis-[4-oxycumarinyl-(3)]-essigsaeure | |
| DE968544C (de) | Verfahren zur Herstellung von Polyestern | |
| EP0045414B1 (de) | Verfahren zur Herstellung von 3-Amino-1-phenylpyrazol-5-on | |
| DE2149709A1 (de) | Neue-Triol-Verbindung,Verfahren zu deren Herstellung sowie deren Anwendung | |
| CH344562A (de) | Verfahren zur Herstellung aluminiumhaltiger Kunstharze | |
| DE1127888B (de) | Verfahren zur Herstellung von Vinylestern hoeherer Carbonsaeuren | |
| DE3441369A1 (de) | Verfahren zur herstellung von hydroxymethylen-alkoxyessigsaeureestern | |
| DE2658955A1 (de) | Verfahren zur herstellung eines vernetzerkomponentengemisches fuer dispersions-anstrichstoffe und -kleber |