DE2132153A1 - Rechteckfoermiges Behaeltnis bzw.Schaukasten,Vitrine od.dgl. - Google Patents
Rechteckfoermiges Behaeltnis bzw.Schaukasten,Vitrine od.dgl.Info
- Publication number
- DE2132153A1 DE2132153A1 DE19712132153 DE2132153A DE2132153A1 DE 2132153 A1 DE2132153 A1 DE 2132153A1 DE 19712132153 DE19712132153 DE 19712132153 DE 2132153 A DE2132153 A DE 2132153A DE 2132153 A1 DE2132153 A1 DE 2132153A1
- Authority
- DE
- Germany
- Prior art keywords
- corners
- frame parts
- frame
- room
- parts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000010276 construction Methods 0.000 claims description 19
- 239000003292 glue Substances 0.000 claims description 2
- 239000000463 material Substances 0.000 description 5
- 239000011521 glass Substances 0.000 description 4
- 238000007789 sealing Methods 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 240000007817 Olea europaea Species 0.000 description 1
- 238000013475 authorization Methods 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 238000007688 edging Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000010437 gem Substances 0.000 description 1
- 239000011121 hardwood Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 239000011120 plywood Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47F—SPECIAL FURNITURE, FITTINGS, OR ACCESSORIES FOR SHOPS, STOREHOUSES, BARS, RESTAURANTS OR THE LIKE; PAYING COUNTERS
- A47F3/00—Show cases or show cabinets
- A47F3/005—Show cases or show cabinets with glass panels
Landscapes
- Freezers Or Refrigerated Showcases (AREA)
- Furniture Connections (AREA)
- Display Racks (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AUPA167970 | 1970-06-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2132153A1 true DE2132153A1 (de) | 1972-01-05 |
Family
ID=3764666
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712132153 Pending DE2132153A1 (de) | 1970-06-30 | 1971-06-29 | Rechteckfoermiges Behaeltnis bzw.Schaukasten,Vitrine od.dgl. |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS5127120B1 (enExample) |
| CA (1) | CA947804A (enExample) |
| DE (1) | DE2132153A1 (enExample) |
| FR (1) | FR2100069A5 (enExample) |
| GB (1) | GB1319736A (enExample) |
| ZA (1) | ZA714083B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4572593A (en) * | 1984-06-12 | 1986-02-25 | Daisuke Takamizawa | Display case |
| US5120116A (en) * | 1989-07-17 | 1992-06-09 | Amstore Corporation | Lighted display case |
| US5524977A (en) * | 1995-02-24 | 1996-06-11 | Orawski; Walter | Security display case |
| US5549372A (en) * | 1995-03-10 | 1996-08-27 | Lewis; Michael W. | Skill crane cabinet |
| US9681560B2 (en) * | 2013-04-07 | 2017-06-13 | Huawei Technologies Co., Ltd. | Cabinet and cabinet group including the same |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU534061B2 (en) * | 1980-02-29 | 1984-01-05 | Clive Investments Pty. Ltd. | Showcase assembly |
| SE432189B (sv) * | 1982-08-19 | 1984-03-26 | Ifoe Sanitaer Ab | Anordning vid duschvegg anordning vid duschvegg |
| AU569932B2 (en) * | 1983-12-23 | 1988-02-25 | Clive Investments Pty. Ltd. | Showcase |
| GB2179204B (en) * | 1985-08-16 | 1989-02-15 | John Arthur Dudley | Boxes for electrical circuits |
| GB2186185A (en) * | 1986-02-12 | 1987-08-12 | Alistair Baxter | Display cases |
| DE3726631A1 (de) * | 1987-08-11 | 1989-02-23 | Guenter Smitka | Eckverbinder, profilstange sowie eckverbindung |
| FR2639523B1 (fr) * | 1988-11-30 | 1991-04-05 | Vattier Claude | Meuble a ossature metallique |
| GB2287642B (en) * | 1994-03-17 | 1997-10-29 | John Joseph Devuyst | Modular box-like framework |
| GB2354426B (en) * | 1999-09-25 | 2004-03-24 | Netherfield Visual Ltd | Side wall mounting for a showcase |
| CN112617452B (zh) * | 2020-12-22 | 2022-04-01 | 常州绘了么信息科技有限公司 | 一种可拆卸心理辅导书籍展示柜 |
-
1971
- 1971-06-21 GB GB2901671A patent/GB1319736A/en not_active Expired
- 1971-06-22 ZA ZA714083A patent/ZA714083B/xx unknown
- 1971-06-24 CA CA116,514A patent/CA947804A/en not_active Expired
- 1971-06-28 JP JP46046389A patent/JPS5127120B1/ja active Pending
- 1971-06-29 DE DE19712132153 patent/DE2132153A1/de active Pending
- 1971-06-30 FR FR7123871A patent/FR2100069A5/fr not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4572593A (en) * | 1984-06-12 | 1986-02-25 | Daisuke Takamizawa | Display case |
| US5120116A (en) * | 1989-07-17 | 1992-06-09 | Amstore Corporation | Lighted display case |
| US5524977A (en) * | 1995-02-24 | 1996-06-11 | Orawski; Walter | Security display case |
| US5549372A (en) * | 1995-03-10 | 1996-08-27 | Lewis; Michael W. | Skill crane cabinet |
| US9681560B2 (en) * | 2013-04-07 | 2017-06-13 | Huawei Technologies Co., Ltd. | Cabinet and cabinet group including the same |
Also Published As
| Publication number | Publication date |
|---|---|
| CA947804A (en) | 1974-05-21 |
| ZA714083B (en) | 1972-02-23 |
| FR2100069A5 (enExample) | 1972-03-17 |
| JPS5127120B1 (enExample) | 1976-08-10 |
| GB1319736A (en) | 1973-06-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3200310C2 (de) | Gestell aus mehreren Profilstäben | |
| DE2132153A1 (de) | Rechteckfoermiges Behaeltnis bzw.Schaukasten,Vitrine od.dgl. | |
| DE2031120A1 (de) | Vitrine mit Schiebetür | |
| DE2350343A1 (de) | Moebeleinheit zum aufstellen in einer rechtwinkligen ecke eines raumes | |
| DE1429495A1 (de) | Anordnung zum Tragen von Platten u.dgl. | |
| DE202017101158U1 (de) | Regal | |
| DE1778336C3 (de) | Möbelsystem für den Zusammenbau von Kastenmöbeln | |
| DE2230213A1 (de) | Zusammensetzbarer schauschrank fuer die ausstellung von gegenstaenden im allgemeinen | |
| DE3106103A1 (de) | Traeger fuer regalboeden, insbesondere fuer den ladenbau | |
| DE1286721B (de) | Regal | |
| DE3100176C2 (de) | Eckstück für die Halterung einer Glasscheibe | |
| WO2019228658A1 (de) | Präsentationssystem | |
| DE8310661U1 (de) | Polygonaler pflanzbehaelter mit verkleidung | |
| DE930544C (de) | Loesbarer Eckbeschlag, insbesondere fuer den Vitrinenbau | |
| DE817191C (de) | Rahmenleiste | |
| DE2113862A1 (de) | Abnehmbares Wandelement | |
| DE1810224A1 (de) | Kunststoffprofilrahmen fuer Tueren,Fenster od.dgl.mit von der Waermeausdehnung des Kunststoffs unabhaengiger Scharnierbefestigung | |
| DE1941797U (de) | Nach dem baukastenprinzip aus vorgefertigten, in massen hergestellten elementen zusammengesetzter kuechenmoebelsatz. | |
| DE577279C (de) | Schrank | |
| DE1561616C (de) | Zerlegbare Vitrine, insbesondere fur Ausstellungszwecke | |
| DE202004007841U1 (de) | Aufbau für eine Glastrennwand | |
| DE7905257U1 (de) | Zerlegbares raumelement | |
| AT231134B (de) | Schienenförmiges Bauelement | |
| AT244044B (de) | Profilrahmen zur Aufnahme von Scheiben, Platten od. dgl. | |
| DE2146643C3 (de) | Trennwand, insbesondere für Abteile in Eisenbahnpersonenwagen |