DE2124124C - - Google Patents
Info
- Publication number
- DE2124124C DE2124124C DE19712124124 DE2124124A DE2124124C DE 2124124 C DE2124124 C DE 2124124C DE 19712124124 DE19712124124 DE 19712124124 DE 2124124 A DE2124124 A DE 2124124A DE 2124124 C DE2124124 C DE 2124124C
- Authority
- DE
- Germany
- Prior art keywords
- cyclohexane
- soluble
- reaction medium
- oxidation
- cyclohexanone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 claims description 13
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 239000003054 catalyst Substances 0.000 claims description 7
- 230000003647 oxidation Effects 0.000 claims description 7
- 238000007254 oxidation reaction Methods 0.000 claims description 7
- -1 alkyl radical Chemical group 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 229910052804 chromium Inorganic materials 0.000 claims description 5
- 239000011651 chromium Substances 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000010924 continuous production Methods 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 239000007791 liquid phase Substances 0.000 claims description 3
- 239000012071 phase Substances 0.000 claims description 3
- 150000003254 radicals Chemical class 0.000 claims description 3
- 150000001844 chromium Chemical class 0.000 claims description 2
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000002978 peroxides Chemical class 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims 3
- 150000005690 diesters Chemical class 0.000 claims 2
- 150000002432 hydroperoxides Chemical class 0.000 claims 2
- 239000012429 reaction media Substances 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000001934 cyclohexanes Chemical class 0.000 claims 1
- 229910001882 dioxygen Inorganic materials 0.000 claims 1
- FGGJBCRKSVGDPO-UHFFFAOYSA-N hydroperoxycyclohexane Chemical compound OOC1CCCCC1 FGGJBCRKSVGDPO-UHFFFAOYSA-N 0.000 claims 1
- 230000000399 orthopedic effect Effects 0.000 claims 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000001924 cycloalkanes Chemical class 0.000 description 3
- 235000011007 phosphoric acid Nutrition 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- SEGLCEQVOFDUPX-UHFFFAOYSA-N di-(2-ethylhexyl)phosphoric acid Chemical compound CCCCC(CC)COP(O)(=O)OCC(CC)CCCC SEGLCEQVOFDUPX-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 235000002020 sage Nutrition 0.000 description 1
- 238000011144 upstream manufacturing Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7017837 | 1970-05-15 | ||
| FR7017837A FR2087365A5 (enFirst) | 1970-05-15 | 1970-05-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2124124A1 DE2124124A1 (enFirst) | 1971-12-02 |
| DE2124124C true DE2124124C (enFirst) | 1973-06-20 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1768529A1 (de) | Verfahren zur Herstellung von Cycloalkanol/Cycloalkanon-Gemischen | |
| EP0004015B1 (de) | Verfahren zur Herstellung von ungefärbten technischen Äthanolaminen | |
| DE1086226B (de) | Verfahren zur Herstellung von Cyclododecatrien-(1, 5, 9) | |
| DE2061113B2 (de) | Verfahren zur Herstellung von Gemischen aus Ketonen und den entsprechenden Alkoholen | |
| DE2351947A1 (de) | Verfahren zur herstellung von chloriertem phthalonitril | |
| DE1225642B (de) | Verfahren zur Herstellung pharmazeutisch wirksamer, oligomerer, organischer Aluminium-verbindungen mit gesteuerter Hydrolysegeschwindigkeit | |
| DE2124124C (enFirst) | ||
| DE2519081A1 (de) | Verfahren zum hydrieren von olefinisch ungesaettigten kohlenwasserstoffen | |
| DE2514126C2 (de) | Verfahren zur Rückgewinnung von unter Normalbedingung gas- und/oder dampfförmiger Monomerer aus Polymerisationsabgasen | |
| DE841505C (de) | Verfahren zur Polymerisation eines ungesaettigten Alkohols, der ein ungesaettigtes Kohlenstoffatom direkt an die Carbinol-gruppe gebunden aufweist | |
| DE1180945B (de) | Verfahren zur Polymerisation von konjugierten Dienen | |
| DE570732C (de) | Verfahren zur Herstellung wertvoller organischer Produkte durch Behandlung von fluessigen Kohlenwasserstoffen mit oxydierenden Gasen | |
| DE2136744A1 (enFirst) | ||
| DE959183C (de) | Verfahren zur Reinigung von Essigsaeure durch Destillation | |
| DE2124124A1 (enFirst) | ||
| DE2124124B (enFirst) | ||
| DE1219945B (de) | Verfahren zum Aufarbeiten der Ablauffraktion, die bei der Herstellung von Phenol durch Oxydieren von Benzoesaeure erhalten worden ist | |
| DE565233C (de) | Verfahren zur Herstellung von Benzoesaeure | |
| AT273913B (de) | Verfahren zur Überführung von gesättigten Kohlenwasserstoffen mit 5 bis 8 Kohlenstoffatomen pro Molekül in die entsprechenden Alkohole und Ketone | |
| DE579033C (de) | Verfahren zur Herstellung einer Aufloesung von Kohle in Mineraloelen oder Teeren | |
| DE709725C (de) | Verfahren zur Destillation und zum Haltbarmachen von Vinylmethylketon | |
| DE1518216C (de) | Verfahren zur Herstellung von ge sattigten aliphatischen Dicarbonsäuren | |
| DE2048575C3 (de) | Verfahren zur Herstellung von e- Caprolactam aus 6-Hydroperoxyhexansäure | |
| DE1047778B (de) | Verfahren zur Herstellung von Cyclohexanol und Cyclohexanon | |
| DE851193C (de) | Verfahren zur Herstellung von Schaeumeroelen fuer Flotationszwecke aus Rohsulfatterpentinoel |