DE2123829C3 - Photoleitfähiges Gemisch mit einer Photoleiter-Bindemittel-Mischung, die einen Schwefel enthaltenden Photoleiter enthält - Google Patents
Photoleitfähiges Gemisch mit einer Photoleiter-Bindemittel-Mischung, die einen Schwefel enthaltenden Photoleiter enthältInfo
- Publication number
- DE2123829C3 DE2123829C3 DE2123829A DE2123829A DE2123829C3 DE 2123829 C3 DE2123829 C3 DE 2123829C3 DE 2123829 A DE2123829 A DE 2123829A DE 2123829 A DE2123829 A DE 2123829A DE 2123829 C3 DE2123829 C3 DE 2123829C3
- Authority
- DE
- Germany
- Prior art keywords
- bis
- thio
- group
- photoconductor
- photoconductive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 32
- 239000011230 binding agent Substances 0.000 title claims description 21
- 229910052717 sulfur Inorganic materials 0.000 title claims description 15
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 title claims description 13
- 239000011593 sulfur Substances 0.000 title claims description 13
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 37
- 229910052757 nitrogen Inorganic materials 0.000 claims description 35
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 15
- 239000000463 material Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 239000002245 particle Substances 0.000 claims description 9
- -1 substituted Chemical class 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000000623 heterocyclic group Chemical group 0.000 claims description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 239000000843 powder Substances 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 239000000126 substance Substances 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 4
- 229920000265 Polyparaphenylene Polymers 0.000 claims description 3
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 3
- 239000011669 selenium Substances 0.000 claims description 3
- 229930192474 thiophene Natural products 0.000 claims description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 2
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 238000004040 coloring Methods 0.000 claims description 2
- 230000008021 deposition Effects 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004957 naphthylene group Chemical group 0.000 claims description 2
- 229910052711 selenium Inorganic materials 0.000 claims description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims 2
- 230000015572 biosynthetic process Effects 0.000 claims 2
- 125000003277 amino group Chemical group 0.000 claims 1
- 230000006378 damage Effects 0.000 claims 1
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 claims 1
- 239000011787 zinc oxide Substances 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 5
- 229920000915 polyvinyl chloride Polymers 0.000 description 5
- 239000004800 polyvinyl chloride Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- PYWVYCXTNDRMGF-UHFFFAOYSA-N rhodamine B Chemical compound [Cl-].C=12C=CC(=[N+](CC)CC)C=C2OC2=CC(N(CC)CC)=CC=C2C=1C1=CC=CC=C1C(O)=O PYWVYCXTNDRMGF-UHFFFAOYSA-N 0.000 description 4
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 3
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 229920001568 phenolic resin Polymers 0.000 description 3
- 229920002689 polyvinyl acetate Polymers 0.000 description 3
- 239000011118 polyvinyl acetate Substances 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- GMPDOIGGGXSAPL-UHFFFAOYSA-N Phenyl vinyl sulfide Chemical compound C=CSC1=CC=CC=C1 GMPDOIGGGXSAPL-UHFFFAOYSA-N 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000036211 photosensitivity Effects 0.000 description 2
- 238000007639 printing Methods 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- 229910052714 tellurium Inorganic materials 0.000 description 2
- KFUSEUYYWQURPO-UHFFFAOYSA-N 1,2-dichloroethene Chemical compound ClC=CCl KFUSEUYYWQURPO-UHFFFAOYSA-N 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 description 1
- 239000002174 Styrene-butadiene Substances 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 150000004662 dithiols Chemical class 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 230000005686 electrostatic field Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical compound O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000007646 gravure printing Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 238000007644 letterpress printing Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 239000011115 styrene butadiene Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0601—Acyclic or carbocyclic compounds
- G03G5/062—Acyclic or carbocyclic compounds containing non-metal elements other than hydrogen, halogen, oxygen or nitrogen
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Developing Agents For Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2348470 | 1970-05-14 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2123829A1 DE2123829A1 (de) | 1971-12-02 |
| DE2123829B2 DE2123829B2 (de) | 1981-02-05 |
| DE2123829C3 true DE2123829C3 (de) | 1981-10-29 |
Family
ID=10196356
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2123829A Expired DE2123829C3 (de) | 1970-05-14 | 1971-05-13 | Photoleitfähiges Gemisch mit einer Photoleiter-Bindemittel-Mischung, die einen Schwefel enthaltenden Photoleiter enthält |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3852065A (enExample) |
| DE (1) | DE2123829C3 (enExample) |
| FR (1) | FR2091630A5 (enExample) |
| GB (1) | GB1351129A (enExample) |
| NL (1) | NL163881C (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1539442A (en) * | 1975-06-04 | 1979-01-31 | Canon Kk | Toner for developing electrostatic latent images |
| US4150987A (en) * | 1977-10-17 | 1979-04-24 | International Business Machines Corporation | Hydrazone containing charge transport element and photoconductive process of using same |
| US4603097A (en) * | 1983-10-28 | 1986-07-29 | Ricoh Company, Limited | Styrene derivatives and electrophotographic photoconductor comprising one of the styrene derivatives |
| US4606988A (en) * | 1984-02-21 | 1986-08-19 | Ricoh Company, Ltd. | Styryl derivatives and electrophotographic photoconductor comprising one styryl derivative |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2351657A (en) * | 1942-12-26 | 1944-06-20 | Carbide & Carbon Chem Corp | Lubricant |
| US2384577A (en) * | 1944-03-03 | 1945-09-11 | Du Pont | Esters |
| US2435508A (en) * | 1944-11-01 | 1948-02-03 | Us Rubber Co | Manufacture of dithio bisarylamines |
| US2983726A (en) * | 1959-08-18 | 1961-05-09 | Goodrich Co B F | Method for preparing secondary aminothiazoledisulfides |
| DE1216689B (de) * | 1960-09-19 | 1966-05-12 | Renker Belipa G M B H | Elektrophotographisches Aufzeichnungsmaterial |
| US3329477A (en) * | 1963-03-11 | 1967-07-04 | Martin Marietta Corp | Method for printing dyestuffs and printing pastes |
| US3261825A (en) * | 1963-03-11 | 1966-07-19 | Martin Marietta Corp | Azo-disulfide triazine dyestuffs |
| US3388126A (en) * | 1965-10-27 | 1968-06-11 | Monsanto Co | Synthesis of sulfenamides in aqueousorganic solvent mixtures |
-
1970
- 1970-05-14 GB GB2348470A patent/GB1351129A/en not_active Expired
-
1971
- 1971-05-10 NL NL7106405.A patent/NL163881C/xx not_active IP Right Cessation
- 1971-05-13 DE DE2123829A patent/DE2123829C3/de not_active Expired
- 1971-05-14 US US00143587A patent/US3852065A/en not_active Expired - Lifetime
- 1971-05-14 FR FR7117533A patent/FR2091630A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL163881B (nl) | 1980-05-16 |
| GB1351129A (en) | 1974-04-24 |
| DE2123829B2 (de) | 1981-02-05 |
| US3852065A (en) | 1974-12-03 |
| FR2091630A5 (enExample) | 1972-01-14 |
| DE2123829A1 (de) | 1971-12-02 |
| NL7106405A (enExample) | 1971-11-16 |
| NL163881C (nl) | 1980-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2939483C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1472950C3 (de) | Elektrofotografisches material | |
| EP0001599B1 (de) | Elektrophotographisches Aufzeichnungsmaterial und dessen Verwendung in einem Kopierverfahren | |
| DE60111130T2 (de) | Photoleitfähiges Bildherstellungselement | |
| EP0061090A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2110971A1 (de) | N,N,N',N'-Tetrabenzyl-4-4'- und dessen Verwendung | |
| DE2123829C3 (de) | Photoleitfähiges Gemisch mit einer Photoleiter-Bindemittel-Mischung, die einen Schwefel enthaltenden Photoleiter enthält | |
| DE3887565T2 (de) | Farbstoffe, geeignet für die Sensibilisierung photoleitfähiger Systeme. | |
| DE2041064A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2048135C3 (de) | Elektrophotographisches Aufzeichnungs material | |
| DE2263139C3 (de) | Elektrophotographisches lichtempfindliches Aufzeichnungsmaterial | |
| DE2005462A1 (enExample) | ||
| DE2043355C3 (de) | Elektrophotographisches Aufzeichungs material | |
| DE69322319T2 (de) | Photoerzeugende Azopigmente | |
| DE2059540C3 (de) | Elektrophotographisches Aufzeichnungsmaterial mit einer photoleitfähigen Schicht | |
| DE69419208T2 (de) | Ein organisches photoleitfähiges Material, und lichtempfindliches Material für elektronische Photographie das dieses photoleitfähiges Material anwendet | |
| DE68919071T2 (de) | Für elektrophotographische Zwecke geeignetes Aufzeichnungsmaterial. | |
| DE2513191A1 (de) | Photoleitfaehige masse und ihre verwendung | |
| DE2047338A1 (de) | Elektrophotographisches Aufzeichnungs material | |
| DE2513189A1 (de) | Photoleitende masse | |
| DE2513167A1 (de) | Fotoleitfaehige zubereitungen, deren verwendung und deren herstellung | |
| DE1943387C (de) | Elektrophotographisches Auf zeichnungsmatenal | |
| DE2028367A1 (de) | Flektrophotographisches Aufzeichnungs material mit vergleichsweise niedrigem gamma Wert | |
| DE2064481A1 (de) | Lichtelektrisch leitfähige Materialien fur die Elektrophotographie | |
| DE1943386C (de) | Elektrophotographisches Aufzeichnungsmaterial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |