DE2119730C3 - - Google Patents
Info
- Publication number
- DE2119730C3 DE2119730C3 DE19712119730 DE2119730A DE2119730C3 DE 2119730 C3 DE2119730 C3 DE 2119730C3 DE 19712119730 DE19712119730 DE 19712119730 DE 2119730 A DE2119730 A DE 2119730A DE 2119730 C3 DE2119730 C3 DE 2119730C3
- Authority
- DE
- Germany
- Prior art keywords
- benzisothiazolin
- groups
- methyl
- carbomethoxybenzenesulfenamide
- mercaptobenzoate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- DMSMPAJRVJJAGA-UHFFFAOYSA-N benzo[d]isothiazol-3-one Chemical compound C1=CC=C2C(=O)NSC2=C1 DMSMPAJRVJJAGA-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- -1 hydrocarbon radical Chemical class 0.000 description 61
- 239000004215 Carbon black (E152) Substances 0.000 description 16
- 229930195733 hydrocarbon Natural products 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 238000000034 method Methods 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 12
- 239000000460 chlorine Substances 0.000 description 11
- QAZLUNIWYYOJPC-UHFFFAOYSA-M sulfenamide Chemical compound [Cl-].COC1=C(C)C=[N+]2C3=NC4=CC=C(OC)C=C4N3SCC2=C1C QAZLUNIWYYOJPC-UHFFFAOYSA-M 0.000 description 11
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 125000003118 aryl group Chemical group 0.000 description 10
- 229910052801 chlorine Inorganic materials 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000047 product Substances 0.000 description 8
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 8
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical class OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 8
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 7
- 125000003545 alkoxy group Chemical group 0.000 description 7
- 125000000000 cycloalkoxy group Chemical group 0.000 description 7
- 150000003254 radicals Chemical class 0.000 description 7
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- 238000007363 ring formation reaction Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 5
- 125000004104 aryloxy group Chemical group 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 125000001246 bromo group Chemical group Br* 0.000 description 5
- 150000002430 hydrocarbons Chemical class 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001555 benzenes Chemical class 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000004950 naphthalene Chemical class 0.000 description 3
- 125000000449 nitro group Chemical class [O-][N+](*)=O 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 2
- LTKRCBGDBZGCJG-UHFFFAOYSA-N 2-pyrimidin-2-yl-1,2-benzothiazol-3-one Chemical compound O=C1N(SC2=CC=CC=C12)C1=NC=CC=N1 LTKRCBGDBZGCJG-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- 229910004013 NO 2 Inorganic materials 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical class NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 150000002019 disulfides Chemical class 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- XEFUGRNMPZZWFA-UHFFFAOYSA-N methyl 2-(benzylamino)sulfanylbenzoate Chemical compound COC(=O)C1=CC=CC=C1SNCC1=CC=CC=C1 XEFUGRNMPZZWFA-UHFFFAOYSA-N 0.000 description 2
- HOFUWSSROMGSDU-UHFFFAOYSA-N methyl 2-(propylaminosulfanyl)benzoate Chemical compound CCCNSC1=CC=CC=C1C(=O)OC HOFUWSSROMGSDU-UHFFFAOYSA-N 0.000 description 2
- RXQDWALLLVIUHZ-UHFFFAOYSA-N methyl 2-anilinosulfanylbenzoate Chemical compound COC(=O)C1=CC=CC=C1SNC1=CC=CC=C1 RXQDWALLLVIUHZ-UHFFFAOYSA-N 0.000 description 2
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical group CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 1
- HRGSKYJMMOTCIB-UHFFFAOYSA-N 2-(2,5-dichlorophenyl)-1,2-benzothiazol-3-one Chemical compound ClC1=CC=C(Cl)C(N2C(C3=CC=CC=C3S2)=O)=C1 HRGSKYJMMOTCIB-UHFFFAOYSA-N 0.000 description 1
- KZWDYISQJWCAHU-UHFFFAOYSA-N 2-(2,5-dimethylphenyl)-1,2-benzothiazol-3-one Chemical compound CC1=CC=C(C)C(N2C(C3=CC=CC=C3S2)=O)=C1 KZWDYISQJWCAHU-UHFFFAOYSA-N 0.000 description 1
- BCNQWYAAOOKHEH-UHFFFAOYSA-N 2-(2,6-dimethylphenyl)-1,2-benzothiazol-3-one Chemical compound CC1=CC=CC(C)=C1N1C(=O)C2=CC=CC=C2S1 BCNQWYAAOOKHEH-UHFFFAOYSA-N 0.000 description 1
- PFRCTDKVBCHTRU-UHFFFAOYSA-N 2-(2-chlorophenyl)-1,2-benzothiazol-3-one Chemical compound ClC1=CC=CC=C1N1C(=O)C2=CC=CC=C2S1 PFRCTDKVBCHTRU-UHFFFAOYSA-N 0.000 description 1
- UATQPZUWKRIYBR-UHFFFAOYSA-N 2-(2-methoxyphenyl)-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC=C1N1C(=O)C2=CC=CC=C2S1 UATQPZUWKRIYBR-UHFFFAOYSA-N 0.000 description 1
- BRGOWJUWXMQBRL-UHFFFAOYSA-N 2-(3,4-dichlorophenyl)-1,2-benzothiazol-3-one Chemical compound C1=C(Cl)C(Cl)=CC=C1N1C(=O)C2=CC=CC=C2S1 BRGOWJUWXMQBRL-UHFFFAOYSA-N 0.000 description 1
- OTXSJKFJDSAKGO-UHFFFAOYSA-N 2-(3-methoxyphenyl)-1,2-benzothiazol-3-one Chemical compound COC1=CC=CC(N2C(C3=CC=CC=C3S2)=O)=C1 OTXSJKFJDSAKGO-UHFFFAOYSA-N 0.000 description 1
- DJKBMBPPLNOFMB-UHFFFAOYSA-N 2-(4-bromophenyl)-1,2-benzothiazol-3-one Chemical compound C1=CC(Br)=CC=C1N1C(=O)C2=CC=CC=C2S1 DJKBMBPPLNOFMB-UHFFFAOYSA-N 0.000 description 1
- NZFJGDSKVUKKGA-UHFFFAOYSA-N 2-(4-butylphenyl)-1,2-benzothiazol-3-one Chemical compound C1=CC(CCCC)=CC=C1N1C(=O)C2=CC=CC=C2S1 NZFJGDSKVUKKGA-UHFFFAOYSA-N 0.000 description 1
- STSFIOVBFRWYHK-UHFFFAOYSA-N 2-(4-ethoxyphenyl)-1,2-benzothiazol-3-one Chemical compound C1=CC(OCC)=CC=C1N1C(=O)C2=CC=CC=C2S1 STSFIOVBFRWYHK-UHFFFAOYSA-N 0.000 description 1
- GQBVBBSACQRWPC-UHFFFAOYSA-N 2-[(4-chlorophenyl)methyl]-1,2-benzothiazol-3-one Chemical compound C1=CC(Cl)=CC=C1CN1C(=O)C2=CC=CC=C2S1 GQBVBBSACQRWPC-UHFFFAOYSA-N 0.000 description 1
- WXKSXJFIVXNAGM-UHFFFAOYSA-N 2-butyl-4-methoxy-1,2-benzothiazol-3-one Chemical compound C1=CC(OC)=C2C(=O)N(CCCC)SC2=C1 WXKSXJFIVXNAGM-UHFFFAOYSA-N 0.000 description 1
- PDAIWRVMSCYLCB-UHFFFAOYSA-N 2-butyl-6-methoxy-1,2-benzothiazol-3-one Chemical compound COC1=CC=C2C(=O)N(CCCC)SC2=C1 PDAIWRVMSCYLCB-UHFFFAOYSA-N 0.000 description 1
- XMEUBXAEPYZHFV-UHFFFAOYSA-N 2-butyl-6-methyl-1,2-benzothiazol-3-one Chemical compound CC1=CC=C2C(=O)N(CCCC)SC2=C1 XMEUBXAEPYZHFV-UHFFFAOYSA-N 0.000 description 1
- KKUXIXMLNAPJIV-UHFFFAOYSA-N 2-cyclohexyl-1,2-benzothiazol-3-one Chemical compound S1C2=CC=CC=C2C(=O)N1C1CCCCC1 KKUXIXMLNAPJIV-UHFFFAOYSA-N 0.000 description 1
- DZBBGODNYKPSFX-UHFFFAOYSA-N 2-hexadecyl-1,2-benzothiazol-3-one Chemical compound C1=CC=C2C(=O)N(CCCCCCCCCCCCCCCC)SC2=C1 DZBBGODNYKPSFX-UHFFFAOYSA-N 0.000 description 1
- ZIQCIGWOWCIJOY-UHFFFAOYSA-N 2-methyl-5-nitro-1,2-benzothiazol-3-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(C)SC2=C1 ZIQCIGWOWCIJOY-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- CIZCWSJDCWBINO-UHFFFAOYSA-N 2-propyl-1,2-benzothiazol-3-one Chemical compound C1=CC=C2C(=O)N(CCC)SC2=C1 CIZCWSJDCWBINO-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- HELZDMVGXASAMM-UHFFFAOYSA-N 6-chloro-2-propyl-1,2-benzothiazol-3-one Chemical compound ClC1=CC=C2C(=O)N(CCC)SC2=C1 HELZDMVGXASAMM-UHFFFAOYSA-N 0.000 description 1
- RXRSFFJGDGLJIJ-UHFFFAOYSA-N 6-nitro-2-phenyl-1,2-benzothiazol-3-one Chemical compound C=1C([N+](=O)[O-])=CC=C(C2=O)C=1SN2C1=CC=CC=C1 RXRSFFJGDGLJIJ-UHFFFAOYSA-N 0.000 description 1
- BPMPAMMKVQECQT-UHFFFAOYSA-N C(C1=CC=CC=C1)N1SC2=C(C1=O)C=CC(=C2)C Chemical compound C(C1=CC=CC=C1)N1SC2=C(C1=O)C=CC(=C2)C BPMPAMMKVQECQT-UHFFFAOYSA-N 0.000 description 1
- QSRZCJUCOFXDRR-UHFFFAOYSA-N C(CCC)N1SC2=C(C1=O)C=CC=C2OC Chemical compound C(CCC)N1SC2=C(C1=O)C=CC=C2OC QSRZCJUCOFXDRR-UHFFFAOYSA-N 0.000 description 1
- UADACLXSCLVULG-UHFFFAOYSA-N C(CCC)NSC1=C(C=CC=C1)C(=O)OCC Chemical compound C(CCC)NSC1=C(C=CC=C1)C(=O)OCC UADACLXSCLVULG-UHFFFAOYSA-N 0.000 description 1
- WSNMPAVSZJSIMT-UHFFFAOYSA-N COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 Chemical compound COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 WSNMPAVSZJSIMT-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- QSFRBDAOXUVRPM-UHFFFAOYSA-N ClC1=C(CN2SC3=C(C2=O)C=CC=C3)C=C(C(=C1)Cl)Cl Chemical compound ClC1=C(CN2SC3=C(C2=O)C=CC=C3)C=C(C(=C1)Cl)Cl QSFRBDAOXUVRPM-UHFFFAOYSA-N 0.000 description 1
- BVZGSFOHPNYPGS-UHFFFAOYSA-N ClC1=C(CN2SC3=C(C2=O)C=CC=C3)C=CC=C1 Chemical compound ClC1=C(CN2SC3=C(C2=O)C=CC=C3)C=CC=C1 BVZGSFOHPNYPGS-UHFFFAOYSA-N 0.000 description 1
- MVVDXKYTKJFVPD-UHFFFAOYSA-N ClC1=C(CNSC2=C(C=CC=C2)C(=O)OC)C=C(C(=C1)Cl)Cl Chemical compound ClC1=C(CNSC2=C(C=CC=C2)C(=O)OC)C=C(C(=C1)Cl)Cl MVVDXKYTKJFVPD-UHFFFAOYSA-N 0.000 description 1
- 206010012504 Dermatophytosis Diseases 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 description 1
- 241001460074 Microsporum distortum Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- JTKSICDKLRFHPI-UHFFFAOYSA-N OC(=O)C1=CC=C(C=C1)C(=O)OS Chemical compound OC(=O)C1=CC=C(C=C1)C(=O)OS JTKSICDKLRFHPI-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 208000002474 Tinea Diseases 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000006226 butoxyethyl group Chemical group 0.000 description 1
- UOTKBRDRSXAZOM-UHFFFAOYSA-N butyl 2-sulfanylbenzoate Chemical compound CCCCOC(=O)C1=CC=CC=C1S UOTKBRDRSXAZOM-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical group 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- QGHVGEVFDYRHCT-UHFFFAOYSA-N methyl 2-(2-hydroxyethylamino)sulfanylbenzoate Chemical compound COC(=O)C1=CC=CC=C1SNCCO QGHVGEVFDYRHCT-UHFFFAOYSA-N 0.000 description 1
- BAQGCWNPCFABAY-UHFFFAOYSA-N methyl 2-sulfanylbenzoate Chemical compound COC(=O)C1=CC=CC=C1S BAQGCWNPCFABAY-UHFFFAOYSA-N 0.000 description 1
- 229940102398 methyl anthranilate Drugs 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- VPYKTMHVSTXCMB-UHFFFAOYSA-N phenyl 2-sulfanylbenzoate Chemical compound SC1=CC=CC=C1C(=O)OC1=CC=CC=C1 VPYKTMHVSTXCMB-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000006233 propoxy propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])OC([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- MAGSSGQAJNNDLU-UHFFFAOYSA-N s-phenylthiohydroxylamine Chemical compound NSC1=CC=CC=C1 MAGSSGQAJNNDLU-UHFFFAOYSA-N 0.000 description 1
- 210000004761 scalp Anatomy 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- HJHVQCXHVMGZNC-JCJNLNMISA-M sodium;(2z)-2-[(3r,4s,5s,8s,9s,10s,11r,13r,14s,16s)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-2,3,4,5,6,7,9,11,12,13,15,16-dodecahydro-1h-cyclopenta[a]phenanthren-17-ylidene]-6-methylhept-5-enoate Chemical compound [Na+].O[C@@H]([C@@H]12)C[C@H]3\C(=C(/CCC=C(C)C)C([O-])=O)[C@@H](OC(C)=O)C[C@]3(C)[C@@]2(C)CC[C@@H]2[C@]1(C)CC[C@@H](O)[C@H]2C HJHVQCXHVMGZNC-JCJNLNMISA-M 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- NRTLTGGGUQIRRT-UHFFFAOYSA-N triethylazanium;bromide Chemical compound [Br-].CC[NH+](CC)CC NRTLTGGGUQIRRT-UHFFFAOYSA-N 0.000 description 1
- 238000007039 two-step reaction Methods 0.000 description 1
- 230000002485 urinary effect Effects 0.000 description 1
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US3246770A | 1970-04-27 | 1970-04-27 | |
| US3246770 | 1970-04-27 | ||
| US259115A US3862955A (en) | 1970-04-27 | 1972-06-02 | Process for the preparation of 1,2-benzisothiazolin 3-ones |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2119730A1 DE2119730A1 (de) | 1971-11-11 |
| DE2119730B2 DE2119730B2 (de) | 1976-09-23 |
| DE2119730C3 true DE2119730C3 (enExample) | 1977-05-05 |
Family
ID=26708461
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712119730 Granted DE2119730B2 (de) | 1970-04-27 | 1971-04-22 | Verfahren zur herstellung von 1,2-benzisothiazolin-3-onen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3862955A (enExample) |
| BE (1) | BE766264A (enExample) |
| CH (1) | CH560708A5 (enExample) |
| DE (1) | DE2119730B2 (enExample) |
| FR (1) | FR2104745B1 (enExample) |
| NL (1) | NL7105597A (enExample) |
| SE (1) | SE392103B (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1039699B (it) * | 1975-07-03 | 1979-12-10 | Prephar | Composizione spermicida a base di derivati benzisotiazolici |
| NZ182325A (en) * | 1975-11-18 | 1979-03-16 | Beecham Group Ltd | 2-substituted-1,2-benzisothiazol-3-ones |
| DE3041036A1 (de) * | 1980-10-31 | 1982-06-09 | A. Nattermann & Cie GmbH, 5000 Köln | Verwendung von benzisothiazolen |
| JPS58166343A (ja) * | 1982-03-27 | 1983-10-01 | Konishiroku Photo Ind Co Ltd | ハロゲン化銀写真感光材料 |
| IE55436B1 (en) * | 1982-09-16 | 1990-09-12 | Shell Int Research | Pesticidal benzoylurea compounds |
| US5128457A (en) * | 1988-07-01 | 1992-07-07 | Miles Inc. | Chromogenic thiol indicators based on an isobenzothiazolone ring system |
| CA1340759C (en) * | 1988-07-01 | 1999-09-21 | James P. Albarella | Isobenzothiazolone chromogenic thiol indicators and their derivatives |
| US5187105A (en) * | 1988-07-01 | 1993-02-16 | Miles Inc. | Process for determining thiols using chromogenic benzoisothiazolone derivatives |
| US5250680A (en) * | 1989-08-31 | 1993-10-05 | Merrell Dow Pharmaceuticals Inc. | Heterogeneous synthesis of azepinones from esters |
| DE4027378A1 (de) * | 1990-08-30 | 1992-03-05 | Riedel De Haen Ag | Verwendung von 2-n-alkyl-1,2-benzisothiazolin-3-onen als technische mikrobiozide |
| TW385231B (en) * | 1993-09-17 | 2000-03-21 | Chugoku Marine Paints | Anti-fouling compositions or fouling control of harmful aquatic organisms |
| GB9500856D0 (en) * | 1995-01-17 | 1995-03-08 | Zeneca Ltd | Composition and use |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3661974A (en) * | 1970-04-27 | 1972-05-09 | Sherwin Williams Co | 2-carbalkoxy-phenyl sulfenamides |
-
1971
- 1971-04-07 SE SE7104572A patent/SE392103B/xx unknown
- 1971-04-22 DE DE19712119730 patent/DE2119730B2/de active Granted
- 1971-04-23 CH CH600371A patent/CH560708A5/xx not_active IP Right Cessation
- 1971-04-26 NL NL7105597A patent/NL7105597A/xx not_active Application Discontinuation
- 1971-04-26 BE BE766264A patent/BE766264A/xx unknown
- 1971-04-27 FR FR7114986A patent/FR2104745B1/fr not_active Expired
-
1972
- 1972-06-02 US US259115A patent/US3862955A/en not_active Expired - Lifetime
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0004279A1 (de) | Verfahren zur Herstellung von 4-Pyridon-3-carbonsäuren, 1-Cyclopropyl-4-Pyridon-3-Carbonsäurederivate und diese enthaltende Arzneimittel | |
| DE2119730C3 (enExample) | ||
| DE3135125C2 (enExample) | ||
| DE2336718A1 (de) | Verfahren zur herstellung von substituierten oxazolinon-(5)-verbindungen | |
| DE2119730B2 (de) | Verfahren zur herstellung von 1,2-benzisothiazolin-3-onen | |
| EP0125506A1 (de) | 5-(2,6-Dichlor-4-trifluormethyl-phenoxy)-2-nitrobenzaldehyd-diacetacylal | |
| EP0000014A1 (de) | 1-Aryl-4-alkyl-1,2,4-triazol-5-onen und Verfahren zu deren Herstellung, sowie deren Verwendung als Schädlingsbekämpfungsmittel | |
| DE2141616C3 (de) | Oxazole- und Oxazine eckige Klammer auf 3,2-c eckige Klammer zu chinazolinone, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE2119711A1 (de) | Aromatische Sulfenamide und Verfahren zu deren Herstellung | |
| DE2733181A1 (de) | Verfahren zur herstellung von n-substituierten alpha-ketocarbonsaeureamiden | |
| DE2320040A1 (de) | Verfahren zur herstellung von 7acylamino-desacetoxy-cephalosporansaeureester | |
| DE2729986C2 (enExample) | ||
| DE69829613T2 (de) | Verfahren zur Herstellung von Heteroarylcarbonsäureamiden und -estern | |
| EP0302227B1 (de) | 5-Halogen-6-amino-nikotin-säurehalogenide, ihre Herstellung und ihre Verwendung | |
| DE1126882B (de) | Verfahren zur Herstellung von 1,2,4-Triazolonen-(5) | |
| US2811524A (en) | 3-[beta-keto-gamma-(1, 4, 5, 6-tetrahydro-2-pyridyl) propyl]-4-quinazolone compounds and methods of making the same | |
| DE1213835B (de) | Verfahren zur Herstellung substituierter Semicarbazide | |
| EP0056938B1 (de) | Verfahren zur Herstellung von 3,6-disubstituierten 4-Amino-1,2,4-triazin-5-onen | |
| DE2705186C2 (enExample) | ||
| DE1543941C (de) | Verfahren zur Herstellung von 1-Oxa-2-methyl-3-aminocarbonyl-4-thia-cyclohex-2-en-4-oxiden oder 4,4-dioxiden | |
| DE2436032A1 (de) | Neue aromatische o-hydroxyaldehyde, verfahren zu ihrer herstellung und ihre verwendung | |
| CH617669A5 (enExample) | ||
| DE2445681A1 (de) | Verfahren zur herstellung von 3-phenylpyridazonen | |
| DE3028291A1 (de) | 3-methylbenzo eckige klammer auf b eckige klammer zu furyl-2-acetamide und ihre verwendung als muskelrelaxantien | |
| DE1543942C (de) | Verfahren zur Herstellung von 1 Oxa 2 methyl 3 carbonylarmno 4 tnia cyclohe xen(2)en |