DE211958C - - Google Patents
Info
- Publication number
- DE211958C DE211958C DENDAT211958D DE211958DA DE211958C DE 211958 C DE211958 C DE 211958C DE NDAT211958 D DENDAT211958 D DE NDAT211958D DE 211958D A DE211958D A DE 211958DA DE 211958 C DE211958 C DE 211958C
- Authority
- DE
- Germany
- Prior art keywords
- parts
- aminoanthraquinones
- amino
- acetic anhydride
- derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 18
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical group O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 claims description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- 229960000583 acetic acid Drugs 0.000 claims description 3
- 239000012362 glacial acetic acid Substances 0.000 claims description 3
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 claims description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 claims description 2
- LRMDXTVKVHKWEK-UHFFFAOYSA-N 1,2-diaminoanthracene-9,10-dione Chemical class C1=CC=C2C(=O)C3=C(N)C(N)=CC=C3C(=O)C2=C1 LRMDXTVKVHKWEK-UHFFFAOYSA-N 0.000 description 3
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000003949 imides Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- XOGPDSATLSAZEK-UHFFFAOYSA-N 2-Aminoanthraquinone Chemical class C1=CC=C2C(=O)C3=CC(N)=CC=C3C(=O)C2=C1 XOGPDSATLSAZEK-UHFFFAOYSA-N 0.000 description 1
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical group C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 1
- -1 acetyl compound Chemical class 0.000 description 1
- 239000012345 acetylating agent Substances 0.000 description 1
- SVTDYSXXLJYUTM-UHFFFAOYSA-N disperse red 9 Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC SVTDYSXXLJYUTM-UHFFFAOYSA-N 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/30—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by doubly-bound oxygen atoms
- C07C233/33—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by doubly-bound oxygen atoms with the substituted hydrocarbon radical bound to the nitrogen atom of the carboxamide group by a carbon atom of a six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE211958C true DE211958C (enrdf_load_stackoverflow) |
Family
ID=473722
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT211958D Active DE211958C (enrdf_load_stackoverflow) |
Country Status (1)
| Country | Link |
|---|---|
| DE (1) | DE211958C (enrdf_load_stackoverflow) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2522034A (en) * | 1946-08-07 | 1950-09-12 | Ciba Ltd | 1-hydroxy-8-acylamino anthraquinone dyestuffs |
| US2691027A (en) * | 1946-08-07 | 1954-10-05 | Ciba Ltd | 1, 5-hydroxy-acylamino anthraquinones |
-
0
- DE DENDAT211958D patent/DE211958C/de active Active
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2522034A (en) * | 1946-08-07 | 1950-09-12 | Ciba Ltd | 1-hydroxy-8-acylamino anthraquinone dyestuffs |
| US2691027A (en) * | 1946-08-07 | 1954-10-05 | Ciba Ltd | 1, 5-hydroxy-acylamino anthraquinones |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE211958C (enrdf_load_stackoverflow) | ||
| DE2247971C3 (de) | Verfahren zur Herstellung von 3'-Hydroxychinophthalonen | |
| DE544288C (de) | Verfahren zur Herstellung wasserloeslicher Derivate von zweibasischen organischen Saeuren | |
| DE536448C (de) | Verfahren zur Darstellung von Kondensationsprodukten aus 1-Aminoanthrachinonabkoemmlingen und o-Aminoarylcarbonsaeureabkoemmlingen | |
| DE421235C (de) | Verfahren zur Darstellung von 1íñ2íñ3íñ4-Tetraoxyanthrachinon | |
| DE2331251A1 (de) | Verfahren zur reinigung von aromatischen carbonsaeuren | |
| DE1229663B (de) | Verfahren zur Herstellung von 4-Brom-3-hydroxychinophthalon | |
| DE836039C (de) | Verfahren zur Chlorierung von Essigsaeure | |
| DE858294C (de) | Loesungsvermittler | |
| DE164293C (enrdf_load_stackoverflow) | ||
| DE559332C (de) | Verfahren zur Darstellung von in 1-Stellung halogenierten 2-Aminoanthrachinonderivaten | |
| DE516845C (de) | Verfahren zur Darstellung von Salzen saurer Schwefelsaeureester von Nitroanthrahydrochinonen | |
| DE606776C (de) | Verfahren zur Herstellung von saeure- und kalkbestaendigen Derivaten ungesaettigter Fettsaeuren bzw. deren Anhydriden oder Estern | |
| AT61187B (de) | Verfahren zur Herstellung jodazetylierter Salole. | |
| AT134811B (de) | Verfahren zur Herstellung von Acetylcellulose. | |
| DE578036C (de) | Verfahren zur Darstellung von Halogenfettsaeureestern der polymeren Kohlenhydrate | |
| AT41831B (de) | Verfahren zur Darstellung von Säureestern aus Zellulose oder ihr nahestehenden Umwandlungsprodukten. | |
| DE675183C (de) | Verfahren zur Stabilisierung von Celluloseestern | |
| DE621404C (de) | Verfahren zur Herstellung von Zwischenprodukten fuer Farbstoffe der Polymethinreihe | |
| DE516250C (de) | Verfahren zur Herstellung von Celluloseestern | |
| DE1271668B (de) | Verfahren zur Herstellung eines linearen Chinacridon-Pigments der beta-Form | |
| DE546512C (de) | Verfahren zur Darstellung von Carboxythiophenanthron-2-carbonsaeure | |
| DE562392C (de) | Verfahren zur Herstellung einer 2, 4-Diaminoazobenzolverbindung | |
| DE561640C (de) | Verfahren zur Darstellung von Kuepenfarbstoffen der Anthrachinonreihe | |
| DE1207397B (de) | Verfahren zur Herstellung von 4-Chlor- und 4-Methoxy-2, 6-dinitranilin |