DE2105687C2 - Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxiden - Google Patents
Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxidenInfo
- Publication number
- DE2105687C2 DE2105687C2 DE2105687A DE2105687A DE2105687C2 DE 2105687 C2 DE2105687 C2 DE 2105687C2 DE 2105687 A DE2105687 A DE 2105687A DE 2105687 A DE2105687 A DE 2105687A DE 2105687 C2 DE2105687 C2 DE 2105687C2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- starting material
- cyclization
- reaction
- benzothiadiazin
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 21
- 238000002360 preparation method Methods 0.000 title claims description 3
- -1 3-substituted 2,1,3-benzothiadiazin-4-one-2,2-dioxides Chemical class 0.000 title description 9
- 238000007363 ring formation reaction Methods 0.000 claims description 16
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- KDNIOKSLVIGAAN-UHFFFAOYSA-N 2-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC=CC=C1C(O)=O KDNIOKSLVIGAAN-UHFFFAOYSA-N 0.000 claims description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 26
- 239000007858 starting material Substances 0.000 description 22
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 15
- 239000007795 chemical reaction product Substances 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 239000003054 catalyst Substances 0.000 description 8
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 150000003857 carboxamides Chemical class 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000002798 polar solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 150000003512 tertiary amines Chemical class 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- MQZXGMYANOJYIY-UHFFFAOYSA-N 2,2-dioxo-1h-2$l^{6},1,3-benzothiadiazin-4-one Chemical class C1=CC=C2C(=O)NS(=O)(=O)NC2=C1 MQZXGMYANOJYIY-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- AGRDPCWQGGNEQL-UHFFFAOYSA-N n-propan-2-ylsulfamoyl chloride Chemical compound CC(C)NS(Cl)(=O)=O AGRDPCWQGGNEQL-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical class NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- JSRLURSZEMLAFO-UHFFFAOYSA-N 1,3-dibromobenzene Chemical compound BrC1=CC=CC(Br)=C1 JSRLURSZEMLAFO-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- MCTWTZJPVLRJOU-UHFFFAOYSA-N 1-methyl-1H-imidazole Chemical compound CN1C=CN=C1 MCTWTZJPVLRJOU-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- VTDIWMPYBAVEDY-UHFFFAOYSA-N 1-propylpiperidine Chemical compound CCCN1CCCCC1 VTDIWMPYBAVEDY-UHFFFAOYSA-N 0.000 description 1
- ADRTWONHWUQCMC-UHFFFAOYSA-N 2-(cyclooctylsulfamoylamino)benzoic acid Chemical compound C1(CCCCCCC1)NS(=O)(=O)NC1=C(C=CC=C1)C(=O)O ADRTWONHWUQCMC-UHFFFAOYSA-N 0.000 description 1
- PLAZTCDQAHEYBI-UHFFFAOYSA-N 2-nitrotoluene Chemical compound CC1=CC=CC=C1[N+]([O-])=O PLAZTCDQAHEYBI-UHFFFAOYSA-N 0.000 description 1
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- SVYKKECYCPFKGB-UHFFFAOYSA-N N,N-dimethylcyclohexylamine Chemical compound CN(C)C1CCCCC1 SVYKKECYCPFKGB-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- WVMBPWMAQDVZCM-UHFFFAOYSA-N N-methylanthranilic acid Chemical compound CNC1=CC=CC=C1C(O)=O WVMBPWMAQDVZCM-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KFUSEUYYWQURPO-UPHRSURJSA-N cis-1,2-dichloroethene Chemical group Cl\C=C/Cl KFUSEUYYWQURPO-UPHRSURJSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 125000002243 cyclohexanonyl group Chemical class *C1(*)C(=O)C(*)(*)C(*)(*)C(*)(*)C1(*)* 0.000 description 1
- KBXRGBYSPXRSOZ-UHFFFAOYSA-N cyclohexyl(dimethyl)azanium;chloride Chemical compound Cl.CN(C)C1CCCCC1 KBXRGBYSPXRSOZ-UHFFFAOYSA-N 0.000 description 1
- 238000007257 deesterification reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical compound NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 description 1
- GJRQTCIYDGXPES-UHFFFAOYSA-N iso-butyl acetate Natural products CC(C)COC(C)=O GJRQTCIYDGXPES-UHFFFAOYSA-N 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical compound CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- FGKJLKRYENPLQH-UHFFFAOYSA-M isocaproate Chemical compound CC(C)CCC([O-])=O FGKJLKRYENPLQH-UHFFFAOYSA-M 0.000 description 1
- OQAGVSWESNCJJT-UHFFFAOYSA-N isovaleric acid methyl ester Natural products COC(=O)CC(C)C OQAGVSWESNCJJT-UHFFFAOYSA-N 0.000 description 1
- WSZJADHVJOBSJL-UHFFFAOYSA-N methyl 2-(sulfamoylamino)benzoate Chemical compound COC(=O)C1=CC=CC=C1NS(N)(=O)=O WSZJADHVJOBSJL-UHFFFAOYSA-N 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- DLMICMXXVVMDNV-UHFFFAOYSA-N n,n-di(propan-2-yl)propan-1-amine Chemical compound CCCN(C(C)C)C(C)C DLMICMXXVVMDNV-UHFFFAOYSA-N 0.000 description 1
- DIAIBWNEUYXDNL-UHFFFAOYSA-N n,n-dihexylhexan-1-amine Chemical compound CCCCCCN(CCCCCC)CCCCCC DIAIBWNEUYXDNL-UHFFFAOYSA-N 0.000 description 1
- OOHAUGDGCWURIT-UHFFFAOYSA-N n,n-dipentylpentan-1-amine Chemical compound CCCCCN(CCCCC)CCCCC OOHAUGDGCWURIT-UHFFFAOYSA-N 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- NVBFHJWHLNUMCV-UHFFFAOYSA-N sulfamide Chemical compound NS(N)(=O)=O NVBFHJWHLNUMCV-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/15—Six-membered rings
- C07D285/16—Thiadiazines; Hydrogenated thiadiazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Catalysts (AREA)
Priority Applications (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2105687A DE2105687C2 (de) | 1971-02-08 | 1971-02-08 | Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxiden |
| CH57472A CH564546A5 (enExample) | 1971-02-08 | 1972-01-14 | |
| BE778819A BE778819A (fr) | 1971-02-08 | 1972-02-01 | Procede de preparation de dioxydes de 4-oxo-3,4-dihydrobenzo (e)-2,1,3-thiadiazines |
| US00223341A US3822257A (en) | 1971-02-08 | 1972-02-03 | Production of 2,1,3-benzothiadiazin-4-one-2,2-dioxides |
| FR7203809A FR2126729A5 (enExample) | 1971-02-08 | 1972-02-04 | |
| IT48155/72A IT996046B (it) | 1971-02-08 | 1972-02-05 | Procedimento per la produzione di 2,1,3 benzotiadiazin 4 one 2,2 biossidi |
| SU1744911A SU509233A3 (ru) | 1971-02-08 | 1972-02-07 | Способ получени 2,2-двуокисей-2,1,3-бензотиадиазин-4-она |
| GB552572A GB1369917A (en) | 1971-02-08 | 1972-02-07 | Production of 2,1,3-benzothiadiazin-4-one-2,2-dioxides |
| JP7213380A JPS5729470B1 (enExample) | 1971-02-08 | 1972-02-08 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2105687A DE2105687C2 (de) | 1971-02-08 | 1971-02-08 | Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxiden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2105687A1 DE2105687A1 (de) | 1972-09-07 |
| DE2105687C2 true DE2105687C2 (de) | 1981-09-24 |
Family
ID=5798039
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2105687A Expired DE2105687C2 (de) | 1971-02-08 | 1971-02-08 | Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxiden |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3822257A (enExample) |
| JP (1) | JPS5729470B1 (enExample) |
| BE (1) | BE778819A (enExample) |
| CH (1) | CH564546A5 (enExample) |
| DE (1) | DE2105687C2 (enExample) |
| FR (1) | FR2126729A5 (enExample) |
| GB (1) | GB1369917A (enExample) |
| IT (1) | IT996046B (enExample) |
| SU (1) | SU509233A3 (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3875155A (en) * | 1973-03-31 | 1975-04-01 | Basf Ag | Process for making salts of 3-isopropyl-2,1,3-benzothiadiazin-(4)-one-2,2-dioxide |
| DE2349114C2 (de) * | 1973-09-29 | 1985-11-14 | Basf Ag, 6700 Ludwigshafen | 3-sek.-Butyl-2,1,3-benzothiadiazin-(4)-on-2,2-dioxid |
| DE2357063C2 (de) * | 1973-11-15 | 1986-07-17 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von N-Isopropyl-2,1,3-benzothiadiazin-4-on-2,2-dioxid |
| US4051130A (en) * | 1974-08-15 | 1977-09-27 | The Dow Chemical Company | 4(3H)-oxobenzo-2,1,3-thiadiazine-2,2-dioxides and derivatives thereof |
| DE2458343A1 (de) * | 1974-12-10 | 1976-06-16 | Basf Ag | N-n'-disubstituierte 2,1,3-benzothiadiazin(4)on-2.2-dioxide |
| DE2553209C2 (de) * | 1975-11-27 | 1986-01-02 | Basf Ag, 6700 Ludwigshafen | 1-Methoxymethyl-3-isopropyl-2,1,3-benzothiadiazin(4)on-2,2-dioxid und diese enthaltende Herbizide |
| US4208514A (en) * | 1976-02-23 | 1980-06-17 | The Dow Chemical Company | 4(3H)-Oxobenzo-2,1,3-thiadiazine-2,2-dioxides |
| US4054440A (en) * | 1976-02-23 | 1977-10-18 | The Dow Chemical Company | 4(3H)-Oxobenzo-2,1,3-thiadiazine-2,2-dioxides |
| DE2710382C2 (de) * | 1977-03-10 | 1983-12-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von 2,1,3-Benzothiadiazin-4-on-2,2-dioxid-derivaten |
| US4100281A (en) * | 1977-03-30 | 1978-07-11 | Fmc Corporation | Mono-5-substituted-thio-3-chloro-4H-1,2,6-thiadiazin-4-one antifungal agents |
| US4097594A (en) * | 1977-03-30 | 1978-06-27 | Fmc Corporation | Mono-5-substituted-3-chloro-4H-1,2,6-thiadiazin-4-one antifungal agents |
| US4139700A (en) * | 1977-07-27 | 1979-02-13 | Monsanto Company | Process for the preparation of bicyclothiadiazinones |
| DE2852159A1 (de) * | 1978-12-02 | 1980-06-19 | Basf Ag | Verfahren zur herstellung von amidosulfonsaeuren |
| DE2852274A1 (de) * | 1978-12-02 | 1980-06-19 | Basf Ag | Verfahren zur herstellung von sulfamidsaeurehalogeniden |
| DE3428837A1 (de) * | 1984-06-30 | 1986-01-09 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von n-phenyl(pyridyl)-sulfonyldiamiden |
| HU199815B (en) * | 1985-12-03 | 1990-03-28 | Nitrokemia Ipartelepek | Process for producing 3-isopropylbenzo-2-thia-1,3-diazinone-/4/2,2-dioxide |
| TW420668B (en) * | 1994-05-10 | 2001-02-01 | Nissan Chemical Ind Ltd | Process for alkylating triazine derivative |
| CN104447618A (zh) * | 2014-12-26 | 2015-03-25 | 合肥星宇化学有限责任公司 | 一种苯达松的纯化方法 |
| CN104557776A (zh) * | 2014-12-28 | 2015-04-29 | 江苏绿利来股份有限公司 | 灭草松的合成方法 |
| CN104693142B (zh) * | 2015-03-31 | 2016-11-23 | 中国石油大学(华东) | 一种改进苯达松生产方法 |
| CN111763184A (zh) * | 2020-07-18 | 2020-10-13 | 江苏省激素研究所股份有限公司 | 一种灭草松原药合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1120456B (de) * | 1958-10-01 | 1961-12-28 | Geigy Ag J R | Verfahren zur Herstellung von neuen 4-Oxo-3, 4-dihydro-2, 1, 3-benzothiadiazin-2, 2-dioxyden |
| BE702877A (enExample) * | 1966-08-30 | 1968-02-21 |
-
1971
- 1971-02-08 DE DE2105687A patent/DE2105687C2/de not_active Expired
-
1972
- 1972-01-14 CH CH57472A patent/CH564546A5/xx not_active IP Right Cessation
- 1972-02-01 BE BE778819A patent/BE778819A/xx not_active IP Right Cessation
- 1972-02-03 US US00223341A patent/US3822257A/en not_active Expired - Lifetime
- 1972-02-04 FR FR7203809A patent/FR2126729A5/fr not_active Expired
- 1972-02-05 IT IT48155/72A patent/IT996046B/it active
- 1972-02-07 SU SU1744911A patent/SU509233A3/ru active
- 1972-02-07 GB GB552572A patent/GB1369917A/en not_active Expired
- 1972-02-08 JP JP7213380A patent/JPS5729470B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| GB1369917A (en) | 1974-10-09 |
| IT996046B (it) | 1975-12-10 |
| JPS5729470B1 (enExample) | 1982-06-23 |
| DE2105687A1 (de) | 1972-09-07 |
| SU509233A3 (ru) | 1976-03-30 |
| US3822257A (en) | 1974-07-02 |
| BE778819A (fr) | 1972-08-01 |
| FR2126729A5 (enExample) | 1972-10-06 |
| CH564546A5 (enExample) | 1975-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2105687C2 (de) | Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxiden | |
| DE1176660B (de) | Verfahren zur Herstellung von triaryl-substituierten Imidazolinonen-4(5) | |
| EP0123187A2 (de) | Verfahren zur Herstellung von fluorierten Phenylessigsäureestern und neue fluorierte Trichlorethylbenzole | |
| DE2213799A1 (de) | Verfahren zur herstellung von 2,5dichlor-3-nitro-benzoesaeure | |
| EP0001760B1 (de) | Alpha-aminomethylen-beta-formylaminopropionitril, Verfahren zu seiner Herstellung sowie Verwendung zur Herstellung von 2-Methyl-4-amino-5-formylaminomethyl-pyrimidin | |
| EP0504182A1 (de) | Verfahren zur herstellung von chinophthalonderivaten. | |
| DE3314435A1 (de) | Verfahren zur herstellung von 1,1-disubstituierten thioharnstoffen | |
| DE1445547C3 (de) | Verfahren zur Herstellung von 3-Amino-2,1-benzoisothiazolen | |
| DE2220275C2 (de) | Verfahren zur Herstellung von Asparaginsäureanhydrid-hydrochlorid oder -hydrobromid | |
| DE2321332C2 (de) | Verfahren zur Herstellung von 2-Nitro-5-chlor-benzolsulfonsäurechlorid oder von 2-Nitro-5-chlor-benzolsulfonsäure | |
| DE2800537C2 (de) | Verfahren zur Herstellung von 1-Amino-2-alkoxy-5-brom-benzolen | |
| DE2104682C3 (de) | Verfahren zur Herstellung von o-Sulfamidobenzoesäuren | |
| DE69013062T2 (de) | Verfahren zur Herstellung von Anilinofumarat via Chloromaleat oder Chlorofumarat oder Mischungen davon. | |
| DE2127898C3 (de) | Verfahren zur Herstellung von ge gebenenfalls inert substituierten o und p Aminothiophenolen | |
| DE3135728C2 (de) | Verfahren zur Herstellung von Apovincaminsäureestern | |
| DE1695067B1 (de) | Verfahren zur Herstellung von 5-Cyanuracilen | |
| AT206897B (de) | Verfahren zur Herstellung von neuen 4-Oxo-2-(halogenalkyl)-2,3-dihydro-[benzo-1,3-oxazinen] | |
| DE2613838A1 (de) | Verfahren zum erzeugen der eckige klammer auf o-(2,6-dichloranilino)- phenyl eckige klammer zu -essigsaeure und von salzen derselben | |
| DE2449219C2 (de) | Verfahren zur Gewinnung von 1-Nitroanthrachinon | |
| AT372940B (de) | Verfahren zur herstellung von (d)-(-)-phydroxyphenylglycylchlorid-hydrochlorid | |
| EP0111120B1 (de) | Verfahren zur Herstellung von Anthrachinonen | |
| AT223324B (de) | Verfahren zur Herstellung von Nitrilen der Tetracycline | |
| DE2640616B2 (de) | Verfahren zur Herstellung von N-Acyl-2-arylglycinen | |
| EP0033476B1 (de) | Verfahren zur Herstellung von 4-Amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4H)-on | |
| DE2513952C2 (de) | Verfahren zur herstellung von monochlorbenzoesaeuren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination |