DE2058532C3 - Verfahren zur Herstellung von 1-Aryloxy-3-aminopropan-Derivaten und neue 1-Aryloxy-3-amino-2-propanoläther - Google Patents
Verfahren zur Herstellung von 1-Aryloxy-3-aminopropan-Derivaten und neue 1-Aryloxy-3-amino-2-propanolätherInfo
- Publication number
- DE2058532C3 DE2058532C3 DE19702058532 DE2058532A DE2058532C3 DE 2058532 C3 DE2058532 C3 DE 2058532C3 DE 19702058532 DE19702058532 DE 19702058532 DE 2058532 A DE2058532 A DE 2058532A DE 2058532 C3 DE2058532 C3 DE 2058532C3
- Authority
- DE
- Germany
- Prior art keywords
- parts
- tert
- ether
- azetidinol
- ppm
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 24
- 230000008569 process Effects 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 4
- ZQQSYPZAPHRXRY-UHFFFAOYSA-N 1-hydroxyazetidine Chemical group ON1CCC1 ZQQSYPZAPHRXRY-UHFFFAOYSA-N 0.000 claims description 29
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000006239 protecting group Chemical group 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- AKUFUVLOXPTTHS-UHFFFAOYSA-N n-[3-(2,3-dimethylphenoxy)-2-phenylmethoxypropyl]-2-methylpropan-2-amine Chemical compound CC1=CC=CC(OCC(CNC(C)(C)C)OCC=2C=CC=CC=2)=C1C AKUFUVLOXPTTHS-UHFFFAOYSA-N 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 125000001033 ether group Chemical group 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 124
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 101
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 57
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 55
- 239000000243 solution Substances 0.000 description 47
- 239000000203 mixture Substances 0.000 description 41
- 235000011121 sodium hydroxide Nutrition 0.000 description 33
- -1 naphthol compound Chemical class 0.000 description 31
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- 150000001875 compounds Chemical class 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 19
- 235000011118 potassium hydroxide Nutrition 0.000 description 19
- 239000011541 reaction mixture Substances 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 150000002989 phenols Chemical class 0.000 description 16
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 15
- 150000004780 naphthols Chemical class 0.000 description 15
- QWBBPBRQALCEIZ-UHFFFAOYSA-N 2,3-dimethylphenol Chemical compound CC1=CC=CC(O)=C1C QWBBPBRQALCEIZ-UHFFFAOYSA-N 0.000 description 14
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 14
- 229910001873 dinitrogen Inorganic materials 0.000 description 14
- 239000000284 extract Substances 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 13
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- 150000003141 primary amines Chemical class 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000013078 crystal Substances 0.000 description 12
- 235000019441 ethanol Nutrition 0.000 description 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 12
- 229960004592 isopropanol Drugs 0.000 description 11
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 10
- 238000007142 ring opening reaction Methods 0.000 description 10
- 238000005481 NMR spectroscopy Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- MGAXYKDBRBNWKT-UHFFFAOYSA-N (5-oxooxolan-2-yl)methyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCC1OC(=O)CC1 MGAXYKDBRBNWKT-UHFFFAOYSA-N 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 239000004593 Epoxy Substances 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- XSGMJDQRZDWEPW-UHFFFAOYSA-N 1-propan-2-ylazetidin-3-ol Chemical compound CC(C)N1CC(O)C1 XSGMJDQRZDWEPW-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- HONIICLYMWZJFZ-UHFFFAOYSA-N azetidine Chemical class C1CNC1 HONIICLYMWZJFZ-UHFFFAOYSA-N 0.000 description 5
- 150000001539 azetidines Chemical class 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- SSQMTFZAUDZFTK-UHFFFAOYSA-N 1-tert-butylazetidin-3-ol Chemical compound CC(C)(C)N1CC(O)C1 SSQMTFZAUDZFTK-UHFFFAOYSA-N 0.000 description 4
- SJFOBPUCUQBNGQ-UHFFFAOYSA-N 3-phenylmethoxy-1-propan-2-ylazetidine Chemical compound C1N(C(C)C)CC1OCC1=CC=CC=C1 SJFOBPUCUQBNGQ-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- GMWFCJXSQQHBPI-UHFFFAOYSA-N azetidin-3-ol Chemical class OC1CNC1 GMWFCJXSQQHBPI-UHFFFAOYSA-N 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 4
- 239000012434 nucleophilic reagent Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- PALQHDJEQRWLAZ-UHFFFAOYSA-N 1-butan-2-ylazetidin-3-ol Chemical compound CCC(C)N1CC(O)C1 PALQHDJEQRWLAZ-UHFFFAOYSA-N 0.000 description 3
- ZMXWVFGREWGXIE-UHFFFAOYSA-N 1-ethylazetidin-3-ol Chemical compound CCN1CC(O)C1 ZMXWVFGREWGXIE-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 230000000269 nucleophilic effect Effects 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- RKUQLAPSGZJLGP-UHFFFAOYSA-N xibenolol Chemical compound CC1=CC=CC(OCC(O)CNC(C)(C)C)=C1C RKUQLAPSGZJLGP-UHFFFAOYSA-N 0.000 description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 2
- ZSBDGXGICLIJGD-UHFFFAOYSA-N 4-phenoxyphenol Chemical compound C1=CC(O)=CC=C1OC1=CC=CC=C1 ZSBDGXGICLIJGD-UHFFFAOYSA-N 0.000 description 2
- LMIQERWZRIFWNZ-UHFFFAOYSA-N 5-hydroxyindole Chemical compound OC1=CC=C2NC=CC2=C1 LMIQERWZRIFWNZ-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 230000005587 bubbling Effects 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 238000010183 spectrum analysis Methods 0.000 description 2
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JAAJQSRLGAYGKZ-UHFFFAOYSA-N 1,2,3,4-tetrahydronaphthalen-1-ol Chemical compound C1=CC=C2C(O)CCCC2=C1 JAAJQSRLGAYGKZ-UHFFFAOYSA-N 0.000 description 1
- HVELAOQZAFXLRD-UHFFFAOYSA-N 1,3-dibromopropan-2-yloxymethylbenzene Chemical compound BrCC(CBr)OCC1=CC=CC=C1 HVELAOQZAFXLRD-UHFFFAOYSA-N 0.000 description 1
- PSXZILDFNHACKW-UHFFFAOYSA-N 1,3-dichloropropan-2-yloxymethylbenzene Chemical compound ClCC(CCl)OCC1=CC=CC=C1 PSXZILDFNHACKW-UHFFFAOYSA-N 0.000 description 1
- 125000005877 1,4-benzodioxanyl group Chemical group 0.000 description 1
- GKTHMDLNLVOVPL-UHFFFAOYSA-N 1-(1,3-dibromopropan-2-yloxymethyl)-2-ethoxybenzene Chemical compound CCOC1=CC=CC=C1COC(CBr)CBr GKTHMDLNLVOVPL-UHFFFAOYSA-N 0.000 description 1
- YSHQCDCAEQSEHH-UHFFFAOYSA-N 1-(1,3-dibromopropan-2-yloxymethyl)-2-methoxybenzene Chemical compound COC1=CC=CC=C1COC(CBr)CBr YSHQCDCAEQSEHH-UHFFFAOYSA-N 0.000 description 1
- SZGQTMHGGIHAQJ-UHFFFAOYSA-N 1-(1,3-dibromopropan-2-yloxymethyl)-4-ethoxybenzene Chemical compound CCOC1=CC=C(COC(CBr)CBr)C=C1 SZGQTMHGGIHAQJ-UHFFFAOYSA-N 0.000 description 1
- HPNMJIXADOURAS-UHFFFAOYSA-N 1-(1,3-dibromopropan-2-yloxymethyl)-4-ethylbenzene Chemical compound CCC1=CC=C(COC(CBr)CBr)C=C1 HPNMJIXADOURAS-UHFFFAOYSA-N 0.000 description 1
- GFBZSKFBOVJDKJ-UHFFFAOYSA-N 1-(1,3-dibromopropan-2-yloxymethyl)-4-methoxybenzene Chemical compound COC1=CC=C(COC(CBr)CBr)C=C1 GFBZSKFBOVJDKJ-UHFFFAOYSA-N 0.000 description 1
- JANMDZLPZXTOLC-UHFFFAOYSA-N 1-(1,3-dibromopropan-2-yloxymethyl)-4-methylbenzene Chemical compound CC1=CC=C(COC(CBr)CBr)C=C1 JANMDZLPZXTOLC-UHFFFAOYSA-N 0.000 description 1
- LDOKXGJELYOGDT-UHFFFAOYSA-N 1-(1,3-dichloropropan-2-yloxymethyl)-4-methoxybenzene Chemical compound COC1=CC=C(COC(CCl)CCl)C=C1 LDOKXGJELYOGDT-UHFFFAOYSA-N 0.000 description 1
- IDRQZUPJALWOTG-UHFFFAOYSA-N 1-(1,3-dichloropropan-2-yloxymethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(COC(CCl)CCl)C=C1 IDRQZUPJALWOTG-UHFFFAOYSA-N 0.000 description 1
- BLOZPOZETDEMRB-UHFFFAOYSA-N 1-(4-aminophenoxy)-3-(tert-butylamino)propan-2-ol Chemical compound CC(C)(C)NCC(O)COC1=CC=C(N)C=C1 BLOZPOZETDEMRB-UHFFFAOYSA-N 0.000 description 1
- ZWFAPQYDHNZNAF-UHFFFAOYSA-N 1-(6-methoxynaphthalen-1-yl)oxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride Chemical compound Cl.CC(C)NCC(O)COC1=CC=CC2=CC(OC)=CC=C21 ZWFAPQYDHNZNAF-UHFFFAOYSA-N 0.000 description 1
- QHRYZVSYFRFRSI-UHFFFAOYSA-N 1-(butan-2-ylamino)-3-naphthalen-1-yloxypropan-2-ol Chemical compound C1=CC=C2C(OCC(O)CNC(C)CC)=CC=CC2=C1 QHRYZVSYFRFRSI-UHFFFAOYSA-N 0.000 description 1
- RNFDZDMIFOFNMC-UHFFFAOYSA-N 1-(propan-2-ylamino)propan-2-ol Chemical compound CC(C)NCC(C)O RNFDZDMIFOFNMC-UHFFFAOYSA-N 0.000 description 1
- AYNBYSNISOAOHW-UHFFFAOYSA-N 1-(tert-butylamino)propan-2-ol Chemical compound CC(O)CNC(C)(C)C AYNBYSNISOAOHW-UHFFFAOYSA-N 0.000 description 1
- VSUFYTXHYIJZDU-UHFFFAOYSA-N 1-benzyl-3-(2-methylbutan-2-yloxy)azetidine Chemical compound C1C(OC(C)(C)CC)CN1CC1=CC=CC=C1 VSUFYTXHYIJZDU-UHFFFAOYSA-N 0.000 description 1
- OTCFGUJMMRFGJQ-UHFFFAOYSA-N 1-benzyl-3-(propan-2-yloxymethoxy)azetidine Chemical compound C1C(OCOC(C)C)CN1CC1=CC=CC=C1 OTCFGUJMMRFGJQ-UHFFFAOYSA-N 0.000 description 1
- JYFDXGJNTIUWIB-UHFFFAOYSA-N 1-benzyl-3-(propoxymethoxy)azetidine Chemical compound C1C(OCOCCC)CN1CC1=CC=CC=C1 JYFDXGJNTIUWIB-UHFFFAOYSA-N 0.000 description 1
- AQFODHGQBIVLBR-UHFFFAOYSA-N 1-benzyl-3-[(2-methylpropan-2-yl)oxy]azetidine Chemical compound C1C(OC(C)(C)C)CN1CC1=CC=CC=C1 AQFODHGQBIVLBR-UHFFFAOYSA-N 0.000 description 1
- XQBGMFKJWPKWTK-UHFFFAOYSA-N 1-benzyl-3-[(2-methylpropan-2-yl)oxymethoxy]azetidine Chemical compound C1C(OCOC(C)(C)C)CN1CC1=CC=CC=C1 XQBGMFKJWPKWTK-UHFFFAOYSA-N 0.000 description 1
- QDGMEVPZFRGEPF-UHFFFAOYSA-N 1-benzyl-3-phenylmethoxyazetidine Chemical compound C=1C=CC=CC=1COC(C1)CN1CC1=CC=CC=C1 QDGMEVPZFRGEPF-UHFFFAOYSA-N 0.000 description 1
- JOXQHYFVXZZGQZ-UHFFFAOYSA-N 1-benzylazetidin-3-ol Chemical compound C1C(O)CN1CC1=CC=CC=C1 JOXQHYFVXZZGQZ-UHFFFAOYSA-N 0.000 description 1
- DHKHRPLFCUZKQV-UHFFFAOYSA-N 1-benzylazetidine Chemical compound C=1C=CC=CC=1CN1CCC1 DHKHRPLFCUZKQV-UHFFFAOYSA-N 0.000 description 1
- NSIJSVHOTIJCAY-UHFFFAOYSA-N 1-chloro-4-(1,3-dichloropropan-2-yloxymethyl)benzene Chemical compound ClCC(CCl)OCC1=CC=C(Cl)C=C1 NSIJSVHOTIJCAY-UHFFFAOYSA-N 0.000 description 1
- WTCGZBVNMLQEOR-UHFFFAOYSA-N 1-ethyl-3-[(2-methoxyphenyl)methoxy]azetidine Chemical compound C1N(CC)CC1OCC1=CC=CC=C1OC WTCGZBVNMLQEOR-UHFFFAOYSA-N 0.000 description 1
- PBZDMJPCSCINFE-UHFFFAOYSA-N 1-ethyl-3-[(4-ethylphenyl)methoxy]azetidine Chemical compound C1N(CC)CC1OCC1=CC=C(CC)C=C1 PBZDMJPCSCINFE-UHFFFAOYSA-N 0.000 description 1
- PFFXUADGQZWFBN-UHFFFAOYSA-N 1-ethyl-3-[(4-methoxyphenyl)methoxy]azetidine Chemical compound C1N(CC)CC1OCC1=CC=C(OC)C=C1 PFFXUADGQZWFBN-UHFFFAOYSA-N 0.000 description 1
- ZKDCRQUFSXESJG-UHFFFAOYSA-N 1-ethyl-3-[(4-methylphenyl)methoxy]azetidine Chemical compound C1N(CC)CC1OCC1=CC=C(C)C=C1 ZKDCRQUFSXESJG-UHFFFAOYSA-N 0.000 description 1
- PTZBYWLHYOFCFP-UHFFFAOYSA-N 1-ethyl-3-phenylmethoxyazetidine Chemical compound C1N(CC)CC1OCC1=CC=CC=C1 PTZBYWLHYOFCFP-UHFFFAOYSA-N 0.000 description 1
- OIKCWRSRDFQMFZ-UHFFFAOYSA-N 1-methyl-3-[(4-methylphenyl)methoxy]azetidine Chemical compound C1N(C)CC1OCC1=CC=C(C)C=C1 OIKCWRSRDFQMFZ-UHFFFAOYSA-N 0.000 description 1
- COJMYCSMNZBNCW-UHFFFAOYSA-N 1-methyl-3-phenylmethoxyazetidine Chemical compound C1N(C)CC1OCC1=CC=CC=C1 COJMYCSMNZBNCW-UHFFFAOYSA-N 0.000 description 1
- XXSOEWWDZLXPJE-UHFFFAOYSA-N 1-tert-butyl-3-(2-methylbutan-2-yloxy)azetidine Chemical compound CCC(C)(C)OC1CN(C(C)(C)C)C1 XXSOEWWDZLXPJE-UHFFFAOYSA-N 0.000 description 1
- WSMWEXFTBCXMQX-UHFFFAOYSA-N 1-tert-butyl-3-[(2-methylpropan-2-yl)oxy]azetidine Chemical compound CC(C)(C)OC1CN(C(C)(C)C)C1 WSMWEXFTBCXMQX-UHFFFAOYSA-N 0.000 description 1
- NMPYQFGJDQFVHU-UHFFFAOYSA-N 1-tert-butyl-3-[(2-methylpropan-2-yl)oxymethoxy]azetidine Chemical compound CC(C)(C)OCOC1CN(C(C)(C)C)C1 NMPYQFGJDQFVHU-UHFFFAOYSA-N 0.000 description 1
- AVUCLQOBPPGMFM-UHFFFAOYSA-N 1-tert-butyl-3-[(4-chlorophenyl)methoxy]azetidine Chemical compound C1N(C(C)(C)C)CC1OCC1=CC=C(Cl)C=C1 AVUCLQOBPPGMFM-UHFFFAOYSA-N 0.000 description 1
- ZAERIGNWSHISGB-UHFFFAOYSA-N 1-tert-butyl-3-[(4-ethoxyphenyl)methoxy]azetidine Chemical compound C1=CC(OCC)=CC=C1COC1CN(C(C)(C)C)C1 ZAERIGNWSHISGB-UHFFFAOYSA-N 0.000 description 1
- SXIRHLBQWVNRLN-UHFFFAOYSA-N 1-tert-butyl-3-phenylmethoxyazetidine Chemical compound C1N(C(C)(C)C)CC1OCC1=CC=CC=C1 SXIRHLBQWVNRLN-UHFFFAOYSA-N 0.000 description 1
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical compound OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 description 1
- RLEWTHFVGOXXTN-UHFFFAOYSA-N 2,3-diethylphenol Chemical compound CCC1=CC=CC(O)=C1CC RLEWTHFVGOXXTN-UHFFFAOYSA-N 0.000 description 1
- IGXSSRPZRAIXQF-UHFFFAOYSA-N 2,3-dihydro-1,4-benzodioxin-5-ol Chemical compound O1CCOC2=C1C=CC=C2O IGXSSRPZRAIXQF-UHFFFAOYSA-N 0.000 description 1
- ZGOBJMLOXGEBAD-UHFFFAOYSA-N 2-(methoxymethoxy)-3-phenoxy-n-propan-2-ylpropan-1-amine Chemical compound COCOC(CNC(C)C)COC1=CC=CC=C1 ZGOBJMLOXGEBAD-UHFFFAOYSA-N 0.000 description 1
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical class C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 1
- OCKYMBMCPOAFLL-UHFFFAOYSA-N 2-ethyl-3-methylphenol Chemical compound CCC1=C(C)C=CC=C1O OCKYMBMCPOAFLL-UHFFFAOYSA-N 0.000 description 1
- WHGXZPQWZJUGEP-UHFFFAOYSA-N 2-prop-1-enylphenol Chemical compound CC=CC1=CC=CC=C1O WHGXZPQWZJUGEP-UHFFFAOYSA-N 0.000 description 1
- FNEJKCGACRPXBT-UHFFFAOYSA-N 2-prop-2-enoxyphenol Chemical compound OC1=CC=CC=C1OCC=C FNEJKCGACRPXBT-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical class [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- ZFLYJWXVTNXHFF-UHFFFAOYSA-N 3-(2-methylbutan-2-yloxy)-1-propan-2-ylazetidine Chemical compound CCC(C)(C)OC1CN(C(C)C)C1 ZFLYJWXVTNXHFF-UHFFFAOYSA-N 0.000 description 1
- OXEJYBKPQIJWQH-UHFFFAOYSA-N 3-(methoxymethoxy)-1-propan-2-ylazetidine Chemical compound COCOC1CN(C(C)C)C1 OXEJYBKPQIJWQH-UHFFFAOYSA-N 0.000 description 1
- OSMYAKZWEIVENZ-UHFFFAOYSA-N 3-[(2-methylpropan-2-yl)oxymethoxy]-1-propan-2-ylazetidine Chemical compound CC(C)N1CC(OCOC(C)(C)C)C1 OSMYAKZWEIVENZ-UHFFFAOYSA-N 0.000 description 1
- XMEOTMGCFUAHCR-UHFFFAOYSA-N 3-[(4-chlorophenyl)methoxy]-1-ethylazetidine Chemical compound C1N(CC)CC1OCC1=CC=C(Cl)C=C1 XMEOTMGCFUAHCR-UHFFFAOYSA-N 0.000 description 1
- IMXQDAZWVHACSV-UHFFFAOYSA-N 3-[(4-chlorophenyl)methoxy]-1-propan-2-ylazetidine Chemical compound C1N(C(C)C)CC1OCC1=CC=C(Cl)C=C1 IMXQDAZWVHACSV-UHFFFAOYSA-N 0.000 description 1
- YPNYSFTVIQJISD-UHFFFAOYSA-N 3-[(4-ethoxyphenyl)methoxy]-1-methylazetidine Chemical compound C1=CC(OCC)=CC=C1COC1CN(C)C1 YPNYSFTVIQJISD-UHFFFAOYSA-N 0.000 description 1
- QLCQGJPGYAYLEJ-UHFFFAOYSA-N 3-[(4-ethoxyphenyl)methoxy]-1-propan-2-ylazetidine Chemical compound C1=CC(OCC)=CC=C1COC1CN(C(C)C)C1 QLCQGJPGYAYLEJ-UHFFFAOYSA-N 0.000 description 1
- IIJDVMNNZUGUJB-UHFFFAOYSA-N 3-[(4-ethylphenyl)methoxy]-1-methylazetidine Chemical compound C1=CC(CC)=CC=C1COC1CN(C)C1 IIJDVMNNZUGUJB-UHFFFAOYSA-N 0.000 description 1
- DLGFAGWXPUHGGA-UHFFFAOYSA-N 3-[(4-methoxyphenyl)methoxy]-1-methylazetidine Chemical compound C1=CC(OC)=CC=C1COC1CN(C)C1 DLGFAGWXPUHGGA-UHFFFAOYSA-N 0.000 description 1
- WGVDGSFAHIFTSJ-UHFFFAOYSA-N 3-[(4-methoxyphenyl)methoxy]-1-propan-2-ylazetidine Chemical compound C1=CC(OC)=CC=C1COC1CN(C(C)C)C1 WGVDGSFAHIFTSJ-UHFFFAOYSA-N 0.000 description 1
- KUSRTKSBVNAGJX-UHFFFAOYSA-N 3-[(4-methylphenyl)methoxy]-1-propan-2-ylazetidine Chemical compound C1N(C(C)C)CC1OCC1=CC=C(C)C=C1 KUSRTKSBVNAGJX-UHFFFAOYSA-N 0.000 description 1
- 229940018563 3-aminophenol Drugs 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- DQKSIYKOLUBHOU-UHFFFAOYSA-N 3-phenylmethoxy-1-propylazetidine Chemical compound C1N(CCC)CC1OCC1=CC=CC=C1 DQKSIYKOLUBHOU-UHFFFAOYSA-N 0.000 description 1
- JGYGKBGVNBUHQQ-UHFFFAOYSA-N 4-[3-(tert-butylamino)-2-hydroxypropoxy]phenol;hydrochloride Chemical compound Cl.CC(C)(C)NCC(O)COC1=CC=C(O)C=C1 JGYGKBGVNBUHQQ-UHFFFAOYSA-N 0.000 description 1
- MTCGSLDAATXWFP-UHFFFAOYSA-N 4-methoxy-2,3-dimethylphenol Chemical compound COC1=CC=C(O)C(C)=C1C MTCGSLDAATXWFP-UHFFFAOYSA-N 0.000 description 1
- SCWNNOCLLOHZIG-UHFFFAOYSA-N 5,6,7,8-tetrahydro-1-naphthol Chemical compound C1CCCC2=C1C=CC=C2O SCWNNOCLLOHZIG-UHFFFAOYSA-N 0.000 description 1
- YPPZCRZRQHFRBH-UHFFFAOYSA-N 5-hydroxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=C1C=CC=C2O YPPZCRZRQHFRBH-UHFFFAOYSA-N 0.000 description 1
- FNSQPQKPPGALFA-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(O)=CC=C21 FNSQPQKPPGALFA-UHFFFAOYSA-N 0.000 description 1
- LPPSENSUXVOOII-UHFFFAOYSA-N 6-methoxynaphthalen-1-ol Chemical compound OC1=CC=CC2=CC(OC)=CC=C21 LPPSENSUXVOOII-UHFFFAOYSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 208000008469 Peptic Ulcer Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- LJSAJMXWXGSVNA-UHFFFAOYSA-N a805044 Chemical compound OC1=CC=C(O)C=C1.OC1=CC=C(O)C=C1 LJSAJMXWXGSVNA-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000000674 adrenergic antagonist Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000007824 aliphatic compounds Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000767 anti-ulcer Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- AIXMJTYHQHQJLU-UHFFFAOYSA-N chembl210858 Chemical compound O1C(CC(=O)OC)CC(C=2C=CC(O)=CC=2)=N1 AIXMJTYHQHQJLU-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 208000000718 duodenal ulcer Diseases 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- PCILLCXFKWDRMK-UHFFFAOYSA-N naphthalene-1,4-diol Chemical compound C1=CC=C2C(O)=CC=C(O)C2=C1 PCILLCXFKWDRMK-UHFFFAOYSA-N 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 238000007344 nucleophilic reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000001175 peptic effect Effects 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- OURGMGVAAPDPBX-UHFFFAOYSA-N propan-2-amine;propane Chemical compound CCC.CC(C)N OURGMGVAAPDPBX-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000006318 tert-butyl amino group Chemical group [H]N(*)C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- NXQMNKUGGYNLBY-UHFFFAOYSA-N toliprolol Chemical compound CC(C)NCC(O)COC1=CC=CC(C)=C1 NXQMNKUGGYNLBY-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/08—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions not involving the formation of amino groups, hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/34—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by halogen atoms, by trihalomethyl, nitro or nitroso groups, or by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D205/00—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom
- C07D205/02—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D205/04—Heterocyclic compounds containing four-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D319/00—Heterocyclic compounds containing six-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D319/10—1,4-Dioxanes; Hydrogenated 1,4-dioxanes
- C07D319/14—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems
- C07D319/16—1,4-Dioxanes; Hydrogenated 1,4-dioxanes condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D319/18—Ethylenedioxybenzenes, not substituted on the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP9502769 | 1969-11-28 | ||
| JP2654970 | 1970-03-31 | ||
| JP2654870A JPS4815925B1 (OSRAM) | 1970-03-31 | 1970-03-31 | |
| JP45063377A JPS4943949B1 (OSRAM) | 1970-07-21 | 1970-07-21 | |
| JP9042970 | 1970-10-16 | ||
| JP9973370A JPS4943950B1 (OSRAM) | 1970-11-13 | 1970-11-13 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2058532A1 DE2058532A1 (de) | 1972-02-03 |
| DE2058532B2 DE2058532B2 (de) | 1978-11-09 |
| DE2058532C3 true DE2058532C3 (de) | 1979-08-09 |
Family
ID=27549297
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702058532 Expired DE2058532C3 (de) | 1969-11-28 | 1970-11-27 | Verfahren zur Herstellung von 1-Aryloxy-3-aminopropan-Derivaten und neue 1-Aryloxy-3-amino-2-propanoläther |
| DE19702065365 Expired DE2065365C3 (de) | 1969-11-28 | 1970-11-27 | 1,3-disubstituierte Azetidine sowie Verfahren zu deren Herstellung und ihre Anwendung |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702065365 Expired DE2065365C3 (de) | 1969-11-28 | 1970-11-27 | 1,3-disubstituierte Azetidine sowie Verfahren zu deren Herstellung und ihre Anwendung |
Country Status (6)
| Country | Link |
|---|---|
| CH (2) | CH561171A5 (OSRAM) |
| DE (2) | DE2058532C3 (OSRAM) |
| FR (1) | FR2073434B1 (OSRAM) |
| GB (2) | GB1349358A (OSRAM) |
| NL (1) | NL145842B (OSRAM) |
| SE (1) | SE378102B (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5123489B1 (OSRAM) * | 1971-05-07 | 1976-07-17 | ||
| DE2644833A1 (de) * | 1976-10-05 | 1978-04-20 | Boehringer Sohn Ingelheim | Neue 1-aryloxy-2-hydroxy-3-alkylenaminopropane und verfahren zu ihrer herstellung |
| US4210653A (en) * | 1978-06-27 | 1980-07-01 | Merck & Co., Inc. | Pyridyloxypropanolamines |
| MY110249A (en) * | 1989-05-31 | 1998-03-31 | Univ Florida State | Method for preparation of taxol using beta lactam |
| US5284865A (en) | 1991-09-23 | 1994-02-08 | Holton Robert A | Cyclohexyl substituted taxanes and pharmaceutical compositions containing them |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE735057A (OSRAM) * | 1968-06-27 | 1969-12-01 |
-
1970
- 1970-11-27 NL NL7017367A patent/NL145842B/xx not_active IP Right Cessation
- 1970-11-27 DE DE19702058532 patent/DE2058532C3/de not_active Expired
- 1970-11-27 GB GB2014270A patent/GB1349358A/en not_active Expired
- 1970-11-27 FR FR7042805A patent/FR2073434B1/fr not_active Expired
- 1970-11-27 SE SE1610470A patent/SE378102B/xx unknown
- 1970-11-27 DE DE19702065365 patent/DE2065365C3/de not_active Expired
- 1970-11-27 GB GB5650170A patent/GB1349357A/en not_active Expired
- 1970-11-30 CH CH1770170A patent/CH561171A5/xx not_active IP Right Cessation
- 1970-11-30 CH CH1843972A patent/CH549013A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2073434B1 (OSRAM) | 1975-08-01 |
| GB1349357A (en) | 1974-04-03 |
| DE2065365A1 (de) | 1973-05-17 |
| CH549013A (de) | 1974-05-15 |
| SE378102B (OSRAM) | 1975-08-18 |
| NL145842B (nl) | 1975-05-15 |
| FR2073434A1 (OSRAM) | 1971-10-01 |
| CH561171A5 (OSRAM) | 1975-04-30 |
| DE2058532A1 (de) | 1972-02-03 |
| DE2065365C3 (de) | 1982-05-06 |
| DE2065365B2 (de) | 1981-08-13 |
| GB1349358A (en) | 1974-04-03 |
| NL7017367A (OSRAM) | 1971-06-02 |
| DE2058532B2 (de) | 1978-11-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0004920A1 (de) | Carbazolyl-(4)-oxy-propanolamin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1668055A1 (de) | Verfahren zur Herstellung von basisch substituierten Cyclopentylphenolaethern | |
| DE2058532C3 (de) | Verfahren zur Herstellung von 1-Aryloxy-3-aminopropan-Derivaten und neue 1-Aryloxy-3-amino-2-propanoläther | |
| DE2132761A1 (de) | 2-AEthynylcyclopropanverbindungen und Verfahren zur Herstellung derselben | |
| DE916168C (de) | Verfahren zur Herstellung von Pyrrolidinoalkylphenothiazinen | |
| DE1543777B2 (de) | Verfahren zur Herstellung von alpha niedrig Alkyl beta (4 hydroxy phenyl) alaninen | |
| EP0923534B1 (de) | Verfahren zur herstellung von racemischen phenethylaminen | |
| DE2540552A1 (de) | Cycloalkylderivate von 1-aryloxy-3- amino-2-propanolen | |
| DE766207C (de) | Verfahren zur Herstellung von basischen Verbindungen der Diarylmethanreihe | |
| DE2330241C3 (de) | Chlorthio-N-phthalimid, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE2924712A1 (de) | Verfahren zur herstellung von n-alkylbenzothiazolonderivaten | |
| CH542179A (de) | Verfahren zur Herstellung des optisch inaktiven oder optisch aktiven N,N'-Bis-(2-(3',4'-dihydroxyphenyl)-2-hydroxyäthyl)-hexamethylendiamins und der Salze desselben | |
| CH449647A (de) | Verbindungen zur Herstellung von substituierten Hydrazinverbindungen | |
| AT164533B (de) | Verfahren zur Herstellung von neuen Äthylendiaminderivaten | |
| DE2222471C3 (de) | Verfahren zur Herstellung von 1-(Acylamino-aryloxy)-3-aminopropanol-Derivaten sowie deren nicht-toxischen Säureadditionssalzen | |
| DE1166782B (de) | Verfahren zur Herstellung von substituierten aromatischen Dicarbonsaeureimiden und deren Salzen | |
| DE1518652A1 (de) | Verfahren zur Herstellung von pharmazeutisch wirksamen Derivaten des 2-Aminoindans | |
| DD139837A5 (de) | Verfahren zur herstellung optisch aktiver basen | |
| DD220304A5 (de) | Verfahren zur herstellung von 1-(alkyl-hydroxy-phenyl)-1-hydroxy-2-(alkylamino)-propanen | |
| DE931828C (de) | Verfahren zur Herstellung von AEthylendiaminderivaten | |
| DD144262A5 (de) | Verfahren zur herstellung neuer 1-pyrrol-und 1-pyrrolidinkarbonsaeurederivate | |
| AT274806B (de) | Verfahren zur Herstellung von in 2-Stellung substituierten 1,3-Diazacyclopentenen-(2) | |
| AT225197B (de) | Verfahren zur Herstellung der neuen N-[p-3,3-disubstituierten-1-Azetidinyläthoxy)-benzyl]-3,4,5-trimethoxybenzamide | |
| DE916055C (de) | Verfahren zur Herstellung von Aminoverbindungen | |
| DE485315C (de) | Verfahren zur Darstellung von 8-Oxychinolin und dessen Derivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: KOHLER, M., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |