DE2050362A1 - Verfahren zur Herstellung von Natriumnitrilotnacetat - Google Patents
Verfahren zur Herstellung von NatriumnitrilotnacetatInfo
- Publication number
- DE2050362A1 DE2050362A1 DE19702050362 DE2050362A DE2050362A1 DE 2050362 A1 DE2050362 A1 DE 2050362A1 DE 19702050362 DE19702050362 DE 19702050362 DE 2050362 A DE2050362 A DE 2050362A DE 2050362 A1 DE2050362 A1 DE 2050362A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- sodium
- minutes
- sodium hydroxide
- nitrilotriacetonitrile
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000002360 preparation method Methods 0.000 title claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 title description 2
- 229910052708 sodium Inorganic materials 0.000 title description 2
- 239000011734 sodium Substances 0.000 title description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 54
- 238000006243 chemical reaction Methods 0.000 claims description 18
- LJAIDEYQVIJERM-UHFFFAOYSA-N 2-[bis(cyanomethyl)amino]acetonitrile Chemical compound N#CCN(CC#N)CC#N LJAIDEYQVIJERM-UHFFFAOYSA-N 0.000 claims description 10
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 claims description 7
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 16
- 235000011121 sodium hydroxide Nutrition 0.000 description 15
- 229910021529 ammonia Inorganic materials 0.000 description 8
- 239000000047 product Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000002738 chelating agent Substances 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- ZYBXCIBWFOILPE-UHFFFAOYSA-N [Na].N#CC#N Chemical compound [Na].N#CC#N ZYBXCIBWFOILPE-UHFFFAOYSA-N 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- RHPXYIKALIRNFA-UHFFFAOYSA-L disodium;2-[carboxylatomethyl(carboxymethyl)amino]acetate Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CC([O-])=O RHPXYIKALIRNFA-UHFFFAOYSA-L 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 238000011031 large-scale manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- -1 nitrile compound Chemical class 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- JMANVNJQNLATNU-UHFFFAOYSA-N oxalonitrile Chemical compound N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- ZAWGLAXBGYSUHN-UHFFFAOYSA-M sodium;2-[bis(carboxymethyl)amino]acetate Chemical compound [Na+].OC(=O)CN(CC(O)=O)CC([O-])=O ZAWGLAXBGYSUHN-UHFFFAOYSA-M 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 1
- JEVFKQIDHQGBFB-UHFFFAOYSA-K tripotassium;2-[bis(carboxylatomethyl)amino]acetate Chemical compound [K+].[K+].[K+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O JEVFKQIDHQGBFB-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/26—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton from compounds containing carboxyl groups by reaction with HCN, or a salt thereof, and amines, or from aminonitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/06—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton
- C07C229/10—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
- C07C229/16—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings to carbon atoms of hydrocarbon radicals substituted by amino or carboxyl groups, e.g. ethylenediamine-tetra-acetic acid, iminodiacetic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/24—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having more than one carboxyl group bound to the carbon skeleton, e.g. aspartic acid
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/24—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the same saturated acyclic carbon skeleton
- C07C255/25—Aminoacetonitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US86672369A | 1969-10-15 | 1969-10-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2050362A1 true DE2050362A1 (de) | 1971-04-29 |
Family
ID=25348254
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702050362 Pending DE2050362A1 (de) | 1969-10-15 | 1970-10-14 | Verfahren zur Herstellung von Natriumnitrilotnacetat |
Country Status (8)
| Country | Link |
|---|---|
| BE (1) | BE757487A (enExample) |
| CH (1) | CH547769A (enExample) |
| DE (1) | DE2050362A1 (enExample) |
| FR (1) | FR2065133A5 (enExample) |
| GB (1) | GB1305486A (enExample) |
| IL (1) | IL35252A (enExample) |
| NL (1) | NL7013609A (enExample) |
| SE (1) | SE358153B (enExample) |
-
0
- BE BE757487D patent/BE757487A/xx unknown
-
1970
- 1970-09-07 IL IL35252A patent/IL35252A/xx unknown
- 1970-09-15 NL NL7013609A patent/NL7013609A/xx unknown
- 1970-09-17 GB GB4442570A patent/GB1305486A/en not_active Expired
- 1970-10-07 FR FR7036218A patent/FR2065133A5/fr not_active Expired
- 1970-10-07 CH CH1482970A patent/CH547769A/xx not_active IP Right Cessation
- 1970-10-13 SE SE13839/70A patent/SE358153B/xx unknown
- 1970-10-14 DE DE19702050362 patent/DE2050362A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| NL7013609A (enExample) | 1971-04-19 |
| IL35252A (en) | 1974-01-14 |
| BE757487A (fr) | 1971-04-14 |
| CH547769A (de) | 1974-04-11 |
| SE358153B (enExample) | 1973-07-23 |
| GB1305486A (enExample) | 1973-01-31 |
| FR2065133A5 (enExample) | 1971-07-23 |
| IL35252A0 (en) | 1970-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DD219023A3 (de) | Verfahren zur herstellung von natriumtaurinat | |
| DE2354098B2 (de) | Verfahren zur herstellung von mercaptocarbonsaeuren | |
| DE2419455A1 (de) | Verfahren zur herstellung von pnitrotoluol-2-sulfonsaeure | |
| DE2245892C3 (de) | Verfahren zur Herstellung von Citronensäure | |
| DE1247284B (de) | Verfahren zur Herstellung von reinem Hydroxylamin oder von Loesungen des Hydroxylamins in Alkoholen | |
| DE2050362A1 (de) | Verfahren zur Herstellung von Natriumnitrilotnacetat | |
| US2777846A (en) | Process of producing morpholine from diethanolamine | |
| EP0050290B1 (de) | Verfahren zur Herstellung von Alkalisalzen der Imidodisulfonsäure | |
| DE1810164A1 (de) | Hydrazinderivate und Verfahren zur Herstellung derselben | |
| DE839794C (de) | Verfahren zur Herstellung eines ein saures Alkalicyanamid enthaltenden Produktes | |
| DE2710399C3 (de) | Verfahren zur Herstellung von Ammoniumsulfamat | |
| DE1950671C3 (de) | Verfahren zur Herstellung von Alkalirhodanid | |
| DE3221003A1 (de) | Verfahren zur herstellung von estern der cyanoessigsaeure | |
| DE1088939B (de) | Verfahren zur Herstellung von Hydrazin | |
| DE2531281A1 (de) | Aminonaphthalin-derivate | |
| DE2000698B2 (de) | Verfahren zur kontinuierlichen Herstellung von Anthranilsäure | |
| DE2244673A1 (de) | Verfahren zur herstellung von trichlorisocyanursaeure | |
| DE2534735C3 (de) | Verfahren zum Reinigen von Glycin oder D,L-Alanin | |
| DE1768217B1 (de) | Verfahren zur Herstellung von Cyclohexylammonium-N-cyclohexylsulfamat | |
| DE1493910A1 (de) | Verfahren zur Herstellung von Nitriliotriacetonitril | |
| DE1592303C3 (de) | Verfahren zur Herstellung von Azinen | |
| DE1593707C3 (de) | Verfahren zur Herstellung von Azinen | |
| DE1061313B (de) | Verfahren zur Herstellung von Harnstoffsalzen des Natriums oder Kaliums | |
| DE1126885B (de) | Verfahren zur Herstellung aliphatischer Diaminopolycarbonsaeuren | |
| DE1197897B (de) | Verfahren zur Herstellung von Alkalisalzen der Nitrilotriessigsaeure |