DE2035644A1 - Disazofarbstoffe - Google Patents
DisazofarbstoffeInfo
- Publication number
- DE2035644A1 DE2035644A1 DE19702035644 DE2035644A DE2035644A1 DE 2035644 A1 DE2035644 A1 DE 2035644A1 DE 19702035644 DE19702035644 DE 19702035644 DE 2035644 A DE2035644 A DE 2035644A DE 2035644 A1 DE2035644 A1 DE 2035644A1
- Authority
- DE
- Germany
- Prior art keywords
- sulfonic acid
- group
- parts
- disazo dyes
- dyes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000975 dye Substances 0.000 title claims description 29
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 title claims description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 15
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 9
- 125000003277 amino group Chemical group 0.000 claims description 6
- RUFPHBVGCFYCNW-UHFFFAOYSA-N 1-naphthylamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1 RUFPHBVGCFYCNW-UHFFFAOYSA-N 0.000 claims description 5
- 230000008878 coupling Effects 0.000 claims description 5
- 238000010168 coupling process Methods 0.000 claims description 5
- 238000005859 coupling reaction Methods 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 239000000463 material Substances 0.000 claims description 5
- -1 aminoazo compound Chemical class 0.000 claims description 3
- 150000002790 naphthalenes Chemical class 0.000 claims description 3
- 239000004753 textile Substances 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 2
- 238000000034 method Methods 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 150000003141 primary amines Chemical class 0.000 claims description 2
- 238000004043 dyeing Methods 0.000 claims 1
- 125000001624 naphthyl group Chemical group 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000004677 Nylon Substances 0.000 description 3
- 229920001778 nylon Polymers 0.000 description 3
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 229920002302 Nylon 6,6 Polymers 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- ULUIMLJNTCECJU-UHFFFAOYSA-N 3-amino-4-hydroxybenzenesulfonate;hydron Chemical compound NC1=CC(S(O)(=O)=O)=CC=C1O ULUIMLJNTCECJU-UHFFFAOYSA-N 0.000 description 1
- SEMRCUIXRUXGJX-UHFFFAOYSA-N 6-aminonaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(N)=CC=C21 SEMRCUIXRUXGJX-UHFFFAOYSA-N 0.000 description 1
- FWEOQOXTVHGIFQ-UHFFFAOYSA-N 8-anilinonaphthalene-1-sulfonic acid Chemical compound C=12C(S(=O)(=O)O)=CC=CC2=CC=CC=1NC1=CC=CC=C1 FWEOQOXTVHGIFQ-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- OVSQVDMCBVZWGM-QSOFNFLRSA-N quercetin 3-O-beta-D-glucopyranoside Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=C(C=2C=C(O)C(O)=CC=2)OC2=CC(O)=CC(O)=C2C1=O OVSQVDMCBVZWGM-QSOFNFLRSA-N 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B31/00—Disazo and polyazo dyes of the type A->B->C, A->B->C->D, or the like, prepared by diazotising and coupling
- C09B31/02—Disazo dyes
- C09B31/04—Disazo dyes from a coupling component "C" containing a directive amino group
- C09B31/041—Disazo dyes from a coupling component "C" containing a directive amino group containing acid groups, e.g. -CO2H, -SO3H, -PO3H2, -OSO3H, -OPO2H2; Salts thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3609669 | 1969-07-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2035644A1 true DE2035644A1 (de) | 1971-02-04 |
Family
ID=10384912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702035644 Pending DE2035644A1 (de) | 1969-07-17 | 1970-07-17 | Disazofarbstoffe |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE753522A (enrdf_load_stackoverflow) |
| DE (1) | DE2035644A1 (enrdf_load_stackoverflow) |
| ES (1) | ES381937A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2051820B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1322705A (enrdf_load_stackoverflow) |
| NL (1) | NL7010330A (enrdf_load_stackoverflow) |
| SE (1) | SE370243B (enrdf_load_stackoverflow) |
| SU (1) | SU367610A3 (enrdf_load_stackoverflow) |
| ZA (1) | ZA704776B (enrdf_load_stackoverflow) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1489215A (en) * | 1974-10-14 | 1977-10-19 | Ici Ltd | Disazo dyes |
| GB1555480A (en) * | 1975-10-08 | 1979-11-14 | Ici Ltd | Disazo dyes |
| CN113620531B (zh) * | 2021-08-19 | 2023-02-03 | 北京北控生态建设集团有限公司 | 一种黑臭水体的修复治理方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE121427C (enrdf_load_stackoverflow) * | ||||
| DE124790C (enrdf_load_stackoverflow) * |
-
1969
- 1969-07-17 GB GB3609669A patent/GB1322705A/en not_active Expired
-
1970
- 1970-07-10 ZA ZA704776A patent/ZA704776B/xx unknown
- 1970-07-13 NL NL7010330A patent/NL7010330A/xx unknown
- 1970-07-14 SE SE7009760A patent/SE370243B/xx unknown
- 1970-07-15 BE BE753522D patent/BE753522A/xx unknown
- 1970-07-17 DE DE19702035644 patent/DE2035644A1/de active Pending
- 1970-07-17 ES ES381937A patent/ES381937A1/es not_active Expired
- 1970-07-17 FR FR7026535A patent/FR2051820B1/fr not_active Expired
- 1970-07-17 SU SU1466883A patent/SU367610A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| GB1322705A (en) | 1973-07-11 |
| NL7010330A (enrdf_load_stackoverflow) | 1971-01-19 |
| SU367610A3 (enrdf_load_stackoverflow) | 1973-01-23 |
| ES381937A1 (es) | 1972-12-01 |
| SE370243B (enrdf_load_stackoverflow) | 1974-10-07 |
| BE753522A (fr) | 1971-01-15 |
| ZA704776B (en) | 1971-03-31 |
| FR2051820A1 (enrdf_load_stackoverflow) | 1971-04-09 |
| FR2051820B1 (enrdf_load_stackoverflow) | 1974-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2340569C2 (de) | Azofarbstoffe | |
| DE2115449C3 (de) | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben von Wolle oder synthetischen Polyamidtextilmaterialien | |
| DE1793008A1 (de) | Azofarbstoffe,ihre Herstellung und Verwendung | |
| DE2035644A1 (de) | Disazofarbstoffe | |
| DE2714204A1 (de) | Monoazofarbstoffe | |
| DE918634C (de) | Verfahren zur Herstellung ueberfaerbeechter Faerbungen auf Acetylcellulose sowie linearen Polyamiden oder Polyurethanen | |
| DE1233520B (de) | Verfahren zur Herstellung von basischen Hydrazonfarbstoffen | |
| DE848979C (de) | Verfahren zur Herstellung chromhaltiger Monoazofarbstoffe | |
| DE870302C (de) | Verfahren zur Herstellung chromhaltiger Monoazofarbstoffe | |
| DE1644235C3 (de) | Wasserlöslicher Diazofarbstoff, Verfahren zu seiner Herstellung und dessen Verwendung | |
| DE1001438C2 (de) | Verfahren zur Herstellung metallhaltiger Monoazofarbstoffe | |
| DE745459C (de) | Verfahren zur Herstellung von Dis- und Trisazofarbstoffen | |
| DE2805809C2 (de) | Farbstoffmischungen und deren Verwendung | |
| DE1097270B (de) | Photographisches Ein- oder Mehrschichtenmaterial zur Herstellung farbiger photographischer Bilder, insbesondere nach dem Silberfarbbleichverfahren | |
| DE964975C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2730148A1 (de) | Anthrachinonfarbstoffe | |
| DE1224421B (de) | Verfahren zur Herstellung chromhaltiger Azo- oder Azomethinfarbstoffe | |
| DE709585C (de) | Verfahren zur Herstellung von Azofarbstoffen auf der Faser | |
| DE896039C (de) | Verfahren zur Herstellung ueberfaerbeechter Faerbungen auf Acetylcellulose sowie linearen Polyamiden und Polyurethanen | |
| DE548680C (de) | Verfahren zur Herstellung von kupferhaltigen Azofarbstoffen | |
| DE1644122C3 (de) | Sulfonsäure- und carbonsäuregruppenfreie wasserunlösliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung | |
| DE1929573C3 (de) | Wasserunlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| DE2347124A1 (de) | Azoverbindungen | |
| DE1221746B (de) | Verfahren zur Herstellung wasserunloeslicher Monoazofarbstoffe | |
| DE908900C (de) | Verfahren zur Herstellung von kupferbaren Polyazofarbstoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |