DE2034785A1 - Adenosin 5 carbonsäurederivate - Google Patents
Adenosin 5 carbonsäurederivateInfo
- Publication number
- DE2034785A1 DE2034785A1 DE19702034785 DE2034785A DE2034785A1 DE 2034785 A1 DE2034785 A1 DE 2034785A1 DE 19702034785 DE19702034785 DE 19702034785 DE 2034785 A DE2034785 A DE 2034785A DE 2034785 A1 DE2034785 A1 DE 2034785A1
- Authority
- DE
- Germany
- Prior art keywords
- adenosine
- carboxylic acid
- general formula
- group
- acceptable salts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- STKYXVXUUPIMSU-UHFFFAOYSA-N (1-acetylindazol-5-yl) acetate Chemical class CC(=O)OC1=CC=C2N(C(C)=O)N=CC2=C1 STKYXVXUUPIMSU-UHFFFAOYSA-N 0.000 title 1
- MWEQTWJABOLLOS-UHFFFAOYSA-L disodium;[[[5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate;trihydrate Chemical class O.O.O.[Na+].[Na+].C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP([O-])(=O)OP(O)([O-])=O)C(O)C1O MWEQTWJABOLLOS-UHFFFAOYSA-L 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 10
- IBYWUFHJUDTSOC-SOVPELCUSA-N 9-riburonosyladenine Chemical class C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H]1O IBYWUFHJUDTSOC-SOVPELCUSA-N 0.000 claims description 9
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000005277 alkyl imino group Chemical group 0.000 claims description 3
- 125000002947 alkylene group Chemical group 0.000 claims description 3
- 125000001118 alkylidene group Chemical group 0.000 claims description 3
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 3
- 125000004467 aryl imino group Chemical group 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 229940079593 drug Drugs 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 3
- 238000000034 method Methods 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 239000000825 pharmaceutical preparation Substances 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000003835 adenosine derivatives Chemical class 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 230000002526 effect on cardiovascular system Effects 0.000 claims 1
- 230000000144 pharmacologic effect Effects 0.000 claims 1
- 235000014101 wine Nutrition 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- 239000000243 solution Substances 0.000 description 12
- -1 stearic acid) Chemical class 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- RRTBBKSJPNRFCG-UHFFFAOYSA-N 4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid Chemical compound C1=NC2=C(N)N=CN=C2N1C(OC1C(O)=O)C2C1OC(C)(C)O2 RRTBBKSJPNRFCG-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- CBHOOMGKXCMKIR-UHFFFAOYSA-N azane;methanol Chemical compound N.OC CBHOOMGKXCMKIR-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229920006158 high molecular weight polymer Polymers 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- BLMHAOGGJQDPLX-LKCKTBJASA-N (2s,3s,4r,5r)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolane-2-carboxamide Chemical compound O[C@@H]1[C@H](O)[C@@H](C(=O)N)O[C@H]1N1C2=NC=NC(N)=C2N=C1 BLMHAOGGJQDPLX-LKCKTBJASA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- NEAQRZUHTPSBBM-UHFFFAOYSA-N 2-hydroxy-3,3-dimethyl-7-nitro-4h-isoquinolin-1-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(O)C(C)(C)CC2=C1 NEAQRZUHTPSBBM-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241000206672 Gelidium Species 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- YIKSCQDJHCMVMK-UHFFFAOYSA-N Oxamide Chemical compound NC(=O)C(N)=O YIKSCQDJHCMVMK-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 229960005305 adenosine Drugs 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 208000026555 breast adenosis Diseases 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 150000007928 imidazolide derivatives Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H19/00—Compounds containing a hetero ring sharing one ring hetero atom with a saccharide radical; Nucleosides; Mononucleotides; Anhydro-derivatives thereof
- C07H19/02—Compounds containing a hetero ring sharing one ring hetero atom with a saccharide radical; Nucleosides; Mononucleotides; Anhydro-derivatives thereof sharing nitrogen
- C07H19/04—Heterocyclic radicals containing only nitrogen atoms as ring hetero atom
- C07H19/16—Purine radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (18)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702034785 DE2034785A1 (de) | 1970-07-14 | 1970-07-14 | Adenosin 5 carbonsäurederivate |
| ZA714483A ZA714483B (en) | 1970-07-14 | 1971-07-07 | New adenosine-5'-carboxylic acid derivatives and the preparation thereof |
| GB1295228D GB1295228A (enrdf_load_stackoverflow) | 1970-07-14 | 1971-07-08 | |
| SE7108839A SE378604B (enrdf_load_stackoverflow) | 1970-07-14 | 1971-07-08 | |
| ES393022A ES393022A1 (es) | 1970-07-14 | 1971-07-08 | Procedimiento para la preparacion de derivados de acidos adenosin-5'-carboxilicos. |
| US05/161,338 US4224438A (en) | 1970-07-14 | 1971-07-09 | Adenosine-5'-carboxylic acid amides |
| CH1013171A CH556345A (de) | 1970-07-14 | 1971-07-09 | Verfahren zur herstellung von adenosin-5'-carbonsaeurederivaten. |
| IL37280A IL37280A (en) | 1970-07-14 | 1971-07-09 | Adenosine-5'-carboxylic acid derivatives,processes for the preparation thereof and pharmaceutical compositions containing the same |
| FI1963/71A FI54316C (fi) | 1970-07-14 | 1971-07-09 | Foerfarande foer framstaellning av adenosin-5'-karbonsyraderivat med kretsomloppsverkan |
| NL7109584A NL7109584A (enrdf_load_stackoverflow) | 1970-07-14 | 1971-07-12 | |
| YU1833/71A YU34533B (en) | 1970-07-14 | 1971-07-12 | Process for preparing novel derivatives of adenosin-5-carboxylic acid |
| CA118,018A CA1077931A (en) | 1970-07-14 | 1971-07-12 | Adenosine-5'-carboxylic acid derivatives and process for their preparation |
| FR7125625A FR2100901B1 (enrdf_load_stackoverflow) | 1970-07-14 | 1971-07-13 | |
| HUBO1304A HU162216B (enrdf_load_stackoverflow) | 1970-07-14 | 1971-07-13 | |
| IE884/71A IE35535B1 (en) | 1970-07-14 | 1971-07-13 | Adenosine-5'-carboxylic acid derivatives |
| AU31159/71A AU449293B2 (en) | 1970-07-14 | 1971-07-13 | New adenosine-5'carboxylic acid derivatives andthe preparation thereof |
| AT611371A AT306253B (de) | 1970-07-14 | 1971-07-13 | Verfahren zur Herstellung von neuen Adenosin-5'-carbonsäurederivaten |
| SU1684055A SU385448A1 (ru) | 1971-07-14 | Способ получения амидов аденозин-5'-карбоновой кислоты |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702034785 DE2034785A1 (de) | 1970-07-14 | 1970-07-14 | Adenosin 5 carbonsäurederivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2034785A1 true DE2034785A1 (de) | 1972-01-20 |
Family
ID=5776675
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702034785 Pending DE2034785A1 (de) | 1970-07-14 | 1970-07-14 | Adenosin 5 carbonsäurederivate |
Country Status (16)
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852268A (en) * | 1973-02-12 | 1974-12-03 | Abbott Lab | Inosine-5 -carboxylic acid amides |
| US3853846A (en) * | 1973-02-12 | 1974-12-10 | Abbott Lab | INOSINE-5 -Carboxylates |
| US3855206A (en) * | 1973-04-11 | 1974-12-17 | Abbott Lab | Adenosine-5{40 -carbohydroxamic esters |
| US3966917A (en) * | 1974-07-30 | 1976-06-29 | Abbott Laboratories | Platelet aggregation inhibitors |
| US4479942A (en) * | 1981-08-10 | 1984-10-30 | Fujisawa Pharmaceutical Co., Ltd. | Tetrahydrofurnancarboxylic acid derivatives, processes for preparation thereof and pharmaceutical compositions thereof |
| US5278150A (en) * | 1992-04-24 | 1994-01-11 | Whitby Research, Inc. | 2-hydrazoadenosines and their utility for the treatmeat of vascular conditions |
| US6426337B1 (en) | 1996-12-24 | 2002-07-30 | Smithkline Beecham Corporation | 2-(Purin-9-yl)-tetrahydrofuran-3,4-diol derivatives |
| US6762170B1 (en) | 1998-01-31 | 2004-07-13 | Smithklinebeecham Corporation | 2-(purin-9-yl)-tetrahydrofuran-3,4-diol derivatives |
| US7737126B2 (en) | 2004-05-24 | 2010-06-15 | Glaxo Group Limited | Purine derivative |
| US7985740B2 (en) | 2005-07-19 | 2011-07-26 | Glaxo Group Limited | Purine derivatives as agonists of the adenosine A2A receptor |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1082695A (en) * | 1972-04-10 | 1980-07-29 | Francis E. Fischer | Process for preparing adenosine-5'-carboxamides |
| AT350735B (de) * | 1976-08-06 | 1979-06-11 | Hoffmann La Roche | Verfahren zur herstellung von neuen ribo- furanosyl-imidazolderivaten |
-
1970
- 1970-07-14 DE DE19702034785 patent/DE2034785A1/de active Pending
-
1971
- 1971-07-07 ZA ZA714483A patent/ZA714483B/xx unknown
- 1971-07-08 SE SE7108839A patent/SE378604B/xx unknown
- 1971-07-08 ES ES393022A patent/ES393022A1/es not_active Expired
- 1971-07-08 GB GB1295228D patent/GB1295228A/en not_active Expired
- 1971-07-09 FI FI1963/71A patent/FI54316C/fi active
- 1971-07-09 CH CH1013171A patent/CH556345A/xx not_active IP Right Cessation
- 1971-07-09 IL IL37280A patent/IL37280A/xx unknown
- 1971-07-12 CA CA118,018A patent/CA1077931A/en not_active Expired
- 1971-07-12 YU YU1833/71A patent/YU34533B/xx unknown
- 1971-07-12 NL NL7109584A patent/NL7109584A/xx not_active Application Discontinuation
- 1971-07-13 AT AT611371A patent/AT306253B/de not_active IP Right Cessation
- 1971-07-13 HU HUBO1304A patent/HU162216B/hu unknown
- 1971-07-13 IE IE884/71A patent/IE35535B1/xx unknown
- 1971-07-13 AU AU31159/71A patent/AU449293B2/en not_active Expired
- 1971-07-13 FR FR7125625A patent/FR2100901B1/fr not_active Expired
Cited By (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3852268A (en) * | 1973-02-12 | 1974-12-03 | Abbott Lab | Inosine-5 -carboxylic acid amides |
| US3853846A (en) * | 1973-02-12 | 1974-12-10 | Abbott Lab | INOSINE-5 -Carboxylates |
| US3855206A (en) * | 1973-04-11 | 1974-12-17 | Abbott Lab | Adenosine-5{40 -carbohydroxamic esters |
| US3966917A (en) * | 1974-07-30 | 1976-06-29 | Abbott Laboratories | Platelet aggregation inhibitors |
| US4479942A (en) * | 1981-08-10 | 1984-10-30 | Fujisawa Pharmaceutical Co., Ltd. | Tetrahydrofurnancarboxylic acid derivatives, processes for preparation thereof and pharmaceutical compositions thereof |
| US5278150A (en) * | 1992-04-24 | 1994-01-11 | Whitby Research, Inc. | 2-hydrazoadenosines and their utility for the treatmeat of vascular conditions |
| US6426337B1 (en) | 1996-12-24 | 2002-07-30 | Smithkline Beecham Corporation | 2-(Purin-9-yl)-tetrahydrofuran-3,4-diol derivatives |
| US6528494B2 (en) | 1996-12-24 | 2003-03-04 | Brian Cox | 2-(purin-9-yl)-tetrahydrofuran-3,4-diol derivatives |
| US6762170B1 (en) | 1998-01-31 | 2004-07-13 | Smithklinebeecham Corporation | 2-(purin-9-yl)-tetrahydrofuran-3,4-diol derivatives |
| US7737126B2 (en) | 2004-05-24 | 2010-06-15 | Glaxo Group Limited | Purine derivative |
| US7985740B2 (en) | 2005-07-19 | 2011-07-26 | Glaxo Group Limited | Purine derivatives as agonists of the adenosine A2A receptor |
Also Published As
| Publication number | Publication date |
|---|---|
| ZA714483B (en) | 1972-04-26 |
| FR2100901B1 (enrdf_load_stackoverflow) | 1974-11-15 |
| FR2100901A1 (enrdf_load_stackoverflow) | 1972-03-24 |
| FI54316C (fi) | 1978-11-10 |
| IE35535B1 (en) | 1976-03-18 |
| IE35535L (en) | 1972-01-14 |
| HU162216B (enrdf_load_stackoverflow) | 1973-01-29 |
| SU385448A3 (enrdf_load_stackoverflow) | 1973-05-29 |
| NL7109584A (enrdf_load_stackoverflow) | 1972-01-18 |
| AU3115971A (en) | 1973-01-18 |
| SE378604B (enrdf_load_stackoverflow) | 1975-09-08 |
| YU183371A (en) | 1979-02-28 |
| ES393022A1 (es) | 1973-08-01 |
| GB1295228A (enrdf_load_stackoverflow) | 1972-11-08 |
| CH556345A (de) | 1974-11-29 |
| IL37280A (en) | 1974-03-14 |
| CA1077931A (en) | 1980-05-20 |
| FI54316B (fi) | 1978-07-31 |
| AU449293B2 (en) | 1974-06-06 |
| IL37280A0 (en) | 1971-10-20 |
| YU34533B (en) | 1979-09-10 |
| AT306253B (de) | 1973-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1620262A1 (de) | Verfahren zur Herstellung von neuen Spiro[4,5]decanderivaten | |
| DE1795769B2 (de) | 6,7A9-Tetrahydro-2H-pyrido [1,2-a] pyrimidinderivate, deren Salze mit Säuren und quaternär? Methosalze, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
| DE2034785A1 (de) | Adenosin 5 carbonsäurederivate | |
| DE2824905A1 (de) | Neue 1, 2, 3, 4, 6, 7-hexahydro-11 balphah-benzo(a)chinolizin-derivate und verfahren zur herstellung derselben | |
| DE1645956A1 (de) | Verfahren zur Herstellung von Benzoxazepinen und Benzothiazepinen | |
| DE1720033A1 (de) | Neue Indolderivate und Verfahren zu ihrer Herstellung | |
| DE2241241C3 (de) | Thiazolo eckige klammer auf 3.2-a eckige klammer zu -pyrimidinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| CH432542A (de) | Verfahren zur Herstellung neuer Hydrazide | |
| US3274212A (en) | 1, 3-dialkylprolines | |
| CH473821A (de) | Verfahren zur Herstellung von Iminodibenzyl-Derivaten | |
| DE1445123C (de) | 7 substituierte 10 (beta Amino athyl) 10,11 dihydrodibenzo eckige Klammer auf b,e eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu diazepinon (11) derivate | |
| DE2237361A1 (de) | (5-indolyloxy)-essigsaeure-derivate und verfahren zur herstellung derselben | |
| DE2235667A1 (de) | Hexahydrobenz/e/indolderivate | |
| CH630919A5 (de) | Verfahren zur herstellung von aminopropanol-derivaten. | |
| DE1695094A1 (de) | Verfahren zur Herstellung von neuen N-Heterocyclen | |
| DE2522688A1 (de) | 3-nitropyrazol-derivate und verfahren zu deren herstellung | |
| DE2065311C3 (de) | v-(4-Hydroxy-4-phenylpiperidino)- 2-amino-4fluorbutyrophenone, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| AT384221B (de) | Verfahren zur herstellung von neuen 3-substituierten tetrahydro-pyrrolo(1,2-a) pyrimidin-derivaten sowie von deren saeureadditions- und quaternaeren salzen | |
| AT305976B (de) | Verfahren zur Herstellung von neuen 5,10-Methano-5H-dibenzo[a,d]cyclohepten-derivaten | |
| AT243261B (de) | Verfahren zur Herstellung von neuen Imidazolderivaten | |
| DE2215999A1 (de) | Nitroimidazolyl-triazolo-pyridazine und verfahren zu ihrer herstellung | |
| AT365200B (de) | Verfahren zur herstellung von neuen thienothiazin-derivaten und von deren salzen | |
| AT249672B (de) | Verfahren zur Herstellung von neuen Imidazolderivaten | |
| DE2404924A1 (de) | Ergolinderivate | |
| DE1493567C3 (de) | Ester von alpha-Alkylthyroxinderivaten und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |