DE2020490C3 - Schlammformiger Sprengstoff - Google Patents
Schlammformiger SprengstoffInfo
- Publication number
- DE2020490C3 DE2020490C3 DE2020490A DE2020490A DE2020490C3 DE 2020490 C3 DE2020490 C3 DE 2020490C3 DE 2020490 A DE2020490 A DE 2020490A DE 2020490 A DE2020490 A DE 2020490A DE 2020490 C3 DE2020490 C3 DE 2020490C3
- Authority
- DE
- Germany
- Prior art keywords
- nitrate
- explosive
- water
- calcium nitrate
- ethylene glycol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002360 explosive Substances 0.000 title claims description 17
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 30
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 11
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 claims description 10
- 239000002562 thickening agent Substances 0.000 claims description 10
- 229910052782 aluminium Inorganic materials 0.000 claims description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 6
- 239000003638 chemical reducing agent Substances 0.000 claims description 5
- -1 polysaccharide compound Chemical class 0.000 claims description 5
- 235000010344 sodium nitrate Nutrition 0.000 claims description 5
- 239000004317 sodium nitrate Substances 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 239000007800 oxidant agent Substances 0.000 claims description 4
- 239000002002 slurry Substances 0.000 claims description 4
- 229920001282 polysaccharide Polymers 0.000 claims description 3
- 239000005017 polysaccharide Substances 0.000 claims description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 2
- 229920002472 Starch Polymers 0.000 claims description 2
- 229920001938 Vegetable gum Polymers 0.000 claims description 2
- 238000004132 cross linking Methods 0.000 claims description 2
- 150000002823 nitrates Chemical class 0.000 claims description 2
- 235000019698 starch Nutrition 0.000 claims description 2
- 239000008107 starch Substances 0.000 claims description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 claims 3
- 229910002651 NO3 Inorganic materials 0.000 claims 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims 1
- 150000004676 glycans Chemical class 0.000 claims 1
- 229910001959 inorganic nitrate Inorganic materials 0.000 claims 1
- 239000000243 solution Substances 0.000 description 9
- 239000010802 sludge Substances 0.000 description 7
- 239000007789 gas Substances 0.000 description 6
- 229920001592 potato starch Polymers 0.000 description 6
- 230000008719 thickening Effects 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- 229910052700 potassium Inorganic materials 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 235000010289 potassium nitrite Nutrition 0.000 description 3
- 239000004304 potassium nitrite Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000005086 pumping Methods 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- HSINOMROUCMIEA-FGVHQWLLSA-N (2s,4r)-4-[(3r,5s,6r,7r,8s,9s,10s,13r,14s,17r)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1h-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid Chemical compound C([C@@]12C)C[C@@H](O)C[C@H]1[C@@H](CC)[C@@H](O)[C@@H]1[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)C[C@H](C)C(O)=O)CC[C@H]21 HSINOMROUCMIEA-FGVHQWLLSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 229920002907 Guar gum Polymers 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 235000010417 guar gum Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000012086 standard solution Substances 0.000 description 2
- JHWIEAWILPSRMU-UHFFFAOYSA-N 2-methyl-3-pyrimidin-4-ylpropanoic acid Chemical compound OC(=O)C(C)CC1=CC=NC=N1 JHWIEAWILPSRMU-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000003613 bile acid Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000005474 detonation Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 230000008014 freezing Effects 0.000 description 1
- 238000007710 freezing Methods 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 238000003958 fumigation Methods 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 230000006855 networking Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000009931 pascalization Methods 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 238000007789 sealing Methods 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Air Bags (AREA)
- Soil Conditioners And Soil-Stabilizing Materials (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Treatment Of Sludge (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82109569A | 1969-05-01 | 1969-05-01 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2020490A1 DE2020490A1 (de) | 1971-01-14 |
| DE2020490B2 DE2020490B2 (de) | 1973-08-16 |
| DE2020490C3 true DE2020490C3 (de) | 1974-04-25 |
Family
ID=25232488
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2020490A Expired DE2020490C3 (de) | 1969-05-01 | 1970-04-27 | Schlammformiger Sprengstoff |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3660181A (enExample) |
| JP (1) | JPS5034606B1 (enExample) |
| AT (1) | AT299041B (enExample) |
| BE (1) | BE749690A (enExample) |
| CA (1) | CA925302A (enExample) |
| CH (1) | CH553733A (enExample) |
| DE (1) | DE2020490C3 (enExample) |
| ES (1) | ES379151A1 (enExample) |
| FI (1) | FI56167C (enExample) |
| FR (1) | FR2047172A5 (enExample) |
| GB (1) | GB1301185A (enExample) |
| IE (1) | IE34109B1 (enExample) |
| IL (1) | IL34412A (enExample) |
| NL (1) | NL7006308A (enExample) |
| NO (1) | NO125443B (enExample) |
| OA (1) | OA03307A (enExample) |
| PH (1) | PH9787A (enExample) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3839107A (en) * | 1970-05-04 | 1974-10-01 | Dow Chemical Co | Calcium nitrate explosive composition |
| US3816191A (en) * | 1970-05-04 | 1974-06-11 | Dow Chemical Co | Method of making calcium nitrate explosive composition |
| US3787254A (en) * | 1971-06-01 | 1974-01-22 | Ireco Chemicals | Explosive compositions containing calcium nitrate |
| US3890171A (en) * | 1971-11-10 | 1975-06-17 | Ireco Chemicals | Explosive compositions containing guar gum derivative |
| US3886010A (en) * | 1972-07-24 | 1975-05-27 | Ireco Chemicals | Stabilized and aerated blasting slurry containing thiourea and a nitrite gassing agent |
| US3899374A (en) * | 1974-03-29 | 1975-08-12 | Dow Chemical Co | Calcium nitrate explosive composition |
| DE2734779C1 (de) * | 1977-08-02 | 1992-09-24 | Dynamit Nobel Ag | Verfahren zur Herstellung poroeser Treibmittelkoerper |
| CA1096172A (en) * | 1978-11-08 | 1981-02-24 | Anthony C. F. Edmonds | Gelled aqueous slurry explosive containing gas bubbles |
| US6508177B1 (en) | 1999-09-13 | 2003-01-21 | The Ensign-Bickford Company | Explosives with embedded bodies |
| RU2183209C1 (ru) * | 2000-12-26 | 2002-06-10 | Анников Владимир Эдуардович | Водосодержащий пороховой взрывчатый состав |
| RU2243200C2 (ru) * | 2002-09-26 | 2004-12-27 | Смагин Николай Петрович | Водосодержащий взрывчатый состав |
| RU2253642C1 (ru) * | 2003-12-05 | 2005-06-10 | Анников Владимир Эдуардович | Способ изготовления зарядов гелеобразного водосодержащего взрывчатого состава |
| US8114231B2 (en) * | 2005-10-26 | 2012-02-14 | Newcastle Innovation Limited | Gassing of emulsion explosives with nitric oxide |
| EP2125675A1 (en) * | 2007-01-10 | 2009-12-02 | Newcastle Innovation Limited | Methods for gassing explosives especially at low temperatures |
| RU2521637C2 (ru) * | 2011-03-14 | 2014-07-10 | Иван Владимирович Бригадин | Водосодержащий пороховой взрывчатый состав |
| WO2013082634A2 (en) * | 2011-11-30 | 2013-06-06 | Ael Mining Services Limited | Base charge explosive formulation |
| RU2537485C2 (ru) * | 2012-09-04 | 2015-01-10 | Михаил Сергеевич Архипов | Водосодержащий взрывчатый состав |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3397097A (en) * | 1966-07-12 | 1968-08-13 | Du Pont | Thickened aqueous inorganic oxidizer salt blasting compositions containing gas bubbles and a crystal habit modifier and method of preparation |
| US3395056A (en) * | 1966-08-01 | 1968-07-30 | Trojan Powder Co | Inorganic oxidizer salt-alcohol explosive slurry containing an alcohol thickening agent |
| US3450582A (en) * | 1967-12-18 | 1969-06-17 | Harold W Sheeran | Aqueous ammonium nitrate blasting composition containing solid carbonaceous fuel and method of preparing same |
| US3522117A (en) * | 1968-08-07 | 1970-07-28 | Du Pont | Aerated water-bearing inorganic oxidizer salt blasting agent containing dissolved and undissolved carbonaceous fuel |
-
1969
- 1969-05-01 US US821095A patent/US3660181A/en not_active Expired - Lifetime
-
1970
- 1970-04-21 IE IE509/70A patent/IE34109B1/xx unknown
- 1970-04-21 GB GB08908/70A patent/GB1301185A/en not_active Expired
- 1970-04-27 DE DE2020490A patent/DE2020490C3/de not_active Expired
- 1970-04-28 JP JP45036003A patent/JPS5034606B1/ja active Pending
- 1970-04-28 BE BE749690D patent/BE749690A/xx not_active IP Right Cessation
- 1970-04-29 IL IL34412A patent/IL34412A/en unknown
- 1970-04-29 NL NL7006308A patent/NL7006308A/xx unknown
- 1970-04-29 ES ES379151A patent/ES379151A1/es not_active Expired
- 1970-04-30 FI FI1228/70A patent/FI56167C/fi not_active IP Right Cessation
- 1970-04-30 FR FR7015969A patent/FR2047172A5/fr not_active Expired
- 1970-04-30 CH CH649970A patent/CH553733A/xx not_active IP Right Cessation
- 1970-04-30 CA CA081604A patent/CA925302A/en not_active Expired
- 1970-04-30 AT AT396870A patent/AT299041B/de not_active IP Right Cessation
- 1970-04-30 NO NO1663/70A patent/NO125443B/no unknown
- 1970-04-30 PH PH11390A patent/PH9787A/en unknown
- 1970-06-29 OA OA53967A patent/OA03307A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2047172A5 (enExample) | 1971-03-12 |
| OA03307A (fr) | 1970-12-15 |
| IL34412A0 (en) | 1970-10-30 |
| IE34109B1 (en) | 1975-02-05 |
| US3660181A (en) | 1972-05-02 |
| DE2020490A1 (de) | 1971-01-14 |
| PH9787A (en) | 1976-03-17 |
| IE34109L (en) | 1970-11-01 |
| GB1301185A (en) | 1972-12-29 |
| ES379151A1 (es) | 1972-09-01 |
| FI56167C (fi) | 1979-12-10 |
| BE749690A (fr) | 1970-10-28 |
| NL7006308A (enExample) | 1970-11-03 |
| CA925302A (en) | 1973-05-01 |
| NO125443B (enExample) | 1972-09-11 |
| JPS5034606B1 (enExample) | 1975-11-10 |
| AT299041B (de) | 1972-06-12 |
| FI56167B (fi) | 1979-08-31 |
| CH553733A (de) | 1974-09-13 |
| IL34412A (en) | 1973-04-30 |
| DE2020490B2 (de) | 1973-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2020490C3 (de) | Schlammformiger Sprengstoff | |
| DE2731609C2 (de) | Wasser-in-Öl-Emulsionssprengstoffmischung | |
| DE2948465A1 (de) | Emulsionssprengstoffmischung | |
| DE1771007A1 (de) | Sprengstoffmischung | |
| DE2601162C2 (de) | Sprengstoffmischung | |
| DE1940069A1 (de) | Verdickter Sprengstoff | |
| DE3134639A1 (de) | "sicherheitssprengstoff" | |
| DE1950580B2 (de) | Sprengstoffzusammensetzung vom slurry-typ | |
| DE1009990B (de) | Plastischer Sicherheitssprengstoff mit ausgeglichener Sauerstoffbilanz | |
| DE2019968C3 (de) | Sprengstoffmischung hoher Brisanz und hoher Gesamtenergie und Verfahren zu deren Herstellung | |
| DE2219249B2 (de) | Gashaltige sprengstoffmischung | |
| DE1232506B (de) | Stabilisierte Sprengstoffzusammensetzung vom Slurry-Typ | |
| DE2116353C3 (de) | Pulverförmiger, von flüssigen Salpetersäureestern freier, Ammoniumnitratsprengstoff hoher Wasserfestigkeit und Dichte | |
| DE1117014B (de) | Sicherheitssprengstoff | |
| AT219532B (de) | Verfahren zum Behandeln von Bohrlöchern oder Erdschächten | |
| AT281649B (de) | Sprengstoff in Form einer wässerigen Aufschlämmung | |
| DE69319654T2 (de) | Wasserhaltige, gelförmige Sprengstoffzusammensetzung mit niedriger Dichte, Herstellung und deren Verwendung | |
| DE2222437A1 (de) | Sprengstoffmischung, enthaltend guarangummiabkoemmlinge | |
| DE2832737A1 (de) | Wasser-in-oel-emulsionssprengstoffmischung | |
| DE1939138C3 (de) | Sprengstoff in Form eines wäßrigen Gels oder Schlamms | |
| AT284688B (de) | Sprengstoff und Verfahren zu seiner Herstellung | |
| DE1646270A1 (de) | Sprengstoff | |
| DE2308680A1 (de) | Sprengstoffmischung mit einem gehalt an vierwertigem titan als quervernetzungsmittel | |
| AT218413B (de) | Flüssiger, von flüssigen Salpetersäureestern freier Sicherheitssprengstoff | |
| DE1964537C (de) | Sprengstoff und Verfahren zur Herstellung desselben |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: IRECO INC., SALT LAKE CITY, UTAH, US |
|
| 8328 | Change in the person/name/address of the agent |
Free format text: DICKEL, K., DIPL.-ING., PAT.-ANW., 8000 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |