DE2016395C3 - Elektrophotographisches Aufzeichnungsmaterial - Google Patents
Elektrophotographisches AufzeichnungsmaterialInfo
- Publication number
- DE2016395C3 DE2016395C3 DE2016395A DE2016395A DE2016395C3 DE 2016395 C3 DE2016395 C3 DE 2016395C3 DE 2016395 A DE2016395 A DE 2016395A DE 2016395 A DE2016395 A DE 2016395A DE 2016395 C3 DE2016395 C3 DE 2016395C3
- Authority
- DE
- Germany
- Prior art keywords
- radical
- group
- recording material
- bis
- electrophotographic recording
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 59
- 229920005989 resin Polymers 0.000 claims description 46
- 239000011347 resin Substances 0.000 claims description 46
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 42
- 239000011230 binding agent Substances 0.000 claims description 30
- 230000001235 sensitizing effect Effects 0.000 claims description 17
- 125000003106 haloaryl group Chemical group 0.000 claims description 4
- -1 p-chloroacetophenone formaldehyde Chemical compound 0.000 description 102
- 239000010410 layer Substances 0.000 description 45
- 230000035945 sensitivity Effects 0.000 description 33
- 125000004432 carbon atom Chemical group C* 0.000 description 28
- 125000003118 aryl group Chemical group 0.000 description 23
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 20
- 125000001424 substituent group Chemical group 0.000 description 19
- 150000001875 compounds Chemical class 0.000 description 16
- 125000000217 alkyl group Chemical group 0.000 description 14
- 229910052739 hydrogen Inorganic materials 0.000 description 14
- 238000000034 method Methods 0.000 description 14
- 239000001257 hydrogen Substances 0.000 description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 13
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 12
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 12
- 239000000975 dye Substances 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- 125000001624 naphthyl group Chemical group 0.000 description 10
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 9
- 239000002253 acid Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 125000003107 substituted aryl group Chemical group 0.000 description 8
- 125000003277 amino group Chemical group 0.000 description 7
- 229910052751 metal Inorganic materials 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 230000000737 periodic effect Effects 0.000 description 6
- 125000005259 triarylamine group Chemical group 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 125000006413 ring segment Chemical group 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- QGKMIGUHVLGJBR-UHFFFAOYSA-M (4z)-1-(3-methylbutyl)-4-[[1-(3-methylbutyl)quinolin-1-ium-4-yl]methylidene]quinoline;iodide Chemical compound [I-].C12=CC=CC=C2N(CCC(C)C)C=CC1=CC1=CC=[N+](CCC(C)C)C2=CC=CC=C12 QGKMIGUHVLGJBR-UHFFFAOYSA-M 0.000 description 4
- TZDXFOCCCOVXEY-UHFFFAOYSA-N 1-(4-bromophenyl)ethanone formaldehyde Chemical compound C=O.BrC1=CC=C(C=C1)C(C)=O TZDXFOCCCOVXEY-UHFFFAOYSA-N 0.000 description 4
- HSFWRNGVRCDJHI-UHFFFAOYSA-N Acetylene Chemical compound C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 4
- 206010034972 Photosensitivity reaction Diseases 0.000 description 4
- 125000002877 alkyl aryl group Chemical group 0.000 description 4
- 125000003368 amide group Chemical group 0.000 description 4
- 150000005840 aryl radicals Chemical class 0.000 description 4
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 4
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 4
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 150000002429 hydrazines Chemical class 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 230000036211 photosensitivity Effects 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- WVIICGIFSIBFOG-UHFFFAOYSA-N pyrylium Chemical compound C1=CC=[O+]C=C1 WVIICGIFSIBFOG-UHFFFAOYSA-N 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 4
- XXWVEJFXXLLAIB-UHFFFAOYSA-N 4-[[4-(diethylamino)-2-methylphenyl]-phenylmethyl]-n,n-diethyl-3-methylaniline Chemical compound CC1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)N(CC)CC)C)C1=CC=CC=C1 XXWVEJFXXLLAIB-UHFFFAOYSA-N 0.000 description 3
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical class [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 3
- 150000004982 aromatic amines Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 235000005513 chalcones Nutrition 0.000 description 3
- 239000008199 coating composition Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 230000014509 gene expression Effects 0.000 description 3
- 125000005059 halophenyl group Chemical group 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- XUDQSFMBCQRHAX-UHFFFAOYSA-N 4-(n-phenylanilino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 XUDQSFMBCQRHAX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 125000004171 alkoxy aryl group Chemical group 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 125000000732 arylene group Chemical group 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000000298 carbocyanine Substances 0.000 description 2
- 125000005026 carboxyaryl group Chemical group 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 150000001789 chalcones Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 125000005027 hydroxyaryl group Chemical group 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000007665 sagging Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 229910000080 stannane Inorganic materials 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- DBHNRMPJKZOKHH-UHFFFAOYSA-N (5-benzoyl-2h-triazol-4-yl)-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C1=NNN=C1C(=O)C1=CC=CC=C1 DBHNRMPJKZOKHH-UHFFFAOYSA-N 0.000 description 1
- FJLAFBORFDOARE-UHFFFAOYSA-N 1,3-bis[4-(diethylamino)phenyl]prop-2-en-1-one Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC(=O)C1=CC=C(N(CC)CC)C=C1 FJLAFBORFDOARE-UHFFFAOYSA-N 0.000 description 1
- WYECURVXVYPVAT-UHFFFAOYSA-N 1-(4-bromophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Br)C=C1 WYECURVXVYPVAT-UHFFFAOYSA-N 0.000 description 1
- QAGGJAJVFIBYQM-UHFFFAOYSA-N 1-[4-(dimethylamino)phenyl]-3-[4-(n-phenylanilino)phenyl]prop-2-en-1-one Chemical compound C1=CC(N(C)C)=CC=C1C(=O)C=CC1=CC=C(N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=C1 QAGGJAJVFIBYQM-UHFFFAOYSA-N 0.000 description 1
- VETPHHXZEJAYOB-UHFFFAOYSA-N 1-n,4-n-dinaphthalen-2-ylbenzene-1,4-diamine Chemical compound C1=CC=CC2=CC(NC=3C=CC(NC=4C=C5C=CC=CC5=CC=4)=CC=3)=CC=C21 VETPHHXZEJAYOB-UHFFFAOYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N 1-propanol Substances CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- CZLVPINBLDRZCJ-UHFFFAOYSA-N 2,3,4,4,5,5,6,6-octachlorocyclohex-2-en-1-one Chemical compound ClC1=C(Cl)C(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C1=O CZLVPINBLDRZCJ-UHFFFAOYSA-N 0.000 description 1
- LWPYVNQGNFIKLG-UHFFFAOYSA-N 2,3,4-triphenyl-3,4-dihydropyrazole Chemical compound C1(=CC=CC=C1)N1N=CC(C1C1=CC=CC=C1)C1=CC=CC=C1 LWPYVNQGNFIKLG-UHFFFAOYSA-N 0.000 description 1
- SYOANZBNGDEJFH-UHFFFAOYSA-N 2,5-dihydro-1h-triazole Chemical compound C1NNN=C1 SYOANZBNGDEJFH-UHFFFAOYSA-N 0.000 description 1
- AJHHRHAXOZYHBP-UHFFFAOYSA-N 2-(4-methylphenyl)-3-phenyl-3,4-dihydropyrazole Chemical compound C1(=CC=C(C=C1)N1N=CCC1C1=CC=CC=C1)C AJHHRHAXOZYHBP-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- GDQQEBQDYLKGPJ-UHFFFAOYSA-N 2-[[4-(N-phenylanilino)phenyl]methylidene]but-3-enoic acid Chemical compound C(=C)C(C(=O)O)=CC1=CC=C(C=C1)N(C1=CC=CC=C1)C1=CC=CC=C1 GDQQEBQDYLKGPJ-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- PHAQUNBZLVJBPU-UHFFFAOYSA-N 3,9-di(carbazol-9-yl)carbazole Chemical group C12=CC=CC=C2C2=CC=CC=C2N1C1=CC=C(N(N2C3=CC=CC=C3C3=CC=CC=C32)C=2C3=CC=CC=2)C3=C1 PHAQUNBZLVJBPU-UHFFFAOYSA-N 0.000 description 1
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- LMCBSDUNSKMNTO-UHFFFAOYSA-N 3-[4-(n-phenylanilino)phenyl]prop-2-enenitrile Chemical compound C1=CC(C=CC#N)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 LMCBSDUNSKMNTO-UHFFFAOYSA-N 0.000 description 1
- TUXUJVDBDXGHMS-UHFFFAOYSA-N 3-[4-(n-phenylanilino)phenyl]prop-2-enoic acid Chemical compound C1=CC(C=CC(=O)O)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 TUXUJVDBDXGHMS-UHFFFAOYSA-N 0.000 description 1
- CNDNHBOLUMADON-UHFFFAOYSA-N 3-[4-(n-phenylanilino)phenyl]prop-2-enoyl 3-[4-(n-phenylanilino)phenyl]prop-2-enoate Chemical compound C=1C=C(N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=CC=1C=CC(=O)OC(=O)C=CC(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 CNDNHBOLUMADON-UHFFFAOYSA-N 0.000 description 1
- BETPIXSZIMPADP-UHFFFAOYSA-N 3-ethoxy-9-(3-ethoxycarbazol-9-yl)carbazole Chemical group C12=CC=CC=C2C2=CC(OCC)=CC=C2N1N1C2=CC=C(OCC)C=C2C2=CC=CC=C21 BETPIXSZIMPADP-UHFFFAOYSA-N 0.000 description 1
- ZKGMDVPIBQZFCD-UHFFFAOYSA-N 3-ethyl-9-(3-ethylcarbazol-9-yl)carbazole Chemical group C12=CC=CC=C2C2=CC(CC)=CC=C2N1N1C2=CC=C(CC)C=C2C2=CC=CC=C21 ZKGMDVPIBQZFCD-UHFFFAOYSA-N 0.000 description 1
- JRDKPBBZJIRXMI-UHFFFAOYSA-N 3-phenyl-9-(3-phenylcarbazol-9-yl)carbazole Chemical group C1=CC=CC=C1C1=CC=C(N(N2C3=CC=C(C=C3C3=CC=CC=C32)C=2C=CC=CC=2)C=2C3=CC=CC=2)C3=C1 JRDKPBBZJIRXMI-UHFFFAOYSA-N 0.000 description 1
- MCGBIXXDQFWVDW-UHFFFAOYSA-N 4,5-dihydro-1h-pyrazole Chemical compound C1CC=NN1 MCGBIXXDQFWVDW-UHFFFAOYSA-N 0.000 description 1
- ORMQJNLBATWCRM-UHFFFAOYSA-N 4-(n-phenylanilino)benzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ORMQJNLBATWCRM-UHFFFAOYSA-N 0.000 description 1
- LLJDXSWLOUUNDM-UHFFFAOYSA-N 4-[4-(diethylamino)-N-[4-(diethylamino)-N-[4-(diethylamino)phenyl]anilino]anilino]-N,N-diethylaniline Chemical compound C(C)N(C1=CC=C(C=C1)N(N(C1=CC=C(C=C1)N(CC)CC)C1=CC=C(C=C1)N(CC)CC)C1=CC=C(C=C1)N(CC)CC)CC LLJDXSWLOUUNDM-UHFFFAOYSA-N 0.000 description 1
- XLHZNWJJXBPXBH-UHFFFAOYSA-N 4-[[4-(diethylamino)phenyl]-diphenylstannyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1[Sn](C=1C=CC(=CC=1)N(CC)CC)(C=1C=CC=CC=1)C1=CC=CC=C1 XLHZNWJJXBPXBH-UHFFFAOYSA-N 0.000 description 1
- BGGDZDRRHQTSPV-UHFFFAOYSA-N 4-ethenyl-n,n-diphenylaniline Chemical compound C1=CC(C=C)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 BGGDZDRRHQTSPV-UHFFFAOYSA-N 0.000 description 1
- JTTMYKSFKOOQLP-UHFFFAOYSA-N 4-hydroxydiphenylamine Chemical compound C1=CC(O)=CC=C1NC1=CC=CC=C1 JTTMYKSFKOOQLP-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- SYFDYRCRHZNEIP-UHFFFAOYSA-N 4-methoxy-2,3-bis(4-methylphenyl)-3,4-dihydropyrazole Chemical compound C1(=CC=C(C=C1)N1N=CC(C1C1=CC=C(C=C1)C)OC)C SYFDYRCRHZNEIP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WNTMGMLSIHCVOQ-UHFFFAOYSA-N 9-[4-(diethylamino)carbazol-9-yl]-n,n-diethylcarbazol-4-amine Chemical group C12=CC=CC=C2C2=C(N(CC)CC)C=CC=C2N1N1C2=CC=CC=C2C2=C1C=CC=C2N(CC)CC WNTMGMLSIHCVOQ-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- XPFWADUCAYKJOR-UHFFFAOYSA-N C(#N)C1=CC=2N(C3=CC=CC=C3C=2C=C1)N1C2=CC=CC=C2C=2C=CC(=CC1=2)C#N Chemical group C(#N)C1=CC=2N(C3=CC=CC=C3C=2C=C1)N1C2=CC=CC=C2C=2C=CC(=CC1=2)C#N XPFWADUCAYKJOR-UHFFFAOYSA-N 0.000 description 1
- CSTAZLXYCJWOBB-UHFFFAOYSA-N C1=CC(N(CC)CC)=CC=C1P(=O)C1=CC=C(N(CC)CC)C=C1 Chemical compound C1=CC(N(CC)CC)=CC=C1P(=O)C1=CC=C(N(CC)CC)C=C1 CSTAZLXYCJWOBB-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- UTGQNNCQYDRXCH-UHFFFAOYSA-N N,N'-diphenyl-1,4-phenylenediamine Chemical compound C=1C=C(NC=2C=CC=CC=2)C=CC=1NC1=CC=CC=C1 UTGQNNCQYDRXCH-UHFFFAOYSA-N 0.000 description 1
- XQVWYOYUZDUNRW-UHFFFAOYSA-N N-Phenyl-1-naphthylamine Chemical compound C=1C=CC2=CC=CC=C2C=1NC1=CC=CC=C1 XQVWYOYUZDUNRW-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- MIOPAZXOXHOPMZ-UHFFFAOYSA-N [3-[4-(N-phenylanilino)phenyl]prop-2-enylideneamino]urea Chemical compound C1(=CC=CC=C1)N(C1=CC=C(C=CC=NNC(N)=O)C=C1)C1=CC=CC=C1 MIOPAZXOXHOPMZ-UHFFFAOYSA-N 0.000 description 1
- CPQZJYRWMLBSSN-UHFFFAOYSA-N [4-(n-phenylanilino)benzoyl] 4-(n-phenylanilino)benzoate Chemical compound C=1C=C(N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=CC=1C(=O)OC(=O)C(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 CPQZJYRWMLBSSN-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 125000005001 aminoaryl group Chemical group 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 150000008425 anthrones Chemical class 0.000 description 1
- PEEDYJQEMCKDDX-UHFFFAOYSA-N antimony bismuth Chemical compound [Sb].[Bi] PEEDYJQEMCKDDX-UHFFFAOYSA-N 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical compound [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000004799 bromophenyl group Chemical group 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 150000004775 coumarins Chemical class 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005266 diarylamine group Chemical class 0.000 description 1
- 125000004986 diarylamino group Chemical group 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001962 electrophoresis Methods 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- IONMUCYQDGALHX-UHFFFAOYSA-N formaldehyde;1-phenylethanone Chemical class O=C.CC(=O)C1=CC=CC=C1 IONMUCYQDGALHX-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 229910052732 germanium Inorganic materials 0.000 description 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- TUJKJAMUKRIRHC-UHFFFAOYSA-N hydroxyl Chemical compound [OH] TUJKJAMUKRIRHC-UHFFFAOYSA-N 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098895 maleic acid Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 1
- LMPDKTVEQHXQKW-UHFFFAOYSA-N methyl 4-(n-phenylanilino)benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 LMPDKTVEQHXQKW-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- CIPVVROJHKLHJI-UHFFFAOYSA-N n,n-diethyl-3-methylaniline Chemical compound CCN(CC)C1=CC=CC(C)=C1 CIPVVROJHKLHJI-UHFFFAOYSA-N 0.000 description 1
- DAUSYACCYYEMII-UHFFFAOYSA-N n,n-diethyl-4-triphenylplumbylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1[Pb](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 DAUSYACCYYEMII-UHFFFAOYSA-N 0.000 description 1
- FDTSORXCDYOHAB-UHFFFAOYSA-N n-[3-[4-(n-phenylanilino)phenyl]prop-2-enylidene]hydroxylamine Chemical compound C1=CC(C=CC=NO)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 FDTSORXCDYOHAB-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229910052699 polonium Inorganic materials 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000523 sample Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000007659 semicarbazones Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000013517 stratification Methods 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- DQFBYFPFKXHELB-VAWYXSNFSA-N trans-chalcone Chemical compound C=1C=CC=CC=1C(=O)\C=C\C1=CC=CC=C1 DQFBYFPFKXHELB-VAWYXSNFSA-N 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- 150000005671 trienes Chemical class 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- ORGHESHFQPYLAO-UHFFFAOYSA-N vinyl radical Chemical compound C=[CH] ORGHESHFQPYLAO-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/05—Organic bonding materials; Methods for coating a substrate with a photoconductive layer; Inert supplements for use in photoconductive layers
- G03G5/0528—Macromolecular bonding materials
- G03G5/0557—Macromolecular bonding materials obtained otherwise than by reactions only involving carbon-to-carbon unsatured bonds
- G03G5/0567—Other polycondensates comprising oxygen atoms in the main chain; Phenol resins
Landscapes
- Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US81420269A | 1969-04-07 | 1969-04-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2016395A1 DE2016395A1 (de) | 1970-10-15 |
| DE2016395B2 DE2016395B2 (de) | 1974-02-14 |
| DE2016395C3 true DE2016395C3 (de) | 1974-09-05 |
Family
ID=25214421
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2016395A Expired DE2016395C3 (de) | 1969-04-07 | 1970-04-06 | Elektrophotographisches Aufzeichnungsmaterial |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3554746A (enExample) |
| JP (1) | JPS4843827B1 (enExample) |
| BE (1) | BE748511A (enExample) |
| CA (1) | CA919479A (enExample) |
| DE (1) | DE2016395C3 (enExample) |
| FR (1) | FR2042976A5 (enExample) |
| GB (1) | GB1283652A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3943108A (en) * | 1974-09-27 | 1976-03-09 | Xerox Corporation | Photoconductive composition of an aldehyde condensate |
| JPH0690546B2 (ja) * | 1986-03-14 | 1994-11-14 | 富士写真フイルム株式会社 | 電子写真式平版印刷用原版 |
| JPS63180197U (enExample) * | 1987-05-08 | 1988-11-21 | ||
| MY109293A (en) * | 1991-12-18 | 1996-12-31 | Gillette Co | Fiber marker including an erasable ink |
| US5599853A (en) * | 1993-01-29 | 1997-02-04 | The Gillette Company | Erasable inks |
-
1969
- 1969-04-07 US US814202A patent/US3554746A/en not_active Expired - Lifetime
-
1970
- 1970-03-06 CA CA076668A patent/CA919479A/en not_active Expired
- 1970-03-26 GB GB04885/70A patent/GB1283652A/en not_active Expired
- 1970-04-03 BE BE748511D patent/BE748511A/xx unknown
- 1970-04-06 DE DE2016395A patent/DE2016395C3/de not_active Expired
- 1970-04-06 FR FR7012361A patent/FR2042976A5/fr not_active Expired
- 1970-04-07 JP JP45029297A patent/JPS4843827B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4843827B1 (enExample) | 1973-12-20 |
| US3554746A (en) | 1971-01-12 |
| DE2016395A1 (de) | 1970-10-15 |
| FR2042976A5 (enExample) | 1971-02-12 |
| DE2016395B2 (de) | 1974-02-14 |
| GB1283652A (en) | 1972-08-02 |
| CA919479A (en) | 1973-01-23 |
| BE748511A (fr) | 1970-09-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3124396C2 (enExample) | ||
| DE3020108A1 (de) | Elektrophotographisches element | |
| DE3715853A1 (de) | Fotoempfindliches element mit styrylbestandteil | |
| DE69530351T2 (de) | Elektrophotoempfindliches Material | |
| DE3441646C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2631629C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2726757A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2016395C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE60316505T2 (de) | Einschichtiger elektrophotographischer Photorezeptor | |
| DE2829751A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE1943386A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2028639C3 (de) | Elektrophotographisches Aufzeichnungs material | |
| DE1797137C3 (enExample) | ||
| DE2048135B2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2601822C2 (de) | Elektrofotografisches Aufzeichnungsmaterial | |
| DE1959181C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3110958A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE1943386C (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1954500C (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2018038C3 (de) | Verfahren zur Herstellung eines elektrophotographischen Aufzeichnungsmaterials | |
| DE3509147A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2421502C3 (de) | EIe ktrophotographisches Aufzeichnungsmaterial | |
| DE1597827C (de) | Verfahren zur Herstellung einer photoleitfähigen Schicht | |
| DE2013506A1 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE1943387C (de) | Elektrophotographisches Auf zeichnungsmatenal |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 | ||
| 8339 | Ceased/non-payment of the annual fee |