DE2003146A1 - Neue 1,4-Dihydropyridinderivate - Google Patents
Neue 1,4-DihydropyridinderivateInfo
- Publication number
- DE2003146A1 DE2003146A1 DE19702003146 DE2003146A DE2003146A1 DE 2003146 A1 DE2003146 A1 DE 2003146A1 DE 19702003146 DE19702003146 DE 19702003146 DE 2003146 A DE2003146 A DE 2003146A DE 2003146 A1 DE2003146 A1 DE 2003146A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- radical
- carbon atoms
- groups
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 title claims description 6
- -1 cyclic alkyl radical Chemical class 0.000 claims description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 150000001875 compounds Chemical class 0.000 claims description 14
- 230000000694 effects Effects 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 229920006395 saturated elastomer Polymers 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- KRTGJZMJJVEKRX-UHFFFAOYSA-N 2-phenylethan-1-yl Chemical compound [CH2]CC1=CC=CC=C1 KRTGJZMJJVEKRX-UHFFFAOYSA-N 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000002560 nitrile group Chemical group 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 2
- 150000003254 radicals Chemical class 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 3
- 239000004480 active ingredient Substances 0.000 claims 3
- 239000003814 drug Substances 0.000 claims 2
- 125000004122 cyclic group Chemical group 0.000 claims 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 5
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- CMWKITSNTDAEDT-UHFFFAOYSA-N 2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC=C1C=O CMWKITSNTDAEDT-UHFFFAOYSA-N 0.000 description 3
- YGCZTXZTJXYWCO-UHFFFAOYSA-N 3-phenylpropanal Chemical compound O=CCCC1=CC=CC=C1 YGCZTXZTJXYWCO-UHFFFAOYSA-N 0.000 description 3
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- WDJHALXBUFZDSR-UHFFFAOYSA-M acetoacetate Chemical compound CC(=O)CC([O-])=O WDJHALXBUFZDSR-UHFFFAOYSA-M 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 3
- KJPRLNWUNMBNBZ-QPJJXVBHSA-N (E)-cinnamaldehyde Chemical compound O=C\C=C\C1=CC=CC=C1 KJPRLNWUNMBNBZ-QPJJXVBHSA-N 0.000 description 2
- PKZJLOCLABXVMC-UHFFFAOYSA-N 2-Methoxybenzaldehyde Chemical compound COC1=CC=CC=C1C=O PKZJLOCLABXVMC-UHFFFAOYSA-N 0.000 description 2
- WMPDAIZRQDCGFH-UHFFFAOYSA-N 3-methoxybenzaldehyde Chemical compound COC1=CC=CC(C=O)=C1 WMPDAIZRQDCGFH-UHFFFAOYSA-N 0.000 description 2
- BXRFQSNOROATLV-UHFFFAOYSA-N 4-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=C(C=O)C=C1 BXRFQSNOROATLV-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N butyl acetate Chemical compound CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229940117916 cinnamic aldehyde Drugs 0.000 description 2
- KJPRLNWUNMBNBZ-UHFFFAOYSA-N cinnamic aldehyde Natural products O=CC=CC1=CC=CC=C1 KJPRLNWUNMBNBZ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 210000004351 coronary vessel Anatomy 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 150000002081 enamines Chemical class 0.000 description 2
- YPMPTULBFPFSEQ-PLNGDYQASA-N ethyl (z)-3-aminobut-2-enoate Chemical compound CCOC(=O)\C=C(\C)N YPMPTULBFPFSEQ-PLNGDYQASA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- BTFQKIATRPGRBS-UHFFFAOYSA-N o-tolualdehyde Chemical compound CC1=CC=CC=C1C=O BTFQKIATRPGRBS-UHFFFAOYSA-N 0.000 description 2
- ZRSNZINYAWTAHE-UHFFFAOYSA-N p-methoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 210000002460 smooth muscle Anatomy 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- DIVNUTGTTIRPQA-UHFFFAOYSA-N (3,4-dimethoxyphenyl)methanamine Chemical compound COC1=CC=C(CN)C=C1OC DIVNUTGTTIRPQA-UHFFFAOYSA-N 0.000 description 1
- YMVFJGSXZNNUDW-UHFFFAOYSA-N (4-chlorophenyl)methanamine Chemical compound NCC1=CC=C(Cl)C=C1 YMVFJGSXZNNUDW-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FJPGAMCQJNLTJC-UHFFFAOYSA-N 2,3-Heptanedione Chemical compound CCCCC(=O)C(C)=O FJPGAMCQJNLTJC-UHFFFAOYSA-N 0.000 description 1
- GISVICWQYMUPJF-UHFFFAOYSA-N 2,4-Dimethylbenzaldehyde Chemical compound CC1=CC=C(C=O)C(C)=C1 GISVICWQYMUPJF-UHFFFAOYSA-N 0.000 description 1
- DMIYKWPEFRFTPY-UHFFFAOYSA-N 2,6-dichlorobenzaldehyde Chemical compound ClC1=CC=CC(Cl)=C1C=O DMIYKWPEFRFTPY-UHFFFAOYSA-N 0.000 description 1
- DGXAGETVRDOQFP-UHFFFAOYSA-N 2,6-dihydroxybenzaldehyde Chemical compound OC1=CC=CC(O)=C1C=O DGXAGETVRDOQFP-UHFFFAOYSA-N 0.000 description 1
- WHFZQNNDIJKLIO-UHFFFAOYSA-N 2,6-dinitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1C=O WHFZQNNDIJKLIO-UHFFFAOYSA-N 0.000 description 1
- KJJPLEZQSCZCKE-UHFFFAOYSA-N 2-aminopropane-1,3-diol Chemical compound OCC(N)CO KJJPLEZQSCZCKE-UHFFFAOYSA-N 0.000 description 1
- WRIAMYXQKSDDRP-UHFFFAOYSA-N 2-bromo-6-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(Br)=C1C=O WRIAMYXQKSDDRP-UHFFFAOYSA-N 0.000 description 1
- LTJCCJIOKZLBAH-UHFFFAOYSA-N 2-butylsulfanylbenzaldehyde Chemical compound CCCCSC1=CC=CC=C1C=O LTJCCJIOKZLBAH-UHFFFAOYSA-N 0.000 description 1
- GZELPDCDUYPUTD-UHFFFAOYSA-N 2-chloro-4-formylbenzonitrile Chemical compound ClC1=CC(C=O)=CC=C1C#N GZELPDCDUYPUTD-UHFFFAOYSA-N 0.000 description 1
- IBMUHJIDXFMZPI-UHFFFAOYSA-N 2-chlorobenzaldehyde Chemical compound ClC1=CC=CC=C1C=O.ClC1=CC=CC=C1C=O IBMUHJIDXFMZPI-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical compound FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- 239000001431 2-methylbenzaldehyde Substances 0.000 description 1
- XIOBUABQJIVPCQ-UHFFFAOYSA-N 2-methylsulfanylbenzaldehyde Chemical compound CSC1=CC=CC=C1C=O XIOBUABQJIVPCQ-UHFFFAOYSA-N 0.000 description 1
- HFOCAQPWSXBFFN-UHFFFAOYSA-N 2-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=CC=C1C=O HFOCAQPWSXBFFN-UHFFFAOYSA-N 0.000 description 1
- ZZJVNPRHHLLANO-UHFFFAOYSA-N 2-propan-2-yloxybenzaldehyde Chemical compound CC(C)OC1=CC=CC=C1C=O ZZJVNPRHHLLANO-UHFFFAOYSA-N 0.000 description 1
- NYRGMNMVISROGJ-UHFFFAOYSA-N 3-benzylidenepentane-2,4-dione Chemical compound CC(=O)C(C(C)=O)=CC1=CC=CC=C1 NYRGMNMVISROGJ-UHFFFAOYSA-N 0.000 description 1
- YESCIRFCEGIMED-UHFFFAOYSA-N 3-butoxybenzaldehyde Chemical compound CCCCOC1=CC=CC(C=O)=C1 YESCIRFCEGIMED-UHFFFAOYSA-N 0.000 description 1
- IERHSIBWKDAZJR-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC=1C=C(C=O)C=CC1.OC=1C=C(C=O)C=CC1 IERHSIBWKDAZJR-UHFFFAOYSA-N 0.000 description 1
- OVSMURBVBQUOSF-UHFFFAOYSA-N 3-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=CC(C=O)=C1 OVSMURBVBQUOSF-UHFFFAOYSA-N 0.000 description 1
- ZETIVVHRRQLWFW-UHFFFAOYSA-N 3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC=CC(C=O)=C1 ZETIVVHRRQLWFW-UHFFFAOYSA-N 0.000 description 1
- PRRBQHNMYJRHFW-UHFFFAOYSA-M 3-oxoheptanoate Chemical compound CCCCC(=O)CC([O-])=O PRRBQHNMYJRHFW-UHFFFAOYSA-M 0.000 description 1
- KWXVVLHKADHVRM-UHFFFAOYSA-N 3-sulfanylbenzaldehyde Chemical compound SC1=CC=CC(C=O)=C1 KWXVVLHKADHVRM-UHFFFAOYSA-N 0.000 description 1
- WQGFZQFGVYDFOP-UHFFFAOYSA-N 4,6-dimethoxypyrimidine-5-carbaldehyde Chemical compound COC1=NC=NC(OC)=C1C=O WQGFZQFGVYDFOP-UHFFFAOYSA-N 0.000 description 1
- MZPNQUMLOFWSEK-UHFFFAOYSA-N 4-chloro-2-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(Cl)=CC=C1C=O MZPNQUMLOFWSEK-UHFFFAOYSA-N 0.000 description 1
- JFZBGMNUFRENSC-UHFFFAOYSA-N 4-chloro-3-hydroxy-2-nitrobenzaldehyde Chemical compound OC1=C(Cl)C=CC(C=O)=C1[N+]([O-])=O JFZBGMNUFRENSC-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- KNKVNTDAQHBEAW-UHFFFAOYSA-N 4-formyl-3-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC(C#N)=CC=C1C=O KNKVNTDAQHBEAW-UHFFFAOYSA-N 0.000 description 1
- WVGDLTQPAQUBMO-UHFFFAOYSA-N 4-hydroxy-3,5-di(propan-2-yl)benzaldehyde Chemical compound CC(C)C1=CC(C=O)=CC(C(C)C)=C1O WVGDLTQPAQUBMO-UHFFFAOYSA-N 0.000 description 1
- YTHJCZRFJGXPTL-UHFFFAOYSA-N 4-hydroxy-3-nitrobenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1[N+]([O-])=O YTHJCZRFJGXPTL-UHFFFAOYSA-N 0.000 description 1
- KLTDQLIGNSBZPO-UHFFFAOYSA-N 4-methoxy-2-nitrobenzaldehyde Chemical compound COC1=CC=C(C=O)C([N+]([O-])=O)=C1 KLTDQLIGNSBZPO-UHFFFAOYSA-N 0.000 description 1
- QRVYABWJVXXOTN-UHFFFAOYSA-N 4-methylsulfanylbenzaldehyde Chemical compound CSC1=CC=C(C=O)C=C1 QRVYABWJVXXOTN-UHFFFAOYSA-N 0.000 description 1
- PSVPUHBSBYJSMQ-UHFFFAOYSA-N 4-methylsulfonylbenzaldehyde Chemical compound CS(=O)(=O)C1=CC=C(C=O)C=C1 PSVPUHBSBYJSMQ-UHFFFAOYSA-N 0.000 description 1
- XLYPHUGUKGMURE-UHFFFAOYSA-N 5-hydroxy-2-nitrobenzaldehyde Chemical compound OC1=CC=C([N+]([O-])=O)C(C=O)=C1 XLYPHUGUKGMURE-UHFFFAOYSA-N 0.000 description 1
- BNTDDWPHSMILHQ-UHFFFAOYSA-N 5-methoxy-2-nitrobenzaldehyde Chemical compound COC1=CC=C([N+]([O-])=O)C(C=O)=C1 BNTDDWPHSMILHQ-UHFFFAOYSA-N 0.000 description 1
- JVVPPRRJHPQUHT-UHFFFAOYSA-N 6-chloro-3-methoxy-2-nitrobenzaldehyde Chemical compound COC1=CC=C(Cl)C(C=O)=C1[N+]([O-])=O JVVPPRRJHPQUHT-UHFFFAOYSA-N 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- 206010001497 Agitation Diseases 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000490229 Eucephalus Species 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- GKESTCSMPAVCFO-UHFFFAOYSA-N NC.ClO Chemical compound NC.ClO GKESTCSMPAVCFO-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000812 cholinergic antagonist Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GJOSRMAVDXJBCZ-UHFFFAOYSA-N cyclohexyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OC1CCCCC1 GJOSRMAVDXJBCZ-UHFFFAOYSA-N 0.000 description 1
- WOWBFOBYOAGEEA-UHFFFAOYSA-N diafenthiuron Chemical compound CC(C)C1=C(NC(=S)NC(C)(C)C)C(C(C)C)=CC(OC=2C=CC=CC=2)=C1 WOWBFOBYOAGEEA-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- KNUYHVRRBLEIHT-UHFFFAOYSA-N ethyl 3-oxo-5-phenylpent-4-enoate Chemical compound CCOC(=O)CC(=O)C=CC1=CC=CC=C1 KNUYHVRRBLEIHT-UHFFFAOYSA-N 0.000 description 1
- KQWWVLVLVYYYDT-UHFFFAOYSA-N ethyl 3-oxohexanoate Chemical compound CCCC(=O)CC(=O)OCC KQWWVLVLVYYYDT-UHFFFAOYSA-N 0.000 description 1
- XCLDSQRVMMXWMS-UHFFFAOYSA-N ethyl 4-methyl-3-oxopentanoate Chemical compound CCOC(=O)CC(=O)C(C)C XCLDSQRVMMXWMS-UHFFFAOYSA-N 0.000 description 1
- TZMFJUDUGYTVRY-UHFFFAOYSA-N ethyl methyl diketone Natural products CCC(=O)C(C)=O TZMFJUDUGYTVRY-UHFFFAOYSA-N 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 229940126601 medicinal product Drugs 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- IAVREABSGIHHMO-UHFFFAOYSA-N meta-hydroxybenzaldehyde Natural products OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- GDOYYMOEBDFFIQ-UHFFFAOYSA-N oxolan-2-ylmethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC1CCCO1 GDOYYMOEBDFFIQ-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- AXLMPTNTPOWPLT-UHFFFAOYSA-N prop-2-enyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCC=C AXLMPTNTPOWPLT-UHFFFAOYSA-N 0.000 description 1
- JKANAVGODYYCQF-UHFFFAOYSA-N prop-2-yn-1-amine Chemical compound NCC#C JKANAVGODYYCQF-UHFFFAOYSA-N 0.000 description 1
- GVIIRWAJDFKJMJ-UHFFFAOYSA-N propan-2-yl 3-oxobutanoate Chemical compound CC(C)OC(=O)CC(C)=O GVIIRWAJDFKJMJ-UHFFFAOYSA-N 0.000 description 1
- 125000003186 propargylic group Chemical group 0.000 description 1
- DHGFMVMDBNLMKT-UHFFFAOYSA-N propyl 3-oxobutanoate Chemical compound CCCOC(=O)CC(C)=O DHGFMVMDBNLMKT-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- OKULHRWWYCFJAB-UHFFFAOYSA-N pyrimidine-4-carbaldehyde Chemical compound O=CC1=CC=NC=N1 OKULHRWWYCFJAB-UHFFFAOYSA-N 0.000 description 1
- FREJAOSUHFGDBW-UHFFFAOYSA-N pyrimidine-5-carbaldehyde Chemical compound O=CC1=CN=CN=C1 FREJAOSUHFGDBW-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 230000003235 vasospasmolytic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Priority Applications (21)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ZA710052A ZA7152B (en) | 1970-01-24 | 1970-01-24 | New pharmaceutically active 1,4-dihydropyridines |
| DE19702003146 DE2003146A1 (de) | 1970-01-24 | 1970-01-24 | Neue 1,4-Dihydropyridinderivate |
| CH1922870A CH586200A5 (enExample) | 1970-01-24 | 1970-12-28 | |
| IL35924A IL35924A (en) | 1970-01-24 | 1970-12-29 | 1,4-dihydropyridines,their manufacture and pharmaceutical compositions containing them |
| IE1652/70A IE34890B1 (en) | 1970-01-24 | 1970-12-31 | New pharmaceutically active 1,4-dihydropyridines |
| GB105771A GB1317425A (en) | 1970-01-24 | 1971-01-08 | Pharmaceutically active 1,4-dihydropyridines |
| US00107849A US3775422A (en) | 1970-01-24 | 1971-01-19 | Unsymmetrical 1,4-dihydro-4-aryl-nicotinate esters |
| CS424A CS163747B2 (enExample) | 1970-01-24 | 1971-01-20 | |
| CS7937*A CS163748B2 (enExample) | 1970-01-24 | 1971-01-20 | |
| CA103,180A CA945167A (en) | 1970-01-24 | 1971-01-20 | 1,4-dihydropyridines and their production |
| NL7100816A NL7100816A (enExample) | 1970-01-24 | 1971-01-21 | |
| SU1615395A SU383290A1 (ru) | 1971-01-22 | Способ получения производных 1,4-дигидропиридина.12 | |
| SU1615424A SU379091A1 (ru) | 1971-01-22 | Способ получения производных 1,4-дигидропиридина | |
| HUBA2524A HU162199B (enExample) | 1970-01-24 | 1971-01-22 | |
| FR7102235A FR2081452B1 (enExample) | 1970-01-24 | 1971-01-22 | |
| BE761929A BE761929A (enExample) | 1970-01-24 | 1971-01-22 | |
| ES387562A ES387562A1 (es) | 1970-01-24 | 1971-01-23 | Procedimiento de 1,4-dihidropiridinas con efecto dilatador de los vasos coronarios. |
| AT57771A AT304552B (de) | 1970-01-24 | 1971-01-25 | Verfahren zur Herstellung von neuen 1,4-Dihydropyridinderivaten |
| AT146272A AT306720B (de) | 1970-01-24 | 1971-01-25 | Verfahren zur Herstellung von neuen 1,4-Dihydropyridinderivaten |
| US344344A US3862161A (en) | 1970-01-24 | 1973-03-23 | 4-pyridyl substituted 1,4-dihydropyridines |
| US05/485,333 US3966948A (en) | 1970-01-24 | 1974-07-03 | Spasmolytic, vaso-dilating and anti-hypertensive compositions and methods |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702003146 DE2003146A1 (de) | 1970-01-24 | 1970-01-24 | Neue 1,4-Dihydropyridinderivate |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2003146A1 true DE2003146A1 (de) | 1971-07-29 |
Family
ID=5760409
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702003146 Pending DE2003146A1 (de) | 1970-01-24 | 1970-01-24 | Neue 1,4-Dihydropyridinderivate |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3775422A (enExample) |
| AT (2) | AT306720B (enExample) |
| BE (1) | BE761929A (enExample) |
| CA (1) | CA945167A (enExample) |
| CH (1) | CH586200A5 (enExample) |
| CS (2) | CS163747B2 (enExample) |
| DE (1) | DE2003146A1 (enExample) |
| ES (1) | ES387562A1 (enExample) |
| FR (1) | FR2081452B1 (enExample) |
| GB (1) | GB1317425A (enExample) |
| HU (1) | HU162199B (enExample) |
| IE (1) | IE34890B1 (enExample) |
| IL (1) | IL35924A (enExample) |
| NL (1) | NL7100816A (enExample) |
| ZA (1) | ZA7152B (enExample) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2302866A1 (de) * | 1972-01-22 | 1973-08-02 | Yamanouchi Pharma Co Ltd | Neue 1-substituierte-1,4-dihydropyridinderivate |
| JPS5040576A (enExample) * | 1973-02-13 | 1975-04-14 | ||
| JPS5223081A (en) * | 1975-08-12 | 1977-02-21 | Hexachimie | 1*44dihydropyridines and application to remedy |
| EP0042093A3 (en) * | 1980-06-12 | 1982-07-14 | Bayer Ag | 4-aralkyl-1,4-dihydropyridines, processes for praparing them, their use as medicines and preparation thereof |
| US4497808A (en) * | 1981-12-30 | 1985-02-05 | Ciba-Geigy Corporation | N-Oxide compounds useful in the treatment of cardiovascular ailments |
| WO2007009670A1 (de) | 2005-07-22 | 2007-01-25 | Bayer Healthcare Ag | 4-chromenonyl-1,4-dihydropyridincarbonitrile und ihre verwendung |
| US7989633B2 (en) | 2005-07-22 | 2011-08-02 | Bayer Schering Pharma Aktiengesellschaft | 4-Chromenonyl-1,4-dihydropyridines and their use |
| WO2013178821A1 (en) * | 2012-06-01 | 2013-12-05 | Leibniz-Institut für Altersforschung - Fritz-Lipmann-Institut e.V. (FLI) | Inhibitors of the notch signalling pathway and secretion for use in medicine |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4001258A (en) * | 1972-03-06 | 1977-01-04 | Bayer Aktiengesellschaft | 2-amino-1,4-dihydropyridine derivatives |
| US3988458A (en) * | 1972-03-06 | 1976-10-26 | Bayer Aktiengesellschaft | Bicyclic derivatives of 1,4-dihydropyridine 3,5-carboxylic acid esters |
| US3857849A (en) * | 1973-02-28 | 1974-12-31 | Bayer Ag | 2-amino-1,4-dihydropyridine derivatives |
| DD106832A5 (enExample) * | 1972-03-06 | 1974-07-05 | ||
| US3860601A (en) * | 1972-03-06 | 1975-01-14 | Horst Meyer | 2,6-diamino-1,4-dihydropyridine derivatives |
| US3935223A (en) * | 1972-03-06 | 1976-01-27 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| US3985886A (en) * | 1972-03-06 | 1976-10-12 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives and process for their preparation |
| DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| US3939171A (en) * | 1972-03-06 | 1976-02-17 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| US3917619A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
| US3992545A (en) * | 1972-03-06 | 1976-11-16 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives in pharmaceutical compositions |
| US3917620A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
| US3917622A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-1,4-dihydropyridine derivatives |
| US3957998A (en) * | 1972-03-06 | 1976-05-18 | Bayer Aktiengesellschaft | Use of 2,6-diamino-4-substituted-1,4-dihydropyridine-3,5-dicarboxylic acid esters for effecting coronary vessel dilation and treating hypertension |
| DE2228363A1 (de) * | 1972-06-10 | 1974-01-03 | Bayer Ag | 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US3968117A (en) * | 1972-06-10 | 1976-07-06 | Bayer Aktiengesellschaft | 1,4-Dihydropyridines |
| DE2242786A1 (de) * | 1972-08-31 | 1974-03-14 | Bayer Ag | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel |
| DE2242787C2 (de) * | 1972-08-31 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | 4-Phenyl-6-amino-3,4-dihydropyridon-(2)-3,5-dicarbonsäure-diäthylesterderivate, ein Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| US3989708A (en) * | 1972-08-31 | 1976-11-02 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| US4002762A (en) * | 1973-03-03 | 1977-01-11 | Bayer Aktiengesellschaft | 2-Amino-3,4-dihydropyridines used to effect coronary vessel dilation and treat hypertension |
| US4529733A (en) * | 1983-04-06 | 1985-07-16 | Merrell Dow Pharmaceuticals Inc. | Antihypertensive 3-furoyl-1,4-dihydropyridines |
| IE57810B1 (en) * | 1984-03-27 | 1993-04-21 | Delagrange Lab | 1,4-dihydropyridine derivatives,their preparation and their use |
| US4994476A (en) * | 1984-10-31 | 1991-02-19 | Bristol-Myers Company | Dihydropyridin-3,5-dicarboxylates incorporating aryloxypropanolamine moieties |
| ES8708211A1 (es) * | 1985-06-14 | 1987-10-01 | Sankyo Co | Un procedimiento para la preparacion de nuevos derivados de 4-(fenil sustituido)-1,4-dihidropiridina. |
| US4772596A (en) * | 1986-10-09 | 1988-09-20 | Sankyo Company Limited | Dihydropyridine derivatives, their preparation and their use |
| DE4118707A1 (de) * | 1991-06-07 | 1992-12-10 | Bayer Ag | Pharmazeutische verwendung von 3-formyl-1,4-dihydropyridinen, neue verbindungen und verfahren zu ihrer herstellung |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3455939A (en) * | 1967-06-07 | 1969-07-15 | Smithkline Corp | 4-(4-chloro-3-sulfamoylphenyl)-1,4-dihydropyridines |
-
1970
- 1970-01-24 ZA ZA710052A patent/ZA7152B/xx unknown
- 1970-01-24 DE DE19702003146 patent/DE2003146A1/de active Pending
- 1970-12-28 CH CH1922870A patent/CH586200A5/xx not_active IP Right Cessation
- 1970-12-29 IL IL35924A patent/IL35924A/xx unknown
- 1970-12-31 IE IE1652/70A patent/IE34890B1/xx unknown
-
1971
- 1971-01-08 GB GB105771A patent/GB1317425A/en not_active Expired
- 1971-01-19 US US00107849A patent/US3775422A/en not_active Expired - Lifetime
- 1971-01-20 CA CA103,180A patent/CA945167A/en not_active Expired
- 1971-01-20 CS CS424A patent/CS163747B2/cs unknown
- 1971-01-20 CS CS7937*A patent/CS163748B2/cs unknown
- 1971-01-21 NL NL7100816A patent/NL7100816A/xx unknown
- 1971-01-22 FR FR7102235A patent/FR2081452B1/fr not_active Expired
- 1971-01-22 HU HUBA2524A patent/HU162199B/hu unknown
- 1971-01-22 BE BE761929A patent/BE761929A/xx unknown
- 1971-01-23 ES ES387562A patent/ES387562A1/es not_active Expired
- 1971-01-25 AT AT146272A patent/AT306720B/de not_active IP Right Cessation
- 1971-01-25 AT AT57771A patent/AT304552B/de not_active IP Right Cessation
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2302866A1 (de) * | 1972-01-22 | 1973-08-02 | Yamanouchi Pharma Co Ltd | Neue 1-substituierte-1,4-dihydropyridinderivate |
| JPS5040576A (enExample) * | 1973-02-13 | 1975-04-14 | ||
| JPS5223081A (en) * | 1975-08-12 | 1977-02-21 | Hexachimie | 1*44dihydropyridines and application to remedy |
| EP0042093A3 (en) * | 1980-06-12 | 1982-07-14 | Bayer Ag | 4-aralkyl-1,4-dihydropyridines, processes for praparing them, their use as medicines and preparation thereof |
| US4497808A (en) * | 1981-12-30 | 1985-02-05 | Ciba-Geigy Corporation | N-Oxide compounds useful in the treatment of cardiovascular ailments |
| WO2007009670A1 (de) | 2005-07-22 | 2007-01-25 | Bayer Healthcare Ag | 4-chromenonyl-1,4-dihydropyridincarbonitrile und ihre verwendung |
| US7989633B2 (en) | 2005-07-22 | 2011-08-02 | Bayer Schering Pharma Aktiengesellschaft | 4-Chromenonyl-1,4-dihydropyridines and their use |
| US8058447B2 (en) | 2005-07-22 | 2011-11-15 | Bayer Pharma Aktiengesellschaft | 4-Chromenonyl-1,4-dihydropyridinecarbonitriles and the use thereof |
| WO2013178821A1 (en) * | 2012-06-01 | 2013-12-05 | Leibniz-Institut für Altersforschung - Fritz-Lipmann-Institut e.V. (FLI) | Inhibitors of the notch signalling pathway and secretion for use in medicine |
| US9828344B2 (en) | 2012-06-01 | 2017-11-28 | LEIBNIZ-INSTITUT FÜR ALTERSFORSCHUNG FRITZ-LIPMANN-INSTITUT e.V. (FLI) | Inhibitors of the notch signaling pathway and secretion for use in medicine |
Also Published As
| Publication number | Publication date |
|---|---|
| AT304552B (de) | 1973-01-10 |
| CS163747B2 (enExample) | 1975-11-07 |
| FR2081452A1 (enExample) | 1971-12-03 |
| GB1317425A (en) | 1973-05-16 |
| NL7100816A (enExample) | 1971-07-27 |
| IE34890L (en) | 1971-07-24 |
| US3775422A (en) | 1973-11-27 |
| ES387562A1 (es) | 1974-01-01 |
| CA945167A (en) | 1974-04-09 |
| HU162199B (enExample) | 1973-01-29 |
| SU383290A3 (enExample) | 1973-05-25 |
| IL35924A (en) | 1974-09-10 |
| AT306720B (de) | 1973-04-25 |
| BE761929A (enExample) | 1971-07-22 |
| CH586200A5 (enExample) | 1977-03-31 |
| IE34890B1 (en) | 1975-09-17 |
| ZA7152B (en) | 1971-10-27 |
| FR2081452B1 (enExample) | 1974-08-23 |
| CS163748B2 (enExample) | 1975-11-07 |
| IL35924A0 (en) | 1971-02-25 |
| SU379091A3 (enExample) | 1973-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2003146A1 (de) | Neue 1,4-Dihydropyridinderivate | |
| DE2005116A1 (de) | Neue 1,4 Dihydropyridindenvate | |
| DE1923990C3 (de) | Verfahren zur Herstellung von N-substituierten M-Dihydropyridin-S.S-dicarbonsäureestern | |
| DE2013431C3 (de) | 4-Azidophenyl-l,4-dihydropyridin-3,5-dicarbonsäureester | |
| DE2218644A1 (de) | Basische ester von 1,4-dihydropyridinen, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2228363A1 (de) | 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1670827A1 (de) | Neue Arzneimittel auf der Grundlage von 4-Aryl-1,4-dihydropyridinderivaten | |
| DE2658183A1 (de) | In 2-position substituierte 1,4- dihydropyridin-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2752820A1 (de) | Neue nitrosubstituierte 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE1963188A1 (de) | Neue Cyanphenyl-1,4-dihydropyridinderivate | |
| DE1963186C3 (de) | Schwefelhaltige 1,4-Dihydropyridin-33-dicarbonsäureester | |
| DE2210633A1 (de) | Neue brueckenkopfheterocyclen, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2003148A1 (de) | Neue 1,4-Dihydropyridinderivate | |
| DE2117573B2 (de) | Verfahren zur herstellung von unsymmetrischen 1,4-dihydropyridin-3,5- dicarbonsaeureestern, sowie ihre verwendung als arzneimittel | |
| DE1813436A1 (de) | N-Alkyl-1,4-dihydropyridine | |
| DE2658804A1 (de) | Kreislaufbeeinflussende mittel | |
| EP0039863A1 (de) | 1,4-Dihydropyridine mit unterschiedlichen Substituenten in 2- und 6-Position, Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimitteln | |
| DE2406198C2 (de) | Verfahren zur Herstellung von neuen 2-Amino-6-dialkylamino-dihydropyridinen | |
| DE2239815A1 (de) | Verfahren zur herstellung von neuen 2-alkylamino-dihydropyridinen sowie ihre verwendung als arzneimittel | |
| DE1545873A1 (de) | Verfahren zur Herstellung von Dihydrodipyridylderivaten | |
| DE1963185A1 (de) | Neue Nitrophenyl-1,4-dihydropyridinderivate | |
| DE1543419A1 (de) | Neues Verfahren zur Herstellung von cyclischen ungesaettigten Ketonen | |
| DE2018738A1 (en) | Hydrogenated pyridines, quinolines andacridi | |
| DE1295560B (de) | Verfahren zur Herstellung von substituierten 5-Aminopyrazolen | |
| EP0001054A2 (de) | 2-Pyridyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel |