IE34890B1 - New pharmaceutically active 1,4-dihydropyridines - Google Patents
New pharmaceutically active 1,4-dihydropyridinesInfo
- Publication number
- IE34890B1 IE34890B1 IE1652/70A IE165270A IE34890B1 IE 34890 B1 IE34890 B1 IE 34890B1 IE 1652/70 A IE1652/70 A IE 1652/70A IE 165270 A IE165270 A IE 165270A IE 34890 B1 IE34890 B1 IE 34890B1
- Authority
- IE
- Ireland
- Prior art keywords
- compound
- substituted
- alkyl
- alkoxy
- linear
- Prior art date
Links
- YNGDWRXWKFWCJY-UHFFFAOYSA-N 1,4-Dihydropyridine Chemical class C1C=CNC=C1 YNGDWRXWKFWCJY-UHFFFAOYSA-N 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 7
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 4
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000000304 alkynyl group Chemical group 0.000 abstract 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 2
- 125000000714 pyrimidinyl group Chemical group 0.000 abstract 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 abstract 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 abstract 1
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 abstract 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 abstract 1
- 125000004423 acyloxy group Chemical group 0.000 abstract 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 125000004414 alkyl thio group Chemical group 0.000 abstract 1
- 239000003416 antiarrhythmic agent Substances 0.000 abstract 1
- 239000002220 antihypertensive agent Substances 0.000 abstract 1
- 229940030600 antihypertensive agent Drugs 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 239000003218 coronary vasodilator agent Substances 0.000 abstract 1
- 125000005594 diketone group Chemical group 0.000 abstract 1
- 125000002541 furyl group Chemical group 0.000 abstract 1
- -1 methylenedioxy Chemical group 0.000 abstract 1
- 125000004430 oxygen atom Chemical group O* 0.000 abstract 1
- 238000007911 parenteral administration Methods 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 239000000546 pharmaceutical excipient Substances 0.000 abstract 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 1
- 125000004076 pyridyl group Chemical group 0.000 abstract 1
- 125000000168 pyrrolyl group Chemical group 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 125000005504 styryl group Chemical group 0.000 abstract 1
- 125000001544 thienyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Hydrogenated Pyridines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19702003146 DE2003146A1 (de) | 1970-01-24 | 1970-01-24 | Neue 1,4-Dihydropyridinderivate |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE34890L IE34890L (en) | 1971-07-24 |
| IE34890B1 true IE34890B1 (en) | 1975-09-17 |
Family
ID=5760409
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE1652/70A IE34890B1 (en) | 1970-01-24 | 1970-12-31 | New pharmaceutically active 1,4-dihydropyridines |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3775422A (enExample) |
| AT (2) | AT306720B (enExample) |
| BE (1) | BE761929A (enExample) |
| CA (1) | CA945167A (enExample) |
| CH (1) | CH586200A5 (enExample) |
| CS (2) | CS163747B2 (enExample) |
| DE (1) | DE2003146A1 (enExample) |
| ES (1) | ES387562A1 (enExample) |
| FR (1) | FR2081452B1 (enExample) |
| GB (1) | GB1317425A (enExample) |
| HU (1) | HU162199B (enExample) |
| IE (1) | IE34890B1 (enExample) |
| IL (1) | IL35924A (enExample) |
| NL (1) | NL7100816A (enExample) |
| ZA (1) | ZA7152B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1430961A (en) * | 1972-01-22 | 1976-04-07 | Yamanouchi Pharma Co Ltd | 1-substituted-1,4-dihyddrypyridine derivatives |
| US4001258A (en) * | 1972-03-06 | 1977-01-04 | Bayer Aktiengesellschaft | 2-amino-1,4-dihydropyridine derivatives |
| US3988458A (en) * | 1972-03-06 | 1976-10-26 | Bayer Aktiengesellschaft | Bicyclic derivatives of 1,4-dihydropyridine 3,5-carboxylic acid esters |
| US3857849A (en) * | 1973-02-28 | 1974-12-31 | Bayer Ag | 2-amino-1,4-dihydropyridine derivatives |
| DD106832A5 (enExample) * | 1972-03-06 | 1974-07-05 | ||
| US3860601A (en) * | 1972-03-06 | 1975-01-14 | Horst Meyer | 2,6-diamino-1,4-dihydropyridine derivatives |
| US3935223A (en) * | 1972-03-06 | 1976-01-27 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| US3985886A (en) * | 1972-03-06 | 1976-10-12 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives and process for their preparation |
| DE2210674C3 (de) * | 1972-03-06 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | 2-Amino-6-methyl-1,4-dihydropyridine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel |
| US3939171A (en) * | 1972-03-06 | 1976-02-17 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| US3917619A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
| US3992545A (en) * | 1972-03-06 | 1976-11-16 | Bayer Aktiengesellschaft | 2-Amino-4,5-dihydropyridine derivatives in pharmaceutical compositions |
| US3917620A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-4,5-dihydropyridine derivatives |
| US3917622A (en) * | 1972-03-06 | 1975-11-04 | Bayer Ag | 2-Amino-1,4-dihydropyridine derivatives |
| US3957998A (en) * | 1972-03-06 | 1976-05-18 | Bayer Aktiengesellschaft | Use of 2,6-diamino-4-substituted-1,4-dihydropyridine-3,5-dicarboxylic acid esters for effecting coronary vessel dilation and treating hypertension |
| DE2228363A1 (de) * | 1972-06-10 | 1974-01-03 | Bayer Ag | 1,4-dihydropyridine, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| US3968117A (en) * | 1972-06-10 | 1976-07-06 | Bayer Aktiengesellschaft | 1,4-Dihydropyridines |
| DE2242786A1 (de) * | 1972-08-31 | 1974-03-14 | Bayer Ag | Verfahren zur herstellung von neuen 2-amino-1,4-dihydropyridinen mit einer carbonylfunktion sowie ihre verwendung als arzneimittel |
| DE2242787C2 (de) * | 1972-08-31 | 1982-01-21 | Bayer Ag, 5090 Leverkusen | 4-Phenyl-6-amino-3,4-dihydropyridon-(2)-3,5-dicarbonsäure-diäthylesterderivate, ein Verfahren zu deren Herstellung und diese enthaltende Arzneimittel |
| US3989708A (en) * | 1972-08-31 | 1976-11-02 | Bayer Aktiengesellschaft | 2-Amino-1,4-dihydropyridine derivatives |
| GB1409865A (en) * | 1973-02-13 | 1975-10-15 | Science Union & Cie | Dihydropyridines derivatives their preparation and pharmaceu tical compositions containing them |
| US4002762A (en) * | 1973-03-03 | 1977-01-11 | Bayer Aktiengesellschaft | 2-Amino-3,4-dihydropyridines used to effect coronary vessel dilation and treat hypertension |
| FR2320750A1 (fr) * | 1975-08-12 | 1977-03-11 | Hexachimie | Dihydro-1,4 pyridines et leur application therapeutique |
| DE3021958A1 (de) * | 1980-06-12 | 1981-12-24 | Bayer Ag, 5090 Leverkusen | 1,4-dihydropyridine, verfahren zu deren herstellung sowie diese enthaltende arzneimittel |
| US4497808A (en) * | 1981-12-30 | 1985-02-05 | Ciba-Geigy Corporation | N-Oxide compounds useful in the treatment of cardiovascular ailments |
| US4529733A (en) * | 1983-04-06 | 1985-07-16 | Merrell Dow Pharmaceuticals Inc. | Antihypertensive 3-furoyl-1,4-dihydropyridines |
| IE57810B1 (en) * | 1984-03-27 | 1993-04-21 | Delagrange Lab | 1,4-dihydropyridine derivatives,their preparation and their use |
| US4994476A (en) * | 1984-10-31 | 1991-02-19 | Bristol-Myers Company | Dihydropyridin-3,5-dicarboxylates incorporating aryloxypropanolamine moieties |
| ES8708211A1 (es) * | 1985-06-14 | 1987-10-01 | Sankyo Co | Un procedimiento para la preparacion de nuevos derivados de 4-(fenil sustituido)-1,4-dihidropiridina. |
| US4772596A (en) * | 1986-10-09 | 1988-09-20 | Sankyo Company Limited | Dihydropyridine derivatives, their preparation and their use |
| DE4118707A1 (de) * | 1991-06-07 | 1992-12-10 | Bayer Ag | Pharmazeutische verwendung von 3-formyl-1,4-dihydropyridinen, neue verbindungen und verfahren zu ihrer herstellung |
| DE102005034264A1 (de) | 2005-07-22 | 2007-02-01 | Bayer Healthcare Ag | 4-Chromenonyl-1,4-dihydropyridincarbonitrile und ihre Verwendung |
| DE102005034267A1 (de) | 2005-07-22 | 2007-01-25 | Bayer Healthcare Ag | 4-Chromenonyl-1,4-dihydropyridine und ihre Verwendung |
| WO2013178821A1 (en) * | 2012-06-01 | 2013-12-05 | Leibniz-Institut für Altersforschung - Fritz-Lipmann-Institut e.V. (FLI) | Inhibitors of the notch signalling pathway and secretion for use in medicine |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3455939A (en) * | 1967-06-07 | 1969-07-15 | Smithkline Corp | 4-(4-chloro-3-sulfamoylphenyl)-1,4-dihydropyridines |
-
1970
- 1970-01-24 ZA ZA710052A patent/ZA7152B/xx unknown
- 1970-01-24 DE DE19702003146 patent/DE2003146A1/de active Pending
- 1970-12-28 CH CH1922870A patent/CH586200A5/xx not_active IP Right Cessation
- 1970-12-29 IL IL35924A patent/IL35924A/xx unknown
- 1970-12-31 IE IE1652/70A patent/IE34890B1/xx unknown
-
1971
- 1971-01-08 GB GB105771A patent/GB1317425A/en not_active Expired
- 1971-01-19 US US00107849A patent/US3775422A/en not_active Expired - Lifetime
- 1971-01-20 CA CA103,180A patent/CA945167A/en not_active Expired
- 1971-01-20 CS CS424A patent/CS163747B2/cs unknown
- 1971-01-20 CS CS7937*A patent/CS163748B2/cs unknown
- 1971-01-21 NL NL7100816A patent/NL7100816A/xx unknown
- 1971-01-22 FR FR7102235A patent/FR2081452B1/fr not_active Expired
- 1971-01-22 HU HUBA2524A patent/HU162199B/hu unknown
- 1971-01-22 BE BE761929A patent/BE761929A/xx unknown
- 1971-01-23 ES ES387562A patent/ES387562A1/es not_active Expired
- 1971-01-25 AT AT146272A patent/AT306720B/de not_active IP Right Cessation
- 1971-01-25 AT AT57771A patent/AT304552B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT304552B (de) | 1973-01-10 |
| DE2003146A1 (de) | 1971-07-29 |
| CS163747B2 (enExample) | 1975-11-07 |
| FR2081452A1 (enExample) | 1971-12-03 |
| GB1317425A (en) | 1973-05-16 |
| NL7100816A (enExample) | 1971-07-27 |
| IE34890L (en) | 1971-07-24 |
| US3775422A (en) | 1973-11-27 |
| ES387562A1 (es) | 1974-01-01 |
| CA945167A (en) | 1974-04-09 |
| HU162199B (enExample) | 1973-01-29 |
| SU383290A3 (enExample) | 1973-05-25 |
| IL35924A (en) | 1974-09-10 |
| AT306720B (de) | 1973-04-25 |
| BE761929A (enExample) | 1971-07-22 |
| CH586200A5 (enExample) | 1977-03-31 |
| ZA7152B (en) | 1971-10-27 |
| FR2081452B1 (enExample) | 1974-08-23 |
| CS163748B2 (enExample) | 1975-11-07 |
| IL35924A0 (en) | 1971-02-25 |
| SU379091A3 (enExample) | 1973-04-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE34890B1 (en) | New pharmaceutically active 1,4-dihydropyridines | |
| GB1326491A (en) | 1,4-dihydropyridine derivatives | |
| GB1347893A (en) | Antiinflammatory imidazoles | |
| GB1305795A (enExample) | ||
| IE31932L (en) | 1,4-dihydropyridines | |
| DE69426698D1 (de) | Kondensierte heteroaromatische cyclopentenderivate mit endothelin-antagonistischer aktivität | |
| GB1389509A (en) | Dihydropyridinepolyesters their production and their medicinal use | |
| GB1384504A (en) | Bridgeheadheterocyclic compounds their production and their medicinal use | |
| GB1291164A (en) | New sulphur-containing 1,4-dihydropyridine derivatives | |
| GB1438265A (enExample) | ||
| GB1373212A (en) | Pyrazole compounds | |
| KR890009910A (ko) | 사이클릭 아미노산 유도체, 이의 제조 방법, 이를 함유하는 제제 및 이의 용도 | |
| IE33862L (en) | Thiepin and oxepin derivatives. | |
| GB1373548A (en) | Anti-hypertensive 6-substituted 3-hydrazino-pyridazines and their preparation | |
| GB1389504A (en) | 2-amino-1,4-dihydropyridines their production and their medicinal use | |
| KR860002508A (ko) | 푸로(3,2-c)피리딘 유도체, 그의 제법 및 그를 포함하는 의약 조성물 | |
| GB1227480A (enExample) | ||
| GB1336913A (en) | Indolyl acetic acid derivatives processes for producing them and compositions containing them | |
| NO141759C (no) | Analogifremgangsmaate til fremstilling av terapeutisk virksomme penicilliner | |
| IE38141B1 (en) | New 3,4-dihydropyridones their production and their medicinal use | |
| GB1384523A (en) | Oxime derivatives and their preparation | |
| GB1227967A (enExample) | ||
| GB1251729A (enExample) | ||
| GB1133080A (en) | Improvements in or relating to derivatives of nitrofuran | |
| GB1311460A (en) | 2-acryloyl benzimidazoles their process for preparation and their therapeutic application |