DE19949352B4 - Heterocyclische Alkoxyamine als Regulatoren in gesteuerten radikalischen Polymerisationsverfahren - Google Patents
Heterocyclische Alkoxyamine als Regulatoren in gesteuerten radikalischen Polymerisationsverfahren Download PDFInfo
- Publication number
- DE19949352B4 DE19949352B4 DE19949352.9A DE19949352A DE19949352B4 DE 19949352 B4 DE19949352 B4 DE 19949352B4 DE 19949352 A DE19949352 A DE 19949352A DE 19949352 B4 DE19949352 B4 DE 19949352B4
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- compound
- methyl
- hydrogen
- phenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 238000010526 radical polymerization reaction Methods 0.000 title claims description 12
- 150000001875 compounds Chemical class 0.000 claims abstract description 412
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 228
- 239000000178 monomer Substances 0.000 claims abstract description 199
- 239000000203 mixture Substances 0.000 claims abstract description 120
- 239000001257 hydrogen Substances 0.000 claims abstract description 113
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 105
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 42
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 41
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims abstract description 31
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 7
- 238000006116 polymerization reaction Methods 0.000 claims description 126
- 125000000217 alkyl group Chemical group 0.000 claims description 110
- -1 ethylene, propylene Chemical group 0.000 claims description 87
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 85
- 150000003254 radicals Chemical class 0.000 claims description 60
- 150000002431 hydrogen Chemical class 0.000 claims description 37
- 229920000642 polymer Polymers 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 28
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 17
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims description 16
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 16
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 16
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 16
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- 229920001400 block copolymer Polymers 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 10
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 9
- 229920001577 copolymer Polymers 0.000 claims description 8
- 238000003776 cleavage reaction Methods 0.000 claims description 7
- 230000007017 scission Effects 0.000 claims description 7
- 239000007858 starting material Substances 0.000 claims description 6
- 125000003055 glycidyl group Chemical group C(C1CO1)* 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 238000006467 substitution reaction Methods 0.000 claims description 5
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical group CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 4
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 claims description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 230000000379 polymerizing effect Effects 0.000 claims description 4
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 3
- 150000007524 organic acids Chemical class 0.000 claims description 3
- 229920005604 random copolymer Polymers 0.000 claims description 3
- OSSNTDFYBPYIEC-UHFFFAOYSA-N 1-ethenylimidazole Chemical compound C=CN1C=CN=C1 OSSNTDFYBPYIEC-UHFFFAOYSA-N 0.000 claims description 2
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N Acrylic acid Chemical class OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 2
- SYNHCENRCUAUNM-UHFFFAOYSA-N Nitrogen mustard N-oxide hydrochloride Chemical group Cl.ClCC[N+]([O-])(C)CCCl SYNHCENRCUAUNM-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 2
- 150000003926 acrylamides Chemical class 0.000 claims description 2
- 125000005396 acrylic acid ester group Chemical group 0.000 claims description 2
- 150000008360 acrylonitriles Chemical class 0.000 claims description 2
- 150000001336 alkenes Chemical class 0.000 claims description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims description 2
- 150000001993 dienes Chemical class 0.000 claims description 2
- 230000005670 electromagnetic radiation Effects 0.000 claims description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000007522 mineralic acids Chemical class 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- ARJOQCYCJMAIFR-UHFFFAOYSA-N prop-2-enoyl prop-2-enoate Chemical class C=CC(=O)OC(=O)C=C ARJOQCYCJMAIFR-UHFFFAOYSA-N 0.000 claims description 2
- 238000000527 sonication Methods 0.000 claims description 2
- 150000003440 styrenes Chemical class 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 229920002554 vinyl polymer Polymers 0.000 claims description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract description 9
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 abstract description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 146
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 138
- 229910052757 nitrogen Inorganic materials 0.000 description 127
- 239000000243 solution Substances 0.000 description 103
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 92
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 81
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 78
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 78
- 238000005227 gel permeation chromatography Methods 0.000 description 75
- 229910052786 argon Inorganic materials 0.000 description 73
- 239000007788 liquid Substances 0.000 description 71
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 54
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 51
- 238000005160 1H NMR spectroscopy Methods 0.000 description 46
- 238000004458 analytical method Methods 0.000 description 36
- 239000012230 colorless oil Substances 0.000 description 35
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 34
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 32
- 239000003921 oil Substances 0.000 description 30
- 238000001704 evaporation Methods 0.000 description 27
- 230000008020 evaporation Effects 0.000 description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 239000013078 crystal Substances 0.000 description 25
- 238000000921 elemental analysis Methods 0.000 description 25
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2-(2-cyanopropan-2-yldiazenyl)-2-methylpropanenitrile Chemical compound N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 22
- 125000003342 alkenyl group Chemical group 0.000 description 22
- 125000000304 alkynyl group Chemical group 0.000 description 22
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 238000009826 distribution Methods 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 19
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 19
- 0 CC(*)(N(C)C(C1(*)*)=O)N1O* Chemical compound CC(*)(N(C)C(C1(*)*)=O)N1O* 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 229910052736 halogen Inorganic materials 0.000 description 18
- 150000002367 halogens Chemical class 0.000 description 18
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 18
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 16
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 14
- 125000003118 aryl group Chemical group 0.000 description 14
- 239000000741 silica gel Substances 0.000 description 14
- 229910002027 silica gel Inorganic materials 0.000 description 14
- 239000007787 solid Substances 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- 125000006702 (C1-C18) alkyl group Chemical group 0.000 description 12
- CHWVDGYLKPLBES-UHFFFAOYSA-N 5-(2-methoxyphenyl)-2-furoic acid Chemical compound COC1=CC=CC=C1C1=CC=C(C(O)=O)O1 CHWVDGYLKPLBES-UHFFFAOYSA-N 0.000 description 12
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 11
- LSXWFXONGKSEMY-UHFFFAOYSA-N di-tert-butyl peroxide Chemical compound CC(C)(C)OOC(C)(C)C LSXWFXONGKSEMY-UHFFFAOYSA-N 0.000 description 11
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 10
- 238000004821 distillation Methods 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 8
- 125000001313 C5-C10 heteroaryl group Chemical group 0.000 description 8
- 125000000753 cycloalkyl group Chemical group 0.000 description 8
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 7
- 150000001412 amines Chemical class 0.000 description 7
- 125000003884 phenylalkyl group Chemical group 0.000 description 7
- 239000002243 precursor Substances 0.000 description 7
- GBBADHNSBOEAJD-UHFFFAOYSA-N 1-n-tert-butyl-2-ethylbutane-1,2-diamine Chemical compound CCC(N)(CC)CNC(C)(C)C GBBADHNSBOEAJD-UHFFFAOYSA-N 0.000 description 6
- VFIXFSTVCVVOML-UHFFFAOYSA-N 1-tert-butyl-3,3-diethyl-5,5-dimethyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CC1(C)CN(C(C)(C)C)C(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 VFIXFSTVCVVOML-UHFFFAOYSA-N 0.000 description 6
- BFYCCASBZGLDSH-UHFFFAOYSA-N 3,3,5,5-tetraethyl-4-(1-phenylethoxy)morpholin-2-one Chemical compound CCC1(CC)COC(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 BFYCCASBZGLDSH-UHFFFAOYSA-N 0.000 description 6
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 125000000041 C6-C10 aryl group Chemical group 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 6
- RLOSKMLOTKSUCJ-UHFFFAOYSA-N [5,5-diethyl-3-methyl-6-oxo-4-(1-phenylethoxy)morpholin-3-yl]methyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCC1(C)COC(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 RLOSKMLOTKSUCJ-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- XMVONEAAOPAGAO-UHFFFAOYSA-N sodium tungstate Chemical compound [Na+].[Na+].[O-][W]([O-])(=O)=O XMVONEAAOPAGAO-UHFFFAOYSA-N 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- KKWUZQSPIBAUDN-UHFFFAOYSA-N 1-tert-butyl-3,3,5-triethyl-5-methyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CCC1(C)CN(C(C)(C)C)C(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 KKWUZQSPIBAUDN-UHFFFAOYSA-N 0.000 description 5
- JBNBGZUYAWNMDG-UHFFFAOYSA-N 1-tert-butyl-3-ethyl-3,5,5-trimethyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CC1(C)CN(C(C)(C)C)C(=O)C(CC)(C)N1OC(C)C1=CC=CC=C1 JBNBGZUYAWNMDG-UHFFFAOYSA-N 0.000 description 5
- DMOMLESTFQRBNY-UHFFFAOYSA-N 1-tert-butyl-5,5-diethyl-4-(1-phenylethoxy)-3,3-dipropylpiperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(CCC)(CCC)N1OC(C)C1=CC=CC=C1 DMOMLESTFQRBNY-UHFFFAOYSA-N 0.000 description 5
- SKUZMLMCANXMFF-UHFFFAOYSA-N 2-[2,2-diethyl-6,6-dimethyl-3-oxo-4-(2,4,4-trimethylpentan-2-yl)piperazin-1-yl]oxy-2-methylpropanenitrile Chemical compound CCC1(CC)N(OC(C)(C)C#N)C(C)(C)CN(C(C)(C)CC(C)(C)C)C1=O SKUZMLMCANXMFF-UHFFFAOYSA-N 0.000 description 5
- YSLQIELHSIUJTR-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethylmorpholin-2-one Chemical compound CCC1(CC)NC(C)(C)COC1=O YSLQIELHSIUJTR-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 239000006184 cosolvent Substances 0.000 description 5
- 229920000578 graft copolymer Polymers 0.000 description 5
- 239000003999 initiator Substances 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 description 4
- JFWQTDYJLXHVBB-UHFFFAOYSA-N 1-butyl-3,3,5,5,7-pentamethyl-4-(1-phenylethoxy)-1,4-diazepan-2-one Chemical compound CC1(C)C(=O)N(CCCC)C(C)CC(C)(C)N1OC(C)C1=CC=CC=C1 JFWQTDYJLXHVBB-UHFFFAOYSA-N 0.000 description 4
- ZQEKJXIMFCNSOI-UHFFFAOYSA-N 1-butyl-3-ethyl-3,5,5,7-tetramethyl-4-(1-phenylethoxy)-1,4-diazepan-2-one Chemical compound CCC1(C)C(=O)N(CCCC)C(C)CC(C)(C)N1OC(C)C1=CC=CC=C1 ZQEKJXIMFCNSOI-UHFFFAOYSA-N 0.000 description 4
- LHNWUKUFGXJJQG-UHFFFAOYSA-N 1-n-tert-butyl-2-methylpropane-1,2-diamine Chemical compound CC(C)(C)NCC(C)(C)N LHNWUKUFGXJJQG-UHFFFAOYSA-N 0.000 description 4
- GMDHSLALCRJDCT-UHFFFAOYSA-N 1-tert-butyl-3,3,5,5-tetraethyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 GMDHSLALCRJDCT-UHFFFAOYSA-N 0.000 description 4
- AAQFPIOHPXUGNM-UHFFFAOYSA-N 1-tert-butyl-3,3,5,5-tetraethyl-4-phenylmethoxypiperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(CC)(CC)N1OCC1=CC=CC=C1 AAQFPIOHPXUGNM-UHFFFAOYSA-N 0.000 description 4
- MLXQULZNIANQDT-UHFFFAOYSA-N 1-tert-butyl-3,3-diethyl-5,5-dimethyl-4-phenylmethoxypiperazin-2-one Chemical compound CC1(C)CN(C(C)(C)C)C(=O)C(CC)(CC)N1OCC1=CC=CC=C1 MLXQULZNIANQDT-UHFFFAOYSA-N 0.000 description 4
- IONRRIGXSWYKKC-UHFFFAOYSA-N 1-tert-butyl-3,5,5-triethyl-3-methyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(C)(CC)N1OC(C)C1=CC=CC=C1 IONRRIGXSWYKKC-UHFFFAOYSA-N 0.000 description 4
- GUAWSHSZRSOUMW-UHFFFAOYSA-N 1-tert-butyl-3,5,5-triethyl-3-methyl-4-phenylmethoxypiperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(C)(CC)N1OCC1=CC=CC=C1 GUAWSHSZRSOUMW-UHFFFAOYSA-N 0.000 description 4
- DEMLMDLMVWXHRC-UHFFFAOYSA-N 1-tert-butyl-3,5,5-trimethyl-3-(2-methylpropyl)-4-(1-phenylethoxy)piperazin-2-one Chemical compound CC1(C)CN(C(C)(C)C)C(=O)C(CC(C)C)(C)N1OC(C)C1=CC=CC=C1 DEMLMDLMVWXHRC-UHFFFAOYSA-N 0.000 description 4
- JZIQRHNKFBJEER-UHFFFAOYSA-N 1-tert-butyl-3,5-diethyl-3,5-dimethyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CCC1(C)CN(C(C)(C)C)C(=O)C(C)(CC)N1OC(C)C1=CC=CC=C1 JZIQRHNKFBJEER-UHFFFAOYSA-N 0.000 description 4
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 4
- ITGOMIKKVVXDLE-UHFFFAOYSA-N 2,7-diethyl-2,3,4,7-tetramethyl-1-(1-phenylethoxy)-1,4-diazepan-5-one Chemical compound CCC1(C)CC(=O)N(C)C(C)C(C)(CC)N1OC(C)C1=CC=CC=C1 ITGOMIKKVVXDLE-UHFFFAOYSA-N 0.000 description 4
- UYRYNBMOGVIGBQ-UHFFFAOYSA-N 2,7-diethyl-2,3,7-trimethyl-1-(1-phenylethoxy)-1,4-diazepan-5-one Chemical compound CCC1(C)CC(=O)NC(C)C(C)(CC)N1OC(C)C1=CC=CC=C1 UYRYNBMOGVIGBQ-UHFFFAOYSA-N 0.000 description 4
- UZBHMLIATWYOHI-UHFFFAOYSA-N 2-(2,2-dibutyl-4-tert-butyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCCCC1(CCCC)N(OC(C)(C)C#N)C(C)(C)CN(C(C)(C)C)C1=O UZBHMLIATWYOHI-UHFFFAOYSA-N 0.000 description 4
- BIQOVFVAJAEPIR-UHFFFAOYSA-N 2-(2-ethyl-2,6,6-trimethyl-3-oxo-4-propan-2-ylpiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(C)N(OC(C)(C)C#N)C(C)(C)CN(C(C)C)C1=O BIQOVFVAJAEPIR-UHFFFAOYSA-N 0.000 description 4
- AOYQRPLJAGLQQK-UHFFFAOYSA-N 2-(4-tert-butyl-2,2,6,6-tetraethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(CC)(CC)N1OC(C)(C)C#N AOYQRPLJAGLQQK-UHFFFAOYSA-N 0.000 description 4
- LYDWSNZBYCAGPK-UHFFFAOYSA-N 2-(4-tert-butyl-2,6,6-triethyl-2-methyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(C)N(OC(C)(C)C#N)C(CC)(CC)CN(C(C)(C)C)C1=O LYDWSNZBYCAGPK-UHFFFAOYSA-N 0.000 description 4
- HWDPFCCKBAFQRC-UHFFFAOYSA-N 2-(4-tert-butyl-6,6-diethyl-2,2-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(C)(C)N1OC(C)(C)C#N HWDPFCCKBAFQRC-UHFFFAOYSA-N 0.000 description 4
- SHEIKGMYXDSXQG-UHFFFAOYSA-N 2-(4-tert-butyl-6,6-dimethyl-3-oxo-2,2-dipropylpiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCCC1(CCC)N(OC(C)(C)C#N)C(C)(C)CN(C(C)(C)C)C1=O SHEIKGMYXDSXQG-UHFFFAOYSA-N 0.000 description 4
- YOIPYKKWCRTZDK-UHFFFAOYSA-N 2-(6,6-diethyl-2,2,3,3-tetramethyl-5-oxopiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(CC)N(OC(C)(C)C#N)C(C)(C)C(C)(C)NC1=O YOIPYKKWCRTZDK-UHFFFAOYSA-N 0.000 description 4
- RMRHAXNPDCHLRX-UHFFFAOYSA-N 2-[2,2-diethyl-4-(1-hydroxy-2-methylpropan-2-yl)-6,6-dimethyl-3-oxopiperazin-1-yl]oxy-2-methylpropanenitrile Chemical compound CCC1(CC)N(OC(C)(C)C#N)C(C)(C)CN(C(C)(C)CO)C1=O RMRHAXNPDCHLRX-UHFFFAOYSA-N 0.000 description 4
- SPXJPAPOMQYVPI-UHFFFAOYSA-N 2-[2,2-diethyl-4-(2-hydroxyethyl)-6,6-dimethyl-3-oxopiperazin-1-yl]oxy-2-methylpropanenitrile Chemical compound CCC1(CC)N(OC(C)(C)C#N)C(C)(C)CN(CCO)C1=O SPXJPAPOMQYVPI-UHFFFAOYSA-N 0.000 description 4
- DILVHMPRDJNBKZ-UHFFFAOYSA-N 3,3-diethyl-1,5,5-trimethyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CC1(C)CN(C)C(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 DILVHMPRDJNBKZ-UHFFFAOYSA-N 0.000 description 4
- FLNMGGVRKPXOEI-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethyl-1-phenyl-4-(1-phenylethoxy)piperazin-2-one Chemical compound CC1(C)CN(C=2C=CC=CC=2)C(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 FLNMGGVRKPXOEI-UHFFFAOYSA-N 0.000 description 4
- IEFBSBLICBWGLS-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethyl-4-(1-phenylethoxy)-1-(2,4,4-trimethylpentan-2-yl)piperazin-2-one Chemical compound CC1(C)CN(C(C)(C)CC(C)(C)C)C(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 IEFBSBLICBWGLS-UHFFFAOYSA-N 0.000 description 4
- NYIPOHVLRWJXJY-UHFFFAOYSA-N 3-ethyl-3,5,5-trimethyl-1-propan-2-ylpiperazin-2-one Chemical compound CCC1(C)NC(C)(C)CN(C(C)C)C1=O NYIPOHVLRWJXJY-UHFFFAOYSA-N 0.000 description 4
- FWMTWCRIPQANJE-UHFFFAOYSA-N 4-[1-(4-acetylphenyl)ethyl]-1-tert-butyl-3,3-diethyl-5,5-dimethylpiperazin-2-one Chemical compound CC1(C)CN(C(C)(C)C)C(=O)C(CC)(CC)N1C(C)C1=CC=C(C(C)=O)C=C1 FWMTWCRIPQANJE-UHFFFAOYSA-N 0.000 description 4
- RQSJAQMWOGLLAU-UHFFFAOYSA-N 4-benzyl-2,7-diethyl-2,3,7-trimethyl-1-phenylmethoxy-1,4-diazepan-5-one Chemical compound CC1C(C)(CC)N(OCC=2C=CC=CC=2)C(CC)(C)CC(=O)N1CC1=CC=CC=C1 RQSJAQMWOGLLAU-UHFFFAOYSA-N 0.000 description 4
- HCFAJYNVAYBARA-UHFFFAOYSA-N 4-heptanone Chemical compound CCCC(=O)CCC HCFAJYNVAYBARA-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- IRGZHLWDILRYSA-UHFFFAOYSA-N [3,5,5-triethyl-6-oxo-4-(1-phenylethoxy)morpholin-3-yl]methyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCC1(CC)COC(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 IRGZHLWDILRYSA-UHFFFAOYSA-N 0.000 description 4
- NWONEONLZLBCFM-UHFFFAOYSA-N [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)ethyl]phenyl] acetate Chemical compound CC1(C)CN(C(C)(C)C)C(=O)C(CC)(CC)N1C(C)C1=CC=C(OC(C)=O)C=C1 NWONEONLZLBCFM-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 125000005262 alkoxyamine group Chemical group 0.000 description 4
- 244000309464 bull Species 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- BTSDTBBXGVOIDN-UHFFFAOYSA-N (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate Chemical compound CCC1(CC)NC(C)(COC(=O)C(C)(C)C)COC1=O BTSDTBBXGVOIDN-UHFFFAOYSA-N 0.000 description 3
- XJYJNEVOBUSPSR-UHFFFAOYSA-N 1-benzyl-3,3-diethyl-5,5-dimethylpiperazin-2-one Chemical compound O=C1C(CC)(CC)NC(C)(C)CN1CC1=CC=CC=C1 XJYJNEVOBUSPSR-UHFFFAOYSA-N 0.000 description 3
- VUEVTMMLZSUWIL-UHFFFAOYSA-N 1-butyl-3-ethyl-3,5,5,7-tetramethyl-1,4-diazepan-2-one Chemical compound CCCCN1C(C)CC(C)(C)NC(C)(CC)C1=O VUEVTMMLZSUWIL-UHFFFAOYSA-N 0.000 description 3
- RTTPXVFZNHJZBN-UHFFFAOYSA-N 1-n-tert-butyl-2-methylbutane-1,2-diamine Chemical compound CCC(C)(N)CNC(C)(C)C RTTPXVFZNHJZBN-UHFFFAOYSA-N 0.000 description 3
- HJVXTKQNOPXNJW-UHFFFAOYSA-N 1-tert-butyl-3,3,5,5-tetraethylpiperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(CC)(CC)N1 HJVXTKQNOPXNJW-UHFFFAOYSA-N 0.000 description 3
- OPZBWPPKTGWDLN-UHFFFAOYSA-N 1-tert-butyl-3,3,5-triethyl-5-methylpiperazin-2-one Chemical compound CCC1(C)CN(C(C)(C)C)C(=O)C(CC)(CC)N1 OPZBWPPKTGWDLN-UHFFFAOYSA-N 0.000 description 3
- XCDAPYJGQJAAPG-UHFFFAOYSA-N 1-tert-butyl-3,3-diethyl-5,5-dimethylpiperazin-2-one Chemical compound CCC1(CC)NC(C)(C)CN(C(C)(C)C)C1=O XCDAPYJGQJAAPG-UHFFFAOYSA-N 0.000 description 3
- OINMIGAEHQMAPX-UHFFFAOYSA-N 1-tert-butyl-3,5,5-triethyl-3-methylpiperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(C)(CC)N1 OINMIGAEHQMAPX-UHFFFAOYSA-N 0.000 description 3
- DWVFCHJCAHCAPS-UHFFFAOYSA-N 1-tert-butyl-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one Chemical compound CC(C)CC1(C)NC(C)(C)CN(C(C)(C)C)C1=O DWVFCHJCAHCAPS-UHFFFAOYSA-N 0.000 description 3
- XUYWAXVJTVZUGK-UHFFFAOYSA-N 1-tert-butyl-3,5-diethyl-3,5-dimethylpiperazin-2-one Chemical compound CCC1(C)CN(C(C)(C)C)C(=O)C(C)(CC)N1 XUYWAXVJTVZUGK-UHFFFAOYSA-N 0.000 description 3
- FONNYDACTANTGT-UHFFFAOYSA-N 1-tert-butyl-3-ethyl-3,5,5-trimethylpiperazin-2-one Chemical compound CCC1(C)NC(C)(C)CN(C(C)(C)C)C1=O FONNYDACTANTGT-UHFFFAOYSA-N 0.000 description 3
- BAMPADUCVOQPMN-UHFFFAOYSA-N 1-tert-butyl-5,5-diethyl-3,3-dimethylpiperazin-2-one Chemical compound CCC1(CC)CN(C(C)(C)C)C(=O)C(C)(C)N1 BAMPADUCVOQPMN-UHFFFAOYSA-N 0.000 description 3
- RZYJMZGSUWYXJW-UHFFFAOYSA-N 1-tert-butyl-5,5-diethyl-3,3-dipropylpiperazin-2-one Chemical compound CCCC1(CCC)NC(CC)(CC)CN(C(C)(C)C)C1=O RZYJMZGSUWYXJW-UHFFFAOYSA-N 0.000 description 3
- HHVOXQQGUFEJDM-UHFFFAOYSA-N 1-tert-butyl-5,5-dimethyl-3,3-dipropylpiperazin-2-one Chemical compound CCCC1(CCC)NC(C)(C)CN(C(C)(C)C)C1=O HHVOXQQGUFEJDM-UHFFFAOYSA-N 0.000 description 3
- YXHKLPCSCPINSU-UHFFFAOYSA-N 2,2,5,5-tetraethyl-1-(1-phenylethoxy)imidazolidin-4-one Chemical compound CCC1(CC)NC(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 YXHKLPCSCPINSU-UHFFFAOYSA-N 0.000 description 3
- ARTINEXELSVQFU-UHFFFAOYSA-N 2,2,5,5-tetraethylimidazolidin-4-one Chemical compound CCC1(CC)NC(=O)C(CC)(CC)N1 ARTINEXELSVQFU-UHFFFAOYSA-N 0.000 description 3
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 3
- YMYLSGJIPSOSTE-UHFFFAOYSA-N 2-(2,2-diethyl-6,6-dimethyl-3-oxo-4-propan-2-ylpiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(CC)N(OC(C)(C)C#N)C(C)(C)CN(C(C)C)C1=O YMYLSGJIPSOSTE-UHFFFAOYSA-N 0.000 description 3
- JNOKYCCKHUYBQZ-UHFFFAOYSA-N 2-(3,3-diethyl-5,5-dimethyl-2-oxomorpholin-4-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(CC)N(OC(C)(C)C#N)C(C)(C)COC1=O JNOKYCCKHUYBQZ-UHFFFAOYSA-N 0.000 description 3
- ZLSULMZGWDODMA-UHFFFAOYSA-N 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(CC)N(OC(C)(C)C#N)C(C)(C)CN(C(C)(C)C)C1=O ZLSULMZGWDODMA-UHFFFAOYSA-N 0.000 description 3
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 3
- NCQJRXVOOIVKQN-UHFFFAOYSA-N 3,3,5,5-tetraethylmorpholin-2-one Chemical compound CCC1(CC)COC(=O)C(CC)(CC)N1 NCQJRXVOOIVKQN-UHFFFAOYSA-N 0.000 description 3
- ORQVHQKOHXDDCZ-UHFFFAOYSA-N 3,3,5-triethyl-5-(hydroxymethyl)morpholin-2-one Chemical compound CCC1(CO)COC(=O)C(CC)(CC)N1 ORQVHQKOHXDDCZ-UHFFFAOYSA-N 0.000 description 3
- FPCBSDQYBHPPFH-UHFFFAOYSA-N 3,3-dibutyl-1-tert-butyl-5,5-dimethylpiperazin-2-one Chemical compound CCCCC1(CCCC)NC(C)(C)CN(C(C)(C)C)C1=O FPCBSDQYBHPPFH-UHFFFAOYSA-N 0.000 description 3
- PGNDDDQJWNFHIZ-UHFFFAOYSA-N 3,3-diethyl-1,5,5-trimethylpiperazin-2-one Chemical compound CCC1(CC)NC(C)(C)CN(C)C1=O PGNDDDQJWNFHIZ-UHFFFAOYSA-N 0.000 description 3
- NOBMHBRBUYKKAF-UHFFFAOYSA-N 3,3-diethyl-1-(1-hydroxy-2-methylpropan-2-yl)-5,5-dimethylpiperazin-2-one Chemical compound CCC1(CC)NC(C)(C)CN(C(C)(C)CO)C1=O NOBMHBRBUYKKAF-UHFFFAOYSA-N 0.000 description 3
- YXKOHXRRQKDSCO-UHFFFAOYSA-N 3,3-diethyl-1-(2-hydroxyethyl)-5,5-dimethylpiperazin-2-one Chemical compound CCC1(CC)NC(C)(C)CN(CCO)C1=O YXKOHXRRQKDSCO-UHFFFAOYSA-N 0.000 description 3
- YWZJDYQIWVIBST-UHFFFAOYSA-N 3,3-diethyl-5,5,6,6-tetramethylpiperazin-2-one Chemical compound CCC1(CC)NC(C)(C)C(C)(C)NC1=O YWZJDYQIWVIBST-UHFFFAOYSA-N 0.000 description 3
- XQYMZVHFHTVFLN-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethyl-1-(2,4,4-trimethylpentan-2-yl)piperazin-2-one Chemical compound CCC1(CC)NC(C)(C)CN(C(C)(C)CC(C)(C)C)C1=O XQYMZVHFHTVFLN-UHFFFAOYSA-N 0.000 description 3
- ARDLGYZNRALACF-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethyl-1-phenylpiperazin-2-one Chemical compound O=C1C(CC)(CC)NC(C)(C)CN1C1=CC=CC=C1 ARDLGYZNRALACF-UHFFFAOYSA-N 0.000 description 3
- LIZJQJSMXQKLMG-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethyl-1-propan-2-ylpiperazin-2-one Chemical compound CCC1(CC)NC(C)(C)CN(C(C)C)C1=O LIZJQJSMXQKLMG-UHFFFAOYSA-N 0.000 description 3
- WDLYLMJXDLUTSG-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethyl-4-(1-phenylethoxy)-1-propan-2-ylpiperazin-2-one Chemical compound CC1(C)CN(C(C)C)C(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 WDLYLMJXDLUTSG-UHFFFAOYSA-N 0.000 description 3
- GCKSSZGFBLPBDU-UHFFFAOYSA-N 3,3-diethyl-5,5-dimethyl-4-(1-phenylethoxy)morpholin-2-one Chemical compound CC1(C)COC(=O)C(CC)(CC)N1OC(C)C1=CC=CC=C1 GCKSSZGFBLPBDU-UHFFFAOYSA-N 0.000 description 3
- CUZNNTLPNGPRQV-UHFFFAOYSA-N 3-ethyl-3,5,5-trimethyl-4-(1-phenylethoxy)-1-propan-2-ylpiperazin-2-one Chemical compound CC1(C)CN(C(C)C)C(=O)C(CC)(C)N1OC(C)C1=CC=CC=C1 CUZNNTLPNGPRQV-UHFFFAOYSA-N 0.000 description 3
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KYIKRXIYLAGAKQ-UHFFFAOYSA-N abcn Chemical compound C1CCCCC1(C#N)N=NC1(C#N)CCCCC1 KYIKRXIYLAGAKQ-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 3
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229920002521 macromolecule Polymers 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 229910052753 mercury Inorganic materials 0.000 description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 3
- 229920006030 multiblock copolymer Polymers 0.000 description 3
- QYZFTMMPKCOTAN-UHFFFAOYSA-N n-[2-(2-hydroxyethylamino)ethyl]-2-[[1-[2-(2-hydroxyethylamino)ethylamino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCCNCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCNCCO QYZFTMMPKCOTAN-UHFFFAOYSA-N 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000005297 pyrex Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- CGWSBVNBUPEXNY-UHFFFAOYSA-N (3,5,5-triethyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCC1(CC)COC(=O)C(CC)(CC)N1 CGWSBVNBUPEXNY-UHFFFAOYSA-N 0.000 description 2
- 125000004642 (C1-C12) alkoxy group Chemical group 0.000 description 2
- HYGXBGZGSMSVSI-UHFFFAOYSA-N 1-[2,5-di(cyclohexylidene)-4-oxoimidazolidin-1-yl]oxycyclohexane-1-carbonitrile Chemical compound C1CCCCC1(C#N)ON1C(=C2CCCCC2)C(=O)NC1=C1CCCCC1 HYGXBGZGSMSVSI-UHFFFAOYSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 2
- RKMGAJGJIURJSJ-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidine Chemical compound CC1(C)CCCC(C)(C)N1 RKMGAJGJIURJSJ-UHFFFAOYSA-N 0.000 description 2
- FVXALBHDMFUWPC-UHFFFAOYSA-N 2,2,7,7-tetramethyl-1-(1-phenylethoxy)-1,4-diazepan-5-one Chemical compound C=1C=CC=CC=1C(C)ON1C(C)(C)CNC(=O)CC1(C)C FVXALBHDMFUWPC-UHFFFAOYSA-N 0.000 description 2
- OUXZUYYNBACOLC-UHFFFAOYSA-N 2-(2,5-diethyl-2,5-dimethyl-4-oxoimidazolidin-1-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(C)NC(=O)C(C)(CC)N1OC(C)(C)C#N OUXZUYYNBACOLC-UHFFFAOYSA-N 0.000 description 2
- HPOKJLFNDLWVBS-UHFFFAOYSA-N 2-(3-ethyl-3,5,5-trimethyl-2-oxomorpholin-4-yl)oxy-2-methylpropanenitrile Chemical compound CCC1(C)N(OC(C)(C)C#N)C(C)(C)COC1=O HPOKJLFNDLWVBS-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- KFFPIBIUMPOVIS-UHFFFAOYSA-N 2-methyl-2-(2,2,5,5-tetraethyl-4-oxoimidazolidin-1-yl)oxypropanenitrile Chemical compound CCC1(CC)NC(=O)C(CC)(CC)N1OC(C)(C)C#N KFFPIBIUMPOVIS-UHFFFAOYSA-N 0.000 description 2
- XEYCUDOEEYKREW-UHFFFAOYSA-N 2-methyl-2-[(2,2,7,7-tetramethyl-5-oxo-1,4-diazepan-1-yl)oxy]propanenitrile Chemical compound N#CC(C)(C)ON1C(C)(C)CNC(=O)CC1(C)C XEYCUDOEEYKREW-UHFFFAOYSA-N 0.000 description 2
- PPGAFAOTXHZHCA-UHFFFAOYSA-N 2-methylpropanenitrile Chemical compound C[C](C)C#N PPGAFAOTXHZHCA-UHFFFAOYSA-N 0.000 description 2
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 2
- JUTAUOIJEXFUAA-UHFFFAOYSA-N 3,3-diethyl-5-(hydroxymethyl)-5-methylmorpholin-2-one Chemical compound CCC1(CC)NC(C)(CO)COC1=O JUTAUOIJEXFUAA-UHFFFAOYSA-N 0.000 description 2
- XHLBWNGWSDTRNY-UHFFFAOYSA-N 3-ethyl-3,5,5-trimethyl-4-(1-phenylethoxy)morpholin-2-one Chemical compound CC1(C)COC(=O)C(CC)(C)N1OC(C)C1=CC=CC=C1 XHLBWNGWSDTRNY-UHFFFAOYSA-N 0.000 description 2
- FLCAEMBIQVZWIF-UHFFFAOYSA-N 6-(dimethylamino)-2-methylhex-2-enamide Chemical compound CN(C)CCCC=C(C)C(N)=O FLCAEMBIQVZWIF-UHFFFAOYSA-N 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- 241001136792 Alle Species 0.000 description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 2
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- BVVNMQQFLWWRFT-UHFFFAOYSA-N N(1)-isopropyl-2-methylpropan-1,2-diamine Chemical compound CC(C)NCC(C)(C)N BVVNMQQFLWWRFT-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- ZPBIZXZRZLYZOU-UHFFFAOYSA-N [4-(2-cyanopropan-2-yloxy)-3,5,5-trimethyl-6-oxomorpholin-3-yl]methyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCC1(C)COC(=O)C(C)(C)N1OC(C)(C)C#N ZPBIZXZRZLYZOU-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- CBTVGIZVANVGBH-UHFFFAOYSA-N aminomethyl propanol Chemical compound CC(C)(N)CO CBTVGIZVANVGBH-UHFFFAOYSA-N 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229920000359 diblock copolymer Polymers 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 2
- 238000007323 disproportionation reaction Methods 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- AOGQPLXWSUTHQB-UHFFFAOYSA-N hexyl acetate Chemical compound CCCCCCOC(C)=O AOGQPLXWSUTHQB-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- SHFJWMWCIHQNCP-UHFFFAOYSA-M hydron;tetrabutylazanium;sulfate Chemical compound OS([O-])(=O)=O.CCCC[N+](CCCC)(CCCC)CCCC SHFJWMWCIHQNCP-UHFFFAOYSA-M 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical class O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229920002959 polymer blend Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- YKYONYBAUNKHLG-UHFFFAOYSA-N propyl acetate Chemical group CCCOC(C)=O YKYONYBAUNKHLG-UHFFFAOYSA-N 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000001542 size-exclusion chromatography Methods 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000012546 transfer Methods 0.000 description 2
- 229920000428 triblock copolymer Polymers 0.000 description 2
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 2
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- WRXCBRHBHGNNQA-UHFFFAOYSA-N (2,4-dichlorobenzoyl) 2,4-dichlorobenzenecarboperoxoate Chemical compound ClC1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1Cl WRXCBRHBHGNNQA-UHFFFAOYSA-N 0.000 description 1
- ZICNIEOYWVIEQJ-UHFFFAOYSA-N (2-methylbenzoyl) 2-methylbenzenecarboperoxoate Chemical compound CC1=CC=CC=C1C(=O)OOC(=O)C1=CC=CC=C1C ZICNIEOYWVIEQJ-UHFFFAOYSA-N 0.000 description 1
- KDGNCLDCOVTOCS-UHFFFAOYSA-N (2-methylpropan-2-yl)oxy propan-2-yl carbonate Chemical compound CC(C)OC(=O)OOC(C)(C)C KDGNCLDCOVTOCS-UHFFFAOYSA-N 0.000 description 1
- BZUZUWIQVUXQEG-UHFFFAOYSA-N (3,5,5-trimethyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate Chemical compound CC(C)(C)C(=O)OCC1(C)COC(=O)C(C)(C)N1 BZUZUWIQVUXQEG-UHFFFAOYSA-N 0.000 description 1
- BRLVXFONMZRJCD-UHFFFAOYSA-N (3-azaniumyl-2,3-dimethylbutan-2-yl)azanium;dichloride Chemical compound Cl.Cl.CC(C)(N)C(C)(C)N BRLVXFONMZRJCD-UHFFFAOYSA-N 0.000 description 1
- OXYKVVLTXXXVRT-UHFFFAOYSA-N (4-chlorobenzoyl) 4-chlorobenzenecarboperoxoate Chemical compound C1=CC(Cl)=CC=C1C(=O)OOC(=O)C1=CC=C(Cl)C=C1 OXYKVVLTXXXVRT-UHFFFAOYSA-N 0.000 description 1
- LMQJZPNTLDBCHC-UHFFFAOYSA-N 1,1,3,3-tetraethyl-2h-isoindole Chemical compound C1=CC=C2C(CC)(CC)NC(CC)(CC)C2=C1 LMQJZPNTLDBCHC-UHFFFAOYSA-N 0.000 description 1
- WNGJCVHWVCNYHU-UHFFFAOYSA-N 1,1,3,3-tetrapropyl-2h-isoindole Chemical compound C1=CC=C2C(CCC)(CCC)NC(CCC)(CCC)C2=C1 WNGJCVHWVCNYHU-UHFFFAOYSA-N 0.000 description 1
- NALFRYPTRXKZPN-UHFFFAOYSA-N 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane Chemical compound CC1CC(C)(C)CC(OOC(C)(C)C)(OOC(C)(C)C)C1 NALFRYPTRXKZPN-UHFFFAOYSA-N 0.000 description 1
- HSLFISVKRDQEBY-UHFFFAOYSA-N 1,1-bis(tert-butylperoxy)cyclohexane Chemical compound CC(C)(C)OOC1(OOC(C)(C)C)CCCCC1 HSLFISVKRDQEBY-UHFFFAOYSA-N 0.000 description 1
- OKIRBHVFJGXOIS-UHFFFAOYSA-N 1,2-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC=CC=C1C(C)C OKIRBHVFJGXOIS-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- XSZYESUNPWGWFQ-UHFFFAOYSA-N 1-(2-hydroperoxypropan-2-yl)-4-methylcyclohexane Chemical compound CC1CCC(C(C)(C)OO)CC1 XSZYESUNPWGWFQ-UHFFFAOYSA-N 0.000 description 1
- OXHNLMTVIGZXSG-UHFFFAOYSA-N 1-Methylpyrrole Chemical compound CN1C=CC=C1 OXHNLMTVIGZXSG-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- YTCAGZFYVIFFPI-UHFFFAOYSA-N 1-butyl-3,3,5,5,7-pentamethyl-1,4-diazepan-2-one Chemical compound CCCCN1C(C)CC(C)(C)NC(C)(C)C1=O YTCAGZFYVIFFPI-UHFFFAOYSA-N 0.000 description 1
- MGIRLRNQAIYENH-UHFFFAOYSA-N 1-n,2-dimethylpropane-1,2-diamine Chemical compound CNCC(C)(C)N MGIRLRNQAIYENH-UHFFFAOYSA-N 0.000 description 1
- ZRIUABLAYPQZGA-UHFFFAOYSA-N 1-n-benzyl-2-methylpropane-1,2-diamine Chemical compound CC(C)(N)CNCC1=CC=CC=C1 ZRIUABLAYPQZGA-UHFFFAOYSA-N 0.000 description 1
- RLXGVAKVMJUGIE-UHFFFAOYSA-N 1-tert-butyl-3,3-diethyl-4-hydroxy-5,5-dimethylpiperazin-2-one Chemical compound CCC1(CC)N(O)C(C)(C)CN(C(C)(C)C)C1=O RLXGVAKVMJUGIE-UHFFFAOYSA-N 0.000 description 1
- FMRWQLAJBBKXDM-UHFFFAOYSA-N 2,2,5,5-tetramethylpyrrolidine Chemical compound CC1(C)CCC(C)(C)N1 FMRWQLAJBBKXDM-UHFFFAOYSA-N 0.000 description 1
- HQOVXPHOJANJBR-UHFFFAOYSA-N 2,2-bis(tert-butylperoxy)butane Chemical compound CC(C)(C)OOC(C)(CC)OOC(C)(C)C HQOVXPHOJANJBR-UHFFFAOYSA-N 0.000 description 1
- MFFMQGGZCLEMCI-UHFFFAOYSA-N 2,4-dimethyl-1h-pyrrole Chemical compound CC1=CNC(C)=C1 MFFMQGGZCLEMCI-UHFFFAOYSA-N 0.000 description 1
- XPBYCOVRGGFGON-UHFFFAOYSA-N 2,7-diethyl-1-hydroxy-2,3,7-trimethyl-1,4-diazepan-5-one Chemical compound CCC1(C)CC(=O)NC(C)C(C)(CC)N1O XPBYCOVRGGFGON-UHFFFAOYSA-N 0.000 description 1
- CCTFAOUOYLVUFG-UHFFFAOYSA-N 2-(1-amino-1-imino-2-methylpropan-2-yl)azo-2-methylpropanimidamide Chemical compound NC(=N)C(C)(C)N=NC(C)(C)C(N)=N CCTFAOUOYLVUFG-UHFFFAOYSA-N 0.000 description 1
- OAYXUHPQHDHDDZ-UHFFFAOYSA-N 2-(2-butoxyethoxy)ethanol Chemical compound CCCCOCCOCCO OAYXUHPQHDHDDZ-UHFFFAOYSA-N 0.000 description 1
- AVTLBBWTUPQRAY-UHFFFAOYSA-N 2-(2-cyanobutan-2-yldiazenyl)-2-methylbutanenitrile Chemical compound CCC(C)(C#N)N=NC(C)(CC)C#N AVTLBBWTUPQRAY-UHFFFAOYSA-N 0.000 description 1
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 description 1
- QSFTWOJPCWPORR-UHFFFAOYSA-N 2-(2-tert-butylperoxypropan-2-ylperoxy)-2-methylpropane Chemical compound CC(C)(C)OOC(C)(C)OOC(C)(C)C QSFTWOJPCWPORR-UHFFFAOYSA-N 0.000 description 1
- DPBJAVGHACCNRL-UHFFFAOYSA-N 2-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)CCOC(=O)C=C DPBJAVGHACCNRL-UHFFFAOYSA-N 0.000 description 1
- LDQYWNUWKVADJV-UHFFFAOYSA-N 2-[(1-amino-2-methyl-1-oxopropan-2-yl)diazenyl]-2-methylpropanamide;dihydrate Chemical compound O.O.NC(=O)C(C)(C)N=NC(C)(C)C(N)=O LDQYWNUWKVADJV-UHFFFAOYSA-N 0.000 description 1
- OEDKOOAJXTXCQZ-UHFFFAOYSA-N 2-[(2-amino-2-methylpropyl)amino]ethanol Chemical compound CC(C)(N)CNCCO OEDKOOAJXTXCQZ-UHFFFAOYSA-N 0.000 description 1
- WYGWHHGCAGTUCH-UHFFFAOYSA-N 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)C WYGWHHGCAGTUCH-UHFFFAOYSA-N 0.000 description 1
- LIZVXGBYTGTTTI-UHFFFAOYSA-N 2-[(4-methylphenyl)sulfonylamino]-2-phenylacetic acid Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(C(O)=O)C1=CC=CC=C1 LIZVXGBYTGTTTI-UHFFFAOYSA-N 0.000 description 1
- RJICLMDXEDUMAK-UHFFFAOYSA-N 2-amino-2-ethylbutan-1-ol Chemical compound CCC(N)(CC)CO RJICLMDXEDUMAK-UHFFFAOYSA-N 0.000 description 1
- IOAOAKDONABGPZ-UHFFFAOYSA-N 2-amino-2-ethylpropane-1,3-diol Chemical compound CCC(N)(CO)CO IOAOAKDONABGPZ-UHFFFAOYSA-N 0.000 description 1
- UXFQFBNBSPQBJW-UHFFFAOYSA-N 2-amino-2-methylpropane-1,3-diol Chemical compound OCC(N)(C)CO UXFQFBNBSPQBJW-UHFFFAOYSA-N 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- OMIGHNLMNHATMP-UHFFFAOYSA-N 2-hydroxyethyl prop-2-enoate Chemical compound OCCOC(=O)C=C OMIGHNLMNHATMP-UHFFFAOYSA-N 0.000 description 1
- QRJCXJWZJKGYRH-UHFFFAOYSA-N 2-methyl-1-n-(2,4,4-trimethylpentan-2-yl)propane-1,2-diamine Chemical compound CC(C)(C)CC(C)(C)NCC(C)(C)N QRJCXJWZJKGYRH-UHFFFAOYSA-N 0.000 description 1
- DFZRHHVRKNPTOQ-UHFFFAOYSA-N 2-methyl-1-n-phenylpropane-1,2-diamine Chemical compound CC(C)(N)CNC1=CC=CC=C1 DFZRHHVRKNPTOQ-UHFFFAOYSA-N 0.000 description 1
- JJRDRFZYKKFYMO-UHFFFAOYSA-N 2-methyl-2-(2-methylbutan-2-ylperoxy)butane Chemical compound CCC(C)(C)OOC(C)(C)CC JJRDRFZYKKFYMO-UHFFFAOYSA-N 0.000 description 1
- CFVWNXQPGQOHRJ-UHFFFAOYSA-N 2-methylpropyl prop-2-enoate Chemical compound CC(C)COC(=O)C=C CFVWNXQPGQOHRJ-UHFFFAOYSA-N 0.000 description 1
- SUGZATOHBPXTDV-UHFFFAOYSA-N 2-nitrobutane Chemical compound CCC(C)[N+]([O-])=O SUGZATOHBPXTDV-UHFFFAOYSA-N 0.000 description 1
- QRIQYQXNFSXNGR-UHFFFAOYSA-N 3,3,6,6,9,9-hexamethyl-1,2,4,5-tetraoxonane Chemical compound CC1(C)CCC(C)(C)OOC(C)(C)OO1 QRIQYQXNFSXNGR-UHFFFAOYSA-N 0.000 description 1
- MUAFAOUCQHXNNH-UHFFFAOYSA-N 3,5-bis(tert-butylperoxy)-3,5-dimethyldioxolane Chemical compound CC(C)(C)OOC1(C)CC(C)(OOC(C)(C)C)OO1 MUAFAOUCQHXNNH-UHFFFAOYSA-N 0.000 description 1
- FRIBMENBGGCKPD-UHFFFAOYSA-N 3-(2,3-dimethoxyphenyl)prop-2-enal Chemical compound COC1=CC=CC(C=CC=O)=C1OC FRIBMENBGGCKPD-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- 125000000474 3-butynyl group Chemical group [H]C#CC([H])([H])C([H])([H])* 0.000 description 1
- VDWCAMDNGFYKIW-UHFFFAOYSA-N 3-ethyl-3,5,5-trimethylmorpholine Chemical compound CCC1(C)COCC(C)(C)N1 VDWCAMDNGFYKIW-UHFFFAOYSA-N 0.000 description 1
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical compound OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 description 1
- HXKNOTGMRCTSEU-UHFFFAOYSA-N 3-n-tert-butyl-2-methylbutane-2,3-diamine Chemical compound CC(N)(C)C(C)NC(C)(C)C HXKNOTGMRCTSEU-UHFFFAOYSA-N 0.000 description 1
- RXPKOTQRDGEKFY-UHFFFAOYSA-N 3-nitropentane Chemical compound CCC(CC)[N+]([O-])=O RXPKOTQRDGEKFY-UHFFFAOYSA-N 0.000 description 1
- JJHHIGCUQPTUHO-UHFFFAOYSA-N 3-tert-butylperoxy-3-phenyl-2-benzofuran-1-one Chemical compound O1C(=O)C2=CC=CC=C2C1(OOC(C)(C)C)C1=CC=CC=C1 JJHHIGCUQPTUHO-UHFFFAOYSA-N 0.000 description 1
- OPPHXULEHGYZRW-UHFFFAOYSA-N 4-methoxy-2,4-dimethyl-2-phenyldiazenylpentanenitrile Chemical compound COC(C)(C)CC(C)(C#N)N=NC1=CC=CC=C1 OPPHXULEHGYZRW-UHFFFAOYSA-N 0.000 description 1
- RTANHMOFHGSZQO-UHFFFAOYSA-N 4-methoxy-2,4-dimethylpentanenitrile Chemical compound COC(C)(C)CC(C)C#N RTANHMOFHGSZQO-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- OWYUMUPFWNDORQ-UHFFFAOYSA-N 5-(hydroxymethyl)-3,3,5-trimethylmorpholin-2-one Chemical compound CC1(C)NC(C)(CO)COC1=O OWYUMUPFWNDORQ-UHFFFAOYSA-N 0.000 description 1
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 1
- XKXGWYAQJRXDPI-UHFFFAOYSA-N 7-methyloctanoyl 7-methyloctaneperoxoate Chemical compound CC(C)CCCCCC(=O)OOC(=O)CCCCCC(C)C XKXGWYAQJRXDPI-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- PAPNRQCYSFBWDI-UHFFFAOYSA-N DMP Natural products CC1=CC=C(C)N1 PAPNRQCYSFBWDI-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- YIVJZNGAASQVEM-UHFFFAOYSA-N Lauroyl peroxide Chemical compound CCCCCCCCCCCC(=O)OOC(=O)CCCCCCCCCCC YIVJZNGAASQVEM-UHFFFAOYSA-N 0.000 description 1
- 238000006725 Meisenheimer rearrangement reaction Methods 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- OQWJEMWYNBRZEO-UHFFFAOYSA-N N#CC1(CCCCC1)NC1(CCCCC1)C#N Chemical compound N#CC1(CCCCC1)NC1(CCCCC1)C#N OQWJEMWYNBRZEO-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- WCQBVYMYTSEPKC-UHFFFAOYSA-N O=C(C1(CCCCC1)NC12CCCCC1)NC2=O Chemical compound O=C(C1(CCCCC1)NC12CCCCC1)NC2=O WCQBVYMYTSEPKC-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 238000006085 Schmidt reaction Methods 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000002537 cosmetic Substances 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- BSVQJWUUZCXSOL-UHFFFAOYSA-N cyclohexylsulfonyl ethaneperoxoate Chemical compound CC(=O)OOS(=O)(=O)C1CCCCC1 BSVQJWUUZCXSOL-UHFFFAOYSA-N 0.000 description 1
- XJOBOFWTZOKMOH-UHFFFAOYSA-N decanoyl decaneperoxoate Chemical compound CCCCCCCCCC(=O)OOC(=O)CCCCCCCCC XJOBOFWTZOKMOH-UHFFFAOYSA-N 0.000 description 1
- 239000000412 dendrimer Substances 0.000 description 1
- 229920000736 dendritic polymer Polymers 0.000 description 1
- 238000003795 desorption Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- ZQMIGQNCOMNODD-UHFFFAOYSA-N diacetyl peroxide Natural products CC(=O)OOC(C)=O ZQMIGQNCOMNODD-UHFFFAOYSA-N 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 150000002009 diols Chemical class 0.000 description 1
- SZXQTJUDPRGNJN-UHFFFAOYSA-N dipropylene glycol Chemical compound OCCCOCCCO SZXQTJUDPRGNJN-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000000806 elastomer Substances 0.000 description 1
- 239000012776 electronic material Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000002432 hydroperoxides Chemical class 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 150000008624 imidazolidinones Chemical class 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000012690 ionic polymerization Methods 0.000 description 1
- 230000002427 irreversible effect Effects 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical compound C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 150000004715 keto acids Chemical class 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- VSEAAEQOQBMPQF-UHFFFAOYSA-N morpholin-3-one Chemical class O=C1COCCN1 VSEAAEQOQBMPQF-UHFFFAOYSA-N 0.000 description 1
- VXRNYQMFDGOGSI-UHFFFAOYSA-N n-(1,3-dihydroxy-2-methylpropan-2-yl)-2-[[1-[(1,3-dihydroxy-2-methylpropan-2-yl)amino]-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide Chemical compound OCC(C)(CO)NC(=O)C(C)(C)N=NC(C)(C)C(=O)NC(C)(CO)CO VXRNYQMFDGOGSI-UHFFFAOYSA-N 0.000 description 1
- CATWEXRJGNBIJD-UHFFFAOYSA-N n-tert-butyl-2-methylpropan-2-amine Chemical compound CC(C)(C)NC(C)(C)C CATWEXRJGNBIJD-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- WSGCRAOTEDLMFQ-UHFFFAOYSA-N nonan-5-one Chemical compound CCCCC(=O)CCCC WSGCRAOTEDLMFQ-UHFFFAOYSA-N 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 1
- SRSFOMHQIATOFV-UHFFFAOYSA-N octanoyl octaneperoxoate Chemical compound CCCCCCCC(=O)OOC(=O)CCCCCCC SRSFOMHQIATOFV-UHFFFAOYSA-N 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- RPQRDASANLAFCM-UHFFFAOYSA-N oxiran-2-ylmethyl prop-2-enoate Chemical class C=CC(=O)OCC1CO1 RPQRDASANLAFCM-UHFFFAOYSA-N 0.000 description 1
- NODGRWCMFMEGJH-UHFFFAOYSA-N p-ethylacetophenone Chemical compound CCC1=CC=C(C(C)=O)C=C1 NODGRWCMFMEGJH-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- MDHYEMXUFSJLGV-UHFFFAOYSA-N phenethyl acetate Chemical compound CC(=O)OCCC1=CC=CC=C1 MDHYEMXUFSJLGV-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- JTHRRMFZHSDGNJ-UHFFFAOYSA-N piperazine-2,3-dione Chemical compound O=C1NCCNC1=O JTHRRMFZHSDGNJ-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920000058 polyacrylate Polymers 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229920005553 polystyrene-acrylate Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000001902 propagating effect Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- BWJUFXUULUEGMA-UHFFFAOYSA-N propan-2-yl propan-2-yloxycarbonyloxy carbonate Chemical compound CC(C)OC(=O)OOC(=O)OC(C)C BWJUFXUULUEGMA-UHFFFAOYSA-N 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003235 pyrrolidines Chemical class 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000006254 rheological additive Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 235000010378 sodium ascorbate Nutrition 0.000 description 1
- PPASLZSBLFJQEF-RKJRWTFHSA-M sodium ascorbate Substances [Na+].OC[C@@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RKJRWTFHSA-M 0.000 description 1
- 229960005055 sodium ascorbate Drugs 0.000 description 1
- PPASLZSBLFJQEF-RXSVEWSESA-M sodium-L-ascorbate Chemical compound [Na+].OC[C@H](O)[C@H]1OC(=O)C(O)=C1[O-] PPASLZSBLFJQEF-RXSVEWSESA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 1
- OPQYOFWUFGEMRZ-UHFFFAOYSA-N tert-butyl 2,2-dimethylpropaneperoxoate Chemical compound CC(C)(C)OOC(=O)C(C)(C)C OPQYOFWUFGEMRZ-UHFFFAOYSA-N 0.000 description 1
- KHJNXCATZZIGAX-UHFFFAOYSA-N tert-butyl 2-ethyl-2-methylheptaneperoxoate Chemical compound CCCCCC(C)(CC)C(=O)OOC(C)(C)C KHJNXCATZZIGAX-UHFFFAOYSA-N 0.000 description 1
- PFBLRDXPNUJYJM-UHFFFAOYSA-N tert-butyl 2-methylpropaneperoxoate Chemical compound CC(C)C(=O)OOC(C)(C)C PFBLRDXPNUJYJM-UHFFFAOYSA-N 0.000 description 1
- GJBRNHKUVLOCEB-UHFFFAOYSA-N tert-butyl benzenecarboperoxoate Chemical compound CC(C)(C)OOC(=O)C1=CC=CC=C1 GJBRNHKUVLOCEB-UHFFFAOYSA-N 0.000 description 1
- SWAXTRYEYUTSAP-UHFFFAOYSA-N tert-butyl ethaneperoxoate Chemical compound CC(=O)OOC(C)(C)C SWAXTRYEYUTSAP-UHFFFAOYSA-N 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- CIHOLLKRGTVIJN-UHFFFAOYSA-N tert‐butyl hydroperoxide Chemical compound CC(C)(C)OO CIHOLLKRGTVIJN-UHFFFAOYSA-N 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/02—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings
- C07D241/06—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members
- C07D241/08—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings not condensed with other rings having one or two double bonds between ring members or between ring members and non-ring members with oxygen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L101/00—Compositions of unspecified macromolecular compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/32—One oxygen atom
- C07D233/36—One oxygen atom with hydrocarbon radicals, substituted by nitrogen atoms, attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/08—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
- C07D265/32—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings with oxygen atoms directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Polymerization Catalysts (AREA)
- Hydrogenated Pyridines (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP98811030.0 | 1998-10-16 | ||
| EP98811030 | 1998-10-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE19949352A1 DE19949352A1 (de) | 2000-04-20 |
| DE19949352B4 true DE19949352B4 (de) | 2015-05-28 |
Family
ID=8236385
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19949352.9A Expired - Lifetime DE19949352B4 (de) | 1998-10-16 | 1999-10-13 | Heterocyclische Alkoxyamine als Regulatoren in gesteuerten radikalischen Polymerisationsverfahren |
Country Status (17)
| Country | Link |
|---|---|
| US (2) | US6479608B1 (enExample) |
| JP (1) | JP4895416B2 (enExample) |
| KR (1) | KR100597892B1 (enExample) |
| CN (1) | CN100343285C (enExample) |
| AU (1) | AU769061B2 (enExample) |
| BE (1) | BE1012727A5 (enExample) |
| BR (1) | BR9904685A (enExample) |
| CA (1) | CA2286375A1 (enExample) |
| DE (1) | DE19949352B4 (enExample) |
| DK (1) | DK199901463A (enExample) |
| ES (1) | ES2178908B1 (enExample) |
| FR (1) | FR2784684B1 (enExample) |
| GB (1) | GB2342649B (enExample) |
| IT (1) | IT1313663B1 (enExample) |
| NL (1) | NL1013259C2 (enExample) |
| SE (1) | SE522619C2 (enExample) |
| TW (1) | TWI225483B (enExample) |
Families Citing this family (81)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW495515B (en) * | 1998-03-09 | 2002-07-21 | Ciba Sc Holding Ag | 1-alkoxy-polyalkyl-piperidine derivatives, a polymerizable composition containing the same and a process for polymerization |
| ATE272610T1 (de) * | 1999-07-02 | 2004-08-15 | Ciba Sc Holding Ag | Mono- und multifunktionelle alkoxyamine zur herstellung von funktionalisierten makromeren |
| WO2001023435A1 (en) * | 1999-09-30 | 2001-04-05 | Noveon Ip Holdings Corp. | Polymerization compositions and methods |
| US7030196B2 (en) | 2000-05-19 | 2006-04-18 | Ciba Specialty Chemicals Corporation | Process for reducing the molecular weight of polypropylene |
| EP1655303B1 (en) | 2000-05-19 | 2011-02-23 | Basf Se | Process for the Controlled Increase in Molecular Weight of Polyethylene or Polyethylene Blends |
| DE10036801A1 (de) | 2000-07-28 | 2002-02-07 | Tesa Ag | Acrylathaftklebemassen mit enger Molekulargewichtsverteilung |
| TW574236B (en) * | 2000-09-25 | 2004-02-01 | Ciba Sc Holding Ag | Process for controlled radical polymerization in aqueous dispersion |
| TWI225492B (en) | 2000-09-25 | 2004-12-21 | Ciba Sc Holding Ag | Composition and process for enhancing controlled free radical polymerization |
| JP4505980B2 (ja) * | 2000-11-28 | 2010-07-21 | 東レ株式会社 | アクリロニトリル系重合体の製造法 |
| US6544304B2 (en) | 2001-04-02 | 2003-04-08 | Ciba Specialty Chemicals Corporation | Candle wax stabilized with morpholinones |
| JP4389247B2 (ja) * | 2001-06-13 | 2009-12-24 | チバ ホールディング インコーポレーテッド | 4−イミノ−n−アルコキシまたはオキシポリアルキルピペリジン化合物および重合調節剤としてのそれらの使用 |
| DE10129608A1 (de) | 2001-06-20 | 2003-05-28 | Tesa Ag | Stripfähige Systeme auf Basis von Acrylatblockcopolymeren |
| DE10133727A1 (de) * | 2001-07-11 | 2003-01-23 | Borchers Gmbh | Verwendung von Mischungen spezieller organischer Verbindungen als Hautverhinderungsmittel in lufttrocknenden Lacken |
| US20030073835A1 (en) | 2001-07-31 | 2003-04-17 | Dario Lazzari | Imidazolidinone derivatives |
| DE10149083A1 (de) | 2001-10-05 | 2003-04-17 | Tesa Ag | Acrylathaftklebemassen mit enger Molekulargewichtsverteilung |
| DE10149084A1 (de) | 2001-10-05 | 2003-06-18 | Tesa Ag | UV-vernetzbare Acrylathaftschmelzhaftkleber mit enger Molekulargewichtsverteilung |
| DE10153677A1 (de) | 2001-10-31 | 2003-05-15 | Tesa Ag | Doppelseitiges Klebeband |
| DE10156088A1 (de) | 2001-11-16 | 2003-06-05 | Tesa Ag | Orientierte Acrylatblockcopolymere |
| DE10157154A1 (de) * | 2001-11-22 | 2003-05-28 | Tesa Ag | Verfahren zur Herstellung orientierter Acrylathotmelts |
| EP1451237A1 (de) | 2001-11-24 | 2004-09-01 | Tesa AG | Vernetzung von photoinitiator-initialisierten polyacrylaten |
| DE10221093A1 (de) | 2002-05-11 | 2003-11-20 | Tesa Ag | Verwendung von Makromonomeren für die Herstellung von Acrylathaftklebemassen |
| DE10234246A1 (de) | 2002-07-27 | 2004-02-05 | Tesa Ag | Haftklebemassen mit hohem Brechungsindex auf Basis von Acrylatblockcopolymeren |
| DE10237950A1 (de) * | 2002-08-20 | 2004-03-11 | Tesa Ag | UV-initiiert thermisch vernetzte Acrylathaftklebemassen |
| JP4490269B2 (ja) * | 2002-09-04 | 2010-06-23 | チバ ホールディング インコーポレーテッド | エポキシ官能化したニトロキシルエーテルを使用する櫛型または星型コポリマーの生成方法 |
| DE10256782A1 (de) * | 2002-12-05 | 2004-08-05 | Tesa Ag | Haftklebeartikel |
| DE10259451A1 (de) * | 2002-12-19 | 2004-07-08 | Tesa Ag | Haftklebeartikel mit wenigstens einer Schicht aus einer thermisch leitfähigen Haftklebemasse und Verfahren zu seiner Herstellung |
| DE10314898A1 (de) | 2003-01-29 | 2004-08-12 | Tesa Ag | Haftklebebänder zur Verklebung von Druckplatten und Verfahren zu deren Herstellung |
| DE10312062A1 (de) * | 2003-03-18 | 2004-09-30 | Tesa Ag | Schmelzhaftkleber mit geringem Rückschrumpf, Verfahren zu seiner Herstellung und Verwendung |
| DE10322830A1 (de) * | 2003-05-19 | 2004-12-09 | Tesa Ag | Verfahren zur kontinuierlichen Herstellung von Polymeren aus vinylischen Verbindungen durch Substanz-beziehungsweise Lösungsmittelpolymerisation |
| ES2303592T3 (es) * | 2003-05-30 | 2008-08-16 | Tesa Ag | Masa autoadhesiva y articulos autoadhesivos con poliacrilato y su correspondiente metodo de tratamiento de fusion en caliente. |
| DE10357322A1 (de) | 2003-12-05 | 2005-06-30 | Tesa Ag | Zweischichtige Haftklebemasse |
| DE10357323A1 (de) | 2003-12-05 | 2005-06-30 | Tesa Ag | Haftklebemasse |
| DE10359350A1 (de) | 2003-12-16 | 2005-07-14 | Tesa Ag | Haftklebemasse |
| DE10359349A1 (de) * | 2003-12-16 | 2005-07-14 | Tesa Ag | Verfahren zur Herstellung von Acrylatschmelzhaftklebern |
| DE10359973A1 (de) | 2003-12-18 | 2005-07-21 | Tesa Ag | Haftklebemasse auf Basis von Acrylatblockcopolymeren |
| DE102004001412A1 (de) | 2004-01-09 | 2005-08-25 | Tesa Ag | Haftklebemasse auf Basis eines Acrylatpolymerblends |
| JP2005232103A (ja) * | 2004-02-20 | 2005-09-02 | Nagase & Co Ltd | 光学活性なビシナルジアミンおよびその製造方法 |
| DE102004013699A1 (de) * | 2004-03-18 | 2005-10-06 | Tesa Ag | Haftklebeband für medizinische Diagnosestreifen |
| US20100210800A1 (en) * | 2004-03-24 | 2010-08-19 | Ciba Corporation | Method of preparing ethylene polymers by controlled high pressure polymerization |
| CA2558370C (en) * | 2004-03-24 | 2012-11-20 | Ciba Specialty Chemicals Holding Inc. | Method of preparing ethylene polymers by controlled high pressure polymerization |
| WO2006000505A2 (de) | 2004-06-23 | 2006-01-05 | Tesa Ag | Medizinischer biosensor, mittels dem biologische flüssigkeiten untersucht werden |
| DE102004033242A1 (de) * | 2004-07-08 | 2006-02-02 | Tesa Ag | Haftklebemasse |
| DE102004044085A1 (de) | 2004-09-09 | 2006-03-16 | Tesa Ag | Haftklebemasse mit dualem Vernetzungsmechanismus |
| WO2006027385A1 (de) | 2004-09-09 | 2006-03-16 | Tesa Ag | Funktionalisierte polymere bzw. haftklebemassen |
| CN100577692C (zh) | 2005-01-11 | 2010-01-06 | 西巴特殊化学品控股有限公司 | 用受控自由基聚合方法制备的均聚物和共聚物的后改性方法 |
| US7410694B2 (en) | 2005-04-11 | 2008-08-12 | Tesa Aktiengesellschaft | Adhesive |
| DE102006035786A1 (de) * | 2006-07-28 | 2008-03-13 | Tesa Ag | Haftklebefolie mit hoher optischer Transparenz zur Verklebung als Splitterschutz auf Glasscheiben in Konsumgüterelektronikbauteilen |
| DE102006042816A1 (de) * | 2006-09-08 | 2008-06-26 | Tesa Ag | Hitze-aktiviert verklebbares Stanzungsflächenelement |
| WO2008032732A1 (en) * | 2006-09-15 | 2008-03-20 | Kuraray Co., Ltd. | Methacrylic resin composition, resin modifier, and molded body |
| EP2122739A1 (en) * | 2007-03-09 | 2009-11-25 | Basf Se | Nitroxides for lithium-ion batteries |
| KR20090127193A (ko) * | 2007-04-05 | 2009-12-09 | 바스프 에스이 | 선택 공중합체를 포함하는 선스크린 및 개인 위생 조성물 |
| DE102007019131A1 (de) | 2007-04-20 | 2008-10-23 | Tesa Ag | Doppelseitiges Haftklebeband |
| WO2008145595A1 (en) * | 2007-06-01 | 2008-12-04 | Basf Se | Modified printable surfaces |
| DE102007038458A1 (de) | 2007-08-14 | 2009-02-19 | Tesa Ag | Verbundelement |
| DE102007045168A1 (de) | 2007-09-20 | 2009-04-02 | Tesa Ag | Transparentes Klebeband |
| DE102007045166A1 (de) | 2007-09-20 | 2009-04-02 | Tesa Ag | Transparentes Klebeband |
| DE102007062447A1 (de) | 2007-12-20 | 2009-06-25 | Tesa Ag | Doppelseitiges Haftklebeband für Flüssigkristallanzeigesysteme |
| EP2280682A2 (en) * | 2008-06-04 | 2011-02-09 | The Procter & Gamble Company | Denture adhesive compositions and methods |
| CA2748912C (en) * | 2009-01-08 | 2014-02-25 | Basf Se | Polymerisation initiator |
| DE102009006593A1 (de) | 2009-01-29 | 2010-08-05 | Tesa Se | Verfahren zur Korrosionsschutzbehandlung von Metalloberflächen |
| DE102009007589A1 (de) | 2009-02-05 | 2010-08-12 | Tesa Se | Transfer-Haftklebeband sowie Verfahren zur Herstellung eines Haftklebebandes |
| US8686179B2 (en) | 2009-06-12 | 2014-04-01 | 3M Innovative Properties Company | Fluorinated aromatic bis(acyl)-containing compounds and polyesters prepared therefrom |
| WO2012000992A1 (en) | 2010-06-29 | 2012-01-05 | Basf Se | Process for improving the flow properties of polymer melts |
| DE102011077927A1 (de) | 2011-06-21 | 2012-12-27 | Tesa Se | Verfahren zur reversiblen kovalenten Vernetzung von Klebemassen |
| WO2013060708A1 (en) | 2011-10-25 | 2013-05-02 | Basf Se | Use of comb or block copolymers as soil antiredeposition agents and soil release agents in laundry processes |
| DE102012208597B4 (de) | 2012-05-23 | 2018-05-30 | Tesa Se | Haftklebemasse für medizinische Zwecke, Verfahren zu ihrer Herstellung und die Haftklebmasse enthaltende Mischung |
| DE102012212883A1 (de) | 2012-07-23 | 2014-05-15 | Tesa Se | Geschäumtes Klebeband zur Verklebung auf unpolaren Oberflächen |
| US9790452B2 (en) | 2013-03-27 | 2017-10-17 | Basf Se | Block copolymers as soil release agents in laundry processes |
| DE102013224774A1 (de) | 2013-12-03 | 2015-06-03 | Tesa Se | Mehrschichtiges Produkt |
| DE102015222028A1 (de) | 2015-11-09 | 2017-05-11 | Tesa Se | Kationisch polymerisierbare Polyacrylate enthaltend Alkoxysilangruppen und deren Verwendung |
| DE102016207540A1 (de) | 2016-05-02 | 2017-11-02 | Tesa Se | Wasserdampfsperrende Klebemasse mit hochfunktionalisiertem Poly(meth)acrylat |
| DE102016207548A1 (de) | 2016-05-02 | 2017-11-02 | Tesa Se | Härtbare Klebemasse und darauf basierende Reaktivklebebänder |
| DE102016207550A1 (de) | 2016-05-02 | 2017-11-02 | Tesa Se | Funktionalisierte (Co)Polymere für Klebesysteme und Klebebänder |
| WO2018095926A1 (de) * | 2016-11-22 | 2018-05-31 | Sika Technology Ag | Herstellung von dispergiermitteln durch nitroxid-vermittelte lösungspolymerisation |
| DE102017223147A1 (de) | 2017-12-19 | 2019-06-19 | Tesa Se | Oberflächenschutzfolie mit Schaumschicht |
| DE102018216868A1 (de) | 2018-10-01 | 2020-04-02 | Tesa Se | Latent reaktiver Klebefilm |
| DE102019215890A1 (de) | 2019-10-16 | 2021-04-22 | Tesa Se | Härtbare Klebemasse und darauf basierende Reaktivklebebänder |
| DE102019219166B4 (de) | 2019-12-09 | 2023-08-24 | Tesa Se | Strukturelle Haftklebemasse und ihre Verwendung |
| DE102020203952A1 (de) | 2020-03-26 | 2021-09-30 | Tesa Se | Latent reaktiver Klebefilm |
| EP4251665B1 (en) | 2020-11-30 | 2025-01-08 | Basf Se | Process of producing polymer dispersions |
| EP4314155B1 (en) | 2021-03-26 | 2025-04-09 | Basf Se | Polymer composition comprising polyacrylic block copolymer and aromatic based polyalkyleneoxide as dispersant |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19903870A1 (de) * | 1998-02-02 | 1999-08-05 | Ciba Geigy Ag | Oxopiperazinyl-Derivate und Licht-stabilisierte Zusammensetzungen |
| WO1999046261A1 (en) * | 1998-03-09 | 1999-09-16 | Ciba Specialty Chemicals Holding Inc. | Nitroxyl derivatives with glycidyl or alkylcarbonyl groups as initiators for radical polymerisation |
| DE19924984A1 (de) * | 1998-06-02 | 1999-12-09 | Ciba Sc Holding Ag | Durch Dioxopiperazinylderivate stabilisierte Zusammensetzungen |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1695737B2 (de) * | 1966-06-15 | 1976-09-23 | Sankyo Co. Ltd., Tokio | 2,2,5,5-tetrasubstituierte imidazolidin-4-on-1-oxide |
| DE1299627B (de) * | 1966-08-31 | 1969-07-24 | Dynamit Nobel Ag | Verfahren zur Herstellung von reinster Terepthalsaeure |
| JPS462905B1 (enExample) * | 1967-11-28 | 1971-01-25 | ||
| JPS5010281B1 (enExample) * | 1970-03-20 | 1975-04-19 | ||
| DE3486145T2 (de) * | 1983-07-11 | 1993-09-23 | Commw Scient Ind Res Org | Verfahren zur polymerisation und nach diesem verfahren hergestellte polymere. |
| AU571240B2 (en) * | 1983-07-11 | 1988-04-14 | Commonwealth Scientific And Industrial Research Organisation | Alkoxy-amines, useful as initiators |
| FR2730240A1 (fr) * | 1995-02-07 | 1996-08-09 | Atochem Elf Sa | Stabilisation d'un polymere par un radical libre stable |
| US5608023A (en) | 1995-03-30 | 1997-03-04 | Xerox Corporation | Rate enhanced polymerization processes |
| DE69708896T2 (de) * | 1996-09-25 | 2002-06-20 | Akzo Nobel N.V., Arnheim/Arnhem | Nitroso verbindungen zur pseudo-lebenden radikalpolymerisation |
| DE69829588T2 (de) * | 1997-01-10 | 2006-01-19 | E.I. Du Pont De Nemours And Co., Wilmington | Farblose wässrige Ammoniumsulfidlösung |
| US6281311B1 (en) | 1997-03-31 | 2001-08-28 | Pmd Holdings Corp. | Controlled free radical polymerization process |
| SG82601A1 (en) | 1998-03-09 | 2001-08-21 | Ciba Sc Holding Ag | 1-alkoxy-polyalkyl-piperidine derivatives and their use as polymerization regulators |
| TW541303B (en) | 2000-03-22 | 2003-07-11 | Ciba Sc Holding Ag | 2,2,6,6 diethyl-dimethyl-1-alkoxy-piperidine compounds and their corresponding 1-oxides |
-
1999
- 1999-08-30 TW TW088115002A patent/TWI225483B/zh active
- 1999-10-06 GB GB9923579A patent/GB2342649B/en not_active Expired - Fee Related
- 1999-10-06 SE SE9903593A patent/SE522619C2/sv not_active IP Right Cessation
- 1999-10-11 NL NL1013259A patent/NL1013259C2/nl not_active IP Right Cessation
- 1999-10-12 BE BE9900673A patent/BE1012727A5/fr not_active IP Right Cessation
- 1999-10-12 AU AU53617/99A patent/AU769061B2/en not_active Ceased
- 1999-10-12 IT IT1999MI002125A patent/IT1313663B1/it active
- 1999-10-13 DK DK199901463A patent/DK199901463A/da not_active Application Discontinuation
- 1999-10-13 DE DE19949352.9A patent/DE19949352B4/de not_active Expired - Lifetime
- 1999-10-14 ES ES009902254A patent/ES2178908B1/es not_active Expired - Fee Related
- 1999-10-14 KR KR1019990044561A patent/KR100597892B1/ko not_active Expired - Fee Related
- 1999-10-14 CA CA002286375A patent/CA2286375A1/en not_active Abandoned
- 1999-10-14 US US09/417,538 patent/US6479608B1/en not_active Expired - Lifetime
- 1999-10-14 FR FR9912810A patent/FR2784684B1/fr not_active Expired - Lifetime
- 1999-10-15 CN CNB991213904A patent/CN100343285C/zh not_active Expired - Fee Related
- 1999-10-15 JP JP29369799A patent/JP4895416B2/ja not_active Expired - Lifetime
- 1999-10-15 BR BR9904685-7A patent/BR9904685A/pt not_active Application Discontinuation
-
2002
- 2002-07-09 US US10/191,193 patent/US6664353B2/en not_active Expired - Lifetime
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE19903870A1 (de) * | 1998-02-02 | 1999-08-05 | Ciba Geigy Ag | Oxopiperazinyl-Derivate und Licht-stabilisierte Zusammensetzungen |
| WO1999046261A1 (en) * | 1998-03-09 | 1999-09-16 | Ciba Specialty Chemicals Holding Inc. | Nitroxyl derivatives with glycidyl or alkylcarbonyl groups as initiators for radical polymerisation |
| DE19924984A1 (de) * | 1998-06-02 | 1999-12-09 | Ciba Sc Holding Ag | Durch Dioxopiperazinylderivate stabilisierte Zusammensetzungen |
Non-Patent Citations (2)
| Title |
|---|
| A. Khalaj, R.D. Bazaz, M. Shekarchi: In Monatshefte für Chemie 128(1997)395-398 * |
| Khalaj, A., Bazaz, R.D., Shekarchi, M.: Synthesis of Novel Imidazolidinones. In: Monatshefte für Chemie, 128, 1997, 395-398. * |
Also Published As
| Publication number | Publication date |
|---|---|
| US6479608B1 (en) | 2002-11-12 |
| FR2784684A1 (fr) | 2000-04-21 |
| DE19949352A1 (de) | 2000-04-20 |
| ES2178908A1 (es) | 2003-01-01 |
| SE522619C2 (sv) | 2004-02-24 |
| GB2342649A (en) | 2000-04-19 |
| ITMI992125A0 (it) | 1999-10-12 |
| KR100597892B1 (ko) | 2006-07-06 |
| SE9903593L (sv) | 2000-04-17 |
| KR20000029079A (ko) | 2000-05-25 |
| US6664353B2 (en) | 2003-12-16 |
| CA2286375A1 (en) | 2000-04-16 |
| JP4895416B2 (ja) | 2012-03-14 |
| GB2342649B (en) | 2001-07-18 |
| DK199901463A (da) | 2000-04-17 |
| NL1013259A1 (nl) | 2000-04-18 |
| TWI225483B (en) | 2004-12-21 |
| SE9903593D0 (sv) | 1999-10-06 |
| GB9923579D0 (en) | 1999-12-08 |
| BR9904685A (pt) | 2000-11-28 |
| JP2000128869A (ja) | 2000-05-09 |
| US20030125494A1 (en) | 2003-07-03 |
| AU5361799A (en) | 2000-04-20 |
| CN100343285C (zh) | 2007-10-17 |
| ES2178908B1 (es) | 2004-04-01 |
| NL1013259C2 (nl) | 2000-11-21 |
| CN1253954A (zh) | 2000-05-24 |
| ITMI992125A1 (it) | 2001-04-12 |
| FR2784684B1 (fr) | 2001-01-26 |
| BE1012727A5 (fr) | 2001-02-06 |
| IT1313663B1 (it) | 2002-09-09 |
| AU769061B2 (en) | 2004-01-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE19949352B4 (de) | Heterocyclische Alkoxyamine als Regulatoren in gesteuerten radikalischen Polymerisationsverfahren | |
| NL1011493C2 (nl) | 1-alkoxy-polyalkylpiperidine-derivaten en de toepassing daarvan als regelmiddelen voor de polymerisatie. | |
| DE69812633T2 (de) | Von nitrone- oder nitroso-verbindungen abgeleitete alkoxyaminverbindungen-enthaltende polymerisierbare zusammensetzungen | |
| DE69806084T2 (de) | Kontrolliertes Radikalpolymerisatonsverfahren | |
| DE69916455T2 (de) | Offenkettige alkoxyaminverbindungen und ihrer anwendung als polymerisationsregler | |
| KR20010092697A (ko) | 2,2,6,6 디에틸-디메틸-1-알콕시-피페리딘 화합물 및이들을 포함하는 중합성 조성물 | |
| DE60103929T2 (de) | N-alkoxy-4,4-dioxy-polyalkyl-piperidin-verbindungen mit glycidyl- oder alkyloxycarbonyl-gruppen als funktionelle initiatoren für die kontrollierte radikalische polymerisation | |
| EP1397349B1 (en) | 4-imino-n-alkoxy or oxy-polyalkyl-piperidine compounds and their use as polymerization regulators | |
| DE69930517T2 (de) | Benutzung von 1-oxyl-2,2,6,6-tetraalkylpiperidin mit langen alkylketten als polymerisationsregulatoren | |
| JP7325560B2 (ja) | ビニルモノマーの線状重合および擬環拡大重合を制御するための調節剤 | |
| MXPA99009004A (en) | Heterociclic alcoxyamins as regulators in polymerization processes by radical controla |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: PFENNING MEINIG & PARTNER GBR, 80339 MUENCHEN |
|
| 8110 | Request for examination paragraph 44 | ||
| 8127 | New person/name/address of the applicant |
Owner name: CIBA HOLDING INC., BASEL, CH |
|
| 8128 | New person/name/address of the agent |
Representative=s name: MAIWALD PATENTANWALTSGESELLSCHAFT MBH, 80335 MUENC |
|
| R016 | Response to examination communication | ||
| R018 | Grant decision by examination section/examining division | ||
| R020 | Patent grant now final | ||
| R071 | Expiry of right |