DE1938674A1 - Heterocyclische Verbindungen und Verfahren zu ihrer Herstellung - Google Patents
Heterocyclische Verbindungen und Verfahren zu ihrer HerstellungInfo
- Publication number
- DE1938674A1 DE1938674A1 DE19691938674 DE1938674A DE1938674A1 DE 1938674 A1 DE1938674 A1 DE 1938674A1 DE 19691938674 DE19691938674 DE 19691938674 DE 1938674 A DE1938674 A DE 1938674A DE 1938674 A1 DE1938674 A1 DE 1938674A1
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- formula
- chlorophenyl
- hydroxy
- temperatures
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 33
- 238000002360 preparation method Methods 0.000 title claims description 7
- 150000002391 heterocyclic compounds Chemical class 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 82
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 32
- 150000003839 salts Chemical class 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 19
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 239000012442 inert solvent Substances 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 17
- 239000000460 chlorine Substances 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 11
- 229910052794 bromium Inorganic materials 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- -1 alkali metal hydrosulfide Chemical class 0.000 claims description 9
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 8
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- GHIYMSVUXQLJSA-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-ethyl-5,6-dihydro-2h-imidazo[2,1-b][1,3]thiazol-3-ol Chemical compound CCC1SC2=NCCN2C1(O)C1=CC=C(Cl)C=C1 GHIYMSVUXQLJSA-UHFFFAOYSA-N 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 230000007717 exclusion Effects 0.000 claims description 2
- 229910052744 lithium Inorganic materials 0.000 claims description 2
- JXWXORXOVYXNFP-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-methyl-5,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-3-ol Chemical compound ClC1=CC=C(C=C1)C1(N2C(SC1C)=NCC2)O JXWXORXOVYXNFP-UHFFFAOYSA-N 0.000 claims 1
- FNNKLUDOORPHGR-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-methyl-5,6-dihydroimidazo[2,1-b][1,3]thiazole Chemical compound N12CCN=C2SC(C)=C1C1=CC=C(Cl)C=C1 FNNKLUDOORPHGR-UHFFFAOYSA-N 0.000 claims 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims 1
- 230000008030 elimination Effects 0.000 claims 1
- 238000003379 elimination reaction Methods 0.000 claims 1
- 150000005826 halohydrocarbons Chemical class 0.000 claims 1
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 239000000825 pharmaceutical preparation Substances 0.000 claims 1
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 34
- 239000000243 solution Substances 0.000 description 31
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 17
- 239000007787 solid Substances 0.000 description 16
- DDGHBOLOCQWPKE-UHFFFAOYSA-N 1,3-thiazole;hydrobromide Chemical compound [Br-].C1=CSC=[NH+]1 DDGHBOLOCQWPKE-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- BATMYWDOUUWCJE-UHFFFAOYSA-N pyrimidin-1-ium;bromide Chemical compound Br.C1=CN=CN=C1 BATMYWDOUUWCJE-UHFFFAOYSA-N 0.000 description 7
- 230000035484 reaction time Effects 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N hydroxymethyl benzene Natural products OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 5
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 5
- NXRIDTLKJCKPOG-UHFFFAOYSA-N 1,4-dihydroimidazole-5-thione Chemical compound S=C1CN=CN1 NXRIDTLKJCKPOG-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000000935 antidepressant agent Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- XLCJPQYALLFIPW-UHFFFAOYSA-N 1-(4-chlorophenyl)butan-1-one Chemical compound CCCC(=O)C1=CC=C(Cl)C=C1 XLCJPQYALLFIPW-UHFFFAOYSA-N 0.000 description 3
- YNVPYNAIGUTVFX-UHFFFAOYSA-N 2-bromo-1-(4-chlorophenyl)butan-1-ol Chemical compound CCC(Br)C(O)C1=CC=C(Cl)C=C1 YNVPYNAIGUTVFX-UHFFFAOYSA-N 0.000 description 3
- MAGGATIDVVMDRH-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-ethyl-2,5,6,7-tetrahydro-[1,3]thiazolo[3,2-a]pyrimidin-3-ol;hydrobromide Chemical compound Br.CCC1SC2=NCCCN2C1(O)C1=CC=C(Cl)C=C1 MAGGATIDVVMDRH-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 229940005513 antidepressants Drugs 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000002552 dosage form Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000000575 pesticide Substances 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 235000011181 potassium carbonates Nutrition 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- 239000012730 sustained-release form Substances 0.000 description 3
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 3
- WCHLYCOBWZVGLI-UHFFFAOYSA-N 2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole hydrobromide Chemical compound Br.S1C=2N(CC1)CCN2 WCHLYCOBWZVGLI-UHFFFAOYSA-N 0.000 description 2
- BYOSXLUJIZHWMJ-UHFFFAOYSA-N 2-bromo-1-(4-chlorophenyl)butan-1-one Chemical compound CCC(Br)C(=O)C1=CC=C(Cl)C=C1 BYOSXLUJIZHWMJ-UHFFFAOYSA-N 0.000 description 2
- MFFPYHCZXSTPLY-UHFFFAOYSA-N 3-(4-chlorophenyl)-2-ethyl-5,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-3-ol hydrobromide Chemical compound Br.ClC1=CC=C(C=C1)C1(N2C(SC1CC)=NCC2)O MFFPYHCZXSTPLY-UHFFFAOYSA-N 0.000 description 2
- CDEMHJCJMMOFMB-UHFFFAOYSA-M ClC1=CC=C([Mg]Br)C=C1 Chemical compound ClC1=CC=C([Mg]Br)C=C1 CDEMHJCJMMOFMB-UHFFFAOYSA-M 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 2
- 229940077388 benzenesulfonate Drugs 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 125000002587 enol group Chemical group 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 150000002696 manganese Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 150000003890 succinate salts Chemical class 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- NVHNGVXBCWYLFA-UHFFFAOYSA-N 1,3-diazinane-2-thione Chemical compound S=C1NCCCN1 NVHNGVXBCWYLFA-UHFFFAOYSA-N 0.000 description 1
- ATDDFEIRQJWWAO-UHFFFAOYSA-N 1-(3-chlorophenyl)butan-1-one Chemical compound CCCC(=O)C1=CC=CC(Cl)=C1 ATDDFEIRQJWWAO-UHFFFAOYSA-N 0.000 description 1
- VESJUQKFLZTADT-UHFFFAOYSA-N 1-(4-chlorophenyl)-2-sulfanylbutan-1-one Chemical compound SC(C(=O)C1=CC=C(C=C1)Cl)CC VESJUQKFLZTADT-UHFFFAOYSA-N 0.000 description 1
- ADCYRBXQAJXJTD-UHFFFAOYSA-N 1-(4-chlorophenyl)propan-1-one Chemical compound CCC(=O)C1=CC=C(Cl)C=C1 ADCYRBXQAJXJTD-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- RBGBYBGFTMQEKQ-UHFFFAOYSA-N Br.C(C)C1C(N2C(=NCCC2)S1)(C1=CC=C(C=C1)F)O Chemical compound Br.C(C)C1C(N2C(=NCCC2)S1)(C1=CC=C(C=C1)F)O RBGBYBGFTMQEKQ-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FRBXHUUHIIGYDT-UHFFFAOYSA-N C(C=C/C(=O)O)(=O)O.S1C=NC=C1 Chemical compound C(C=C/C(=O)O)(=O)O.S1C=NC=C1 FRBXHUUHIIGYDT-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 244000089409 Erythrina poeppigiana Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 235000009776 Rathbunia alamosensis Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000000578 anorexic effect Effects 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000002830 appetite depressant Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 206010061428 decreased appetite Diseases 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- ZINJLDJMHCUBIP-UHFFFAOYSA-N ethametsulfuron-methyl Chemical compound CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- ZYCMDWDFIQDPLP-UHFFFAOYSA-N hbr bromine Chemical compound Br.Br ZYCMDWDFIQDPLP-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-M hydrosulfide Chemical compound [SH-] RWSOTUBLDIXVET-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- UVNXNSUKKOLFBM-UHFFFAOYSA-N imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=CSC2=NC=CN21 UVNXNSUKKOLFBM-UHFFFAOYSA-N 0.000 description 1
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 238000010653 organometallic reaction Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- ZOCLAPYLSUCOGI-UHFFFAOYSA-M potassium hydrosulfide Chemical compound [SH-].[K+] ZOCLAPYLSUCOGI-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 239000007916 tablet composition Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Purses, Travelling Bags, Baskets, Or Suitcases (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US74892968A | 1968-07-31 | 1968-07-31 | |
| US74893468A | 1968-07-31 | 1968-07-31 | |
| US79045169A | 1969-01-10 | 1969-01-10 | |
| US79044969A | 1969-01-10 | 1969-01-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1938674A1 true DE1938674A1 (de) | 1970-02-05 |
Family
ID=27505649
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691938674 Pending DE1938674A1 (de) | 1968-07-31 | 1969-07-30 | Heterocyclische Verbindungen und Verfahren zu ihrer Herstellung |
Country Status (9)
| Country | Link |
|---|---|
| BE (1) | BE736739A (cg-RX-API-DMAC10.html) |
| CH (1) | CH513918A (cg-RX-API-DMAC10.html) |
| DE (1) | DE1938674A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2014048A1 (cg-RX-API-DMAC10.html) |
| IL (1) | IL32724A0 (cg-RX-API-DMAC10.html) |
| NL (1) | NL6911687A (cg-RX-API-DMAC10.html) |
| NO (1) | NO126229B (cg-RX-API-DMAC10.html) |
| OA (1) | OA03392A (cg-RX-API-DMAC10.html) |
| RO (1) | RO56851A (cg-RX-API-DMAC10.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10112197A1 (de) * | 2001-03-14 | 2002-09-19 | Gruenenthal Gmbh | Substituierte Pyrazolo- und Thiazolopyrimidine |
| WO2006085118A3 (en) * | 2005-02-08 | 2006-10-19 | Prosidion Ltd | Dihydroimidazothiazole derivatives |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2436263C2 (de) * | 1974-07-27 | 1983-02-17 | Hoechst Ag, 6000 Frankfurt | Thiazolidinderivate und Verfahren zu ihrer Herstellung |
| FR2414510A1 (fr) * | 1977-06-27 | 1979-08-10 | Parcor | Nouveaux thiazoles condenses, notamment vasodilatateurs et hypotenseurs |
| FR2448544A1 (fr) * | 1979-02-12 | 1980-09-05 | Synthelabo | Derives de thiazole et leur application en therapeutique |
| FR2479831A1 (fr) * | 1980-04-08 | 1981-10-09 | Synthelabo | Derives de thiazole, leur preparation et leur application en therapeutique |
| FR2508909A1 (fr) * | 1981-07-03 | 1983-01-07 | Synthelabo | Derives phenethyles de thiazole, leur preparation et leur application en therapeuthique |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2969369A (en) * | 1959-10-23 | 1961-01-24 | Searle & Co | Derivatives of 3-phenyl-5, 6-dihydroimidazo-[2. 1-b] thiazoles |
-
1969
- 1969-07-11 CH CH1063669A patent/CH513918A/de not_active IP Right Cessation
- 1969-07-14 NO NO02938/69A patent/NO126229B/no unknown
- 1969-07-25 RO RO62702A patent/RO56851A/ro unknown
- 1969-07-29 FR FR6925918A patent/FR2014048A1/fr not_active Withdrawn
- 1969-07-29 OA OA53691A patent/OA03392A/xx unknown
- 1969-07-29 IL IL32724A patent/IL32724A0/xx unknown
- 1969-07-29 BE BE736739A patent/BE736739A/fr unknown
- 1969-07-30 DE DE19691938674 patent/DE1938674A1/de active Pending
- 1969-07-31 NL NL6911687A patent/NL6911687A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10112197A1 (de) * | 2001-03-14 | 2002-09-19 | Gruenenthal Gmbh | Substituierte Pyrazolo- und Thiazolopyrimidine |
| WO2006085118A3 (en) * | 2005-02-08 | 2006-10-19 | Prosidion Ltd | Dihydroimidazothiazole derivatives |
| EA012374B1 (ru) * | 2005-02-08 | 2009-10-30 | Прозидион Лимитед | Производные дигидроимидазотиазола |
Also Published As
| Publication number | Publication date |
|---|---|
| IL32724A0 (en) | 1969-09-25 |
| OA03392A (fr) | 1970-12-15 |
| CH513918A (de) | 1971-10-15 |
| RO56851A (cg-RX-API-DMAC10.html) | 1974-11-11 |
| BE736739A (fr) | 1970-01-29 |
| FR2014048A1 (en) | 1970-04-10 |
| NO126229B (cg-RX-API-DMAC10.html) | 1973-01-08 |
| NL6911687A (cg-RX-API-DMAC10.html) | 1970-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69716062T2 (de) | Benzofuran-derivate und deren verwendung | |
| DE3231255A1 (de) | Tetrazin-derivate, verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammensetzungen | |
| DD146293A5 (de) | Verfahren zur herstellung von 5-(4-pyridyl)-6-(4-fluorphenyl)-2,3-dihydroimidazo eckige klammer auf 2,1-b eckige klammer zu thiazol,seiner salze und seiner oxide | |
| DE1545935A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| EP0041215B1 (de) | Imidazoazolalkensäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| DE1938674A1 (de) | Heterocyclische Verbindungen und Verfahren zu ihrer Herstellung | |
| DE2523103A1 (de) | Neue propargyl-2-phenylamino-imidazoline-(2), deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zur herstellung derselben | |
| DE3542661A1 (de) | Imidazopyridazinalkensaeureamide, verfahren zu ihrer herstellung, zwischenprodukte zu ihrer herstellung | |
| DE1695133A1 (de) | Verfahren zur Herstellung von Imidazolderivaten | |
| DE3877124T2 (de) | Imidazol-derivate, verfahren zu deren herstellung und deren anwendung als alpha-2-adrenoceptor-antagonisten. | |
| DE2413610A1 (de) | Neue heterocyclische verbindungen und verfahren zu deren herstellung | |
| DE2051962A1 (de) | Benzimidazo eckige Klammer auf l,2d eckige Klammer zu eckige Klammer auf 1,4 eckige Klammer zu benzodiazepin 6 (5H) one und Verfahren zu deren Her stellung | |
| DE1695189A1 (de) | Verfahren zur Herstellung von Imidazolderivaten | |
| DE1937459A1 (de) | Neue Pyrimidinderivate und Verfahren zu ihrer Herstellung | |
| DE2140865A1 (de) | 1-imidazolyl-methanphosphonsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE2156046A1 (de) | Verfahren zur Herstellung von 2(2-Hydroxyalkyl)-pyridazin(2H)-3-onen | |
| EP0088323B1 (de) | Imidazothiadiazolalkencarbonsäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| AT304540B (de) | Verfahren zur Herstellung neuer 2-n-Alkyl-3-hydroxy-3-phenyl-2,3,6,7-tetrahydro-5H-thiazolo[3,2-a]pyrimidine bzw. 2-n-Alkyl-3-hydroxy-3-phenyl-2,3,5,6-tetrahydroimidazo[2,1-b]thiazole und ihrer Salze | |
| CH579565A5 (en) | Imidazolin-2-ylamino-2,1,3-benzothiadiazoles prodn. - by cyclising corresp. beta aminoethyl (thio) ureas, active against muscle tremors and rigor | |
| AT377520B (de) | Verfahren zur herstellung des neuen 9-(3-(3,5-cis-dimethylpiperazino)-propyl)-carbacols, von dessen salzen oder solvaten dieser salze | |
| DE2237502A1 (de) | Neue heterocyclische verbindungen und verfahren zu deren herstellung | |
| CH515270A (de) | Verfahren zur Herstellung neuer 2-n-Alkyl-3-hydroxy-3-phenyl-2,3,6,7-tetrahydro-5H-thiazolo-(3,2-a)pyrimidine bzw. 2-n-Alkyl-3-hydroxy-3-phenyl-2,3,5,6-tetrahydroimidazol(2,1-b)thiazole | |
| DE2734866A1 (de) | Neue 1,2-benzisothiazole und verfahren zu ihrer herstellung | |
| CH515271A (de) | Verfahren zur Herstellung neuer 2-n-Alkyl-3-hydroxy-3-phenyl-2,3,6,7-tetrahydro-5H-thiazolo-(3,2-a)pyrimidine bzw. 2-n-Alkyl-3-hydroxy-3-phenyl-2,3,5,6-tetrahydroimidazo(2,1-b)thiazole | |
| DE2238226A1 (de) | Neues verfahren zur herstellung von neuen polycyclischen pentanonen |