DE1919181A1 - 3-[1,2,4-Triazolyl-(1)]-7-aryltriazolylcumarine - Google Patents
3-[1,2,4-Triazolyl-(1)]-7-aryltriazolylcumarineInfo
- Publication number
- DE1919181A1 DE1919181A1 DE19691919181 DE1919181A DE1919181A1 DE 1919181 A1 DE1919181 A1 DE 1919181A1 DE 19691919181 DE19691919181 DE 19691919181 DE 1919181 A DE1919181 A DE 1919181A DE 1919181 A1 DE1919181 A1 DE 1919181A1
- Authority
- DE
- Germany
- Prior art keywords
- triazolyl
- compounds
- coumarin
- aryltriazolyl
- groups
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 claims description 14
- 125000001424 substituent group Chemical group 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000000332 coumarinyl group Chemical group O1C(=O)C(=CC2=CC=CC=C12)* 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 239000000463 material Substances 0.000 claims description 4
- 229920000728 polyester Polymers 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002657 fibrous material Substances 0.000 claims 1
- 229920002994 synthetic fiber Polymers 0.000 claims 1
- -1 triazolyl radical Chemical class 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000007844 bleaching agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000001376 1,2,4-triazolyl group Chemical class N1N=C(N=C1)* 0.000 description 1
- ZYVYEJXMYBUCMN-UHFFFAOYSA-N 1-methoxy-2-methylpropane Chemical compound COCC(C)C ZYVYEJXMYBUCMN-UHFFFAOYSA-N 0.000 description 1
- GOLORTLGFDVFDW-UHFFFAOYSA-N 3-(1h-benzimidazol-2-yl)-7-(diethylamino)chromen-2-one Chemical compound C1=CC=C2NC(C3=CC4=CC=C(C=C4OC3=O)N(CC)CC)=NC2=C1 GOLORTLGFDVFDW-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- KNIUHBNRWZGIQQ-UHFFFAOYSA-N 7-diethoxyphosphinothioyloxy-4-methylchromen-2-one Chemical compound CC1=CC(=O)OC2=CC(OP(=S)(OCC)OCC)=CC=C21 KNIUHBNRWZGIQQ-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- QJXNFFOZBVXQTH-UHFFFAOYSA-N N-[3-hydroxy-4-(phenyliminomethyl)phenyl]acetamide Chemical class OC1=CC(NC(=O)C)=CC=C1C=NC1=CC=CC=C1 QJXNFFOZBVXQTH-UHFFFAOYSA-N 0.000 description 1
- 125000004054 acenaphthylenyl group Chemical group C1(=CC2=CC=CC3=CC=CC1=C23)* 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000005282 brightening Methods 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691919181 DE1919181A1 (de) | 1969-04-16 | 1969-04-16 | 3-[1,2,4-Triazolyl-(1)]-7-aryltriazolylcumarine |
| GB1774470A GB1269004A (en) | 1969-04-16 | 1970-04-14 | 3-[1,2,4-triazolyl-(1)]-7-aryltriazolylcoumarines |
| NL7005432A NL7005432A (enExample) | 1969-04-16 | 1970-04-15 | |
| CH558670A CH528537A (de) | 1969-04-16 | 1970-04-15 | Verfahren zur Herstellung von 3-(1,2,4-Triazolyl-(1))-7-aryltriazolyl-cumarinen |
| FR7013810A FR2043451A5 (enExample) | 1969-04-16 | 1970-04-16 | |
| BE749059D BE749059A (fr) | 1969-04-16 | 1970-04-16 | Agents eclaircissants optiques de la serie des 3-(1,2,4-triazolyl-(1))-7-aryltriazolyl coumarines |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691919181 DE1919181A1 (de) | 1969-04-16 | 1969-04-16 | 3-[1,2,4-Triazolyl-(1)]-7-aryltriazolylcumarine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1919181A1 true DE1919181A1 (de) | 1970-10-22 |
Family
ID=5731303
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691919181 Pending DE1919181A1 (de) | 1969-04-16 | 1969-04-16 | 3-[1,2,4-Triazolyl-(1)]-7-aryltriazolylcumarine |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE749059A (enExample) |
| CH (1) | CH528537A (enExample) |
| DE (1) | DE1919181A1 (enExample) |
| FR (1) | FR2043451A5 (enExample) |
| GB (1) | GB1269004A (enExample) |
| NL (1) | NL7005432A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP2265092A1 (en) | 2002-06-06 | 2010-12-22 | Ciba Holding Inc. | Electroluminescent device |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2925546A1 (de) * | 1979-06-25 | 1981-01-15 | Bayer Ag | Cumarinverbindungen sowie deren herstellung und verwendung als farbstoffe |
-
1969
- 1969-04-16 DE DE19691919181 patent/DE1919181A1/de active Pending
-
1970
- 1970-04-14 GB GB1774470A patent/GB1269004A/en not_active Expired
- 1970-04-15 CH CH558670A patent/CH528537A/de not_active IP Right Cessation
- 1970-04-15 NL NL7005432A patent/NL7005432A/xx unknown
- 1970-04-16 FR FR7013810A patent/FR2043451A5/fr not_active Expired
- 1970-04-16 BE BE749059D patent/BE749059A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP2265092A1 (en) | 2002-06-06 | 2010-12-22 | Ciba Holding Inc. | Electroluminescent device |
| EP2315502A1 (en) | 2002-06-06 | 2011-04-27 | Basf Se | Electroluminescent device |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7005432A (enExample) | 1970-10-20 |
| BE749059A (fr) | 1970-10-01 |
| FR2043451A5 (enExample) | 1971-02-12 |
| CH528537A (de) | 1972-09-30 |
| GB1269004A (en) | 1972-03-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0252406B1 (de) | Verfahren zur Herstellung polycyclischer Verbindungen | |
| DE1794389C3 (de) | Disazofarbstoffe, ihre Herstellung und Verwendung | |
| DE2353987C3 (de) | Verfahren zur Isolierung leichtlöslicher basischer Oxazin- und Phenazinfarbstoffe | |
| DE1300948B (de) | Verfahren zur Herstellung von Benzimidazoliumverbindungen | |
| DE1919181A1 (de) | 3-[1,2,4-Triazolyl-(1)]-7-aryltriazolylcumarine | |
| DE1519468A1 (de) | 3-Pyrazolyl-7-aryltriazolyl-cumarinverbindungen | |
| EP0229980A2 (de) | Verfahren zur Herstellung kationischer Hydrazonfarbstoffe | |
| DE1670969A1 (de) | 3-[Pyrazolyl-(1)]-7-[v-triazolyl-(2)]-cumarine | |
| DE1805371A1 (de) | Optische Bleichmittel,Verfahren zu deren Herstellung sowie deren Anwendung | |
| DE1670999A1 (de) | Triazolyl-cumarine | |
| DE1519471A1 (de) | 3-Phenyl-7-benzotriazolyl-cumarine | |
| EP0005172B1 (de) | Cumarin-Verbindungen und ihre Verwendung als Aufheller für organische hochmolekulare Materialien | |
| DE1670890A1 (de) | Naphthylen-bis-2-benzimidazole,Verfahren zu ihrer Herstellung und ihre Verwendung als optische Aufhellungsmittel | |
| DE1544587A1 (de) | Farbstoff-Eisen-Komplex sowie Verfahren zu seiner Herstellung | |
| DE2010764B2 (de) | 4-(2-Triazolyl)-2-cyan-stilbene | |
| DE2353580C2 (de) | Verfahren zur Herstellung von o-Acylamino-diarylverbindungen | |
| DE2131788C3 (de) | Verfahren zur Herstellung von 7-Pyrazolylcumarinen | |
| EP0186627B1 (de) | Orthonitroaniline und ein Verfahren zu deren Herstellung | |
| DE1795152A1 (de) | Triazolylcumarine | |
| DE2203093C3 (de) | N-(Aminobe nzoyl) -aminoarylsulfonsäuren, deren AlkaHsalze, Verfahren zur Herstellung dieser Verbindungen und Ihre Verwendung | |
| DE2521649A1 (de) | 3-amino-4-carbalkoxybenzoesaeure- 4'-phenoxyanilide, verfahren zu ihrer herstellung und ihre verwendung | |
| DE1917740A1 (de) | 4-v-Triazolyl-4'-phenylstilbene | |
| DE3412731A1 (de) | Aminoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung | |
| DE3914650A1 (de) | Neue phenylendiamine sowie ein verfahren zur herstellung von phenylendiaminen | |
| DE2408012A1 (de) | 4-amino-1,8-naphthalsaeureimid-3-sulfonsaeuren, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |