DE1910005A1 - Verfahren zur kontinuierlichen Herstellung von N.P.- bzw. N.P.K.-Duengemitteln - Google Patents
Verfahren zur kontinuierlichen Herstellung von N.P.- bzw. N.P.K.-DuengemittelnInfo
- Publication number
- DE1910005A1 DE1910005A1 DE19691910005 DE1910005A DE1910005A1 DE 1910005 A1 DE1910005 A1 DE 1910005A1 DE 19691910005 DE19691910005 DE 19691910005 DE 1910005 A DE1910005 A DE 1910005A DE 1910005 A1 DE1910005 A1 DE 1910005A1
- Authority
- DE
- Germany
- Prior art keywords
- gypsum
- amount
- phosphoric acid
- acid
- phosphate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003337 fertilizer Substances 0.000 title claims description 16
- 238000000034 method Methods 0.000 title claims description 13
- 238000010924 continuous production Methods 0.000 title claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 48
- 239000010440 gypsum Substances 0.000 claims description 40
- 229910052602 gypsum Inorganic materials 0.000 claims description 40
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 34
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 30
- 239000002367 phosphate rock Substances 0.000 claims description 30
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 24
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 17
- 229910017604 nitric acid Inorganic materials 0.000 claims description 17
- 239000011575 calcium Substances 0.000 claims description 16
- 238000001556 precipitation Methods 0.000 claims description 15
- 239000000243 solution Substances 0.000 claims description 14
- 239000012452 mother liquor Substances 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 230000029087 digestion Effects 0.000 claims description 10
- 239000000725 suspension Substances 0.000 claims description 8
- 229910052921 ammonium sulfate Inorganic materials 0.000 claims description 7
- 235000011130 ammonium sulphate Nutrition 0.000 claims description 7
- 238000001704 evaporation Methods 0.000 claims description 7
- 230000008020 evaporation Effects 0.000 claims description 7
- 238000006386 neutralization reaction Methods 0.000 claims description 7
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- YYRMJZQKEFZXMX-UHFFFAOYSA-L calcium bis(dihydrogenphosphate) Chemical compound [Ca+2].OP(O)([O-])=O.OP(O)([O-])=O YYRMJZQKEFZXMX-UHFFFAOYSA-L 0.000 claims description 5
- 239000001506 calcium phosphate Substances 0.000 claims description 5
- 238000005469 granulation Methods 0.000 claims description 5
- 230000003179 granulation Effects 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 229910000150 monocalcium phosphate Inorganic materials 0.000 claims description 5
- 235000019691 monocalcium phosphate Nutrition 0.000 claims description 5
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 claims description 5
- 229910052939 potassium sulfate Inorganic materials 0.000 claims description 5
- 235000011151 potassium sulphates Nutrition 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- 238000010790 dilution Methods 0.000 claims description 4
- 239000012895 dilution Substances 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 3
- 239000007788 liquid Substances 0.000 claims description 3
- 238000004064 recycling Methods 0.000 claims description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 238000001226 reprecipitation Methods 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims 2
- 239000002253 acid Substances 0.000 claims 1
- 239000012295 chemical reaction liquid Substances 0.000 claims 1
- 230000029142 excretion Effects 0.000 claims 1
- 238000002156 mixing Methods 0.000 description 10
- 239000002244 precipitate Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 5
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 4
- 101100372509 Mus musculus Vat1 gene Proteins 0.000 description 4
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Inorganic materials [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 4
- 229910004261 CaF 2 Inorganic materials 0.000 description 3
- 239000001166 ammonium sulphate Substances 0.000 description 3
- ZOMBKNNSYQHRCA-UHFFFAOYSA-J calcium sulfate hemihydrate Chemical compound O.[Ca+2].[Ca+2].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZOMBKNNSYQHRCA-UHFFFAOYSA-J 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000011507 gypsum plaster Substances 0.000 description 3
- 239000011505 plaster Substances 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 2
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 2
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 description 2
- 238000010009 beating Methods 0.000 description 2
- 235000019837 monoammonium phosphate Nutrition 0.000 description 2
- 239000006012 monoammonium phosphate Substances 0.000 description 2
- 239000010452 phosphate Substances 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000001120 potassium sulphate Substances 0.000 description 2
- 229910021653 sulphate ion Inorganic materials 0.000 description 2
- -1 sulphate ions Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 101150114468 TUB1 gene Proteins 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B11/00—Fertilisers produced by wet-treating or leaching raw materials either with acids in such amounts and concentrations as to yield solutions followed by neutralisation, or with alkaline lyes
- C05B11/04—Fertilisers produced by wet-treating or leaching raw materials either with acids in such amounts and concentrations as to yield solutions followed by neutralisation, or with alkaline lyes using mineral acid
- C05B11/06—Fertilisers produced by wet-treating or leaching raw materials either with acids in such amounts and concentrations as to yield solutions followed by neutralisation, or with alkaline lyes using mineral acid using nitric acid (nitrophosphates)
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6802841A NL6802841A (enExample) | 1968-02-29 | 1968-02-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1910005A1 true DE1910005A1 (de) | 1969-09-11 |
Family
ID=19802898
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19691910005 Pending DE1910005A1 (de) | 1968-02-29 | 1969-02-27 | Verfahren zur kontinuierlichen Herstellung von N.P.- bzw. N.P.K.-Duengemitteln |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3600154A (enExample) |
| BE (1) | BE729114A (enExample) |
| DE (1) | DE1910005A1 (enExample) |
| FR (1) | FR2002966A1 (enExample) |
| GB (1) | GB1253121A (enExample) |
| NL (1) | NL6802841A (enExample) |
| PL (1) | PL72623B1 (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2623094A1 (de) * | 1974-11-29 | 1977-12-08 | Kemira Oy | Gewinnungsverfahren fuer eine zur herstellung von stickstoff sowie phosphor und eventuell kalium enthaltendem mischduenger (mehrnaehrstoffduenger) geeignete aufschwemmung |
| DE102004055648A1 (de) * | 2004-11-12 | 2006-05-18 | Ami-Agrolinz Melamine International Gmbh | Verfahren und Vorrichtung zur Gewinnung schwefelhaltiger Stickstoffdünger |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7008838A (enExample) * | 1970-06-17 | 1971-12-21 | ||
| US4177053A (en) * | 1973-10-11 | 1979-12-04 | Veba-Chemie Aktiengesellschaft | Method for the production of phosphoric acid with high contents of fertilizer-nutrients |
| US4175944A (en) * | 1978-06-26 | 1979-11-27 | Mobil Oil Corporation | Removal of fluorine during production of fertilizer |
| RU2154045C1 (ru) * | 1999-04-20 | 2000-08-10 | ОАО "Кирово-Чепецкий химический комбинат им.Б.П.Константинова" | Способ получения сложного минерального удобрения |
| RU2167843C2 (ru) * | 2000-08-29 | 2001-05-27 | Открытое акционерное общество "Научно-исследовательский институт по удобрениям и инсектофунгицидам им. Я.В. Самойлова" | Способ получения сложных удобрений |
| RU2234485C1 (ru) * | 2003-08-05 | 2004-08-20 | Открытое Акционерное Общество "Научно-Исследовательский Институт По Удобрениям И Инсектофунгицидам Им. Проф. Я.В. Самойлова" | Способ получения сложных удобрений |
| DE602007003332D1 (de) * | 2006-03-31 | 2009-12-31 | Basf Se | 3-amino-1,2-benzisothiazol-verbindungen zur bekämpfung von tierpest |
| EP2064196B1 (en) * | 2007-01-26 | 2012-03-14 | Basf Se | 3-amino-1,2-benzisothiazole compounds for combating animal pest ii |
| RU2388733C1 (ru) * | 2008-12-04 | 2010-05-10 | Закрытое акционерное общество "Завод минеральных удобрений Кирово-Чепецкого химического комбината" (ЗАО "ЗМУ КЧХК") | Способ получения азотнокислотного раствора бедного фосфатного сырья |
| CN108101586A (zh) * | 2017-12-13 | 2018-06-01 | 贵州芭田生态工程有限公司 | 一种硝酸酸解磷矿冷冻脱钙母液制备硝酸磷肥装置及方法 |
-
1968
- 1968-02-29 NL NL6802841A patent/NL6802841A/xx unknown
-
1969
- 1969-02-27 DE DE19691910005 patent/DE1910005A1/de active Pending
- 1969-02-27 GB GB1253121D patent/GB1253121A/en not_active Expired
- 1969-02-28 PL PL1969132029A patent/PL72623B1/pl unknown
- 1969-02-28 BE BE729114D patent/BE729114A/xx unknown
- 1969-02-28 US US803261*A patent/US3600154A/en not_active Expired - Lifetime
- 1969-03-03 FR FR6905681A patent/FR2002966A1/fr not_active Withdrawn
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2623094A1 (de) * | 1974-11-29 | 1977-12-08 | Kemira Oy | Gewinnungsverfahren fuer eine zur herstellung von stickstoff sowie phosphor und eventuell kalium enthaltendem mischduenger (mehrnaehrstoffduenger) geeignete aufschwemmung |
| DE102004055648A1 (de) * | 2004-11-12 | 2006-05-18 | Ami-Agrolinz Melamine International Gmbh | Verfahren und Vorrichtung zur Gewinnung schwefelhaltiger Stickstoffdünger |
Also Published As
| Publication number | Publication date |
|---|---|
| PL72623B1 (enExample) | 1974-08-30 |
| US3600154A (en) | 1971-08-17 |
| NL6802841A (enExample) | 1969-09-02 |
| BE729114A (enExample) | 1969-08-28 |
| FR2002966A1 (fr) | 1969-11-07 |
| GB1253121A (enExample) | 1971-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE662211C (de) | Herstellung von Phosphorsaeure | |
| DE1910005A1 (de) | Verfahren zur kontinuierlichen Herstellung von N.P.- bzw. N.P.K.-Duengemitteln | |
| DE1283205B (de) | Verfahren zur Herstellung von Calciumnitrat und Phosphaten oder Phosphaten, die als Duenge- und Futtermittel verwendet werden, aus Reaktionsgemischen, die durch Aufschluss von Rohphosphaten mit Salpetersaeure gewonnen werden | |
| DE1947643C3 (de) | Verfahren zur Herstellung von Kaliumdihydrogenphosphat | |
| DE3914796C1 (enExample) | ||
| DE2603652C3 (de) | Kontinuierliches Verfahren zur gleichzeitigen Herstellung von konzentrierter Phosphorsäure oder von Phosphaten und eines granulierten NPK-Düngemittels | |
| DE1959122A1 (de) | Verfahren zur Herstellung von Phosphorsaeure | |
| DE1592599A1 (de) | Verfahren zur Herstellung von Duengemitteln | |
| DE2363096C3 (de) | Verfahren zur Herstellung von Mehrnährstoffdüngern aus Rohphosphaten unter gleichzeitiger Gewinnung von Gips | |
| DE2336254C3 (de) | Verfahren zur Herstellung einer Monokaliumphosphatlösung oder von PK- bzw. NPK-Polymerisationsprodukten | |
| DE970746C (de) | Verfahren zur Herstellung von phosphorsauren Alkalisalzen | |
| DE1567495C3 (de) | Verfahren zur kontinuierlichen Herstellung von Phosphorsäure | |
| DE663253C (de) | Verfahren zur Herstellung von Superphosphat | |
| DE663252C (de) | Verfahren zur Herstellung von Phosphatduengemitteln | |
| DE1592727B1 (de) | Verfahren zur Herstellung eines Mehrnaehrstoffduengemittels mit einem wasserloeslichen P2O5-Anteil | |
| DE2503843A1 (de) | Verfahren zur herstellung von sehr reinen phosphorsaeure-loesungen, ausgehend von roher nassverfahrensphosphorsaeure | |
| DE572057C (de) | Verfahren zur gleichzeitigen Herstellung von Dicalciumphosphat und Nitraten | |
| DE1002009B (de) | Verfahren zur Herstellung von Mehrnaehrstoffduengemitteln mit hohem Gehalt an wasserloeslicher Phosphorsaeure | |
| DE1592776C (de) | Verfahren zur Herstellung von Phosphatdüngemitteln | |
| AT227733B (de) | Kontinuierliches Verfahren zur Herstellung eines Phosphatdüngemittels | |
| DE1902737C3 (de) | Verfahren zur Herstellung von Ammoniumdihydrogenphosphat | |
| DE665773C (de) | Herstellung von Phosphorsaeure | |
| DE1190449B (de) | Verfahren zur Gewinnung eines zur Herstellung von Aluminium geeigneten Kryoliths aus Fluor und Phosphorverbindungen enthaltenden Gasen | |
| DE1233417B (de) | Verfahren zur Herstellung von Mehrnaehrstoffduengemitteln | |
| DE1934953A1 (de) | Verfahren zur Gewinnung von Phosphor-Stickstoff-Duengemittel |