PL72623B1 - - Google Patents
Download PDFInfo
- Publication number
- PL72623B1 PL72623B1 PL1969132029A PL13202969A PL72623B1 PL 72623 B1 PL72623 B1 PL 72623B1 PL 1969132029 A PL1969132029 A PL 1969132029A PL 13202969 A PL13202969 A PL 13202969A PL 72623 B1 PL72623 B1 PL 72623B1
- Authority
- PL
- Poland
- Prior art keywords
- gypsum
- acid
- phase
- potassium
- mother liquor
- Prior art date
Links
- 239000010440 gypsum Substances 0.000 claims description 50
- 229910052602 gypsum Inorganic materials 0.000 claims description 50
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 24
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 22
- 239000002367 phosphate rock Substances 0.000 claims description 17
- 239000003337 fertilizer Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 13
- 229910017604 nitric acid Inorganic materials 0.000 claims description 13
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 12
- 239000011575 calcium Substances 0.000 claims description 9
- 239000012452 mother liquor Substances 0.000 claims description 7
- 239000002002 slurry Substances 0.000 claims description 7
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 claims description 6
- 229910052921 ammonium sulfate Inorganic materials 0.000 claims description 6
- 235000011130 ammonium sulphate Nutrition 0.000 claims description 6
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 claims description 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 5
- 229910052791 calcium Inorganic materials 0.000 claims description 5
- YUWBVKYVJWNVLE-UHFFFAOYSA-N [N].[P] Chemical compound [N].[P] YUWBVKYVJWNVLE-UHFFFAOYSA-N 0.000 claims description 4
- 239000001166 ammonium sulphate Substances 0.000 claims description 4
- 238000001704 evaporation Methods 0.000 claims description 4
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 claims description 4
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 claims description 4
- 229910052939 potassium sulfate Inorganic materials 0.000 claims description 4
- 235000011151 potassium sulphates Nutrition 0.000 claims description 4
- 239000007787 solid Substances 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 3
- 230000008020 evaporation Effects 0.000 claims description 3
- 238000001556 precipitation Methods 0.000 claims description 3
- 229910021653 sulphate ion Inorganic materials 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 2
- 239000012295 chemical reaction liquid Substances 0.000 claims description 2
- 238000011437 continuous method Methods 0.000 claims description 2
- 238000005469 granulation Methods 0.000 claims description 2
- 230000003179 granulation Effects 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- 239000000203 mixture Substances 0.000 claims 1
- 238000006386 neutralization reaction Methods 0.000 claims 1
- ZDHURYWHEBEGHO-UHFFFAOYSA-N potassiopotassium Chemical compound [K].[K] ZDHURYWHEBEGHO-UHFFFAOYSA-N 0.000 claims 1
- 238000011084 recovery Methods 0.000 claims 1
- 238000012216 screening Methods 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 235000001508 sulfur Nutrition 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 4
- 101100372509 Mus musculus Vat1 gene Proteins 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000001120 potassium sulphate Substances 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 102100032986 CCR4-NOT transcription complex subunit 8 Human genes 0.000 description 1
- 101000942586 Homo sapiens CCR4-NOT transcription complex subunit 8 Proteins 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 101000912874 Schizosaccharomyces pombe (strain 972 / ATCC 24843) Iron-sensing transcriptional repressor Proteins 0.000 description 1
- XXIKDZHDQMWROA-UHFFFAOYSA-N [N+](=O)([O-])[O-].[Ca+2].P(O)(O)(O)=O.[N+](=O)([O-])[O-] Chemical compound [N+](=O)([O-])[O-].[Ca+2].P(O)(O)(O)=O.[N+](=O)([O-])[O-] XXIKDZHDQMWROA-UHFFFAOYSA-N 0.000 description 1
- WZLMXYBCAZZIRQ-UHFFFAOYSA-N [N].[P].[K] Chemical compound [N].[P].[K] WZLMXYBCAZZIRQ-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 1
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-L calcium bis(dihydrogenphosphate) Chemical compound [Ca+2].OP(O)([O-])=O.OP(O)([O-])=O YYRMJZQKEFZXMX-UHFFFAOYSA-L 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 229910001634 calcium fluoride Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000019837 monoammonium phosphate Nutrition 0.000 description 1
- 239000006012 monoammonium phosphate Substances 0.000 description 1
- 229910000150 monocalcium phosphate Inorganic materials 0.000 description 1
- 235000019691 monocalcium phosphate Nutrition 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- -1 sulphate ions Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05B—PHOSPHATIC FERTILISERS
- C05B11/00—Fertilisers produced by wet-treating or leaching raw materials either with acids in such amounts and concentrations as to yield solutions followed by neutralisation, or with alkaline lyes
- C05B11/04—Fertilisers produced by wet-treating or leaching raw materials either with acids in such amounts and concentrations as to yield solutions followed by neutralisation, or with alkaline lyes using mineral acid
- C05B11/06—Fertilisers produced by wet-treating or leaching raw materials either with acids in such amounts and concentrations as to yield solutions followed by neutralisation, or with alkaline lyes using mineral acid using nitric acid (nitrophosphates)
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
- Compounds Of Alkaline-Earth Elements, Aluminum Or Rare-Earth Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL6802841A NL6802841A (enExample) | 1968-02-29 | 1968-02-29 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL72623B1 true PL72623B1 (enExample) | 1974-08-30 |
Family
ID=19802898
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969132029A PL72623B1 (enExample) | 1968-02-29 | 1969-02-28 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3600154A (enExample) |
| BE (1) | BE729114A (enExample) |
| DE (1) | DE1910005A1 (enExample) |
| FR (1) | FR2002966A1 (enExample) |
| GB (1) | GB1253121A (enExample) |
| NL (1) | NL6802841A (enExample) |
| PL (1) | PL72623B1 (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7008838A (enExample) * | 1970-06-17 | 1971-12-21 | ||
| US4177053A (en) * | 1973-10-11 | 1979-12-04 | Veba-Chemie Aktiengesellschaft | Method for the production of phosphoric acid with high contents of fertilizer-nutrients |
| FI50964C (fi) * | 1974-11-29 | 1976-09-10 | Kemira Oy | Menetelmä typpeä sekä fosforia ja mahdollisesti kaliumia sisältävän se oslannoitteen valmistukseen soveltuvan lietteen valmistamiseksi. |
| US4175944A (en) * | 1978-06-26 | 1979-11-27 | Mobil Oil Corporation | Removal of fluorine during production of fertilizer |
| RU2154045C1 (ru) * | 1999-04-20 | 2000-08-10 | ОАО "Кирово-Чепецкий химический комбинат им.Б.П.Константинова" | Способ получения сложного минерального удобрения |
| RU2167843C2 (ru) * | 2000-08-29 | 2001-05-27 | Открытое акционерное общество "Научно-исследовательский институт по удобрениям и инсектофунгицидам им. Я.В. Самойлова" | Способ получения сложных удобрений |
| RU2234485C1 (ru) * | 2003-08-05 | 2004-08-20 | Открытое Акционерное Общество "Научно-Исследовательский Институт По Удобрениям И Инсектофунгицидам Им. Проф. Я.В. Самойлова" | Способ получения сложных удобрений |
| DE102004055648A1 (de) * | 2004-11-12 | 2006-05-18 | Ami-Agrolinz Melamine International Gmbh | Verfahren und Vorrichtung zur Gewinnung schwefelhaltiger Stickstoffdünger |
| DE602007003332D1 (de) * | 2006-03-31 | 2009-12-31 | Basf Se | 3-amino-1,2-benzisothiazol-verbindungen zur bekämpfung von tierpest |
| EP2064196B1 (en) * | 2007-01-26 | 2012-03-14 | Basf Se | 3-amino-1,2-benzisothiazole compounds for combating animal pest ii |
| RU2388733C1 (ru) * | 2008-12-04 | 2010-05-10 | Закрытое акционерное общество "Завод минеральных удобрений Кирово-Чепецкого химического комбината" (ЗАО "ЗМУ КЧХК") | Способ получения азотнокислотного раствора бедного фосфатного сырья |
| CN108101586A (zh) * | 2017-12-13 | 2018-06-01 | 贵州芭田生态工程有限公司 | 一种硝酸酸解磷矿冷冻脱钙母液制备硝酸磷肥装置及方法 |
-
1968
- 1968-02-29 NL NL6802841A patent/NL6802841A/xx unknown
-
1969
- 1969-02-27 DE DE19691910005 patent/DE1910005A1/de active Pending
- 1969-02-27 GB GB1253121D patent/GB1253121A/en not_active Expired
- 1969-02-28 PL PL1969132029A patent/PL72623B1/pl unknown
- 1969-02-28 BE BE729114D patent/BE729114A/xx unknown
- 1969-02-28 US US803261*A patent/US3600154A/en not_active Expired - Lifetime
- 1969-03-03 FR FR6905681A patent/FR2002966A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| DE1910005A1 (de) | 1969-09-11 |
| US3600154A (en) | 1971-08-17 |
| NL6802841A (enExample) | 1969-09-02 |
| BE729114A (enExample) | 1969-08-28 |
| FR2002966A1 (fr) | 1969-11-07 |
| GB1253121A (enExample) | 1971-11-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL72623B1 (enExample) | ||
| US1836672A (en) | Method of leaching phosphate rock | |
| CA1261116A (en) | Process of removing cationic impurities from wet process phosphoric acid | |
| EP0396043B1 (de) | Verfahren zur Herstellung von Kaliummagnesiumphosphat | |
| DE1283205B (de) | Verfahren zur Herstellung von Calciumnitrat und Phosphaten oder Phosphaten, die als Duenge- und Futtermittel verwendet werden, aus Reaktionsgemischen, die durch Aufschluss von Rohphosphaten mit Salpetersaeure gewonnen werden | |
| DE2603652B2 (de) | Kontinuierliches Verfahren zur gleichzeitigen Herstellung von konzentrierter Phosphorsäure oder von Phosphaten und eines granulierten NPK-Düngemittels | |
| PL124240B1 (en) | Method of manufacture of mixed fertilizers | |
| NO136419B (enExample) | ||
| US2879152A (en) | Manufacture of fertilizers | |
| DE955772C (de) | Verfahren zur Herstellung von Phosphorsaeure, Kali und Stickstoff enthaltenden Duengemitteln | |
| PL11447B1 (pl) | Sposób lugowania fosforanu surowego. | |
| US3429686A (en) | Method of precipitating calcium sulfate from an acidulated phosphate rock slurry | |
| RU2680269C1 (ru) | Способ переработки фосфогипса на азотно-фосфорное удобрение | |
| AT227734B (de) | Kontinuierliches Verfahren zur Herstellung eines Phosphatdüngemittels | |
| DE572057C (de) | Verfahren zur gleichzeitigen Herstellung von Dicalciumphosphat und Nitraten | |
| AT227733B (de) | Kontinuierliches Verfahren zur Herstellung eines Phosphatdüngemittels | |
| CN121472605A (zh) | 一种从伴生稀土磷矿中综合回收磷肥和稀土的方法 | |
| GB1153176A (en) | Fertilizers | |
| PL19584B1 (pl) | Sposób przeróbki surowych fosforanów. | |
| PL66158B1 (enExample) | ||
| EA030576B1 (ru) | Фосфор-калий-азотсодержащее npk-удобрение и способ получения гранулированного фосфор-калий-азотсодержащего npk-удобрения | |
| PL53460B1 (enExample) | ||
| SU1747431A1 (ru) | Способ получени жидких комплексных удобрений | |
| SU1020416A1 (ru) | Способ получени сложного удобрени | |
| SU1458358A1 (ru) | Способ получени сложных минеральных удобрений |