DE1808681A1 - Verfahren zum Herstellen von Salicylaniliden - Google Patents
Verfahren zum Herstellen von SalicylanilidenInfo
- Publication number
- DE1808681A1 DE1808681A1 DE19681808681 DE1808681A DE1808681A1 DE 1808681 A1 DE1808681 A1 DE 1808681A1 DE 19681808681 DE19681808681 DE 19681808681 DE 1808681 A DE1808681 A DE 1808681A DE 1808681 A1 DE1808681 A1 DE 1808681A1
- Authority
- DE
- Germany
- Prior art keywords
- chloro
- aniline
- isocyanate
- phosgene
- salicylanilide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 25
- 230000008569 process Effects 0.000 title claims description 6
- -1 trifluoromethylphenylthio Chemical group 0.000 claims description 48
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 28
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 18
- 229950000975 salicylanilide Drugs 0.000 claims description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- WKEDVNSFRWHDNR-UHFFFAOYSA-N salicylanilide Chemical compound OC1=CC=CC=C1C(=O)NC1=CC=CC=C1 WKEDVNSFRWHDNR-UHFFFAOYSA-N 0.000 claims description 14
- 239000012948 isocyanate Substances 0.000 claims description 13
- 150000002513 isocyanates Chemical class 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000011065 in-situ storage Methods 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 150000002989 phenols Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 claims description 5
- FAXWFCTVSHEODL-UHFFFAOYSA-N 2,4-dibromophenol Chemical compound OC1=CC=C(Br)C=C1Br FAXWFCTVSHEODL-UHFFFAOYSA-N 0.000 claims description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- 159000000000 sodium salts Chemical class 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 150000002540 isothiocyanates Chemical class 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000001188 haloalkyl group Chemical group 0.000 claims description 2
- 239000013067 intermediate product Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- WHNNFTDRBPUVBH-UHFFFAOYSA-N 4-[2-(trifluoromethyl)phenyl]sulfanylaniline Chemical compound FC(C1=C(C=CC=C1)SC1=CC=C(N)C=C1)(F)F WHNNFTDRBPUVBH-UHFFFAOYSA-N 0.000 claims 1
- 241000188250 Idas Species 0.000 claims 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 claims 1
- 239000003513 alkali Substances 0.000 claims 1
- 229910052783 alkali metal Inorganic materials 0.000 claims 1
- 150000001340 alkali metals Chemical class 0.000 claims 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 1
- 150000001342 alkaline earth metals Chemical class 0.000 claims 1
- 125000004414 alkyl thio group Chemical group 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 150000001721 carbon Chemical group 0.000 claims 1
- ZBKFYXZXZJPWNQ-UHFFFAOYSA-N isothiocyanate group Chemical group [N-]=C=S ZBKFYXZXZJPWNQ-UHFFFAOYSA-N 0.000 claims 1
- 229910052987 metal hydride Inorganic materials 0.000 claims 1
- 150000004681 metal hydrides Chemical class 0.000 claims 1
- 229910000000 metal hydroxide Inorganic materials 0.000 claims 1
- 150000004692 metal hydroxides Chemical class 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 27
- 239000002904 solvent Substances 0.000 description 16
- 238000006243 chemical reaction Methods 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 11
- 125000003277 amino group Chemical group 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 150000003931 anilides Chemical class 0.000 description 7
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 6
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 5
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZDPIFFNPJSYUJG-UHFFFAOYSA-N [Na].BrC1=C(C=CC(=C1)Br)O Chemical compound [Na].BrC1=C(C=CC(=C1)Br)O ZDPIFFNPJSYUJG-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 229940117389 dichlorobenzene Drugs 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000242711 Fasciola hepatica Species 0.000 description 2
- 208000030852 Parasitic disease Diseases 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 125000000950 dibromo group Chemical group Br* 0.000 description 2
- 208000006275 fascioliasis Diseases 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VNHGETRQQSYUGZ-UHFFFAOYSA-N 1-nitro-2-phenoxybenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1OC1=CC=CC=C1 VNHGETRQQSYUGZ-UHFFFAOYSA-N 0.000 description 1
- FNAKEOXYWBWIRT-UHFFFAOYSA-N 2,3-dibromophenol Chemical compound OC1=CC=CC(Br)=C1Br FNAKEOXYWBWIRT-UHFFFAOYSA-N 0.000 description 1
- DAHRRUMUNVQEOB-UHFFFAOYSA-N 2,4-diiodophenol Chemical compound OC1=CC=C(I)C=C1I DAHRRUMUNVQEOB-UHFFFAOYSA-N 0.000 description 1
- VUEVZDKXGIAABF-UHFFFAOYSA-N 3-chloro-4-(4-methoxyphenoxy)aniline Chemical compound C1=CC(OC)=CC=C1OC1=CC=C(N)C=C1Cl VUEVZDKXGIAABF-UHFFFAOYSA-N 0.000 description 1
- DDTQHROTTBWWTI-UHFFFAOYSA-N 3-chloro-4-(4-methylphenoxy)aniline Chemical compound C1=CC(C)=CC=C1OC1=CC=C(N)C=C1Cl DDTQHROTTBWWTI-UHFFFAOYSA-N 0.000 description 1
- 241000415078 Anemone hepatica Species 0.000 description 1
- 241000157302 Bison bison athabascae Species 0.000 description 1
- 244000228957 Ferula foetida Species 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 244000025221 Humulus lupulus Species 0.000 description 1
- 235000008694 Humulus lupulus Nutrition 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000242541 Trematoda Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- NLIZFJSBNTXDBL-UHFFFAOYSA-N acetyl acetate;nitric acid Chemical compound O[N+]([O-])=O.CC(=O)OC(C)=O NLIZFJSBNTXDBL-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000000507 anthelmentic effect Effects 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- ZCILODAAHLISPY-UHFFFAOYSA-N biphenyl ether Natural products C1=C(CC=C)C(O)=CC(OC=2C(=CC(CC=C)=CC=2)O)=C1 ZCILODAAHLISPY-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007769 metal material Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- UNNFUOQPVNQPFU-UHFFFAOYSA-N n-phenyl-2-sulfanylbenzamide Chemical compound SC1=CC=CC=C1C(=O)NC1=CC=CC=C1 UNNFUOQPVNQPFU-UHFFFAOYSA-N 0.000 description 1
- 150000005181 nitrobenzenes Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- MLFGJTKJZBBWCT-UHFFFAOYSA-N oxo-(2-phenylphenyl)-sulfidoazanium Chemical compound C1(=CC=CC=C1)C1=C(C=CC=C1)[N+](=S)[O-] MLFGJTKJZBBWCT-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 1
- 229940031826 phenolate Drugs 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C265/00—Derivatives of isocyanic acid
- C07C265/12—Derivatives of isocyanic acid having isocyanate groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US68496767A | 1967-11-22 | 1967-11-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1808681A1 true DE1808681A1 (de) | 1969-07-17 |
Family
ID=24750249
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681808681 Pending DE1808681A1 (de) | 1967-11-22 | 1968-11-13 | Verfahren zum Herstellen von Salicylaniliden |
Country Status (6)
| Country | Link |
|---|---|
| BR (1) | BR6804170D0 (enrdf_load_stackoverflow) |
| DE (1) | DE1808681A1 (enrdf_load_stackoverflow) |
| DK (1) | DK127553B (enrdf_load_stackoverflow) |
| ES (1) | ES360381A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1221257A (enrdf_load_stackoverflow) |
| NL (1) | NL6815873A (enrdf_load_stackoverflow) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1226041B (de) * | 1965-05-07 | 1966-09-29 | Esterer A G Maschf | Vorrichtung zum Transport von Langgut |
| DE3510797A1 (de) * | 1984-03-26 | 1985-10-03 | Kabushiki Kaisha Toshiba, Kawasaki, Kanagawa | Transportsystem |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7012496A (enrdf_load_stackoverflow) * | 1969-09-08 | 1971-03-10 | ||
| CZ298498B6 (cs) * | 2005-05-26 | 2007-10-17 | Universita Karlova v Praze, Farmaceutická fakultav Hradci Králové | Zpusob prípravy thiosalicylamidu, zejména thiosalicylanilidu |
| CZ2005337A3 (cs) * | 2005-05-26 | 2007-01-10 | Universita Karlova v Praze, Farmaceutická fakulta v Hradci Králové | Antimykotické a antimykobakteriální thiosalicylanilidy a způsob jejich přípravy |
-
1968
- 1968-11-07 NL NL6815873A patent/NL6815873A/xx unknown
- 1968-11-13 DE DE19681808681 patent/DE1808681A1/de active Pending
- 1968-11-18 ES ES360381A patent/ES360381A1/es not_active Expired
- 1968-11-18 GB GB5465968A patent/GB1221257A/en not_active Expired
- 1968-11-20 BR BR20417068A patent/BR6804170D0/pt unknown
-
1970
- 1970-11-20 DK DK590270A patent/DK127553B/da unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1226041B (de) * | 1965-05-07 | 1966-09-29 | Esterer A G Maschf | Vorrichtung zum Transport von Langgut |
| DE3510797A1 (de) * | 1984-03-26 | 1985-10-03 | Kabushiki Kaisha Toshiba, Kawasaki, Kanagawa | Transportsystem |
| US4919054A (en) * | 1984-03-26 | 1990-04-24 | Kabushiki Kaisha Toshiba | Conveying apparatus |
Also Published As
| Publication number | Publication date |
|---|---|
| BR6804170D0 (pt) | 1973-01-16 |
| GB1221257A (en) | 1971-02-03 |
| ES360381A1 (es) | 1970-07-01 |
| NL6815873A (enrdf_load_stackoverflow) | 1969-05-27 |
| DK127553B (da) | 1973-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1418217A1 (de) | Verfahren zur Herstellung von neuen Arylsulfonarylamiden | |
| DE1493856A1 (de) | Verfahren zur Herstellung von optisch aktiven Verbindungen | |
| DE3008908C2 (enrdf_load_stackoverflow) | ||
| DE2242519C2 (de) | Verfahren zur Herstellung von gegebenenfalls im Kern substituierten chlorierten Diphenylethern | |
| DE1808681A1 (de) | Verfahren zum Herstellen von Salicylaniliden | |
| DE2129200A1 (de) | Verfahren zur Herstellung von N-Arylharnstoffen | |
| DE1668805A1 (de) | Verfahren zur Herstellung von Isocyanatophenolen | |
| EP0432135A1 (de) | Zwischenprodukte für Benzoylphenylharnstoffe | |
| DE3209878A1 (de) | Verfahren zur herstellung von diphenylaethern | |
| DE1290147B (de) | Verfahren zur Herstellung von 4, 4-Dinitrodiphenylaethern | |
| DE1808679A1 (de) | Verfahren zum Herstellen von Salicylaniliden | |
| DE1593871A1 (de) | Verfahren zur Herstellung von Nitroaminodiarylaethern | |
| DE1518417A1 (de) | Verfahren zur Herstellung von 4,4'-Bis (aminophenyl)methan | |
| DE1174768B (de) | Verfahren zur Herstellung von 4-Nitrostilbenen | |
| DE2417669A1 (de) | Verfahren zur herstellung von n(halogenaryl)-n',n'-dialkylamidinen | |
| DE1670711A1 (de) | Verfahren zur Herstellung von Thionothiolphosphor-(-phosphon-,-phosphin-)saeureestern | |
| DE1933525A1 (de) | Verfahren zur Herstellung von chlor- und/oder cyansubstituierten Hydroxybenzonitrilen oder deren Alkali- oder Erdalkalisalzen | |
| DE1810821A1 (de) | Verfahren zum Herstellen halogenierter Salicylanilide | |
| DE2214061A1 (de) | Seitenkettenfluorierte benzonitrile | |
| AT209894B (de) | Verfahren zur Herstellung von neuen Anthranilsäurederivaten | |
| DE3241114A1 (de) | Verfahren zur herstellung von 1-amino-1,3,5-triazin-2,4-(1h,3h)dionen | |
| AT318598B (de) | Verfahren zur Herstellung von neuen 2-Nitroindan-1,3-dionderivaten | |
| DE1200313B (de) | Verfahren zur Herstellung von 3, 5-Dioxo-1, 2, 4-triazolidinen | |
| AT222112B (de) | Verfahren zur Herstellung von Mono- und Bis-glyoxalen | |
| AT272353B (de) | Verfahren zur Herstellung von basisch substituierten Phthalazonen sowie ihren Salzen und quaternären Ammoniumverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SH | Request for examination between 03.10.1968 and 22.04.1971 |