DE1793779A1 - Verfahren zur herstellung von (+)-2amino-1-butanol-(+)-hydrogentartrat - Google Patents
Verfahren zur herstellung von (+)-2amino-1-butanol-(+)-hydrogentartratInfo
- Publication number
- DE1793779A1 DE1793779A1 DE19681793779 DE1793779A DE1793779A1 DE 1793779 A1 DE1793779 A1 DE 1793779A1 DE 19681793779 DE19681793779 DE 19681793779 DE 1793779 A DE1793779 A DE 1793779A DE 1793779 A1 DE1793779 A1 DE 1793779A1
- Authority
- DE
- Germany
- Prior art keywords
- amino
- butanol
- hydrogen tartrate
- aqueous solution
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- JCBPETKZIGVZRE-BYPYZUCNSA-N (2s)-2-aminobutan-1-ol Chemical compound CC[C@H](N)CO JCBPETKZIGVZRE-BYPYZUCNSA-N 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 33
- UVRLVWTYHIFQPQ-UHFFFAOYSA-N 4-(2-aminobutoxy)-2,3-dihydroxy-4-oxobutanoic acid Chemical compound C(=O)(O)C(O)C(O)C(=O)OCC(CC)N UVRLVWTYHIFQPQ-UHFFFAOYSA-N 0.000 claims description 19
- 238000009835 boiling Methods 0.000 claims description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- 238000003756 stirring Methods 0.000 claims description 11
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 8
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 8
- 238000001816 cooling Methods 0.000 claims description 8
- 239000007864 aqueous solution Substances 0.000 claims description 7
- JCBPETKZIGVZRE-UHFFFAOYSA-N 2-aminobutan-1-ol Chemical compound CCC(N)CO JCBPETKZIGVZRE-UHFFFAOYSA-N 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 4
- 238000002156 mixing Methods 0.000 claims description 3
- 235000002906 tartaric acid Nutrition 0.000 claims description 3
- 239000011975 tartaric acid Substances 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000013078 crystal Substances 0.000 claims description 2
- OZHIYEINSCNALY-UHFFFAOYSA-N 1-aminobutan-1-ol Chemical compound CCCC(N)O OZHIYEINSCNALY-UHFFFAOYSA-N 0.000 claims 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-M L-tartrate(1-) Chemical compound OC(=O)[C@H](O)[C@@H](O)C([O-])=O FEWJPZIEWOKRBE-JCYAYHJZSA-M 0.000 claims 1
- 238000001640 fractional crystallisation Methods 0.000 claims 1
- -1 methyl- Chemical group 0.000 claims 1
- 238000000746 purification Methods 0.000 claims 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 14
- AEUTYOVWOVBAKS-UWVGGRQHSA-N ethambutol Chemical compound CC[C@@H](CO)NCCN[C@@H](CC)CO AEUTYOVWOVBAKS-UWVGGRQHSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 14
- 229960000285 ethambutol Drugs 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000005119 centrifugation Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 235000019441 ethanol Nutrition 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 159000000007 calcium salts Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- DYLZFGAHXMXPCS-UHFFFAOYSA-N 4-(1-aminobutoxy)-2,3-dihydroxy-4-oxobutanoic acid Chemical compound C(=O)(O)C(O)C(O)C(=O)OC(CCC)N DYLZFGAHXMXPCS-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 206010029350 Neurotoxicity Diseases 0.000 description 1
- 206010044221 Toxic encephalopathy Diseases 0.000 description 1
- 229940121383 antituberculosis agent Drugs 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007135 neurotoxicity Effects 0.000 description 1
- 231100000228 neurotoxicity Toxicity 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 239000000814 tuberculostatic agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/14—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic the nitrogen atom of the amino group being further bound to hydrocarbon groups substituted by amino groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB18491/68A GB1198923A (en) | 1968-04-18 | 1968-04-18 | Process for the Preparation of the Dextrorotatory 2, 2', (Ethylenediimino)-di-1-butanoldihydrochloride |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1793779A1 true DE1793779A1 (de) | 1975-01-09 |
Family
ID=10113339
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681768610 Pending DE1768610B2 (de) | 1968-04-18 | 1968-06-06 | Verfahren zur herstellung von sehr reinem, pharmazeutisch geeignetem rechtsdrehenden 2,2'-(aethylendiimin)di-1-butanol-dihydrochlorid |
| DE19681793779 Pending DE1793779A1 (de) | 1968-04-18 | 1968-06-06 | Verfahren zur herstellung von (+)-2amino-1-butanol-(+)-hydrogentartrat |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681768610 Pending DE1768610B2 (de) | 1968-04-18 | 1968-06-06 | Verfahren zur herstellung von sehr reinem, pharmazeutisch geeignetem rechtsdrehenden 2,2'-(aethylendiimin)di-1-butanol-dihydrochlorid |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3579587A (Direct) |
| AT (1) | AT281786B (Direct) |
| BE (1) | BE729463A (Direct) |
| BG (1) | BG20783A3 (Direct) |
| BR (1) | BR6907187D0 (Direct) |
| CH (1) | CH496654A (Direct) |
| CS (1) | CS158241B2 (Direct) |
| DE (2) | DE1768610B2 (Direct) |
| ES (1) | ES362444A1 (Direct) |
| GB (1) | GB1198923A (Direct) |
| IL (1) | IL31704A (Direct) |
| NL (1) | NL150427B (Direct) |
| OA (1) | OA03019A (Direct) |
| PL (1) | PL81001B1 (Direct) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5318006B2 (Direct) * | 1973-09-28 | 1978-06-13 | ||
| US3944616A (en) * | 1974-10-29 | 1976-03-16 | American Cyanamid Company | Purification of d,d'-2,2'(ethylenediimino)di-1-butanol dihydrochloride |
| US3944618A (en) * | 1976-02-20 | 1976-03-16 | American Cyanamid Company | Synthesis of ethambutol |
| DE2933895A1 (de) * | 1979-08-22 | 1981-03-12 | Basf Ag, 6700 Ludwigshafen | Verfahren zur spaltung racemischer aepfelsaeure. |
| US7456222B2 (en) | 2002-05-17 | 2008-11-25 | Sequella, Inc. | Anti tubercular drug: compositions and methods |
| CN101404986B (zh) * | 2002-05-17 | 2011-09-28 | 赛奎拉公司 | 用于诊断和治疗感染性疾病的组合物和制药方法 |
| US20040033986A1 (en) * | 2002-05-17 | 2004-02-19 | Protopopova Marina Nikolaevna | Anti tubercular drug: compositions and methods |
| WO2005034857A2 (en) * | 2003-09-05 | 2005-04-21 | Sequella, Inc. | Methods and compositions comprising diamines as new anti-tubercular therapeutics |
| US20090281054A1 (en) * | 2008-05-06 | 2009-11-12 | Venkata Reddy | Compositions and methods comprising capuramycin analogues |
| CN103772214B (zh) * | 2012-10-25 | 2016-04-20 | 北大方正集团有限公司 | 制备乙胺丁醇和盐酸乙胺丁醇的方法 |
-
1968
- 1968-04-18 GB GB18491/68A patent/GB1198923A/en not_active Expired
- 1968-06-06 DE DE19681768610 patent/DE1768610B2/de active Pending
- 1968-06-06 DE DE19681793779 patent/DE1793779A1/de active Pending
- 1968-10-23 AT AT1031368A patent/AT281786B/de active
- 1968-11-13 US US775536A patent/US3579587A/en not_active Expired - Lifetime
- 1968-11-26 CH CH1761868A patent/CH496654A/fr not_active IP Right Cessation
-
1969
- 1969-01-13 ES ES362444A patent/ES362444A1/es not_active Expired
- 1969-02-27 IL IL31704A patent/IL31704A/en unknown
- 1969-03-06 BE BE729463D patent/BE729463A/xx unknown
- 1969-03-13 NL NL696903892A patent/NL150427B/xx unknown
- 1969-03-14 BR BR207187/69A patent/BR6907187D0/pt unknown
- 1969-03-15 OA OA53546A patent/OA03019A/xx unknown
- 1969-03-17 BG BG011858A patent/BG20783A3/xx unknown
- 1969-03-21 CS CS204369A patent/CS158241B2/cs unknown
- 1969-04-17 PL PL1969132994A patent/PL81001B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6903892A (Direct) | 1969-10-21 |
| OA03019A (fr) | 1970-12-15 |
| DE1768610A1 (de) | 1971-11-11 |
| BR6907187D0 (pt) | 1973-03-13 |
| ES362444A1 (es) | 1970-09-01 |
| BE729463A (Direct) | 1969-08-18 |
| CS158241B2 (Direct) | 1974-10-15 |
| DE1768610B2 (de) | 1973-07-26 |
| US3579587A (en) | 1971-05-18 |
| IL31704A (en) | 1972-08-30 |
| IL31704A0 (en) | 1969-04-30 |
| BG20783A3 (bg) | 1975-12-20 |
| NL150427B (nl) | 1976-08-16 |
| PL81001B1 (Direct) | 1975-08-30 |
| GB1198923A (en) | 1970-07-15 |
| AT281786B (de) | 1970-06-10 |
| CH496654A (fr) | 1970-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1793779A1 (de) | Verfahren zur herstellung von (+)-2amino-1-butanol-(+)-hydrogentartrat | |
| DE887651C (de) | Verfahren zur Herstellung von Aminoketonen | |
| DE1768612A1 (de) | Verfahren zur Herstellung von sehr reinem,pharmazeutisch geeignetem rechtsdrehenden 2,2'-(AEthylendiimin)-di-1-butanoldihydrochlorid | |
| DE2501957C2 (de) | Verfahren zur Gewinnung von optisch aktivem p-Hydroxyphenylglycin | |
| DE2750376C2 (Direct) | ||
| EP0029175A1 (de) | Verfahren zur Gewinnung der enantiomeren Formen von 4-Cyan-1-(N-methyl-N-(2'-((3",4"-dimethoxyphenyl))-ethyl)-amino)-5-methyl-4-(3',4',5'-trimethoxyphenyl)-hexan und dessen Salzen | |
| EP0608693A2 (de) | Verfahren zur Herstellung von Folsäure | |
| DE69001461T2 (de) | Stereoisomere. | |
| DE2023426C3 (de) | Verfahren zur Spaltung von dlalpha-Phenyl-beta-(niederalkyl-phenyl)äthylamin-Racematen in ihre optischen Antipoden | |
| CH495950A (de) | Verfahren zur Herstellung von neuen racemischen oder optisch aktiven 1-Nitrilophenoxy- oder 1-Alkinyloxyphenoxy-2-hydroxy-3-tert.-butylaminopropanen und deren Salzen | |
| DE697661C (de) | Verfahren zur Herstellung N-alkylierter ª‰-(p-Oxyphenyl)-isopropylamine | |
| DE2605567C3 (de) | Verfahren zur Gewinnung von optisch aktivem a Phenylglycin-hydrochlorid | |
| AT309395B (de) | Verfahren zur Herstellung von (+)-2,2'-(Äthylendiimino)-di-1-butanol-dihydrochlorid | |
| AT371804B (de) | Verfahren zur herstellung von s-methyl-methionin- sulfonium-salzen | |
| AT222814B (de) | Verfahren zur Herstellung von optisch aktiven Tropasäuren | |
| DE2032097C (de) | Verfahren zur Abtrennung von (+)trans-Chrysanthemummonocarbonsäure aus (+)-trans-Chrysanthemummonocarbonsäure | |
| DE2628042B2 (de) | 3-Amino-tricyclo [53.1.0.3A1 -undecan, dessen Säureadditionssalze und Verfahren zur Herstellung dieser Verbindungen | |
| DE1693190C3 (de) | Durch Alkylsulfonyloxyäthylamino-Gruppen disubstituierte Alkane und Hydroxyalkane, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische Präparate | |
| AT282595B (de) | Verfahren zur herstellung von neuem racemischem oder optisch aktivem (1-2'-nitrilophenoxy)-2-hydroxy-3-isopropylaminopropan und dessen salzen | |
| DE1543811C (de) | Verfahren zur Trennung von racemi schem Carmtinnitril m seine optisch akti ven Antipoden | |
| AT269835B (de) | Verfahren zur Herstellung von neuen basischen, tricyclischen Verbindungen und deren Salzen | |
| AT282586B (de) | Verfahren zur herstellung von neuem racemischem oder optisch aktivem (1-2'-nitrilophenoxy)-2-hydroxy-3-isopropylaminopropan und dessen salzen | |
| DE2433889C2 (de) | Verfahren zur Herstellung reiner allcls-Cyclopentan-1,2,3,4-tetracarbonsäure bzw. ihre Salze | |
| DE2518516C3 (de) | 2-(3,45-Trimethoxybenzyl)-3,4-dimethylpyridin | |
| DE2328035A1 (de) | Verfahren zur herstellung von (+)-2,2' -(aethylendiimino)-di-1-butanol und seinen salzen |