DE1772430C3 - Fuer photographische Diffusionsuebertragungsverfahren geeignetes Bildempfangsmaterial - Google Patents
Fuer photographische Diffusionsuebertragungsverfahren geeignetes BildempfangsmaterialInfo
- Publication number
- DE1772430C3 DE1772430C3 DE19681772430 DE1772430A DE1772430C3 DE 1772430 C3 DE1772430 C3 DE 1772430C3 DE 19681772430 DE19681772430 DE 19681772430 DE 1772430 A DE1772430 A DE 1772430A DE 1772430 C3 DE1772430 C3 DE 1772430C3
- Authority
- DE
- Germany
- Prior art keywords
- acrylamide
- layer
- image
- copolymer
- temperature
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 44
- 238000000034 method Methods 0.000 title claims description 10
- 238000009792 diffusion process Methods 0.000 title description 18
- 230000008569 process Effects 0.000 title description 9
- 229920000642 polymer Polymers 0.000 claims description 56
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 claims description 39
- 239000002253 acid Substances 0.000 claims description 30
- 125000006850 spacer group Chemical group 0.000 claims description 28
- 229920001577 copolymer Polymers 0.000 claims description 27
- OMNKZBIFPJNNIO-UHFFFAOYSA-N n-(2-methyl-4-oxopentan-2-yl)prop-2-enamide Chemical compound CC(=O)CC(C)(C)NC(=O)C=C OMNKZBIFPJNNIO-UHFFFAOYSA-N 0.000 claims description 27
- QNILTEGFHQSKFF-UHFFFAOYSA-N n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C=C QNILTEGFHQSKFF-UHFFFAOYSA-N 0.000 claims description 24
- 239000003513 alkali Substances 0.000 claims description 18
- 230000035699 permeability Effects 0.000 claims description 17
- 229920001897 terpolymer Polymers 0.000 claims description 11
- 229920002554 vinyl polymer Polymers 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000001165 hydrophobic group Chemical group 0.000 claims description 7
- CNCOEDDPFOAUMB-UHFFFAOYSA-N N-Methylolacrylamide Chemical compound OCNC(=O)C=C CNCOEDDPFOAUMB-UHFFFAOYSA-N 0.000 claims description 6
- DPBJAVGHACCNRL-UHFFFAOYSA-N 2-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)CCOC(=O)C=C DPBJAVGHACCNRL-UHFFFAOYSA-N 0.000 claims description 4
- 229920002401 polyacrylamide Polymers 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- NFTVTXIQFYRSHF-UHFFFAOYSA-N 1-(dimethylamino)ethyl prop-2-enoate Chemical compound CN(C)C(C)OC(=O)C=C NFTVTXIQFYRSHF-UHFFFAOYSA-N 0.000 claims 1
- 239000010410 layer Substances 0.000 description 109
- 239000000243 solution Substances 0.000 description 35
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 26
- 239000000975 dye Substances 0.000 description 25
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- 239000004372 Polyvinyl alcohol Substances 0.000 description 15
- 229920002451 polyvinyl alcohol Polymers 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- -1 silver halide Chemical class 0.000 description 13
- 239000000839 emulsion Substances 0.000 description 10
- 230000001419 dependent effect Effects 0.000 description 9
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 7
- 239000012153 distilled water Substances 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- SWPMNMYLORDLJE-UHFFFAOYSA-N n-ethylprop-2-enamide Chemical compound CCNC(=O)C=C SWPMNMYLORDLJE-UHFFFAOYSA-N 0.000 description 5
- 229910052709 silver Inorganic materials 0.000 description 5
- 239000004332 silver Substances 0.000 description 5
- 108010010803 Gelatin Proteins 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 4
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- 230000002209 hydrophobic effect Effects 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- 229910017604 nitric acid Inorganic materials 0.000 description 4
- JKNCOURZONDCGV-UHFFFAOYSA-N 2-(dimethylamino)ethyl 2-methylprop-2-enoate Chemical compound CN(C)CCOC(=O)C(C)=C JKNCOURZONDCGV-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 229920002301 cellulose acetate Polymers 0.000 description 3
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 3
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000008961 swelling Effects 0.000 description 3
- DLHITURSJUTRKN-UHFFFAOYSA-N 3-methyl-2-(prop-2-enoylamino)butanamide Chemical compound CC(C)C(C(N)=O)NC(=O)C=C DLHITURSJUTRKN-UHFFFAOYSA-N 0.000 description 2
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical class CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 239000003963 antioxidant agent Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229920000578 graft copolymer Polymers 0.000 description 2
- BJRNKVDFDLYUGJ-RMPHRYRLSA-N hydroquinone O-beta-D-glucopyranoside Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-RMPHRYRLSA-N 0.000 description 2
- 239000011229 interlayer Substances 0.000 description 2
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- GVGGWUXGMRTNIK-UHFFFAOYSA-N n-(2-amino-2-oxoethyl)prop-2-enamide Chemical compound NC(=O)CNC(=O)C=C GVGGWUXGMRTNIK-UHFFFAOYSA-N 0.000 description 2
- 230000035515 penetration Effects 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920002689 polyvinyl acetate Polymers 0.000 description 2
- 239000011118 polyvinyl acetate Substances 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- CRWJEUDFKNYSBX-UHFFFAOYSA-N sodium;hypobromite Chemical compound [Na+].Br[O-] CRWJEUDFKNYSBX-UHFFFAOYSA-N 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 1
- ULEVTQHCVWIDPC-UHFFFAOYSA-N 2-(methylamino)ethyl prop-2-enoate Chemical compound CNCCOC(=O)C=C ULEVTQHCVWIDPC-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- UGIJCMNGQCUTPI-UHFFFAOYSA-N 2-aminoethyl prop-2-enoate Chemical compound NCCOC(=O)C=C UGIJCMNGQCUTPI-UHFFFAOYSA-N 0.000 description 1
- YQIGLEFUZMIVHU-UHFFFAOYSA-N 2-methyl-n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C(C)=C YQIGLEFUZMIVHU-UHFFFAOYSA-N 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- JNRLEMMIVRBKJE-UHFFFAOYSA-N 4,4'-Methylenebis(N,N-dimethylaniline) Chemical compound C1=CC(N(C)C)=CC=C1CC1=CC=C(N(C)C)C=C1 JNRLEMMIVRBKJE-UHFFFAOYSA-N 0.000 description 1
- FKNQCJSGGFJEIZ-UHFFFAOYSA-N 4-methylpyridine Chemical compound CC1=CC=NC=C1 FKNQCJSGGFJEIZ-UHFFFAOYSA-N 0.000 description 1
- WMVPFEQOLJSBDR-UHFFFAOYSA-N 4-propan-2-yloxynaphthalen-1-ol Chemical compound C1=CC=C2C(OC(C)C)=CC=C(O)C2=C1 WMVPFEQOLJSBDR-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 101150065749 Churc1 gene Proteins 0.000 description 1
- 229920001634 Copolyester Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 102100038239 Protein Churchill Human genes 0.000 description 1
- 206010037867 Rash macular Diseases 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 229920006322 acrylamide copolymer Polymers 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical group 0.000 description 1
- 230000003078 antioxidant effect Effects 0.000 description 1
- 229960000271 arbutin Drugs 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- DNSISZSEWVHGLH-UHFFFAOYSA-N butanamide Chemical compound CCCC(N)=O DNSISZSEWVHGLH-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 229920006217 cellulose acetate butyrate Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- FGRVOLIFQGXPCT-UHFFFAOYSA-L dipotassium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[K+].[O-]S([O-])(=O)=S FGRVOLIFQGXPCT-UHFFFAOYSA-L 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 230000003455 independent Effects 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- 150000002596 lactones Chemical group 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- YPPFWRWCZNXINO-UHFFFAOYSA-N methyl 1-hydroxy-6-phenyl-4-(trifluoromethyl)indole-2-carboxylate Chemical compound C1=C2N(O)C(C(=O)OC)=CC2=C(C(F)(F)F)C=C1C1=CC=CC=C1 YPPFWRWCZNXINO-UHFFFAOYSA-N 0.000 description 1
- WFKDPJRCBCBQNT-UHFFFAOYSA-N n,2-dimethylprop-2-enamide Chemical compound CNC(=O)C(C)=C WFKDPJRCBCBQNT-UHFFFAOYSA-N 0.000 description 1
- VMOWKUTXPNPTEN-UHFFFAOYSA-N n,n-dimethylpropan-2-amine Chemical compound CC(C)N(C)C VMOWKUTXPNPTEN-UHFFFAOYSA-N 0.000 description 1
- PZWRHDSUKRJIDJ-UHFFFAOYSA-N n-(2-amino-2-oxoethyl)-2-methylprop-2-enamide Chemical compound CC(=C)C(=O)NCC(N)=O PZWRHDSUKRJIDJ-UHFFFAOYSA-N 0.000 description 1
- RWJGITGQDQSWJG-UHFFFAOYSA-N n-(3-methoxypropyl)prop-2-enamide Chemical compound COCCCNC(=O)C=C RWJGITGQDQSWJG-UHFFFAOYSA-N 0.000 description 1
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 1
- YRVUCYWJQFRCOB-UHFFFAOYSA-N n-butylprop-2-enamide Chemical compound CCCCNC(=O)C=C YRVUCYWJQFRCOB-UHFFFAOYSA-N 0.000 description 1
- ZIWDVJPPVMGJGR-UHFFFAOYSA-N n-ethyl-2-methylprop-2-enamide Chemical compound CCNC(=O)C(C)=C ZIWDVJPPVMGJGR-UHFFFAOYSA-N 0.000 description 1
- WDFKEEALECCKTJ-UHFFFAOYSA-N n-propylprop-2-enamide Chemical compound CCCNC(=O)C=C WDFKEEALECCKTJ-UHFFFAOYSA-N 0.000 description 1
- XFHJDMUEHUHAJW-UHFFFAOYSA-N n-tert-butylprop-2-enamide Chemical compound CC(C)(C)NC(=O)C=C XFHJDMUEHUHAJW-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- BJRNKVDFDLYUGJ-UHFFFAOYSA-N p-hydroxyphenyl beta-D-alloside Natural products OC1C(O)C(O)C(CO)OC1OC1=CC=C(O)C=C1 BJRNKVDFDLYUGJ-UHFFFAOYSA-N 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 239000013047 polymeric layer Substances 0.000 description 1
- 229940005642 polystyrene sulfonic acid Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000001047 purple dye Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 230000036632 reaction speed Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- DCKVNWZUADLDEH-UHFFFAOYSA-N sec-butyl acetate Chemical compound CCC(C)OC(C)=O DCKVNWZUADLDEH-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 238000007614 solvation Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N triethylamine Natural products CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- 239000001043 yellow dye Substances 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/42—Structural details
- G03C8/52—Bases or auxiliary layers; Substances therefor
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Structural Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US64167067A | 1967-05-26 | 1967-05-26 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1772430A1 DE1772430A1 (de) | 1971-01-21 |
| DE1772430B2 DE1772430B2 (de) | 1972-12-21 |
| DE1772430C3 true DE1772430C3 (de) | 1973-07-05 |
Family
ID=24573381
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681772430 Expired DE1772430C3 (de) | 1967-05-26 | 1968-05-14 | Fuer photographische Diffusionsuebertragungsverfahren geeignetes Bildempfangsmaterial |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3421893A (enExample) |
| BE (1) | BE715624A (enExample) |
| DE (1) | DE1772430C3 (enExample) |
| FR (1) | FR1563581A (enExample) |
| GB (1) | GB1230181A (enExample) |
| NL (1) | NL160093C (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3753764A (en) * | 1970-11-19 | 1973-08-21 | Eastman Kodak Co | Photographic diffusion transfer product and process |
| JPS5246496B2 (enExample) * | 1972-03-07 | 1977-11-25 | ||
| US3806346A (en) * | 1972-04-24 | 1974-04-23 | Polaroid Corp | Diffusion transfer film units and their manufacture |
| DE2455762A1 (de) * | 1974-11-26 | 1976-08-12 | Agfa Gevaert Ag | Neutralisationssystem fuer das farbdiffusionsuebertragungsverfahren |
| JPS5917410B2 (ja) * | 1975-07-24 | 1984-04-21 | 富士写真フイルム株式会社 | カラ−拡散転写用写真材料 |
| DE2601653A1 (de) * | 1976-01-17 | 1977-07-21 | Agfa Gevaert Ag | Bremsschicht zur verzoegerung der diffusion von hydroxylionen bei dem farbdiffusionsuebertragungsverfahren |
| NL7703734A (nl) * | 1976-04-06 | 1977-10-10 | Oreal | Nieuwe copolymeren van n-alkylacrylamiden of -me- thacrylamiden, de bereidingswijze ervan, als- mede hun gebruik in kosmetika. |
| CA1116455A (en) * | 1976-04-14 | 1982-01-19 | David E. Hannie | Timing layers for photographic products |
| JPS6029103B2 (ja) * | 1976-12-10 | 1985-07-09 | 富士写真フイルム株式会社 | カラ−拡散転写法用写真要素 |
| JPS5917412B2 (ja) * | 1978-04-19 | 1984-04-21 | 富士写真フイルム株式会社 | カラ−拡散転写法用写真要素 |
| US4539383A (en) * | 1981-08-03 | 1985-09-03 | Polaroid Corporation | Temporary polymeric mordants containing acetoxybenzyl substituted quaternary ammonium groups |
| US4360425A (en) * | 1981-09-14 | 1982-11-23 | American Cyanamid Company | Low molecular weight copolymers and terpolymers as depressants in mineral ore flotation |
| US4375506A (en) * | 1981-10-30 | 1983-03-01 | Eastman Kodak Company | Timing layers for color transfer assemblages containing positive-working redox dye-releasers and development accelerators |
| US4356249A (en) * | 1981-10-30 | 1982-10-26 | Eastman Kodak Company | Timing layers and auxiliary neutralizing layer for color transfer assemblages containing positive-working redox dye-releasers |
| US4504569A (en) * | 1983-08-26 | 1985-03-12 | Eastman Kodak Company | Photographic material with a temporary barrier layer comprising a chill-gelable polymer |
| US4563411A (en) * | 1984-08-17 | 1986-01-07 | Polaroid Corporation | Copolymeric mordants and photographic products and processes containing same |
| JPS61103452U (enExample) * | 1984-12-12 | 1986-07-01 | ||
| JPS61225203A (ja) * | 1985-03-29 | 1986-10-07 | Agency Of Ind Science & Technol | 親水性−疎水性熱可逆型重合体及びその製造方法 |
| US4975375A (en) * | 1985-07-02 | 1990-12-04 | Canon Kabushiki Kaisha | Biocatalyst immobilization with a reversibly swelling and shrinking polymer |
| CH666131A5 (fr) * | 1985-10-31 | 1988-06-30 | Battelle Memorial Institute | Support a phase solide muni d'un composant destine a participer a une reaction dans une phase liquide. |
| US4912032A (en) * | 1986-04-17 | 1990-03-27 | Genetec Systems Corporation | Methods for selectively reacting ligands immobilized within a temperature-sensitive polymer gel |
| US5593810A (en) * | 1996-05-14 | 1997-01-14 | Polaroid Corporation | Diffusion transfer film unit |
| ATE260697T1 (de) | 1999-03-17 | 2004-03-15 | Foster Miller Inc | Sensible gele und verfahren zur ihrer verwendung |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1191688B (de) * | 1963-05-01 | 1965-04-22 | Polaroid Corp | Fuer Diffusionsuebertragungsfarbverfahren geeignetes photographisches Material |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3225283A (en) * | 1960-06-09 | 1965-12-21 | Kokusai Denshin Denwa Co Ltd | Regulable-output rectifying apparatus |
| US3212893A (en) * | 1961-03-27 | 1965-10-19 | Eastman Kodak Co | Photographic multicolor diffusion transfer process using dye developers |
| NL131882C (enExample) * | 1963-07-31 |
-
1967
- 1967-05-26 US US641670A patent/US3421893A/en not_active Expired - Lifetime
-
1968
- 1968-05-14 DE DE19681772430 patent/DE1772430C3/de not_active Expired
- 1968-05-24 BE BE715624D patent/BE715624A/xx not_active IP Right Cessation
- 1968-05-24 GB GB1230181D patent/GB1230181A/en not_active Expired
- 1968-05-27 FR FR1563581D patent/FR1563581A/fr not_active Expired
- 1968-05-27 NL NL6807463.A patent/NL160093C/xx not_active IP Right Cessation
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1191688B (de) * | 1963-05-01 | 1965-04-22 | Polaroid Corp | Fuer Diffusionsuebertragungsfarbverfahren geeignetes photographisches Material |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1772430B2 (de) | 1972-12-21 |
| NL160093C (nl) | 1979-09-17 |
| BE715624A (enExample) | 1968-11-25 |
| DE1772430A1 (de) | 1971-01-21 |
| US3421893A (en) | 1969-01-14 |
| FR1563581A (enExample) | 1969-04-11 |
| GB1230181A (enExample) | 1971-04-28 |
| NL6807463A (enExample) | 1968-11-27 |
| NL160093B (nl) | 1979-04-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1772430C3 (de) | Fuer photographische Diffusionsuebertragungsverfahren geeignetes Bildempfangsmaterial | |
| CH616008A5 (enExample) | ||
| DE3116044C2 (de) | Photographisches Aufzeichnungsmaterial nach dem Diffusionsübertragungsverfahren | |
| DE2137559C2 (de) | Bildempfangsmaterial für photographische Farbdiffusionsübertragungsverfahren | |
| DE1191689B (de) | Lichtempfindliches photographisches Material fuer Diffusionsuebertragungsfarbverfahren | |
| DE2336379A1 (de) | Strahlungsempfindliches aufzeichnungsmaterial | |
| DE2001320C3 (de) | Für fotografische Diffusionsübertragungsverfahren geeignetes Bildempfangsmaterial | |
| DE69401495T2 (de) | Bildempfangselement für diffusionsübertragungsphotographische filmprodukte | |
| DE2319489A1 (de) | Photographische entwicklungs- oder behandlungsmasse, insbesondere fuer das diffusionsuebertragungsverfahren | |
| DE1572119C3 (enExample) | ||
| DE69601163T2 (de) | Photographische diffusionstransferfilmeinheit | |
| DE2652464A1 (de) | Fotografische filmeinheit zur herstellung farbiger uebertragsbilder | |
| DE1597537B1 (de) | Farbphotographisches Aufzeichnungsmaterial fuer das Diffusionsuebertragungsverfahren | |
| DE1135756B (de) | Verfahren zur Herstellung von farbigen, gegenueber den schaedlichen Einwirkungen ultravioletten Lichtes geschuetzten UEbertragungsbildern | |
| DE69601925T2 (de) | Bildempfangselement für photographische und photothermographische diffusionsübertragungsprodukte | |
| DE68919264T2 (de) | Bildempfangendes Element für ein photographisches Diffusionsübertragungsprodukt. | |
| DE2058263C3 (de) | Lichtempfindliches fotografisches Aufzeichnungsmaterial | |
| DE1772431C (de) | Fur fotografische Diffusionsuber tragungsverfahren geeignetes licht empfindliches Aufzeichnungsmaterial | |
| DE3335160A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE3232390C2 (de) | Verfahren zur Erzeugung von Farbdiffusionsübertragungsbildern | |
| DE2064884A1 (de) | Lichtempfindliches fotografisches Aufzeichnungsmaterial für Diffusions-übertragungsverfahren. Ausscheidung aus: 2038260 | |
| DE2910270C2 (enExample) | ||
| DE1191688B (de) | Fuer Diffusionsuebertragungsfarbverfahren geeignetes photographisches Material | |
| DE1914361A1 (de) | Verfahren zum Diffusionsfestmachen von Anionen in hydrophilen Kolloiden | |
| DE2910271C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |