DE1770853A1 - Verfahren zur Herstellung von 3-Chlor-1,2-Benzisothiazolen - Google Patents
Verfahren zur Herstellung von 3-Chlor-1,2-BenzisothiazolenInfo
- Publication number
- DE1770853A1 DE1770853A1 DE19681770853 DE1770853A DE1770853A1 DE 1770853 A1 DE1770853 A1 DE 1770853A1 DE 19681770853 DE19681770853 DE 19681770853 DE 1770853 A DE1770853 A DE 1770853A DE 1770853 A1 DE1770853 A1 DE 1770853A1
- Authority
- DE
- Germany
- Prior art keywords
- benzisothiazoles
- acid
- chloro
- hydrogen atom
- halogen atom
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 7
- BCPVKLRBQLRWDQ-UHFFFAOYSA-N 3-chloro-1,2-benzothiazole Chemical class C1=CC=C2C(Cl)=NSC2=C1 BCPVKLRBQLRWDQ-UHFFFAOYSA-N 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical class C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 150000007524 organic acids Chemical class 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 235000005985 organic acids Nutrition 0.000 claims description 4
- 150000008065 acid anhydrides Chemical class 0.000 claims description 3
- 150000001805 chlorine compounds Chemical class 0.000 claims description 3
- 150000002825 nitriles Chemical class 0.000 claims description 3
- XCGZCFRDYWZKRV-UHFFFAOYSA-N 3,4-dichloro-1,2-benzothiazole Chemical compound C1=CC(Cl)=C2C(Cl)=NSC2=C1 XCGZCFRDYWZKRV-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000007858 starting material Substances 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 239000007795 chemical reaction product Substances 0.000 description 5
- -1 4,6-dichloro-5-hydroxy-1,2-benzisothiazole Chemical compound 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- WWZKQHOCKIZLMA-UHFFFAOYSA-N octanoic acid Chemical compound CCCCCCCC(O)=O WWZKQHOCKIZLMA-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- LPUJHVNRGNTQPL-UHFFFAOYSA-N 1,2-benzothiazol-5-amine Chemical class NC1=CC=C2SN=CC2=C1 LPUJHVNRGNTQPL-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- RTENJJBMPXSXBB-UHFFFAOYSA-N 3,4,5-trichloro-1,2-benzothiazole Chemical compound C1=C(Cl)C(Cl)=C2C(Cl)=NSC2=C1 RTENJJBMPXSXBB-UHFFFAOYSA-N 0.000 description 1
- QEYMMOKECZBKAC-UHFFFAOYSA-N 3-chloropropanoic acid Chemical compound OC(=O)CCCl QEYMMOKECZBKAC-UHFFFAOYSA-N 0.000 description 1
- VVIXDPOFXLSGIU-UHFFFAOYSA-N 4,5-dichloro-1,2-benzothiazole Chemical compound ClC1=CC=C2SN=CC2=C1Cl VVIXDPOFXLSGIU-UHFFFAOYSA-N 0.000 description 1
- DHLIRMWNYRKKPN-UHFFFAOYSA-N 4-chloro-1,2-benzothiazole Chemical compound ClC1=CC=CC2=C1C=NS2 DHLIRMWNYRKKPN-UHFFFAOYSA-N 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 239000005635 Caprylic acid (CAS 124-07-2) Substances 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000257159 Musca domestica Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000003559 chemosterilizing effect Effects 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 150000002763 monocarboxylic acids Chemical class 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229960002446 octanoic acid Drugs 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- XGISHOFUAFNYQF-UHFFFAOYSA-N pentanoyl chloride Chemical compound CCCCC(Cl)=O XGISHOFUAFNYQF-UHFFFAOYSA-N 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003206 sterilizing agent Substances 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Thiazole And Isothizaole Compounds (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681770853 DE1770853A1 (de) | 1968-07-11 | 1968-07-11 | Verfahren zur Herstellung von 3-Chlor-1,2-Benzisothiazolen |
| CH1042869A CH513905A (de) | 1968-07-11 | 1969-07-08 | Verfahren zur Herstellung von 3-Chlor-1,2-Benzisothiazolen |
| FR6923486A FR2012748A1 (https=) | 1968-07-11 | 1969-07-10 | |
| GB1265091D GB1265091A (https=) | 1968-07-11 | 1969-07-10 | |
| NL6910645A NL6910645A (https=) | 1968-07-11 | 1969-07-10 | |
| BE735904D BE735904A (https=) | 1968-07-11 | 1969-07-10 | |
| US840830A US3655686A (en) | 1968-07-11 | 1969-07-10 | Production of 3-chloro-1 2-benzoisothiazoles |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681770853 DE1770853A1 (de) | 1968-07-11 | 1968-07-11 | Verfahren zur Herstellung von 3-Chlor-1,2-Benzisothiazolen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1770853A1 true DE1770853A1 (de) | 1972-01-13 |
Family
ID=5700667
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19681770853 Pending DE1770853A1 (de) | 1968-07-11 | 1968-07-11 | Verfahren zur Herstellung von 3-Chlor-1,2-Benzisothiazolen |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3655686A (https=) |
| BE (1) | BE735904A (https=) |
| CH (1) | CH513905A (https=) |
| DE (1) | DE1770853A1 (https=) |
| FR (1) | FR2012748A1 (https=) |
| GB (1) | GB1265091A (https=) |
| NL (1) | NL6910645A (https=) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1212670B (de) * | 1963-09-20 | 1966-03-17 | Wilh Steffen K G | Vorrichtung zum Bewickeln von strangfoermigen Teilen mit einem Band |
| EP0138762A1 (de) * | 1983-09-14 | 1985-04-24 | Ciba-Geigy Ag | Schädlingsbekämpfungsmittel |
-
1968
- 1968-07-11 DE DE19681770853 patent/DE1770853A1/de active Pending
-
1969
- 1969-07-08 CH CH1042869A patent/CH513905A/de not_active IP Right Cessation
- 1969-07-10 GB GB1265091D patent/GB1265091A/en not_active Expired
- 1969-07-10 FR FR6923486A patent/FR2012748A1/fr not_active Withdrawn
- 1969-07-10 BE BE735904D patent/BE735904A/xx unknown
- 1969-07-10 US US840830A patent/US3655686A/en not_active Expired - Lifetime
- 1969-07-10 NL NL6910645A patent/NL6910645A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1212670B (de) * | 1963-09-20 | 1966-03-17 | Wilh Steffen K G | Vorrichtung zum Bewickeln von strangfoermigen Teilen mit einem Band |
| EP0138762A1 (de) * | 1983-09-14 | 1985-04-24 | Ciba-Geigy Ag | Schädlingsbekämpfungsmittel |
Also Published As
| Publication number | Publication date |
|---|---|
| NL6910645A (https=) | 1970-01-13 |
| FR2012748A1 (https=) | 1970-03-20 |
| US3655686A (en) | 1972-04-11 |
| CH513905A (de) | 1971-10-15 |
| GB1265091A (https=) | 1972-03-01 |
| BE735904A (https=) | 1970-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH629183A5 (de) | Verfahren zur herstellung von acylcyaniden. | |
| DE1238478B (de) | Verfahren zur Herstellung von 3-Amino-pyrazin-carbonsaeurederivaten | |
| DE2414280A1 (de) | Verfahren zur herstellung von 1-alkyl- 5-nitroimidazolen | |
| CH628877A5 (de) | Verfahren zur herstellung von acylcyaniden. | |
| DD239591A5 (de) | Verfahren zur herstellung von 2,4-dichlor-5-fluor-benzoesaeure | |
| DE1770853A1 (de) | Verfahren zur Herstellung von 3-Chlor-1,2-Benzisothiazolen | |
| DE2614241A1 (de) | Verfahren zur herstellung von acylcyaniden | |
| DE2166270C3 (de) | Nicotinoylaminoäthansulfonyl-2amino-thiazol | |
| DE2640616C3 (de) | Verfahren zur Herstellung von N-Acyl-2-aiylglycinen | |
| DE1906087A1 (de) | Oxodihydrobenzoxazinderivate und Verfahren zu ihrer Herstellung | |
| EP0043490B1 (de) | Verfahren zur Herstellung von Acylcyaniden | |
| AT258916B (de) | Verfahren zur Herstellung von neuen Alkyl-3-amino-5-chlor-6-X-pyrazinoaten | |
| DE2111610C3 (de) | Verfahren zur Herstellung von Salzen von Pyrimidyl-pyridiniumderivaten | |
| AT343113B (de) | Verfahren zur herstellung von neuen 5- oder 6- substituierten benzoxazolen | |
| DE915814C (de) | Verfahren zur Herstellung von basischen Alkylestern phenylsubstituierter, halogenierter o-Oxybenzoesaeuren und deren Saeureadditionssalzen | |
| AT354432B (de) | Verfahren zur herstellung von 3-indolylessig- saeuren | |
| DE3412292C2 (https=) | ||
| CH617669A5 (https=) | ||
| AT206897B (de) | Verfahren zur Herstellung von neuen 4-Oxo-2-(halogenalkyl)-2,3-dihydro-[benzo-1,3-oxazinen] | |
| DE1695909C3 (de) | Verfahren zur Herstellung von 1-(5-Nitro-2-thiazolyl)-2-oxo-imidazolidinen | |
| DE2708184A1 (de) | Verfahren zur herstellung von alpha- ketocarbonsaeureamiden (a) | |
| DE19547075A1 (de) | Verbessertes Verfahren zur Herstellung von 5-Formylthiazol | |
| AT258294B (de) | Verfahren zur Herstellung von kernchlorierten 3-Aminopyrazincarbonsäureverbindungen | |
| AT320147B (de) | Verfahren zur Herstellung von neuen Penicillinen und Cephalosporinen | |
| DE1958238C (de) | l-Oxy-S^-dibrom-ö-halogen-thiochromanone |